diff --git a/Documentation/Examples/geometry_example.cc b/Documentation/Examples/geometry_example.cc index 9c589ee714f1b4e0b36d2987c7558899389027fc..8ed0d6f65de7327b0cf07a6726cd00ab2c772669 100644 --- a/Documentation/Examples/geometry_example.cc +++ b/Documentation/Examples/geometry_example.cc @@ -32,7 +32,8 @@ int main() { CoordinateSystem cs2 = root.translate({0_m, 0_m, 1_m}); // rotations are possible, too; parameters are axis vector and angle - CoordinateSystem cs3 = root.rotate({1_m, 0_m, 0_m}, 90 * degree_angle); + CoordinateSystem cs3 = + root.rotate(QuantityVector<length_d>{1_m, 0_m, 0_m}, 90 * degree_angle); // now let's define some geometrical objects: Point const p1(root, {0_m, 0_m, 0_m}); // the origin of the root CS diff --git a/Environment/NuclearComposition.h b/Environment/NuclearComposition.h index dee18a4463c340698bbff372cc504d4744748375..e7f0d6d8a3827985238117dc24db28345d25463e 100644 --- a/Environment/NuclearComposition.h +++ b/Environment/NuclearComposition.h @@ -13,6 +13,8 @@ #define _include_NuclearComposition_h #include <corsika/particles/ParticleProperties.h> +#include <corsika/units/PhysicalUnits.h> + #include <cassert> #include <numeric> #include <random> @@ -76,6 +78,28 @@ namespace corsika::environment { } } + template <typename TFunction> + auto WeightedSum(TFunction func) const { + using ResultQuantity = decltype(func(*fComponents.cbegin())); + + auto const sum = [](auto x, auto y) { return x + y; }; + auto const prod = [&](auto const compID, auto const fraction) { + return func(compID) * fraction; + }; + + if constexpr (phys::units::is_quantity_v<ResultQuantity>) { + return std::inner_product( + fComponents.cbegin(), fComponents.cend(), fNumberFractions.cbegin(), + ResultQuantity::zero(), // .zero() is defined for quantity types only + sum, prod); + } else { + return std::inner_product( + fComponents.cbegin(), fComponents.cend(), fNumberFractions.cbegin(), + ResultQuantity(0), // in other cases we have to use a bare 0 + sum, prod); + } + } + auto size() const { return fNumberFractions.size(); } auto const& GetFractions() const { return fNumberFractions; } diff --git a/Environment/VolumeTreeNode.h b/Environment/VolumeTreeNode.h index 7a8b2e785f134ba59546e5622366a03c8f7554a4..d996758625969d82860ab8638c7e4e64328381a2 100644 --- a/Environment/VolumeTreeNode.h +++ b/Environment/VolumeTreeNode.h @@ -75,15 +75,12 @@ namespace corsika::environment { */ template <typename TCallable, bool preorder = true> void walk(TCallable func) { - if constexpr (preorder) { - func(*this); - std::for_each(fChildNodes.begin(), fChildNodes.end(), - [&](auto& v) { v->walk(func); }); - } else { - std::for_each(fChildNodes.begin(), fChildNodes.end(), - [&](auto& v) { v->walk(func); }); - func(*this); - } + if constexpr (preorder) { func(*this); } + + std::for_each(fChildNodes.begin(), fChildNodes.end(), + [&](auto& v) { v->walk(func); }); + + if constexpr (!preorder) { func(*this); }; } void AddChild(VTNUPtr pChild) { diff --git a/Framework/Geometry/CMakeLists.txt b/Framework/Geometry/CMakeLists.txt index f827de1f4cfcf4f8ef0ee5d4f986cea0eeff96b2..c12c79b01d9663c8caf08a8068ec0dc13b529e3c 100644 --- a/Framework/Geometry/CMakeLists.txt +++ b/Framework/Geometry/CMakeLists.txt @@ -40,6 +40,7 @@ set_target_properties ( target_link_libraries ( CORSIKAgeometry CORSIKAunits + CORSIKAutilities ) target_include_directories ( diff --git a/Framework/Geometry/CoordinateSystem.h b/Framework/Geometry/CoordinateSystem.h index aaf226f3833b732488bcb457f76c0dbbd80049dc..195e89bb8bf74b952a108bf95ade7b4a9507c6d1 100644 --- a/Framework/Geometry/CoordinateSystem.h +++ b/Framework/Geometry/CoordinateSystem.h @@ -14,6 +14,7 @@ #include <corsika/geometry/QuantityVector.h> #include <corsika/units/PhysicalUnits.h> +#include <corsika/utl/sgn.h> #include <Eigen/Dense> #include <stdexcept> @@ -23,6 +24,8 @@ typedef Eigen::Translation<double, 3> EigenTranslation; namespace corsika::geometry { class RootCoordinateSystem; + template <typename T> + class Vector; using corsika::units::si::length_d; @@ -59,7 +62,38 @@ namespace corsika::geometry { return CoordinateSystem(*this, translation); } - auto rotate(QuantityVector<phys::units::length_d> axis, double angle) const { + template <typename TDim> + auto RotateToZ(Vector<TDim> vVec) const { + auto const a = vVec.normalized().GetComponents(*this).eVector; + auto const a1 = a(0), a2 = a(1); + + auto const s = utl::sgn(a(2)); + auto const c = 1 / (1 + s * a(2)); + + Eigen::Matrix3d A, B; + + if (s > 0) { + A << 1, 0, -a1, // comment to prevent clang-format + 0, 1, -a2, // . + a1, a2, 1; // . + B << -a1 * a1 * c, -a1 * a2 * c, 0, // . + -a1 * a2 * c, -a2 * a2 * c, 0, // . + 0, 0, -(a1 * a1 + a2 * a2) * c; // . + + } else { + A << 1, 0, a1, // . + 0, -1, -a2, // . + a1, a2, -1; // . + B << -a1 * a1 * c, -a1 * a2 * c, 0, // . + +a1 * a2 * c, +a2 * a2 * c, 0, // . + 0, 0, (a1 * a1 + a2 * a2) * c; // . + } + + return CoordinateSystem(*this, EigenTransform(A + B)); + } + + template <typename TDim> + auto rotate(QuantityVector<TDim> axis, double angle) const { if (axis.eVector.isZero()) { throw std::runtime_error("null-vector given as axis parameter"); } @@ -69,8 +103,9 @@ namespace corsika::geometry { return CoordinateSystem(*this, rotation); } + template <typename TDim> auto translateAndRotate(QuantityVector<phys::units::length_d> translation, - QuantityVector<phys::units::length_d> axis, double angle) { + QuantityVector<TDim> axis, double angle) { if (axis.eVector.isZero()) { throw std::runtime_error("null-vector given as axis parameter"); } diff --git a/Framework/Utilities/CMakeLists.txt b/Framework/Utilities/CMakeLists.txt index f55df7645645fe362070a467e563983c5bcac6fc..763c534f1c6df580d04211e0d29f87588758418a 100644 --- a/Framework/Utilities/CMakeLists.txt +++ b/Framework/Utilities/CMakeLists.txt @@ -27,6 +27,7 @@ set ( COMBoost.h Bit.h Singleton.h + sgn.h CorsikaFenv.h MetaProgramming.h ) diff --git a/Framework/Utilities/COMBoost.cc b/Framework/Utilities/COMBoost.cc index a12b533bbc0ef756737920b750a5c00a9556a58f..a94645215f95f047d934e316a0dfff3857636419 100644 --- a/Framework/Utilities/COMBoost.cc +++ b/Framework/Utilities/COMBoost.cc @@ -14,17 +14,12 @@ #include <corsika/geometry/Vector.h> #include <corsika/units/PhysicalUnits.h> #include <corsika/utl/COMBoost.h> +#include <corsika/utl/sgn.h> using namespace corsika::utl; using namespace corsika::units::si; using namespace corsika::geometry; -//! sign function without branches -template <typename T> -static int sgn(T val) { - return (T(0) < val) - (val < T(0)); -} - COMBoost::COMBoost(FourVector<HEPEnergyType, Vector<hepmomentum_d>> const& Pprojectile, const HEPMassType massTarget) : fCS(Pprojectile.GetSpaceLikeComponents().GetCoordinateSystem()) { diff --git a/Framework/Utilities/sgn.h b/Framework/Utilities/sgn.h new file mode 100644 index 0000000000000000000000000000000000000000..71d5bec5bbb59fe8c71ef35d0c3f9da1a40b27b7 --- /dev/null +++ b/Framework/Utilities/sgn.h @@ -0,0 +1,14 @@ +#ifndef _utilities_sgn_h +#define _utilities_sgn_h + +namespace corsika::utl { + +//! sign function without branches +template <typename T> +static int sgn(T val) { + return (T(0) < val) - (val < T(0)); +} + +} + +#endif diff --git a/Processes/CMakeLists.txt b/Processes/CMakeLists.txt index d6162179ca3440e788a40a9a6ab0c18edb7d44f6..2835a7043cc80101ef22d1301af981b5735de6bb 100644 --- a/Processes/CMakeLists.txt +++ b/Processes/CMakeLists.txt @@ -9,6 +9,7 @@ add_subdirectory (TrackWriter) add_subdirectory (TrackingLine) add_subdirectory (HadronicElasticModel) add_subdirectory (EnergyLoss) +add_subdirectory (UrQMD) #add_custom_target(CORSIKAprocesses) add_library (CORSIKAprocesses INTERFACE) @@ -20,3 +21,4 @@ endif (PYTHIA8_FOUND) add_dependencies(CORSIKAprocesses ProcessStackInspector) add_dependencies(CORSIKAprocesses ProcessTrackingLine) add_dependencies(CORSIKAprocesses ProcessEnergyLoss) +add_dependencies(CORSIKAprocesses ProcessUrQMD) diff --git a/Processes/Sibyll/CMakeLists.txt b/Processes/Sibyll/CMakeLists.txt index 357964b39c77d5d1ddcdaa9d3ae290debd61d911..58b83f9b8ebccc6292752982ea26735944e536a2 100644 --- a/Processes/Sibyll/CMakeLists.txt +++ b/Processes/Sibyll/CMakeLists.txt @@ -74,6 +74,7 @@ set_target_properties ( # target dependencies on other libraries (also the header onlys) target_link_libraries ( ProcessSibyll + CORSIKAprocesssequence CORSIKAparticles CORSIKAutilities CORSIKAunits diff --git a/Processes/Sibyll/Interaction.cc b/Processes/Sibyll/Interaction.cc index ed550a012d63df6b89586198933ce10c4d01b8d2..949086012af40a584c35d9e5dc9c806526828932 100644 --- a/Processes/Sibyll/Interaction.cc +++ b/Processes/Sibyll/Interaction.cc @@ -29,8 +29,8 @@ using std::tuple; using namespace corsika; using namespace corsika::setup; -using Particle = Stack::StackIterator; // ParticleType; -using Projectile = StackView::StackIterator; // ParticleType; +using SetupParticle = setup::Stack::StackIterator; +using SetupProjectile = setup::StackView::StackIterator; using Track = Trajectory; namespace corsika::process::sibyll { @@ -118,7 +118,7 @@ namespace corsika::process::sibyll { } template <> - units::si::GrammageType Interaction::GetInteractionLength(Particle& vP, Track&) const { + units::si::GrammageType Interaction::GetInteractionLength(SetupParticle& vP, Track&) const { using namespace units; using namespace units::si; @@ -162,35 +162,21 @@ namespace corsika::process::sibyll { ideally as full particle object so that the four momenta and the boosts can be defined.. */ + auto const* currentNode = vP.GetNode(); - const auto mediumComposition = + const auto& mediumComposition = currentNode->GetModelProperties().GetNuclearComposition(); - // determine average interaction length - // weighted sum - int i = -1; - si::CrossSectionType weightedProdCrossSection = 0_mb; - // get weights of components from environment/medium - const auto& w = mediumComposition.GetFractions(); - // loop over components in medium - for (auto const targetId : mediumComposition.GetComponents()) { - i++; - cout << "Interaction: get interaction length for target: " << targetId << endl; - - auto const [productionCrossSection, elaCrossSection] = - GetCrossSection(corsikaBeamId, targetId, ECoM); - [[maybe_unused]] const auto& dummy_elaCX = elaCrossSection; - cout << "Interaction: " - << " IntLength: sibyll return (mb): " << productionCrossSection / 1_mb - << endl; - weightedProdCrossSection += w[i] * productionCrossSection; - } + si::CrossSectionType weightedProdCrossSection = mediumComposition.WeightedSum( + [=](particles::Code targetID) -> si::CrossSectionType { + return std::get<0>(this->GetCrossSection(corsikaBeamId, targetID, ECoM)); + }); + cout << "Interaction: " << "IntLength: weighted CrossSection (mb): " << weightedProdCrossSection / 1_mb << endl; // calculate interaction length in medium - //#warning check interaction length units GrammageType const int_length = mediumComposition.GetAverageMassNumber() * units::constants::u / weightedProdCrossSection; cout << "Interaction: " @@ -209,7 +195,7 @@ namespace corsika::process::sibyll { */ template <> - process::EProcessReturn Interaction::DoInteraction(Projectile& vP) { + process::EProcessReturn Interaction::DoInteraction(SetupProjectile& vP) { using namespace units; using namespace utl; diff --git a/Processes/UrQMD/CMakeLists.txt b/Processes/UrQMD/CMakeLists.txt new file mode 100644 index 0000000000000000000000000000000000000000..897492b2e808cd9c743a33bb8b4f66f5ee9a9d79 --- /dev/null +++ b/Processes/UrQMD/CMakeLists.txt @@ -0,0 +1,100 @@ +set ( + MODEL_SOURCES + UrQMD.cc + urqmdInterface.F + addpart.f + angdis.f + anndec.f + blockres.f + boxprg.f + cascinit.f + coload.f + dectim.f + delpart.f + detbal.f + dwidth.f + error.f + getmass.f + getspin.f + init.f + iso.f + ityp2pdg.f + jdecay2.f + make22.f + numrec.f + output.f + paulibl.f + proppot.f + saveinfo.f + scatter.f + siglookup.f + string.f + tabinit.f + urqmd.f + whichres.f +) + +set ( + MODEL_HEADERS + UrQMD.h + ) + +set ( + MODEL_NAMESPACE + corsika/process/urqmd + ) + +add_library (ProcessUrQMD STATIC ${MODEL_SOURCES}) +CORSIKA_COPY_HEADERS_TO_NAMESPACE (ProcessUrQMD ${MODEL_NAMESPACE} ${MODEL_HEADERS}) + +set_target_properties ( + ProcessUrQMD + PROPERTIES + VERSION ${PROJECT_VERSION} + SOVERSION 1 +# PUBLIC_HEADER "${MODEL_HEADERS}" + ) + +# target dependencies on other libraries (also the header onlys) +target_link_libraries ( + ProcessUrQMD + CORSIKAprocesssequence + CORSIKAparticles + CORSIKAunits + CORSIKAgeometry + CORSIKArandom + CORSIKAsetup + ) + +target_include_directories ( + ProcessUrQMD + INTERFACE + $<BUILD_INTERFACE:${PROJECT_BINARY_DIR}/include> + $<INSTALL_INTERFACE:include/include> + ) + +install ( + TARGETS ProcessUrQMD + LIBRARY DESTINATION lib + ARCHIVE DESTINATION lib +# PUBLIC_HEADER DESTINATION include/${MODEL_NAMESPACE} + ) + + +# -------------------- +# code unit testing +add_executable (testUrQMD + testUrQMD.cc + ${MODEL_HEADERS} + ) + +target_link_libraries ( + testUrQMD + ProcessUrQMD + CORSIKAsetup + CORSIKArandom + CORSIKAgeometry + CORSIKAunits + CORSIKAthirdparty # for catch2 + ) +CORSIKA_ADD_TEST(testUrQMD) diff --git a/Processes/UrQMD/Copyright b/Processes/UrQMD/Copyright new file mode 100644 index 0000000000000000000000000000000000000000..0667505f66addd37ae1094f423366bdf97ab69a4 --- /dev/null +++ b/Processes/UrQMD/Copyright @@ -0,0 +1,35 @@ + +Copyright + + +UrQMD source and documentation are provided freely for the purpose of +checking and reproducing published results of the authors. + +The Open Standard Codes and Routines (OSCAR)-Group has established - +for good reasons - guidelines for reproducablity, usage and quality +control of simlulations codes for pA and AA collsions. + +UrQMD is a complex model. In order to ensure that it is used correctly +that all results are reproducible and that the proper credits are +given we ask for your agreement to the following copyright and +safeguard mechanisms in the OSCAR spirit. + +The UrQMD collaboration favors cooperation and joint projects with +outside researchers. We encourage experimental collaborations to +compare their results to UrQMD. We support you and/or cooperate on any +sensible project related to UrQMD + +If you are interested in a project, please contact us. + +Projects without the participation of the UrQMD-Collaboration are +accepted, if the project is not a current thesis topic of any +UrQMD-Collaboration member. + +We expect that the code authors are informed about any changes and +modifications made to the code. Any changes to the official version +must be documented. + +The code or any fragments of it shall not be given away to third +parties. Similarily, events generated with UrQMD shall not be given +to third parties without consent of the code authors. + diff --git a/Processes/UrQMD/README b/Processes/UrQMD/README new file mode 100644 index 0000000000000000000000000000000000000000..3fa900fee63555075a318e21c5ce38b2d1a3c27c --- /dev/null +++ b/Processes/UrQMD/README @@ -0,0 +1,49 @@ +additional files needed for building (from UrQMD v1.3cr): + + Copyright + README + UrQMD-1.3.1-xs.dat + addpart.f + angdis.f + anndec.f + blockres.f + boxinc.f + boxprg.f + cascinit.f + colltab.f + coload.f + comnorm.f + comres.f + coms.f + comstr.f + comwid.f + conex.h + conex.incnex + dectim.f + delpart.f + detbal.f + dwidth.f + error.f + freezeout.f + getmass.f + getspin.f + init.f + inputs.f + iso.f + ityp2pdg.f + jdecay2.f + make22.f + newpart.f + numrec.f + options.f + outcom.f + output.f + paulibl.f + proppot.f + saveinfo.f + scatter.f + siglookup.f + string.f + tabinit.f + urqmd.f + whichres.f diff --git a/Processes/UrQMD/UrQMD.cc b/Processes/UrQMD/UrQMD.cc new file mode 100644 index 0000000000000000000000000000000000000000..df4456bfb965f398720e33aafd286ed56bbdb307 --- /dev/null +++ b/Processes/UrQMD/UrQMD.cc @@ -0,0 +1,285 @@ +#include <corsika/geometry/QuantityVector.h> +#include <corsika/geometry/Vector.h> +#include <corsika/particles/ParticleProperties.h> +#include <corsika/process/urqmd/UrQMD.h> +#include <corsika/random/RNGManager.h> +#include <corsika/setup/SetupStack.h> +#include <corsika/setup/SetupTrajectory.h> +#include <corsika/units/PhysicalUnits.h> + +#include <algorithm> +#include <functional> +#include <iostream> +#include <random> + +using namespace corsika::process::UrQMD; +using namespace corsika::units::si; + +UrQMD::UrQMD() { iniurqmd_(); } + +using SetupStack = corsika::setup::Stack; +using SetupParticle = corsika::setup::Stack::StackIterator; +using SetupProjectile = corsika::setup::StackView::StackIterator; +using SetupTrack = corsika::setup::Trajectory; + +template <typename TParticle> // need template here, as this is called both with + // SetupParticle as well as SetupProjectile +CrossSectionType UrQMD::GetCrossSection(TParticle const& vProjectile, + corsika::particles::Code vTargetCode) const { + using namespace units::si; + + // TODO: energy cuts, return 0 for non-hadrons + + auto const projectileCode = vProjectile.GetPID(); + auto const projectileEnergyLab = vProjectile.GetEnergy(); + + // the following is a translation of ptsigtot() into C++ + if (projectileCode != particles::Code::Nucleus && + !IsNucleus(vTargetCode)) { // both particles are "special" + auto const mProj = particles::GetMass(projectileCode); + auto const mTar = particles::GetMass(vTargetCode); + double sqrtS = + sqrt(units::si::detail::static_pow<2>(mProj) + + units::si::detail::static_pow<2>(mTar) + 2 * projectileEnergyLab * mTar) * + (1 / 1_GeV); + + // we must set some UrQMD globals first... + auto const [ityp, iso3] = ConvertToUrQMD(projectileCode); + inputs_.spityp[0] = ityp; + inputs_.spiso3[0] = iso3; + + auto const [itypTar, iso3Tar] = ConvertToUrQMD(vTargetCode); + inputs_.spityp[1] = itypTar; + inputs_.spiso3[1] = iso3Tar; + + int one = 1; + int two = 2; + return sigtot_(one, two, sqrtS) * 1_mb; + } else { + int const Ap = + (projectileCode == particles::Code::Nucleus) ? vProjectile.GetNuclearA() : 1; + int const At = IsNucleus(vTargetCode) ? particles::GetNucleusA(vTargetCode) : 1; + + double const maxImpact = nucrad_(Ap) + nucrad_(At) + 2 * options_.CTParam[30 - 1]; + return 10_mb * M_PI * units::si::detail::static_pow<2>(maxImpact); + // is a constant cross-section really reasonable? + } +} + +bool UrQMD::CanInteract(particles::Code vCode) const { + // According to the manual, UrQMD can use all mesons, baryons and nucleons + // which are modeled also as input particles. I think it is safer to accept + // only the usual long-lived species as input. + // TODO: Charmed mesons should be added to the list, too + + static particles::Code const validProjectileCodes[] = { + particles::Code::Nucleus, particles::Code::Proton, particles::Code::AntiProton, + particles::Code::Neutron, particles::Code::AntiNeutron, particles::Code::PiPlus, + particles::Code::PiMinus, particles::Code::KPlus, particles::Code::KMinus, + particles::Code::K0, particles::Code::K0Bar}; + + return std::find(std::cbegin(validProjectileCodes), std::cend(validProjectileCodes), + vCode) != std::cend(validProjectileCodes); +} + +GrammageType UrQMD::GetInteractionLength(SetupParticle& vParticle, SetupTrack&) const { + if (!CanInteract(vParticle.GetPID())) { + // we could do the canInteract check in GetCrossSection, too but if + // we do it here we have the advantage of avoiding the loop + return std::numeric_limits<double>::infinity() * 1_g / (1_cm * 1_cm); + } + + auto const& mediumComposition = + vParticle.GetNode()->GetModelProperties().GetNuclearComposition(); + using namespace std::placeholders; + + CrossSectionType const weightedProdCrossSection = mediumComposition.WeightedSum( + std::bind(&UrQMD::GetCrossSection<decltype(vParticle)>, this, vParticle, _1)); + + return mediumComposition.GetAverageMassNumber() * units::constants::u / + weightedProdCrossSection; +} + +corsika::process::EProcessReturn UrQMD::DoInteraction(SetupProjectile& vProjectile) { + using namespace units::si; + + auto const projectileCode = vProjectile.GetPID(); + auto const projectileEnergyLab = vProjectile.GetEnergy(); + auto const& projectileMomentumLab = vProjectile.GetMomentum(); + auto const& projectilePosition = vProjectile.GetPosition(); + auto const projectileTime = vProjectile.GetTime(); + + // sample target particle + auto const& mediumComposition = + vProjectile.GetNode()->GetModelProperties().GetNuclearComposition(); + auto const componentCrossSections = std::invoke([&]() { + auto const& components = mediumComposition.GetComponents(); + std::vector<CrossSectionType> crossSections; + crossSections.reserve(components.size()); + + for (auto const c : components) { + crossSections.push_back(GetCrossSection(vProjectile, c)); + } + + return crossSections; + }); + + auto const targetCode = mediumComposition.SampleTarget(componentCrossSections, fRNG); + auto const targetA = particles::GetNucleusA(targetCode); + auto const targetZ = particles::GetNucleusZ(targetCode); + + inputs_.nevents = 1; + sys_.eos = 0; // could be configurable in principle + inputs_.outsteps = 1; + sys_.nsteps = 1; + + // initialization regarding projectile + if (particles::Code::Nucleus == projectileCode) { + // is this everything? + inputs_.prspflg = 0; + + sys_.Ap = vProjectile.GetNuclearA(); + sys_.Zp = vProjectile.GetNuclearZ(); + rsys_.ebeam = (projectileEnergyLab - vProjectile.GetMass()) * (1 / 1_GeV) / + vProjectile.GetNuclearA(); + + rsys_.bdist = nucrad_(targetA) + nucrad_(sys_.Ap) + 2 * options_.CTParam[30 - 1]; + + int const id = 1; + cascinit_(sys_.Zp, sys_.Ap, id); + } else { + inputs_.prspflg = 1; + sys_.Ap = 1; // even for non-baryons this has to be set, see vanilla UrQMD.f + rsys_.bdist = nucrad_(targetA) + nucrad_(1) + 2 * options_.CTParam[30 - 1]; + rsys_.ebeam = (projectileEnergyLab - vProjectile.GetMass()) * (1 / 1_GeV); + + auto const [ityp, iso3] = ConvertToUrQMD(projectileCode); + // todo: conversion of K_long/short into strong eigenstates; + inputs_.spityp[0] = ityp; + inputs_.spiso3[0] = iso3; + } + + // initilazation regarding target + if (particles::IsNucleus(targetCode)) { + sys_.Zt = targetZ; + sys_.At = targetA; + inputs_.trspflg = 0; // nucleus as target + int const id = 2; + cascinit_(sys_.Zt, sys_.At, id); + } else { + inputs_.trspflg = 1; // special particle as target + auto const [ityp, iso3] = ConvertToUrQMD(targetCode); + inputs_.spityp[1] = ityp; + inputs_.spiso3[1] = iso3; + } + + int iflb = 0; // flag for retrying interaction in case of empty event, 0 means retry + urqmd_(iflb); + + // now retrieve secondaries from UrQMD + auto const& originalCS = projectileMomentumLab.GetCoordinateSystem(); + geometry::CoordinateSystem const zAxisFrame = + originalCS.RotateToZ(projectileMomentumLab); + + for (int i = 0; i < sys_.npart; ++i) { + auto const code = ConvertFromUrQMD(isys_.ityp[i], isys_.iso3[i]); + // "coor_.p0[i] * 1_GeV" is likely off-shell as UrQMD doesn't preserve masses well + auto momentum = geometry::Vector( + zAxisFrame, + geometry::QuantityVector<dimensionless_d>{coor_.px[i], coor_.py[i], coor_.pz[i]} * + 1_GeV); + + auto const energy = sqrt(momentum.squaredNorm() + square(particles::GetMass(code))); + + momentum.rebase(originalCS); // transform back into standard lab frame + std::cout << i << " " << code << " " << momentum.GetComponents() << std::endl; + + vProjectile.AddSecondary( + std::tuple<particles::Code, HEPEnergyType, stack::MomentumVector, geometry::Point, + TimeType>{code, energy, momentum, projectilePosition, projectileTime}); + } + + std::cout << "UrQMD generated " << sys_.npart << " secondaries!" << std::endl; + + return process::EProcessReturn::eOk; +} + +/** + * the random number generator function of UrQMD + */ +double corsika::process::UrQMD::ranf_(int&) { + static corsika::random::RNG& rng = + corsika::random::RNGManager::GetInstance().GetRandomStream("UrQMD"); + static std::uniform_real_distribution<double> dist; + + return dist(rng); +} + +corsika::particles::Code corsika::process::UrQMD::ConvertFromUrQMD(int vItyp, int vIso3) { + int const pdgInt = + pdgid_(vItyp, vIso3); // use the conversion function provided by UrQMD + if (pdgInt == 0) { // pdgid_ returns 0 on error + throw std::runtime_error("UrQMD pdgid() returned 0"); + } + auto const pdg = static_cast<particles::PDGCode>(pdgInt); + return particles::ConvertFromPDG(pdg); +} + +std::pair<int, int> corsika::process::UrQMD::ConvertToUrQMD( + corsika::particles::Code code) { + static const std::map<int, std::pair<int, int>> mapPDGToUrQMD{ + // data mostly from github.com/afedynitch/ParticleDataTool + {22, {100, 0}}, // gamma + {111, {101, 0}}, // pi0 + {211, {101, 2}}, // pi+ + {-211, {101, -2}}, // pi- + {321, {106, 1}}, // K+ + {-321, {-106, -1}}, // K- + {311, {106, -1}}, // K0 + {-311, {-106, 1}}, // K0bar + {2212, {1, 1}}, // p + {2112, {1, -1}}, // n + {221, {102, 0}}, // eta + {213, {104, 2}}, // rho+ + {-213, {104, -2}}, // rho- + {113, {104, 0}}, // rho0 + {323, {108, 2}}, // K*+ + {-323, {108, -2}}, // K*- + {313, {108, 0}}, // K*0 + {-313, {-108, 0}}, // K*0-bar + {223, {103, 0}}, // omega + {333, {109, 0}}, // phi + {3222, {40, 2}}, // Sigma+ + {3212, {40, 0}}, // Sigma0 + {3112, {40, -2}}, // Sigma- + {3322, {49, 0}}, // Xi0 + {3312, {49, -1}}, // Xi- + {3122, {27, 0}}, // Lambda0 + {2224, {17, 4}}, // Delta++ + {2214, {17, 2}}, // Delta+ + {2114, {17, 0}}, // Delta0 + {1114, {17, -2}}, // Delta- + {3224, {41, 2}}, // Sigma*+ + {3214, {41, 0}}, // Sigma*0 + {3114, {41, -2}}, // Sigma*- + {3324, {50, 0}}, // Xi*0 + {3314, {50, -1}}, // Xi*- + {3334, {55, 0}}, // Omega- + {411, {133, 2}}, // D+ + {-411, {133, -2}}, // D- + {421, {133, 0}}, // D0 + {-421, {-133, 0}}, // D0-bar + {441, {107, 0}}, // etaC + {431, {138, 1}}, // Ds+ + {-431, {138, -1}}, // Ds- + {433, {139, 1}}, // Ds*+ + {-433, {139, -1}}, // Ds*- + {413, {134, 1}}, // D*+ + {-413, {134, -1}}, // D*- + {10421, {134, 0}}, // D*0 + {-10421, {-134, 0}}, // D*0-bar + {443, {135, 0}}, // jpsi + }; + + return mapPDGToUrQMD.at(static_cast<int>(GetPDG(code))); +} diff --git a/Processes/UrQMD/UrQMD.h b/Processes/UrQMD/UrQMD.h new file mode 100644 index 0000000000000000000000000000000000000000..0b34e2e147a94c58a933d0cf508a428be5c7b917 --- /dev/null +++ b/Processes/UrQMD/UrQMD.h @@ -0,0 +1,127 @@ +#ifndef _Processes_UrQMD_UrQMD_h +#define _Processes_UrQMD_UrQMD_h + +#include <corsika/particles/ParticleProperties.h> +#include <corsika/process/InteractionProcess.h> +#include <corsika/random/RNGManager.h> +#include <corsika/setup/SetupStack.h> +#include <corsika/setup/SetupTrajectory.h> +#include <corsika/units/PhysicalUnits.h> + +#include <array> +#include <utility> + +namespace corsika::process::UrQMD { + class UrQMD : public corsika::process::InteractionProcess<UrQMD> { + public: + UrQMD(); + corsika::units::si::GrammageType GetInteractionLength( + corsika::setup::Stack::StackIterator&, corsika::setup::Trajectory&) const; + + template <typename TParticle> + corsika::units::si::CrossSectionType GetCrossSection(TParticle const&, + corsika::particles::Code) const; + + corsika::process::EProcessReturn DoInteraction( + corsika::setup::StackView::StackIterator&); + + bool CanInteract(particles::Code) const; + + private: + corsika::random::RNG& fRNG = + corsika::random::RNGManager::GetInstance().GetRandomStream("UrQMD"); + }; + + namespace constants { + // from coms.f + int constexpr nmax = 500; + + // from options.f + int constexpr numcto = 400; + int constexpr numctp = 400; + + // from inputs.f + int constexpr aamax = 300; + + } // namespace constants + + template <typename T> + using nmaxArray = std::array<T, constants::nmax>; + using nmaxIntArray = nmaxArray<int>; + using nmaxDoubleArray = nmaxArray<double>; + + extern "C" { + void iniurqmd_(); + double ranf_(int&); + void cascinit_(int const&, int const&, int const&); + double nucrad_(int const&); + void urqmd_(int&); + int pdgid_(int&, int&); + double sigtot_(int&, int&, double&); + + // defined in coms.f + extern struct { + int npart, nbar, nmes, ctag, nsteps, uid_cnt, ranseed, event; + int Ap; // projectile mass number (in case of nucleus) + int At; // target mass number (in case of nucleus) + int Zp; // projectile charge number (in case of nucleus) + int Zt; // target charge number (in case of nucleus) + int eos, dectag, NHardRes, NSoftRes, NDecRes, NElColl, NBlColl; + } sys_; + + extern struct { + double time, acttime, bdist, bimp, bmin; + double ebeam; // lab-frame energy of projectile + double ecm; + } rsys_; + + // defined in coms.f + extern struct { + nmaxIntArray spin, ncoll, charge, ityp, lstcoll, iso3, origin, strid, uid; + } isys_; + + // defined in coor.f + extern struct { + nmaxDoubleArray r0, rx, ry, rz, p0, px, py, pz, fmass, rww, dectime; + } coor_; + + // defined in inputs.f + extern struct { + int nevents; + std::array<int, 2> spityp; // particle codes of: [0]: projectile, [1]: target + int prspflg; // projectile special flag + int trspflg; // target special flag, set to 1 unless target is nucleus > H + std::array<int, 2> spiso3; // particle codes of: [0]: projectile, [1]: target + int outsteps, bflag, srtflag, efuncflag, nsrt, npb, firstev; + } inputs_; + + // defined in inputs.f + extern struct { + double srtmin, srtmax, pbeam, betann, betatar, betapro, pbmin, pbmax; + } input2_; + + // defined in options.f + extern struct { + std::array<double, constants::numcto> CTOption; + std::array<double, constants::numctp> CTParam; + } options_; + + extern struct { + int fixedseed, bf13, bf14, bf15, bf16, bf17, bf18, bf19, bf20; + } loptions_; + + // defined in urqmdInterface.F + extern struct { std::array<double, 3> xs, bim; } cxs_u2_; + } + + /** + * convert CORSIKA code to UrQMD code tuple + * + * In the current implementation a detour via the PDG code is made. + */ + std::pair<int, int> ConvertToUrQMD(particles::Code); + particles::Code ConvertFromUrQMD(int vItyp, int vIso3); + +} // namespace corsika::process::UrQMD + +#endif diff --git a/Processes/UrQMD/addpart.f b/Processes/UrQMD/addpart.f new file mode 100644 index 0000000000000000000000000000000000000000..1d28a4cfaf419f344474da52210659fb53ad1bef --- /dev/null +++ b/Processes/UrQMD/addpart.f @@ -0,0 +1,154 @@ +c $Id: addpart.f,v 1.4 2000/01/12 16:02:32 bass Exp $ +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC +C + subroutine addpart(index) +c +c Revision : 1.0 +c +cinput index : index for slot to create in particle arrays +c +c This subroutine creates an entry for a particle with index {\tt index} in all +c particle arrays. +c \danger{The {\tt nbar} and {\tt nmes} counters must be updated by the +c calling routine !} +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + include 'coms.f' + include 'newpart.f' + include 'freezeout.f' + integer ind,i,j,index + ind=index + +c now shift vectors upwards + do 10 i=npart,ind,-1 + r0(i+1)=r0(i) + rx(i+1)=rx(i) + ry(i+1)=ry(i) + rz(i+1)=rz(i) + + p0(i+1)=p0(i) + px(i+1)=px(i) + py(i+1)=py(i) + pz(i+1)=pz(i) + fmass(i+1)=fmass(i) + ityp(i+1)=ityp(i) + iso3(i+1)=iso3(i) + ncoll(i+1)=ncoll(i) + lstcoll(i+1)=lstcoll(i) + charge(i+1)=charge(i) + spin(i+1)=spin(i) + dectime(i+1)=dectime(i) + tform(i+1)=tform(i) + xtotfac(i+1)=xtotfac(i) + origin(i+1)=origin(i) + strid(i+1)=strid(i) + uid(i+1)=uid(i) + frr0(i+1)=frr0(i) + frrx(i+1)=frrx(i) + frry(i+1)=frry(i) + frrz(i+1)=frrz(i) + frp0(i+1)=frp0(i) + frpx(i+1)=frpx(i) + frpy(i+1)=frpy(i) + frpz(i+1)=frpz(i) + ffermpx(i+1)=ffermpx(i) + ffermpy(i+1)=ffermpy(i) + ffermpz(i+1)=ffermpz(i) + + r0_t(i+1)=r0_t(i) + rx_t(i+1)=rx_t(i) + ry_t(i+1)=ry_t(i) + rz_t(i+1)=rz_t(i) + + do 11 j=1,2 + p0td(j,i+1)=p0td(j,i) + pxtd(j,i+1)=pxtd(j,i) + pytd(j,i+1)=pytd(j,i) + pztd(j,i+1)=pztd(j,i) + fmasstd(j,i+1)=fmasstd(j,i) + ityptd(j,i+1)=ityptd(j,i) + iso3td(j,i+1)=iso3td(j,i) + 11 continue + + + 10 continue + +c increment npart + npart=npart+1 +c + if(npart.ge.nmax) then + write(6,*)'*** error in addpart:too much particles>',nmax + write(6,*)' -> increase nmax in coms.f ' + call file14out(999) + stop + endif + +c initialize new slot + r0(ind)=0.0 + rx(ind)=0.0 + ry(ind)=0.0 + rz(ind)=0.0 + + p0(ind)=0.0 + px(ind)=0.0 + py(ind)=0.0 + pz(ind)=0.0 + fmass(ind)=0.0 + ityp(ind)=0 + iso3(ind)=0 + ncoll(ind)=0 + lstcoll(ind)=0 + charge(ind)=0 + spin(ind)=-1 + dectime(ind)=0.d0 + tform(ind)=0.0d0 + xtotfac(ind)=1.0d0 + origin(ind)=0 + strid(ind)=0 + uid(ind)=0 + frr0(ind)=0.d0 + frrx(ind)=0.d0 + frry(ind)=0.d0 + frrz(ind)=0.d0 + frp0(ind)=0.d0 + frpx(ind)=0.d0 + frpy(ind)=0.d0 + frpz(ind)=0.d0 + ffermpx(ind)=0.d0 + ffermpy(ind)=0.d0 + ffermpz(ind)=0.d0 +cpot + r0_t(ind)=0.d0 + rx_t(ind)=0.d0 + ry_t(ind)=0.d0 + rz_t(ind)=0.d0 +ctd + do 12 j=1,2 + p0td(j,ind)=0.d0 + pxtd(j,ind)=0.d0 + pytd(j,ind)=0.d0 + pztd(j,ind)=0.d0 + fmasstd(j,ind)=0.d0 + ityptd(j,ind)=0 + iso3td(j,ind)=0 + 12 continue + +c rescan collision table - all particle indices which have been +c shifted upwards must be modified in the collision tables, too. + call scantab(ind,1) + +c the lstcoll array must also be shifted due to the new particle slot + do 15 i=1,npart + if(lstcoll(i).le.nmax) then + if(lstcoll(i).eq.ind) then + lstcoll(i)=0 + elseif(lstcoll(i).gt.ind) then + lstcoll(i)=lstcoll(i) + 1 + endif + endif + 15 continue + + + return + end diff --git a/Processes/UrQMD/angdis.f b/Processes/UrQMD/angdis.f new file mode 100644 index 0000000000000000000000000000000000000000..90fdb4aaf1fd84279ca167b6d5e1fc28999e7f46 --- /dev/null +++ b/Processes/UrQMD/angdis.f @@ -0,0 +1,343 @@ +c $Id: angdis.f,v 1.15 2000/01/12 16:02:33 bass Exp $ +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine angdisnew(sqrts,m1,m2,iline,costh,phi) +c +c Revision : 1.1 +c +c input: sqrts, m1, m2, iline : characteristics of the ingoing channel +coutput costh : cos(theta) of theta-angle +coutput phi : phi-angle +c +c {\tt angdisnew} delivers phi and cos(theta) scattering angles +c according to the angular distributions given by Mao et al. +c {\tt angdisnew} performs numerical inversion of the integral of the +c differential cross-section by means of a bisection method. +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + implicit none + + real*8 sqrts, m1, m2, costh, costhcoll, phi, ranf, pi, s + real*8 anginter + integer iline + logical symlog(38) + + parameter (pi = 3.14159265358979312d0) + +c symmetrize or not angular distribution (depending on iline) +c this data statements may be changed ... + data symlog /14*.true., 1*.false., 6*.true., 7*.false., + & 7*.true., 1*.false., 2*.true./ + + + s = sqrts*sqrts + phi = 2.0d0*pi*ranf(0) + + goto (4, 4, 4, 4, 4, 4, 4, 4, 4, 9, + & 9, 4, 4, 4, 4, 4, 4, 4, 4, 9, +c ISO-FB interpolation for MB iline 26/27/28 + & 4, 4,10,10,10,11,11,11, 4, 4, + & 4, 4, 4, 4, 4, 9, 9, 4) abs(iline) + +c cross-sections NN (Mao et al.) + 4 continue + costh = -costhcoll(s,m1,m2,symlog(abs(iline))) + + return + +c isotropic decay + 9 continue + costh = 1.0d0-2.0d0*ranf(0) + return + +c no deflection at all + 10 continue + costh = 1.0d0 + return + +c smooth interpolation between iso and f-b: + 11 continue +cbl only for intermediate masses, otherwise no deflection (zero degree scattering) + if(sqrts.gt.6d0) goto 10 + costh = anginter() + return + + end + + function costhcoll(s,m1,m2,sym) + implicit none + real*8 costhcoll, s, m1, m2, x, dct, ct, dsigma, ranf + integer j + logical sym + + x = ranf(0) + dct = 2.0d0 + costhcoll = -1.0d0 +c +c for jmax=12 the accuracy is better than 0.1 degree +c + do j=1,12 ! accuracy 2**-jmax + dct = 0.5d0*dct + ct = costhcoll+dct + if (dsigma(s,m1,m2,sym,ct).le.x) costhcoll=ct + enddo +c +c randomize in final interval in order to avoid discrete angles +c + costhcoll = costhcoll+ranf(0)*dct + return + end + + function dsigma(s_in,m1_in,m2_in,sym,costh) +c +cc dsigma(s\_in,chosth) = int_-1^costh dsigma/dOmega(s_in,..) dOmega +cc it is normalized such that dsigma(s\_in,-1) = 0 and +cc dsigma(s\_in,1) = 1 + implicit none + + include 'coms.f' + + real*8 dsigma + real*8 s_in, m1_in, m2_in, costh, + & msi, cmsi, gsi, mom, cmom, gom, mpi, cmpi, gpi, m + real*8 m42, mpi2, cmpi2, d_pi1, d_pi2, cm6gp, + & cpi_3, cpi_2, cpi_1, cpi_m, cpi_l, cpi_0, + & msi2, cmsi2, cmsi4, cmsi6, d_si1, d_si2, d_si3, cm2gs, + & csi_3, csi_2, csi_1, csi_m, csi_l, csi_0, + & mom2, cmom2, cmom4, cmom6, d_om1, d_om2, d_om3, s_om1, + & cm2go, com_3, com_2, com_1, com_m, com_l, + & fac1, d_mx1, d_mx2, d_mx3, + & cmx_o1, cmx_s1, cmx_om, cmx_sm, fac2, fac3, + & cmx_olc, cmx_ols, cmx_slc, cmx_sls + + real*8 sig, tp_pi, tp_si, tp_om, tm_pi, tm_si, tm_om, + & bom_3, bom_2, bom_1, bom_m, bom_0, bom_l, + & bmx_o1, bmx_s1, bmx_om, bmx_sm, bmx_ol, bmx_sl + + real*8 s, tmax, tp, to, twos, brak1, norm, + & t1_pi, t2_pi, t1_si, t2_si, t1_om, t2_om, + & t3_pi, t4_pi, t3_si, t4_si, t3_om, t4_om + + logical firstlog, sym + common /nn/ norm + + +c define masses and coupling constants + data msi /0.550d0/ cmsi /1.200d0/ gsi /9.40d0/ + data mom /0.783d0/ cmom /0.808d0/ gom /10.95d0/ + data mpi /0.138d0/ cmpi /0.510d0/ gpi /7.27d0/ + data m /0.938d0/ + + save firstlog + + save m42, mpi2, cmpi2, d_pi1, d_pi2, cm6gp, + & cpi_3, cpi_2, cpi_1, cpi_m, cpi_l, cpi_0 + + save msi2, cmsi2, cmsi4, cmsi6, d_si1, d_si2, d_si3, cm2gs, + & csi_3, csi_2, csi_1, csi_m, csi_l, csi_0 + + save mom2, cmom2, cmom4, cmom6, d_om1, d_om2, d_om3, s_om1, + & cm2go, com_3, com_2, com_1, com_m, com_l + + save fac1, d_mx1, d_mx2, d_mx3, + & cmx_o1, cmx_s1, cmx_om, cmx_sm, fac2, fac3, + & cmx_olc, cmx_ols, cmx_slc, cmx_sls + + sig(tp_pi,tp_si,tp_om,tm_pi,tm_si,tm_om) = +c pion + & +((cpi_3*tp_pi + cpi_2)*tp_pi + cpi_1)*tp_pi + & + cpi_m/tm_pi + cpi_0 + cpi_l*log(tp_pi*tm_pi) +c sigma + & +((csi_3*tp_si + csi_2)*tp_si + csi_1)*tp_si + & + csi_m/tm_si + csi_0 + csi_l*log(tp_si*tm_si) +c omega + & +((bom_3*tp_om + bom_2)*tp_om + bom_1)*tp_om + & + bom_m/tm_om + bom_0 + bom_l*log(tp_om*tm_om) +c mix + & + bmx_o1*(tp_om - 1.0d0) + & + bmx_s1*(tp_si - 1.0d0) + & + bmx_om*log(tm_om) + & + bmx_sm*log(tm_si) + & + bmx_ol*log(tp_om) + & + bmx_sl*log(tp_si) + +c calculate constants only once! + if(firstlog) goto 1000 + if (info) write(6,*) + $ '(info) dsigma: calculating constants for ang. dist.' + +c define constants for pion-Term (no s-dependence) + m42 = 4.0d0*m*m + mpi2 = mpi*mpi + cmpi2 = cmpi*cmpi + d_pi1 = cmpi2-mpi2 + d_pi2 = d_pi1*d_pi1 + cm6gp = 1.5d0*cmpi2**3*gpi**4*m42*m42/d_pi2 + + cpi_3 = -(cm6gp/3.0d0) + cpi_2 = -(cm6gp*mpi2/d_pi1) + cpi_1 = -(cm6gp*mpi2*(2.0d0*cmpi2 + mpi2)/d_pi2) + cpi_m = -(cm6gp*cmpi2*mpi2/d_pi2) + cpi_l = -(cm6gp*2.0d0*cmpi2*mpi2*(cmpi2 + mpi2)/d_pi2/d_pi1) + cpi_0 = -(cpi_3 + cpi_2 + cpi_1 + cpi_m) + +c define constants for sigma-Term (no s-dependence) + msi2 = msi*msi + cmsi2 = cmsi*cmsi + cmsi4 = cmsi2*cmsi2 + cmsi6 = cmsi2*cmsi4 + d_si1 = m42-cmsi2 + d_si2 = m42-msi2 + d_si3 = cmsi2-msi2 + cm2gs = 0.5d0*cmsi2*gsi**4/d_si3**2 + + csi_3 = -(cm2gs*d_si1**2/3.0d0) + csi_2 = -(cm2gs*cmsi2*d_si1*d_si2/d_si3) + csi_1 = -(cm2gs*cmsi4*(2.0d0*d_si1 + d_si2)*d_si2/d_si3**2) + csi_m = -(cm2gs*cmsi6*d_si2**2/msi2/d_si3**2) + csi_l = -(cm2gs*cmsi6*d_si2*(d_si1 + d_si2)*2.0d0/d_si3**3) + csi_0 = -(csi_3 + csi_2 + csi_1 + csi_m) + +c define constants for omega-Term + mom2 = mom*mom + cmom2 = cmom*cmom + cmom4 = cmom2*cmom2 + cmom6 = cmom2*cmom4 + d_om1 = m42-cmom2 + d_om2 = m42-mom2 + d_om3 = cmom2-mom2 + s_om1 = cmom2+mom2 + cm2go = 0.5d0*cmom2*gom**4/d_om3**2 + + com_3 = cm2go/3.0d0 + com_2 = -(cm2go*cmom2/d_om3) + com_1 = cm2go*cmom4/d_om3**2 + com_m = cm2go*cmom6/(d_om3**2*mom2) + com_l = -(cm2go*cmom6*4.0d0/d_om3**3) + +c define constants for mix-Term + fac1 = -((gsi*gom*cmsi2*cmom2)**2*m42) + d_mx1 = cmom2 - cmsi2 + d_mx2 = cmom2 - msi2 + d_mx3 = cmsi2 - mom2 + + cmx_o1 = fac1/(cmom2*d_mx1**2*d_mx2*d_om3) + cmx_s1 = fac1/(cmsi2*d_mx1**2*d_mx3*d_si3) + cmx_om = fac1/(d_om3**2*d_mx3**2*(mom2 - msi2)) + cmx_sm = fac1/(d_si3**2*d_mx2**2*(msi2 - mom2)) + fac2 = (-fac1)/(d_mx1**3*d_om3**2*d_mx2**2) + fac3 = (-fac1)/(d_mx1**3*d_mx3**2*d_si3**2) + + cmx_olc = + & fac2*(3.0d0*cmom2**3 - cmom2**2*cmsi2 + & - 2.0d0*cmom2**2*mom2 - 2.0d0*cmom2**2*msi2 + & + cmom2*mom2*msi2 + cmsi2*mom2*msi2 + & - 4.0d0*cmom2**2*m42 + 2.0d0*cmom2*cmsi2*m42 + & + 3.0d0*cmom2*mom2*m42 - cmsi2*mom2*m42 + & + 3.0d0*cmom2*msi2*m42 - cmsi2*msi2*m42 + & - 2.0d0*mom2*msi2*m42) + + cmx_ols = + & fac2*(8.0d0*cmom2**2 - 4.0d0*cmom2*cmsi2 + & - 6.0d0*cmom2*mom2 + 2.0d0*cmsi2*mom2 + & - 6.0d0*cmom2*msi2 + 2.0d0*cmsi2*msi2 + & + 4.0d0*mom2*msi2) + + cmx_slc = + & fac3*(cmom2*cmsi2**2 - 3.0d0*cmsi2**3 + & + 2.0d0*cmsi2**2*mom2 + 2.0d0*cmsi2**2*msi2 + & - cmom2*mom2*msi2 - cmsi2*mom2*msi2 + & - 2.0d0*cmom2*cmsi2*m42 + 4.0d0*cmsi2**2*m42 + & + cmom2*mom2*m42 - 3.0d0*cmsi2*mom2*m42 + & + cmom2*msi2*m42 - 3.0d0*cmsi2*msi2*m42 + & + 2.0d0*mom2*msi2*m42) + + cmx_sls = + & fac3*(4.0d0*cmom2*cmsi2 - 8.0d0*cmsi2**2 + & - 2.0d0*cmom2*mom2 + 6.0d0*cmsi2*mom2 + & - 2.0d0*cmom2*msi2 + 6.0d0*cmsi2*msi2 + & - 4.0d0*mom2*msi2) + + firstlog = .true. + if (info) write(6,*) '(info) dsigma: calculation finished' + +c s-dependence beyond this point + + 1000 continue + s = s_in - (m1_in+m2_in)**2 + m42 + tmax = s-m42 + tp = 0.5d0*(costh+1.0d0)*tmax + twos = 2.0d0*s + +c define s-dependent stuff for omega-Term + brak1 = (twos-m42)**2 + bom_3 = com_3*(-(2.0d0*cmom2**2) - 2.0d0*cmom2*twos - brak1) + bom_2 = com_2*(2.0d0*cmom2*mom2 + s_om1*twos + brak1) + bom_1 = com_1*(-(4.0d0*cmom2*mom2) - 2.0d0*mom2**2 - + & 2.0d0*(cmom2+2*mom2)*twos - 3.0d0*brak1) + bom_m = com_m*(-(2.0d0*mom2**2)- 2.0d0*mom2*twos - brak1) + bom_l = com_l*(s_om1*mom2 + (cmom2 + 3.0d0*mom2)*s + brak1) + bom_0 = -(bom_3 + bom_2 + bom_1 + bom_m) + +c define s-dependent stuff for mix-Term + bmx_o1 = cmx_o1*(d_om1 - twos) + bmx_s1 = cmx_s1*(d_si1 - twos) + bmx_om = cmx_om*(d_om2 - twos) + bmx_sm = cmx_sm*(d_si2 - twos) + bmx_ol = cmx_olc + cmx_ols*s + bmx_sl = cmx_slc + cmx_sls*s + + t1_pi = 1.0d0/(1.0d0+tmax/cmpi2) + t2_pi = 1.0d0+tmax/mpi2 + t1_si = 1.0d0/(1.0d0+tmax/cmsi2) + t2_si = 1.0d0+tmax/msi2 + t1_om = 1.0d0/(1.0d0+tmax/cmom2) + t2_om = 1.0d0+tmax/mom2 + + norm = sig(t1_pi,t1_si,t1_om,t2_pi,t2_si,t2_om) + + t1_pi = 1.0d0/(1.0d0+tp/cmpi2) + t2_pi = 1.0d0+tp/mpi2 + t1_si = 1.0d0/(1.0d0+tp/cmsi2) + t2_si = 1.0d0+tp/msi2 + t1_om = 1.0d0/(1.0d0+tp/cmom2) + t2_om = 1.0d0+tp/mom2 + + if (sym) then + norm=2.0d0*norm + to = tmax-tp + t3_pi = 1.0d0/(1.0d0+to/cmpi2) + t4_pi = 1.0d0+to/mpi2 + t3_si = 1.0d0/(1.0d0+to/cmsi2) + t4_si = 1.0d0+to/msi2 + t3_om = 1.0d0/(1.0d0+to/cmom2) + t4_om = 1.0d0+to/mom2 + + dsigma = (sig(t1_pi,t1_si,t1_om,t2_pi,t2_si,t2_om) + & -sig(t3_pi,t3_si,t3_om,t4_pi,t4_si,t4_om))/norm+0.5d0 + else + dsigma = sig(t1_pi,t1_si,t1_om,t2_pi,t2_si,t2_om)/norm + end if + return + end + + function anginter() + implicit none + real*8 ranf, anginter, a +c* + a=8d0 +c* +c the costheta distribution p(x) is proportional to exp(a*x) +c x is chosen between -1 and +1 +c a=0 corresponds to isotropic distr. +c a=infinity corresponds to exactly forward distr. +c inverse transform method is used: + + anginter=1d0/a*log( ranf(0)*(exp(a)-exp(-a))+exp(-a) ) + + if(anginter.lt.-1d0.or.anginter.gt.1d0)then + write(*,*)"#angdis# illegal costh value: ",anginter + endif + + return + end + diff --git a/Processes/UrQMD/anndec.f b/Processes/UrQMD/anndec.f new file mode 100644 index 0000000000000000000000000000000000000000..6ccce6a4512034caa7f0aa12144791307b3fcacd --- /dev/null +++ b/Processes/UrQMD/anndec.f @@ -0,0 +1,983 @@ +c $Id: anndec.f,v 1.20 2003/05/02 13:14:47 weber Exp $ +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine anndec(io,mm1,ii1,iiz1,mm2,ii2,iiz2,sqrts,sig,gam) +c +c +cinput io : 0: annihilation; 1: decay +cinput mm1 : mass of scattering/decaying particle 1 +cinput ii1 : ID of scattering/decaying particle 1 +cinput iiz1 : $2\cdot I_3$ of scattering/decaying particle 1 +cinput mm2 : mass of scattering particle 2 +cinput ii2 : ID of scattering particle 2 +cinput iiz2 : $2\cdot I_3$ of scattering particle 2 +cinput sqrts : $sqrts{s}$ of collision; resonance mass for decay +coutput sig : resonance scattering cross section +coutput gam : width of the produced resonance +c +c {\tt anndec} handles meson-baryon and meson-meson annihilations +c as well as all meson and baryon resonance decays. In case of +c annihilations it returs the total resonance production cross section +c and the decay width of the resonance chosen as final state. +c The final state itself for both cases, annihilation and decay +c is returned via the {\tt newpart} common block. In the case +c of a decay the final state may consist of up to 4 particles. +c +c Technically, {\tt anndec} is only an interface to {\tt anndex}, +c which actually handles the summation of the Breit-Wigner formulas +c in the annihilation case and the final state generation for +c annihilation and decay. +c +Ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +C + implicit none + integer io,i1,i2,iz1,iz2,ii1,ii2,iiz1,iiz2,is + real*8 m1,m2,mm1,mm2,sig,gam,sqrts + + include 'comres.f' + include 'options.f' + + integer strit +C +C ************************************************************************ +C Case 1 : Two ingoing Particles --> One outgoing Particle (Resonance,...) +C +C + i1=ii1 + i2=ii2 + iz1=iiz1 + iz2=iiz2 + m1=mm1 + m2=mm2 + + if(io.eq.0)then !annihilation +C + sig=0d0 + gam=0d0 +C +C Check if (sqrt(s)-masses of ingoing particles) is significant different +C from zero +C + if(sqrts-mm1-mm2.le.1d-3)return +C +C Check if CTOption(15) is set different from zero-->then skip anndec.f +C + if(CTOption(15).ne.0)return +C +C +C Check if itype of particle one is smaller than the one of particle two +C if so --> interchange particle one and particle two +C in case of particle one = B and particle two = M --> then +C new particle one = M and new particle two = B +C + if(iabs(i1).lt.iabs(i2))call swpizm(i1,iz1,m1,i2,iz2,m2) +C +C Determination of the amount of the netstrangness +C + is=iabs(strit(i1)+strit(i2)) +C +C maxbar (Maximum Baryon ityp) +C if second particle is antibaryon and first particle is strange +C switch antibaryon to baryon +C + if(iabs(i2).le.maxbar)then + if(i2.lt.0)then + if(strit(i1).ne.0)i1=-i1 ! get corresponding anti-branch + end if + end if +C +C +C Check if both particles are mesons +C + if(iabs(i1).ge.minmes.and.iabs(i2).ge.minmes)then +C +C +c... boson+boson sector +C +C +C Check if amount of netstrangeness is greater than 1 +c currently no resonant processes for |s|>1 are implemented + + if(is.gt.1)return + + if(is.ne.0)then + call anndex(0,m1,i1,iz1,m2,i2,iz2,sqrts, + . sig,gam,maxbrm,minmes+1,maxmes,bmtype,branmes) + else + call anndex(0,m1,i1,iz1,m2,i2,iz2,sqrts, + . sig,gam,maxbrm,minmes+1,maxmes,bmtype,branmes) + endif + +C +C Check if second particle is baryon +C (with zero amount of netstrangeness) ? +C e.g. pion-nucleon case +C + else if(is.eq.0.and.iabs(i2).le.maxbar)then +c... (anti-)N*,D* + call anndex(0,m1,i1,iz1,m2,i2,iz2,sqrts,sig,gam, + . maxbra,minnuc+1,maxdel,brtype,branres) + +C +C Check if second particle is baryon +C (with amount one of netstrangeness) ? +C + else if(is.eq.1.and.iabs(i2).le.maxbar)then +c... (anti-)Y* + call anndex(0,m1,i1,iz1,m2,i2,iz2,sqrts,sig,gam, + . maxbrs1,minlam+1,maxsig,bs1type,branbs1) +C +C Check if second particle is baryon +C (with amount two of netstrangeness) ? +C + else if(is.eq.2.and.iabs(i2).le.maxbar)then +c... (anti-)X* + call anndex(0,m1,i1,iz1,m2,i2,iz2,sqrts,sig,gam, + . maxbrs2,mincas+1,maxcas,bs2type,branbs2) +C +C + else + sig=0d0 + return + end if +C +C ************************************************************* +Css Case 2 : one ingoing particle (resonance,..) --> 2-4 outgoing +Css particles (decay) +C + else ! decay !!!!! + + i2=0 + iz2=0 + m2=0.d0 + is=iabs(strit(i1)) +c + if(iabs(i1).ge.minmes)then ! meson dec. + call anndex(1,m1,i1,iz1,m2,i2,iz2,sqrts,sig,gam, + . maxbrm ,minmes+1,maxmes,bmtype,branmes) + + + else if(is.eq.0)then ! n*,d,d* + call anndex(1,m1,i1,iz1,m2,i2,iz2,sqrts,sig,gam, + . maxbra,minnuc+1,maxdel,brtype,branres) + + + else if(is.eq.1)then ! + call anndex(1,m1,i1,iz1,m2,i2,iz2,sqrts,sig,gam, + . maxbrs1,minlam+1,maxsig,bs1type,branbs1) + + + else if(is.eq.2)then + call anndex(1,m1,i1,iz1,m2,i2,iz2,sqrts,sig,gam, + . maxbrs2,mincas+1,maxcas,bs2type,branbs2) + + else + write(6,*)'make22(anndex): s=',is,'not included' + stop + end if +C +C End of Cases 1 and 2 : annihilation/decay +C + end if +C ************************************************************ +C + return + end + + + +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine anndex(io,m1,i1,iz1,m2,i2,iz2,sqrts,sig,gam, + & maxbr,mini,maxi,btype,branch) +c +cinput io : 0: annihilation; 1: decay +cinput m1 : mass of scattering/decaying particle 1 +cinput i1 : ID of scattering/decaying particle 1 +cinput iz1 : $2\cdot I_3$ of scattering/decaying particle 1 +cinput m2 : mass of scattering particle 2 +cinput i2 : ID of scattering particle 2 +cinput iz2 : $2\cdot I_3$ of scattering particle 2 +cinput sqrts : $sqrts{s}$ of collision; resonance mass for decay +coutput sig : resonance scattering cross section +coutput gam : width of the produced resonance +cinput maxbr : number of decay channels for particle class +cinput mini : smallest {\tt ityp} of particle class +cinput maxi : largest {\tt ityp} of particle class +cinput btype : array with exit channel definitions +cinput branch : array with branching ratios for final state +c +c +c {\tt anndex} performs meson-baryon and meson-meson annihilations +c as well as all meson and baryon resonance decays. In case of +c annihilations it returs the total resonance production cross section +c and the decay width of the resonance chosen as final state. +c The final state itself for both cases, annihilation and decay +c is returned via the {\tt newpart} common block. In the case +c of a decay the final state may consist of up to 4 particles. +c +c In {\tt anndex} the actual summation over Breit-Wigner formulas +c in the case of annihilations is performed. +c +c For decays the branch is choosen according to the mass dependent +c part of the decay width (call to {\tt fbrancx}); then the final +c state (which consists of particle {\tt ityp}, $2\cdot I_3$ and +c mass is generated and transferred to teh {\tt newpart} common +c block. +c +Ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + + include 'comres.f' + include 'comwid.f' + include 'newpart.f' + include 'options.f' + + real*8 pi,cc,sqrts + parameter(pi=3.1415927,cc=0.38937966) + integer maxbr,mini,maxi,btype(4,0:maxbr) + real*8 branch(0:maxbr,mini:maxi) + integer icnt,is + + + integer io,i,j,i1,i2,iz1,iz2,itag,ii1,ii2 + integer itn1,itnz1 + real*8 m1,m2,prob(0:100),sum,sig,gam,cgk2 + real*8 sigi(minnuc:maxmes),mmax,mmin,br,mmi1,mmi2,ppcm,gt + real*8 m,g,mo + +c functions + real*8 fbrwig,pcms,massit + real*8 mminit,widit,fbrancx,ranf,fcgk,fwidth + real*8 fprwdt + integer jit,isoit,strit + if(io.eq.1)then +C +C +C one ingoing particle --> two,three,four outgoing particles +C +c... decays + + do 3 i=0,maxbr + if(isoit(btype(1,i))+isoit(btype(2,i))+isoit(btype(3,i))+ + & isoit(btype(4,i)).lt.iabs(iz1).or. + & m1.lt.mminit(btype(1,i))+mminit(btype(2,i)) + & +mminit(btype(3,i))+mminit(btype(4,i)) )then + prob(i)=0.d0 + else + prob(i)=fbrancx(i,iabs(i1),iz1,m1,branch(i,iabs(i1)), + & btype(1,i),btype(2,i),btype(3,i),btype(4,i)) + endif + 3 continue + + icnt=0 +c... find out branch = i + call getbran(prob,0,100,sum,0,maxbr,i) +ctp060202 9 call getbran(prob,0,100,sum,0,maxbr,i) + + if(i.gt.maxbr)then + write(6,*)'anndex(dec): no final state found for:',i1,m1,iz1 + write(6,*)'please check minimal masses: m1,m1min,m2min' + write(6,*)'and iso3 of decaying particle' + write(6,*)(prob(j),j=0,maxbr) + stop + end if + +c... get itypes and set number of outgoing particles, prepare final state + nexit=2 + itypnew(1)=btype(1,i) + itot(1)=isoit(itypnew(1)) + itypnew(2)=btype(2,i) + itot(2)=isoit(itypnew(2)) + + + itypnew(3)=btype(3,i) + if(itypnew(3).ne.0) then + itot(3)=isoit(itypnew(3)) + pnew(5,3)=massit(itypnew(3)) +c sidnew is used to set the lstcoll array + sidnew(3)=strcount + sidnew(2)=strcount ! correct here, set only for nexit > 2 + nexit=nexit+1 + endif + itypnew(4)=btype(4,i) + if(itypnew(4).ne.0) then + itot(4)=isoit(itypnew(4)) + pnew(5,4)=massit(itypnew(4)) + sidnew(4)=strcount + nexit=nexit+1 + endif + if(nexit.gt.2) strcount=strcount+1 + + +c check for some special cases involving decay of antibaryons and +c strange mesons + if(iabs(i1).ge.minmes.and.strit(i1).ne.0) then + do 41 j=1,nexit + if(strit(itypnew(j)).ne.0)then +c for anti-K* decays(mesons with one s-quark) + itypnew(j)=isign(itypnew(j),i1) + end if + 41 continue + elseif(iabs(i1).lt.minmes) then +c the (anti-)baryon MUST always be the first outgoing particle +c -> conserve baryon-charge + itypnew(1)=isign(itypnew(1),i1) + do 42 j=2,nexit + if(strit(itypnew(j)).ne.0.and.i1.lt.0) then + itypnew(j)=(-1)*itypnew(j) + endif + 42 continue + endif + + + +c... get isopin-3 components + itag=-50 + call isonew4(isoit(i1),iz1,itot,i3new,itag) +c write(6,*)'anndem:',iz3,iz1,iz2,'#',is3,is1,is2 + + +c... get masses + if(widit(itypnew(1)).ge.1.d-4.and. + & widit(itypnew(2)).le.1.d-4)then +c... i1 is a broad meson + pnew(5,2)=massit(itypnew(2)) + mmin=mminit(itypnew(1)) + mo = pnew(5,2) + if(nexit.gt.2) then + do 39 j=3,nexit + mo=mo+pnew(5,j) + 39 continue + endif + + mmax=sqrts-mo + call getmas(massit(itypnew(1)),widit(itypnew(1)),itypnew(1) + & ,isoit(itypnew(1)),mmin,mmax,mo,pnew(5,1)) + + elseif(widit(itypnew(2)).ge.1.d-4 + & .and.widit(itypnew(1)).le.1.d-4)then +c... i2 is a broad meson + pnew(5,1)=massit(itypnew(1)) + mmin=mminit(itypnew(2)) + + mo = pnew(5,1) + if(nexit.gt.2) then + do 49 j=3,nexit + mo=mo+pnew(5,j) + 49 continue + endif + mmax=sqrts-mo + call getmas(massit(itypnew(2)),widit(itypnew(2)),itypnew(2) + & ,isoit(itypnew(2)),mmin,mmax,mo,pnew(5,2)) + + elseif(widit(itypnew(1)).ge.1.d-4 + & .and.widit(itypnew(2)).ge.1.d-4)then +c... i1&i2 are both broad + if(ranf(0).gt.0.5)then + mmin=mminit(itypnew(1)) + mo=mminit(itypnew(2)) + if(nexit.gt.2) then + do 59 j=3,nexit + mo=mo+pnew(5,j) + 59 continue + endif + mmax=sqrts-mo + + call getmas(massit(itypnew(1)),widit(itypnew(1)), + & itypnew(1),isoit(itypnew(1)),mmin,mmax,mo,pnew(5,1)) + + mmin=mminit(itypnew(2)) + mo=pnew(5,1) + if(nexit.gt.2) then + do 69 j=3,nexit + mo=mo+pnew(5,j) + 69 continue + endif + mmax=sqrts-mo + call getmas(massit(itypnew(2)),widit(itypnew(2)), + & itypnew(2),isoit(itypnew(2)),mmin,mmax,mo,pnew(5,2)) + + else ! of ranf.gt.0.5 + mmin=mminit(itypnew(2)) + mo=mminit(itypnew(1)) + if(nexit.gt.2) then + do 79 j=3,nexit + mo=mo+pnew(5,j) + 79 continue + endif + mmax=sqrts-mo + call getmas(massit(itypnew(2)),widit(itypnew(2)), + & itypnew(2),isoit(itypnew(2)),mmin,mmax,mo,pnew(5,2)) + + mmin=mminit(itypnew(1)) + mo=pnew(5,2) + if(nexit.gt.2) then + do 89 j=3,nexit + mo=mo+pnew(5,j) + 89 continue + endif + mmax=sqrts-mo + call getmas(massit(itypnew(1)),widit(itypnew(1)), + & itypnew(1),isoit(itypnew(1)),mmin,mmax,mo,pnew(5,1)) + + endif +c none are broad + else + pnew(5,2)=massit(itypnew(2)) + pnew(5,1)=massit(itypnew(1)) + end if + + mmax=0.d0 + do 99 j=1,nexit + mmax=mmax+pnew(5,j) + 99 continue + + if(sqrts.le.mmax)then + write(6,*)' *** error(anndex): treshold violated',sqrts-mmax + stop + end if +C +C +C two ingoing particles --> one outgoing particle (resonance) +C +C i.e. (i0=0) + else +c.... collisions: find in-branch = j + sig=0.0 + gam=0.0 +C + ii1=i1 + ii2=i2 +c for strange - nonstrange meson-meson scattering: strip sign + is=iabs(strit(i1)+strit(i2)) + if(is.ne.0.and.iabs(i1).ge.minmes.and.iabs(i2).ge.minmes) then + ii1=iabs(i1) + ii2=iabs(i2) + endif +c for meson baryon, strip sign of baryon + if(iabs(i2).le.maxbar) then + ii2=iabs(i2) + endif + +c + call getobr(btype,0,maxbr,ii1,ii2,j) + + if(j.eq.-99)return + + mmi1=mminit(i1) + mmi2=mminit(i2) +c +C next line outside the loop (compare post-QM-version: inside the loop) +C +C + ppcm=pcms(sqrts,m1,m2) +C +C Loop over different branches (resonances...) +C + do 88 i=mini,maxi + sigi(i)=0.d0 + br=branch(j,i) + gt=widit(i) + if(br*gt.lt.1d-4)goto 88 + + cgk2=fcgk(i1,i2,iz1,iz2,i) + if(br*cgk2.gt.0d0.and.sqrts.gt.mmi1+mmi2+1d-2.and. + & ppcm.gt.1d-2)then +C +C + br=fprwdt(j,i,iz1+iz2,sqrts)/fwidth(i,iz1+iz2,sqrts) + m=dabs(sqrts) + g=fwidth(i,iz1+iz2,m) + sigi(i)=dble(jit(i)+1) + / /dble((jit(i1)+1)*(jit(i2)+1)) + * *pi/ppcm**2*br + * *g*g/((m-massit(i))**2+g*g/4d0)*cgk2*cc + end if + if(sigi(i).gt.1e10)then + write(6,*)' ***error(anndec) cross section too high ' + write(6,*)'anndex(ann):',i, + , br,cgk2,fbrwig(i,iz1+iz2,sqrts,1), + , 1/pcms(sqrts,m1,m2),sigi(i) + write(6,*)m1,m2,sqrts + write(6,*)i1,i2,i + write(6,*)iz1,iz2,iz1+iz2 + end if +C +C + 88 continue +c... find outgoing resonance + call getbran(sigi,minnuc,maxmes,sig,mini,maxi,itn1) +ctp060202 108 call getbran(sigi,minnuc,maxmes,sig,mini,maxi,itn1) + + if(sig.ge.1d-10)then + itnz1=iz1+iz2 + gam=fwidth(itn1,itnz1,sqrts) + end if + +c copy created resonance into newpart arrays + itypnew(1)=itn1 + i3new(1)=itnz1 + pnew(5,1)=sqrts + + if(iabs(i1).ge.minmes.and.iabs(i2).ge.minmes) then + if(iabs(strit(i1)+strit(i2)).ne.0) then + itypnew(1)=isign(itypnew(1),i1*i2) + endif + else + itypnew(1)=isign(itypnew(1),i2) + endif + +ctp060202 3333 continue + + +C +C End of two Cases (annihilation/decay) +C +C + end if !dec/ann + + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function fbrwig(i,iz,mi,bit) +c +cinput i : resonance ID +cinput iz : $2\cdot I_3$ of resonance +cinput mi : mass of resonance +cinput bit : sign is used as option to toggle between fixed and m.dep. widths +c +c {\tt fbrwig} returns a normalized Breit-Wigner Function. +c Note, that the normalization actually only holds true for +c fixed decay widths. {\tt fbrwig}, however, uses per default +c a mass dependent width. You should divide by +c {\tt bwnorm} to obtain normalized Breit-Wigners for mass dependent +c widths also. For {\tt bit} < 0 a fixed width is used. +c +cccccCcc1ccccccccc2ccccccccc3ccccccccc4ccccccccc5ccccccccc6ccccccccc7cc + + implicit none + + integer i,iz,bit + real*8 pi,mi,g,fwidth,massit,widit + real*8 f,e,m0,g1,g2 + parameter(pi=3.1415927) + + f(e,m0,g1,g2)=0.5/pi*g1/((e-m0)**2+0.25*g2**2) + + if(bit.lt.0)then + g=widit(i) + fbrwig=f(mi,massit(i),g,g) + else + g=fwidth(i,iz,mi) + fbrwig=f(mi,massit(i),g,g) + end if + + return + end + + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine getbran(x,dmin,dmax,sumx,nmin,nmax,i) +c +c +cinput x : vector containing weights, dimension is {\tt x(dmin:dmax)} +cinput dmin : lower dimension of {\tt x} +cinput dmax : upper dimension of {\tt x} +coutput sumx : sum of elements of {\tt x} from {\tt nmin} to {\tt nmax} +cinput nmin : lower boundary for {\tt getbran} operation +cinput nmax : upper boundary for {\tt getbran} operation +coutput i : index of element which has been choosen randomly +c +c {\tt getbran} takes a vector of weights or probabilities +c {\tt x(dmin:dmax)} and sums up the elements from +c {\tt nmin} to {\tt nmax}. It then chooses randomly an element {\tt i} +c between {\tt nmin} and {\tt nmax}. The probability of +c choosing {\tt i} depends on the weights contained in {\tt x}. +c +c \danger{ {\tt i} will be undefined if {\tt sum} is less or +c equal to zero} +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + + integer i,j,nmin,nmax,dmin,dmax + real*8 x(dmin:dmax),sumx,ranf,rx,cut + parameter (cut=1d-20) + + sumx=0D0 + do 10 j=nmin,nmax + sumx=sumx+x(j) + 10 continue + if (sumx.lt.cut) then + i=nmax+1 + return + endif + + rx=sumx*ranf(0) + do 20 j=nmin,nmax + if (rx.le.x(j)) then + i=j + return + endif + rx=rx-x(j) + 20 continue + if (abs(rx).lt.1D-10) then + i=nmax + return + endif + + call error ('getbran','no channel found',rx,3) + + end + +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine getobr(x,dmin,dmax,i1,i2,i) +c +c +cinput x : array, either {\tt brtype, bmtype, bs1type} or {\tt bs2type} +cinput dmin : lower dimension of {\tt x(4,dmin:dmax)} +cinput dmin : upper dimension of {\tt x(4,dmin:dmax)} +cinput i1 : ID of first incoming particle +cinput i2 : ID of second incoming particle +coutput i : index of decay branch into {\tt i1} and {\tt i2} +c +c {\tt getobr} returns the index of the decay branch for the +c exit channel $B^* \rightarrow$ {\tt i1} + {\tt i2} +c from one of the arrays +c {\tt brtype, bmtype, bs1type} or {\tt bs2type}. This index +c is needed for the calculation of the cross section +c {\tt i1} + {\tt i2} $\rightarrow B^*$. +c +cccccCcc1ccccccccc2ccccccccc3ccccccccc4ccccccccc5ccccccccc6ccccccccc7cc + implicit none + integer i,j,i1,i2,dmin,dmax,x(4,dmin:dmax) + + do 108 j=dmin,dmax + if((x(1,j).eq.i1.and.x(2,j).eq.i2.and.x(3,j).eq.0).OR. + & (x(1,j).eq.i2.and.x(2,j).eq.i1.and.x(3,j).eq.0))then + i=j + return + end if + 108 continue + i=-99 + return + end + + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine normit (sigma,isigline) +c +c Revision : 1.0 +c +cinput sigma : vector with all (partial) cross sections +coutput sigma : unitarized vector with cross sections +cinput isigline : process class of cross sections +c +c {\tt normit} unitarizes the cross sections contained in the +c {\tt sigma} array. The total cross section is stored in +c {\tt sigma(0)}. The partial cross sections are unitarized +c (rescaled) such, that their sum adds up to the total cross +c section. Confidence levels can be assigned to different +c partial cross sections indicating whether they may be rescaled +c (i.e. if they are not well known) or whether they must not +c be rescaled (i.e. because they have been fitted to experimental +c data). +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + + include 'options.f' + include 'comres.f' + + real*8 sigma(0:maxpsig) + integer isigline + + integer i, npsig, restart + integer uncert(1:maxpsig) + real*8 diff, sumpart, gsumpart + real*8 newsig(0:maxpsig) + +c get the number of channels + npsig=sigmaln(1,1,isigline) +c normalize only if sigtot is not given by the sum of sigpart + if (sigmaln(2,1,isigline).gt.0) then +c copy array + do 10 i=1,npsig + uncert(i)=sigmaln(i+2,2,isigline) + 10 continue + 100 restart=0 + sumpart=0 + gsumpart=0 +c calculate the sum of all sigpart + do 20 i=1,npsig + sumpart=sumpart+sigma(i) + gsumpart=gsumpart+sigma(i)*uncert(i) + 20 continue +c difference between sigtot and the sum of sigpart + diff=sigma(0)-sumpart +c if all channels are exactly zero, there must be an error in blockres.f! + if (sumpart.eq.0.0) then + write (6,*) 'normit: Error! sumpart.eq.0' +c stop + return + endif + if (gsumpart.eq.0.0) then + do 50 i=1,npsig +c now all channels can be modified + if (uncert(i).eq.0) then +c write (6,*) 'modify channel',i + uncert(i)=1 + endif + 50 continue +c restart calculation + goto 100 + endif + do 60 i=1,npsig +c rescale channels + newsig(i)=sigma(i)+uncert(i)*diff*sigma(i)/gsumpart +c if a channel is negative... + if (newsig(i).lt.0) then +c set it to zero and restart + sigma(i)=0.0 + restart=1 + endif + 60 continue + if (restart.eq.1) goto 100 +c copy new values to sigma + do 70 i=1,npsig + sigma(i)=newsig(i) + 70 continue + endif + + if (CTOption(7).eq.1.and.sigma(2).gt.1d-10) then + sigma(1)=0d0 + endif + if (CTOption(7).eq.-1) then + do 80 i=2,npsig + sigma(i)=0d0 + 80 continue + end if + + return + end + + + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function fwidth(ir,izr,m) +c +cinput ir : resonance ID +cinput izr : $2\cdot I_3$ of resonance +cinput m : mass of resonance +c +c {\tt fwidth} returns the mass-dependent total decay width +c of the resonance {\tt ir}. +c +c +C####C##1#########2#########3#########4#########5#########6#########7## + + implicit none + + include 'comres.f' + include 'comwid.f' + include 'options.f' + + integer i,ir,izr,mm,mp,ires + real*8 gtot,m,widit,splint + real*8 minwid, fprwdt + + if (CTOption(1).ne.0) then + fwidth=widit(ir) + return + endif + if (wtabflg.gt.0.and.CTOption(33).eq.0) then + ires=iabs(ir) + minwid=min(widit(ir),1D-8) + if (ires.ge.minbar.and.ires.le.maxbar) then !baryons +c widths are continued horicontally outside the spline region + if(m.le.maxtab2)then + fwidth=max(splint(tabx(1),fbtaby(1,ires,1), + . fbtaby(1,ires,2),widnsp,m),minwid) + else + fwidth=max(splint(tabx(1),fbtaby(1,ires,1), + . fbtaby(1,ires,2),widnsp,maxtab2),minwid) + endif + else if (ires.ge.minmes.and.ires.le.maxmes) then !mesons +c widths are continued horicontally outside the spline region + if(m.le.maxtab2)then + fwidth=max(splint(tabx(1),fmtaby(1,ires,1), + . fmtaby(1,ires,2),widnsp,m),minwid) + else + fwidth=max(splint(tabx(1),fmtaby(1,ires,1), + . fmtaby(1,ires,2),widnsp,maxtab2),minwid) + endif + else + write (6,*) '*** error(fwidth) wrong itype:',ir + fwidth=0 + endif + else + call brange(ir,mm,mp) + gtot=0d0 + if(mp.gt.0)then + do 27 i=mm,mp + gtot=gtot+fprwdt(i,ir,izr,m) + 27 continue + end if + fwidth=gtot !*widit(ir) + end if + + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function fprwdt(i,ir,izr,mi) +c +cinput i : decay branch +cinput ir : resonance ID +cinput izr : $2\cdot I_3$ of resonance +cinput mi : mass of resonance +c +c {\tt fprwdt} returns the mass dependent partial decay width +c of the decay channel {\tt i}. +c +C####C##1#########2#########3#########4#########5#########6#########7## + + implicit none + real*8 m,br,bi,mir,g,mi + integer i,ir,izr,i1,i2,i3,i4 + real*8 widit,fbrancx,mminit,massit + + call b3type(ir,i,bi,i1,i2,i3,i4) + m=dabs(mi) + g=0d0 + mir=massit(ir) + if(bi.gt.1d-9.and.mir.gt.mminit(i1)+mminit(i2))then + br=fbrancx(i,ir,izr,m,bi,i1,i2,i3,i4) +c write(6,*)' ',bi,gi,widit(ir) + g=br*widit(ir) + end if + fprwdt=g + return + end + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + real*8 function fbrancx(i,ir,izr,em,bi,b1,b2,b3,b4) +c +cinput i : decay branch +cinput ir : ID of resonance +cinput em : actual mass of resonance +cinput bi : branching ration at peak +cinput b1 : itype of 1st outgoing particle +cinput b2 : itype of 2nd outgoing particle +cinput b3 : itype of 3rd outgoing particle +cinput b4 : itype of 4th outgoing particle +c +c {\tt fbrancx} returns the mass dependent branching ratio for +c the decay channel {\tt i} of resonance {\tt ir}. This +c branching ratio is NOT normalized. To extract the mass dependent +c decay width, use {\tt fprwdt}. +c +c {\tt fbrancx} =$ +c \left( \Gamma^{i,j}_{R} \frac{M_{R}}{M} +c \left( \frac{\langle p_{i,j}(M) \rangle} +c {\langle p_{i,j}(M_{R}) \rangle} \right)^{2l+1} +c \frac{1.2}{1+ 0.2 +c \left( \frac{\langle p_{i,j}(M) \rangle} +c {\langle p_{i,j}(M_{R}) \rangle} \right)^{2l} } +c \right) $ +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + implicit none + real*8 kdiv1,kdiv2,em,b,mmin,mn,m1m,m2m + real*8 bi,minwid + real*8 fbran,splint,splintth,pmean + integer i,ires,ir,izr,b1,b2,b3,b4 + include 'comres.f' + include 'comwid.f' + include 'options.f' + + real*8 mminit,massit + integer isoit,flbr,ipwr,ipwr1 + + ires=iabs(ir) + + if(iabs(izr).gt.isoit(ires))then + fbrancx=0d0 + return + end if + + if(CTOption(8).ne.0)then + fbrancx=bi + return + end if + + m1m=mminit(b1) + m2m=mminit(b2) +c in case of three or four particle decays put masses in m2m + if(b3.ne.0) m2m=m2m+mminit(b3) + if(b4.ne.0) m2m=m2m+mminit(b4) + mn=massit(ires) ! nominal mass + mmin= m1m+m2m ! minimal mass of resonance + + if (wtabflg.ge.2.and.CTOption(33).eq.0) then + minwid=min(fbran(i,ires),1D-8) + if (ires.ge.minbar.and.ires.le.maxbar) then !baryons +c branching ratios are continued horicontally outside the spline region + if(em.le.maxtab2)then + b=max(splintth(tabx,pbtaby(1,1,ires,i), + . pbtaby(1,2,ires,i),widnsp,em,mmin),minwid) + else + b=max(splintth(tabx,pbtaby(1,1,ires,i), + . pbtaby(1,2,ires,i),widnsp,maxtab2,mmin),minwid) + endif + else if (ires.ge.minmes.and.ires.le.maxmes) then !mesons + if (em.le.maxtab2) then +c branching ratios are continued horicontally outside the spline region + b=max(splint(tabx,pmtaby(1,1,ires,i), + . pmtaby(1,2,ires,i),widnsp,em),minwid) + else + b=max(splint(tabx,pmtaby(1,1,ires,i), + . pmtaby(1,2,ires,i),widnsp,maxtab2),minwid) + endif + else + write (6,*) '*** error(fbrancx) wrong id:',ir + b=0 + endif + else + b=0d0 + if (bi.gt.0.and.em.gt.mmin.and.mn.gt.mmin) then + + ipwr=flbr(i,ires) + ipwr1=ipwr+1 + +c determine expectation values of outgoing masses +c call of pmean with -99 instead of iso3 to ensure usage of fixed +c resonance widths: 5% error, but avoids recursion via call +c to fwidth from pmean + if(CTOption(33).ne.0)then + kdiv1=pmean(em,b1,-99,b2,-99,b3,-99,b4,-99,ipwr1)/ + & pmean(mn,b1,-99,b2,-99,b3,-99,b4,-99,ipwr1) + kdiv2=pmean(em,b1,-99,b2,-99,b3,-99,b4,-99,ipwr)/ + & pmean(mn,b1,-99,b2,-99,b3,-99,b4,-99,ipwr) + else + kdiv1=pmean(em,b1,isoit(b1),b2,isoit(b2), + & b3,isoit(b3),b4,isoit(b4),ipwr1)/ + & pmean(mn,b1,isoit(b1),b2,isoit(b2), + & b3,isoit(b3),b4,isoit(b4),ipwr1) + kdiv2=pmean(em,b1,isoit(b1),b2,isoit(b2), + & b3,isoit(b3),b4,isoit(b4),ipwr)/ + & pmean(mn,b1,isoit(b1),b2,isoit(b2), + & b3,isoit(b3),b4,isoit(b4),ipwr) + end if + b=bi*mn/em*kdiv1*1.2/(1.+0.2*kdiv2) + else + b=0. + end if + end if + fbrancx=b + return + end + diff --git a/Processes/UrQMD/blockres.f b/Processes/UrQMD/blockres.f new file mode 100644 index 0000000000000000000000000000000000000000..fa6357301152c284ca1f328a25edcadcc71e3b30 --- /dev/null +++ b/Processes/UrQMD/blockres.f @@ -0,0 +1,1033 @@ +c $Id: blockres.f,v 1.19 2003/06/29 14:26:35 weber Exp $ + blockdata setres +cc itypes: 100 g, 101 pi, 102 eta, 103 om, 104 rho, 105 f_0(1370) +cc 106 K, 107 eta', 108 K*, 109 phi, +cc 0++ 110 k_0*(1430), 111 a_0(980), 112 f_0(1370) +cc 1++ 113 k_1(1270), 114 a_1(1260), 115 f_1(1285), 116 f_1(1420), +cc 2++ 117 k_2(1430), 118 a_2(1320), 119 f_2(1270), 120 f_2'(1525) +cc 1+- 121 K_1(1400), 122 b_1(1235), 123 h_1(1170), 124 h_1'(1380) +cc 1-- 125 K*(1410), 126 rho(1465), 127 om(1419), 128 phi(1680), +cc 1-- 129 K*(1680), 130 rho(1700), 131 om(1662), 132 phi?(1900) +cc +cc (see 'Review of Particle Properties' Phys. Rev. D50 (1994) +cc Phys. Rev. D54 (1996) and Eur. Phys. J. C3 (1998)) +cc + implicit none + include 'comres.f' + integer i, j, k + +c set a string for the what and ident tools + data versiontag/'@(#)$UrQMD: Version 1.3b (10035/10002) $'/ +c channels, branching ratios, angular momentum of branches, +c etc. +c ALL of the beyond is sensitive to the parameters defined in comres.f + + data massres/0.938, +c Nucleon resonances + @ 1.440,1.515,1.550,1.645,1.675,1.680, + @ 1.730,1.710,1.720,1.850,1.950,2.000, 2.150, + @ 2.220,2.250, +c Delta (and resonances)(Particle Data Group) +c @ 1.232,1.600,1.620,1.700,1.900,1.905, +c @ 1.910,1.920,1.930,1.950, +c Delta (and resonances) + @ 1.232,1.700,1.675,1.750,1.840,1.880, + @ 1.900,1.920,1.970,1.990, +c Lambda (and resonances) + @ 1.116,1.407,1.520,1.600,1.670,1.690, + @ 1.800,1.810,1.820,1.830,1.890,2.100, + @ 2.110, +c Sigma (and resonances) + @ 1.192,1.384,1.660,1.670,1.750,1.775, + @ 1.915,1.940,2.030, +c Xi (and resonances) + @ 1.315,1.532,1.700,1.823,1.950,2.025, +c @ 1.315,1.532,1.690,1.823,1.950,2.025, +c Omega + @ 1.672/ + + data widres/ 0.d0, +c Nucleon resonances + @ 0.350,0.120,0.140,0.160,0.140,0.120, + @ 0.120,0.140,0.150,0.500,0.550,0.350,0.500, + @ 0.550,0.470, +c Delta (and resonances)(Particle-Data-Group) +c @ 0.120,0.350,0.150,0.300,0.200,0.350, +c @ 0.250,0.200,0.350,0.300, +c Delta (and resonances) + @ 0.115,0.350,0.160,0.350,0.260,0.350, + @ 0.250,0.200,0.350,0.350, +c Lambda (and resonances) + @ 0.,0.050,0.016,0.150,0.035,0.060, + @ 0.300,0.150,0.080,0.095,0.100,0.200, + @ 0.200, +c Sigma (and resonances) + @ 0.,0.036,0.100,0.060,0.090,0.120, + @ 0.120,0.220,0.180, +c Xi (and resonances) + @ 0.,0.009,0.05,0.024,0.06,0.02, +c Omega + @ 0./ + + data massmes/ +c g pi eta omega rho f_0(980) K + & 0.000, 0.138, 0.547, 0.782, 0.769, 0.990, 0.494, +c eta' K* phi + @ 0.958, 0.893, 1.019, +c 0++ scalar k_0*(1430), a_0(980), f_0(1370) + @ 1.429, .990, 1.370, +c 1++ k_1(1270),a_1(1260),f_1(1285),f_1(1420) + @ 1.273, 1.230, 1.282, 1.426, +c 2++ tensor k_2*(1430),a_2(1320),f_2(1270),f_2'(1525) + @ 1.430, 1.318, 1.275, 1.525, +c 1+- K_1(1400) b1 h1 h1' + @ 1.400, 1.235, 1.170, 1.386, +c 1-- K rho omega phi + & 1.410,1.465,1.419,1.681, + & 1.680,1.720,1.649,1.910/ + + data widmes / +c g pi eta omega rho f_0(980) K + & 0.0, 0.0, 0.0, 8.43e-3 ,0.151, 0.1, 0.0, +c eta' K* phi + @ 0.201e-3, 50.e-3, 4.43e-3, +c 0++ scalar k_0*(1430), a_0(980), f_0(1370) + @ .287, .100, .200, +c 1++ pseudo-vector k_1(1270),a_1(1260),f_1(1285),f_1(1420) + @ .090, .400, .024, .055, +c 2++ tensor k_2*(1430),a_2(1320),f_2(1270),f_2'(1525) + @ .100, .107, .185, .076, +c 1+- k1(1400) b1 h1 h1* + @ 0.174, 0.142, 0.36, 0.09, +c 1-- K rho omega phi + & 0.227, 0.310, 0.174, 0.150, + & 0.323, 0.240, 0.220, 0.090/ + +c Spins of resonances and mesons (multiplied by two): + + data Jres/ 1, + @ 1, 3, 1, 1, 5, 5, + @ 3, 1, 3, 3, 7, 3, 7, + @ 9, 9, + D 3, 3, 1, 3, 1, 5, + @ 1, 3, 5, 7, + L 1, 1, 3, 1, 1, 3, + @ 1, 1, 5, 5, 3, 7, 5, + S 1, 3, 1, 3, 1, 5, + @ 5, 3, 7, + X 1, 3, 3, 3, 3, 5, + O 3 / + + data Jmes/ 2,0,0,2,2,0,0,0,2,2,0,0,0,2,2,2,2,4,4,4,4,2,2,2,2, +c 1-- + & 2,2,2,2,2,2,2,2/ + +c Parities of resonances and mesons: + + data Pares/ 1, + @ 1, -1, -1, -1, -1, 1, + @ -1, 1, 1, 1, 1, -1, -1, + @ 1, -1, + D 1, 1, -1, -1, -1, 1, + @ 1, 1, -1, 1, + L 1, -1, -1, 1, -1, -1, + @ -1, 1, 1, -1, 1, -1, 1, + S 1, 1, 1, -1, -1, -1, + @ 1, -1, 1, +c some Xi parities are unknown ? ? ? + X 1, 1, 1, -1, 1, 1, + O 1 / + +c g pi et om rh si k et k* ph k0* a0 f0 k1 a1 f1 f1* + data Pames/ -1,-1,-1,-1,-1, 1,-1,-1,-1,-1, 1, 1, 1, 1, 1, 1, 1, +c k2 a2 f2* f2' k1 b1 h1 h1* rh* rh* om* om* + & 1, 1, 1, 1, 1, 1, 1, 1, +c 1-- (incl. rh* rh* om* om*) + & -1, -1, -1, -1, -1, -1, -1, -1/ + +c + +c Isospins of resonances and mesons (multiplied by two) + + data Isores/ 1, + @ 1,1,1,1,1,1,1,1,1,1,1,1,1,1,1, + d 3,3,3,3,3,3,3,3,3,3, + l 0,0,0,0,0,0,0,0,0,0,0,0,0, + s 2,2,2,2,2,2,2,2,2, + x 1,1,1,1,1,1, + o 0/ + data Isomes/ 0,2,0,0,2,0,1,0,1,0,1,2,0,1,2,0,0,1,2,0,0,1,2,0,0, +c 1-- + & 1,2,0,0,1,2,0,0/ +c & 2,2,0,0/ + +c strres gives the number of strange quarks for baryons +c (switch sign for anti-part.) + data strres/ 26*0,13*1,9*1,6*2,3/ +c strmes gives the number of strange quarks for mesons +c (switch sign for anti-part.) + data strmes/ 6*0,-1,0,-1,0,-1,0,0,-1,0,0,0,-1,0,0,0,-1,0,0,0, +c 1-- + & -1,0,0,0,-1,0,0,0/ +c & 0,0,0,0/ + + +c meson id's sorted by multipletts + data mlt2it/ + & 101, 106, 102, 107, + & 104, 108, 103, 109, + & 111, 110, 105, 112, + & 114, 113, 115, 116, + & 118, 117, 119, 120, + & 122, 121, 123, 124, + & 126, 125, 127, 128, + & 130, 129, 131, 132/ + + +c the decay branches have different angular momentum +C gN,piN,etN,omN,rhN,pipiN,piD,piN*,KL,KS,f0N,a0N +c now some n*'s + data lbr/ + & 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, + & 0, 2, 2, 0, 0, 2, 0, 2, 2, 2, 1, 1, + & 0, 0, 0, 0, 0, 0, 2, 0, 0, 0, 1, 1, + & 0, 0, 0, 0, 0, 0, 2, 0, 0, 0, 1, 1, + & 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 3, 3, + & 1, 3, 3, 1, 1, 3, 1, 3, 3, 3, 2, 2, + & 0, 2, 2, 0, 0, 2, 0, 2, 2, 2, 1, 1, + & 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, + & 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 2, 2, + & 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 2, 2, + & 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, 4, 4, + & 0, 2, 2, 0, 0, 2, 0, 2, 2, 2, 1, 1, + & 2, 4, 4, 2, 2, 4, 2, 4, 4, 4, 3, 3, + & 3, 5, 5, 3, 3, 5, 3, 5, 5, 5, 4, 4, + & 4, 4, 4, 4, 4, 4, 4, 4, 4, 4, 5, 5, + + +c d,d* + & 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 2, 2, + & 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 2, 2, + & 0, 0, 0, 0, 0, 0, 2, 0, 0, 0, 1, 1, + & 0, 2, 2, 0, 0, 2, 0, 2, 2, 2, 1, 1, + & 0, 0, 0, 0, 0, 0, 2, 0, 0, 0, 1, 1, + & 1, 3, 3, 1, 1, 3, 1, 3, 3, 3, 2, 2, + & 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, + & 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 2, 2, + & 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 3, 3, + & 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, 4, 4/ + + + data lbs1/ +c orbital angular momentum of decays (baryons with s=1) +c _ _ _ +c NK NK892 Sipi Si*pi gLa etLa omLa Lapi etSi La*pi DelK +c lambda*'s + & 0, 0, 0, 2, 0, 0, 0, 0, 0, 1, 2, + & 2, 0, 2, 0, 0, 2, 0, 2, 2, 1, 0, + & 1, 1, 1, 1, 1, 1, 1, 1, 1, 2, 1, + & 0, 0, 0, 2, 0, 0, 0, 0, 0, 1, 2, + & 2, 0, 2, 0, 0, 2, 0, 2, 2, 1, 0, + & 0, 0, 0, 2, 0, 0, 0, 0, 0, 1, 2, + & 1, 1, 1, 1, 1, 1, 1, 1, 1, 2, 1, + & 3, 1, 3, 1, 1, 3, 1, 3, 3, 2, 1, + & 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 2, + & 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, + & 4, 2, 4, 2, 2, 4, 2, 4, 4, 3, 2, + & 3, 1, 3, 1, 1, 3, 1, 3, 3, 2, 1, +c sigma's + & 1, 1, 1, 1, 1, 1, 1, 1, 1, 2, 1, + & 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 1, + & 1, 1, 1, 1, 1, 1, 1, 1, 1, 2, 1, + & 2, 0, 2, 0, 0, 2, 0, 2, 2, 1, 0, + & 0, 0, 0, 2, 0, 0, 0, 0, 0, 1, 2, + & 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 2, + & 3, 1, 3, 1, 1, 3, 1, 3, 3, 2, 1, + & 2, 0, 2, 0, 0, 2, 0, 2, 2, 1, 0, + & 3, 3, 3, 3, 3, 3, 3, 3, 3, 2, 3/ + + + data lbs2/ +c orbital angular momentum of decays (baryons with s=2) + & 1, 1, 1, 1, + & 1, 1, 1, 1, + & 2, 0, 2, 2, + & 1, 1, 1, 1, + & 3, 1, 3, 3/ + + data lbm/ +c orbital angular momentum of meson decays +c (9 stands for 'forbidden', branching ratio should be zero!) +C gg gpi grho gome geta gK 2pi pirho pisi pieta sisi +c 0 1 2 3 4 5 6 7 8 9 10 +c rhet etsig 2rho rhom 2eta KK KK* Kpi K*pi Krho kome K*K ompi +c 11 12 13 14 15 16 17 18 19 20 21 22 23 +c +C gg gpi grho gome geta gK 2pi pirho 3pi pieta 4pi KK* K*K +c 0 1 2 3 4 5 6 7 8 9 10 11 12 +c et2pi etrho rho2pi om2pi 2eta KK 2Kpi Kpi K*pi Krho kom K*2pi ompi +c 13 14 15 16 17 18 19 20 21 22 23 24 25 +c 8 10 121314 1617 19 23 + & 1,1,1,1,1,1,9,1,9,9,9,1,1,9,1,1,1,9,9,9,9,1,1,1,1,1, !101 + & 1,1,1,1,1,1,9,1,9,9,9,1,1,9,1,1,1,9,9,9,9,1,1,1,1,1, !102 + & 1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1, !103 + & 1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1, !104 + & 0,9,0,0,9,9,0,9,0,0,0,9,9,0,9,9,9,0,0,0,0,9,9,9,9,9, !105 + & 1,1,1,1,1,1,9,1,9,9,9,1,1,9,1,1,1,9,9,9,9,1,1,1,1,1, !106 + & 1,1,1,1,1,1,9,1,9,9,9,1,1,9,1,1,1,9,9,9,9,1,1,1,1,1, !107 + & 1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1, !108 + & 1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1, !109 +c 0++ +c 8 10 121314 1617 19 23 + & 0,9,0,0,9,9,0,9,0,0,0,9,9,0,9,9,9,0,0,0,0,9,9,9,9,9, !110 + & 0,9,0,0,9,9,0,9,0,0,0,9,9,0,9,9,9,0,0,0,0,9,9,9,9,9, + & 0,9,0,0,9,9,0,9,0,0,0,9,9,0,9,9,9,0,0,0,0,9,9,9,9,9, +c 1++ + & 0,0,0,0,0,0,9,0,9,9,9,0,0,9,0,0,0,9,9,9,9,0,0,0,0,0, + & 0,0,0,0,0,0,9,0,9,9,9,0,0,9,0,0,0,9,9,9,9,0,0,0,0,0, + & 0,0,0,0,0,0,9,0,9,9,9,0,0,9,0,0,0,9,9,9,9,0,0,0,0,0, + & 0,0,0,0,0,0,9,0,9,9,9,0,0,9,0,0,0,9,9,9,9,0,0,0,0,0, +c 2++ + & 0,2,0,0,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2, + & 0,2,0,0,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2, + & 0,2,0,0,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2, + & 0,2,0,0,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2, +c 1+- +C gg gpi grho gome geta gK 2pi pirho pisi pieta sisi +c 0 1 2 3 4 5 6 7 8 9 10 +c rhet etsig 2rho rhom 2eta KK KK* Kpi K*pi Krho kome K*K ompi +c 11 12 13 14 15 16 17 18 19 20 21 22 23 +c +C gg gpi grho gome geta gK 2pi pirho 3pi pieta 4pi KK* K*K +c 0 1 2 3 4 5 6 7 8 9 10 11 12 +c et2pi etrho rho2pi om2pi 2eta KK 2Kpi Kpi K*pi Krho kom K*2pi ompi +c 13 14 15 16 17 18 19 20 21 22 23 24 25 +c 8 10 121314 1617 19 23 + & 0,0,0,0,0,0,9,0,9,9,9,0,0,9,0,0,0,9,9,9,9,0,0,0,0,0, + & 0,0,0,0,0,0,9,0,9,9,9,0,0,9,0,0,0,9,9,9,9,0,0,0,0,0, + & 0,0,0,0,0,0,9,0,9,9,9,0,0,9,0,0,0,9,9,9,9,0,0,0,0,0, + & 0,0,0,0,0,0,9,0,9,9,9,0,0,9,0,0,0,9,9,9,9,0,0,0,0,0, +c 1-- + & 1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1, + & 1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1, + & 1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1, + & 1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1, +c 1-- + & 1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1, + & 1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1, + & 1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1, + & 1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1/ + + + data branres/ + +Channels: gN piN etN omN rhN pipiN piD piN* KL KS f0N a0N +c n* resonances + a 4d-4, .65, .00, .00, .00, .10, .25, .00, .00, .00, .00, .00, !1440 + b 45d-4, .60, .00, .00, .15, .05, .20, .00, .00, .00, .00, .00, !1520 + c 45d-4, .60, .30, .00, .00, .05, .00, .05, .00, .00, .00, .00, !1535 + d 1d-3 , .60, .06, .00, .00, .10, .10, .05, .07, .02, .00, .00, !1650 + e 5d-5 , .40, .00, .00, .00, .00, .55, .05, .00, .00, .00, .00, !1675 + f 21d-4, .60, .00, .00, .00, .20, .15, .05, .00, .00, .00, .00, !1680 + g 1d-4 , .05, .15, .00, .05, .30, .40, .05, .00, .00, .00, .00, !1700 + h 0., .16, .15, .00, .05, .26, .20, .10, .05, .03, .00, .00, !1710 + i 1d-4 , .10, .00, .00, .80, .05, .00, .00, .03, .02, .00, .00, !1720 + j 0., .30, .00, .55, .15, .00, .00, .00, .00, .00, .00, .00, !1900 + k 0., .12, .00, .00, .43, .19, .14, .05, .03, .00, .04, .00, !1990 + l 0., .45, .10, .10, .20, .05, .10, .00, .00, .00, .00, .00, !2080 + m 0., .35, .00, .05, .30, .10, .15, .05, .00, .00, .00, .00, !2190 + n 0., .35, .00, .00, .25, .20, .20, .00, .00, .00, .00, .00, !2220 + o 0., .30, .00, .00, .25, .20, .20, .05, .00, .00, .00, .00, !2250 +c delta resonances + a 6d-3, 1.0, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, !1232 + b 0., .10, .00, .00, .00, .00, .65, .25, .00, .00, .00, .00, !1600 + c 4d-4, .15, .00, .00, .05, .00, .65, .15, .00, .00, .00, .00, !1620 + d 2d-3, .20, .00, .00, .25, .00, .55, .00, .00, .00, .00, .00, !1700 + e 0., .25, .00, .00, .25, .00, .25, .25, .00, .00, .00, .00, !1900 + f 3d-4, .18, .00, .00, .80, .00, .02, .00, .00, .00, .00, .00, !1905 + g 0., .30, .00, .00, .10, .00, .35, .25, .00, .00, .00, .00, !1910 + h 0., .27, .00, .00, .00, .00, .40, .30, .00, .03, .00, .00, !1920 + i 0., .22, .00, .00, .05, .00, .40, .30, .00, .03, .00, .00, !1930 + j 15d-3, .38, .00, .00, .00, .00, .34, .24, .00, .00, .00, .04/ !1950 + + + data branbs1/ +c...the branching ratios for unstable baryons with strangeness -1: +channels: _ _ _ +c NK NK892 Sipi Si*pi gLa etLa omLa Lapi etSi La*pi DelK +c lambda*'s + @ .00, .00,1.00, .00, .00, .00, .00, .00, .00, .00, .00, + @ .45, .00, .43, .11,.008, .00, .00, .00, .00, .00, .00, + @ .35, .00, .65, .00, .00, .00, .00, .00, .00, .00, .00, + @ .20, .00, .50, .00, .00, .30, .00, .00, .00, .00, .00, + @ .25, .00, .45, .30, .00, .00, .00, .00, .00, .00, .00, + @ .40, .20, .20, .20, .00, .00, .00, .00, .00, .00, .00, + @ .35, .45, .15, .05, .00, .00, .00, .00, .00, .00, .00, + @ .65, .00, .14, .10, .00, .00, .00, .00, .00, .00, .00, + @ .10, .00, .70, .20, .00, .00, .00, .00, .00, .00, .00, + @ .35, .20, .10, .30, .00, .00, .00, .00, .00, .00, .00, + @ .35, .20, .05, .30, .00, .02, .08, .00, .00, .00, .00, + @ .25, .45, .30, .00, .00, .00, .00, .00, .00, .00, .00, +c sigma's ! stable particles shoud add to zero! + @ .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, + @ .00, .00, .12, .00, .00, .00, .00, .88, .00, .00, .00, + @ .30, .00, .35, .00, .00, .00, .00, .35, .00, .00, .00, + @ .15, .00, .70, .00, .00, .00, .00, .15, .00, .00, .00, + @ .40, .00, .05, .00, .00, .00, .00, .00, .55, .00, .00, + @ .40, .00, .04, .10, .00, .00, .00, .23, .00, .23, .00, + @ .15, .00, .40, .05, .00, .00, .00, .40, .00, .00, .00, + @ .10, .15, .15, .15, .00, .00, .00, .15, .00, .15, .15, + @ .20, .04, .10, .10, .00, .00, .00, .20, .00, .18, .18/ + + data branbs2/ +c...the branching ratios for unstable baryons with strangeness -2: +channels: _ _ +c Xipi Xigamma LaK SigK +c Xi's + @ .98, .02, 0., 0., + @ .10, .00, .70, .20, + @ .15, .00, .70, .15, + @ .20, .00, .40, .20, + @ .10, .00, .20, .70/ + + + data branmes / +C gg gpi grho gome geta gK 2pi pirho 3pi pieta 4pi KK* K*K +c 0 1 2 3 4 5 6 7 8 9 10 11 12 +c et2pi etrho rho2pi om2pi 2eta KK 2Kpi Kpi K*pi Krho kom K*2pi ompi +c 13 14 15 16 17 18 19 20 21 22 23 24 25 +c pion + a 1.00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, +c eta + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, +c omega + a .00, .09, .00, .00, .00, .00, .02, .00, .89, .00, .00, .00, .00, + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, +c rho(770) + a .00, .00, .00, .00, .00, .00,1.00, .00, .00, .00, .00, .00, .00, + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, +c f_0(980) + a .00, .00, .00, .00, .00, .00, .70, .00, .00, .00, .00, .00, .00, + a .00, .00, .00, .00, .00, .30, .00, .00, .00, .00, .00, .00, .00, +c kaon + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, +c eta' + a .02, .00, .30, .03, .00, .00, .00, .00, .00, .00, .00, .00, .00, + a .65, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, +c K*(892) + a .00, .00, .00, .00, .00,.003, .00, .00, .00, .00, .00, .00, .00, + a .00, .00, .00, .00, .00, .00, .00,1.00, .00, .00, .00, .00, .00, +c phi + a .00, .00, .00, .00, .01, .00, .00, .13, .02, .00, .00, .00, .00, + a .00, .00, .00, .00, .00, .84, .00, .00, .00, .00, .00, .00, .00, +c K_0(1430) + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, + a .00, .00, .00, .00, .00, .00, .00,1.00, .00, .00, .00, .00, .00, +c a_0(980) + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .90, .00, .00, .00, + a .00, .00, .00, .00, .00, .10, .00, .00, .00, .00, .00, .00, .00, +c f_0(1370) + a .00, .00, .00, .00, .00, .00, .10, .00, .00, .00, .70, .00, .00, + a .00, .00, .00, .00, .00, .20, .00, .00, .00, .00, .00, .00, .00, +C gg gpi grho gome geta gK 2pi pirho 3pi pieta 4pi KK* K*K +c 0 1 2 3 4 5 6 7 8 9 10 11 12 +c et2pi etrho rho2pi om2pi 2eta KK 2Kpi Kpi K*pi Krho kom K*2pi ompi +c 13 14 15 16 17 18 19 20 21 22 23 24 25 +c K_1(1270) + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, + a .00, .00, .00, .00, .00, .00, .00, .00, .47, .42, .11, .00, .00, +c a_1(1260) + a .00, .10, .00, .00, .00, .00, .00, .90, .00, .00, .00, .00, .00, + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, +c f_1(1285) + a .00, .00, .05, .00, .00, .00, .00, .00, .00, .00, .33, .00, .00, + a .53, .00, .00, .00, .00, .00, .09, .00, .00, .00, .00, .00, .00, +c f_1(1420) + a .00, .00, .00, .00, .00, .00, .00, .00, .04, .00, .00, .48, .48, + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, +c k_2(1430) + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, + a .00, .00, .00, .00, .00, .00, .00, .50, .25, .09, .03, .13, .00, +c a_2(1320) + a .00, .00, .00, .00, .00, .00, .00, .70, .00, .14, .00, .00, .00, + a .00, .00, .00, .11, .00, .05, .00, .00, .00, .00, .00, .00, .00, +c f_2(1270) + a .00, .00, .00, .00, .00, .00, .50, .00, .00, .00, .30, .00, .00, + a .00, .00, .00, .00, .00, .20, .00, .00, .00, .00, .00, .00, .00, +c f_2'(1525) + a .00, .00, .00, .00, .00, .00, .01, .00, .00, .00, .00, .00, .00, + a .00, .00, .00, .00, .10, .89, .00, .00, .00, .00, .00, .00, .00, +C gg gpi grho gome geta gK 2pi pirho 3pi pieta 4pi KK* K*K +c 0 1 2 3 4 5 6 7 8 9 10 11 12 +c et2pi etrho rho2pi om2pi 2eta KK 2Kpi Kpi K*pi Krho kom K*2pi ompi +c 13 14 15 16 17 18 19 20 21 22 23 24 25 +c 1+- +c K_1(1400) + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, + a .00, .00, .00, .00, .00, .00, .00, .00, .96, .03, .01, .00, .00, +c b_1(1235) + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, + a .00, .10, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .90, +c h_1(1170) + a .00, .00, .00, .00, .00, .00, .00, .90, .10, .00, .00, .00, .00, + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, +c h_1'(1380) + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .50, .50, + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, +C gg gpi grho gome geta gK 2pi pirho 3pi pieta 4pi KK* K*K +c 0 1 2 3 4 5 6 7 8 9 10 11 12 +c et2pi etrho rho2pi om2pi 2eta KK 2Kpi Kpi K*pi Krho kom K*2pi ompi +c 13 14 15 16 17 18 19 20 21 22 23 24 25 +c 1-- +c K*(1410) + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, + a .00, .00, .00, .00, .00, .00, .00, .30, .65, .05, .00, .00, .00, +c rho(1450) + a .00, .00, .00, .00, .00, .00, .50, .00, .00, .00, .50, .00, .00, + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, +c om(1420) + a .00, .00, .00, .00, .00, .00, .00,1.00, .00, .00, .00, .00, .00, + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, +c phi(1680) + a .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, .40, .40, + a .00, .00, .00, .00, .00, .10, .10, .00, .00, .00, .00, .00, .00, +C gg gpi grho gome geta gK 2pi pirho 3pi pieta 4pi KK* K*K +c 0 1 2 3 4 5 6 7 8 9 10 11 12 +c et2pi etrho rho2pi om2pi 2eta KK 2Kpi Kpi K*pi Krho kom K*2pi ompi +c 13 14 15 16 17 18 19 20 21 22 23 24 25 +c 1-- +c K*(1680) + a .00, .00, .00, .00, .00,.003, .00, .00, .00, .00, .00, .00, .00, + a .00, .00, .00, .00, .00, .00, .00, .40, .30, .30, .00, .00, .00, +c rho(1700) + a .00, .00, .00, .00, .00, .00, .20, .00, .00, .00, .10, .00, .00, + a .00, .00, .70, .00, .00, .00, .00, .00, .00, .00, .00, .00, .00, +c om(1600) + a .00, .00, .00, .00, .00, .00, .00, .50, .00, .00, .00, .00, .00, + a .00, .00, .00, .50, .00, .00, .00, .00, .00, .00, .00, .00, .00, +c phi(1900) + a .00, .00, .00, .00, .00, .00, .20, .00, .00, .00, .00, .00, .00, + a .00, .00, .00, .00, .10, .70, .00, .00, .00, .00, .00, .00, .00 + a / +C gg gpi grho gome geta gK 2pi pirho 3pi pieta 4pi KK* K*K +c 0 1 2 3 4 5 6 7 8 9 10 11 12 +c et2pi etrho rho2pi om2pi 2eta KK 2Kpi Kpi K*pi Krho kom K*2pi ompi +c 13 14 15 16 17 18 19 20 21 22 23 24 25 + +c minimal masses of mesons +c g pi eta om rh f0 k + data mmesmn/0.0,0.138,0.547,0.276,0.276,0.276,0.495, +c eta', k*, phi,k_0*, a_0,f_0 + a 0.278,0.636,.414,.636,0.685,0.276, +c k1 a1 f1 f1 k2* a2* f2 f2' + a 0.774, 0.414, 0.276,1.272,0.636,0.414,0.276,.990, +c 1+- + & 0.774,0.556,0.417,1.272, +c 1-- + & 0.636, 0.278, 0.414, 0.990, + & 0.636, 0.278, 0.414, 0.990/ + + data bmtype/ +c for each branch you have itype1(M),itype2(M),itype3(M),itype4(M) +c in case of resonances in the exit-channel, maximum two are allowed +c which must be listed as the first two entries +c note: if total strangeness .ne.0, the first meson should be strange! +c g g g pi g rho g om + @ 100,100,0,0, 100,101,0,0, 100,104,0,0, 100,103,0,0, +c g eta k g pi pi pi rho + @ 100,102,0,0, 106,100,0,0, 101,101,0,0, 101,104,0,0, +c pi pi pi pi et pi pi pi pi k kbar* + @ 101,101,101,0, 101,102,0,0, 101,101,101,101, 106,-108,0,0, +c kbar k* et pi pi + @ -106,108,0,0, 102,101,101,0, +c rho et rho pi pi om pi pi et et + @ 104,102,0,0, 104,101,101,0, 103,101,101,0, 102,102,0,0, +c k kbar k kbar pi k pi k* pi + @ 106,-106,0,0, 106,-106,101,0, 106,101,0,0, 108,101,0,0, +c k rho k om k* pi pi om pi + @ 106,104,0,0, 106,103,0,0, 108,101,101,0, 103,101,0,0/ + + data brtype/ +c non-strange baryon decay branches: +c for each branch you have a maximum of 4 outgoing itypes +c in case of resonances in the exit-channel, maximum two are allowed +c which must be listed as the first two entries +c N g N pi N et N om N rho + @ 1,100,0,0, 1,101,0,0, 1,102,0,0, 1,103,0,0, 1,104,0,0, +c N pi pi Delta pi N* pi La k Sig k + @ 1,101,101,0, 17,101,0,0, 2,101,0,0, 27,106,0,0, 40,106,0,0, +c N f0 N a0 + @ 1,105,0,0, 1,111,0,0/ + + + +c strangeness -1 baryon decay branches: +c in case of resonances in the exit-channel, maximum two are allowed +c which must be listed as the first two entries + data bs1type/ +c N Kbar N K*bar Si pi Si*pi + @ 1,-106,0,0, 1,-108,0,0, 40,101,0,0, 41,101,0,0, +c La g La et La om La pi + @ 27,100,0,0, 27,102,0,0, 27,103,0,0, 27,101,0,0, +c Si et La* pi Delta kbar + @ 40,102,0,0, 29,101,0,0, 17,-106,0,0/ + +c strangeness -2 baryon decay branches: +c in case of resonances in the exit-channel, maximum two are allowed +c which must be listed as the first two entries + data bs2type/ +c Xi pi Xi pi La Kbar Si Kbar + @ 49,101,0,0, 49,100,0,0, 27,-106,0,0, 40,-106,0,0/ + + +c +cccccccccccccccccccc pointer arrays for cross sections cccccccccccccccccc +c general structure: +c SigmaLn(SigLnXX(ICLTYP),*) contains in its columns +c EITHER flags for the crossx and make22 subroutines in which +c the respective parametrizations and exitchannels are stored +c OR the line-numbers of the +c sigmainf(LINE,*) and sigmascal(LINE,*) arrays +c in which information about the cross sections for the processes with +c particles of ITYPs ITYP1 and ITYP2 in the entry channel are stored. +c The first entry in the respective LINE of the sigmainf contains +c the number of possible exit channels for the collision and the +c second entry points to the total cross section. +c The ELASTIC cross section MUST always exist and be the FIRST +c cross section entry after the total cross section!! +c In case of NEGATIVE LINENUMBERS in sigmaLn(j>2,i), a DETAILED BALANCE +c calculation will be performed + + + data (((sigmaLN(i,j,k),i=1,maxpsig),j=1,2),k=1,maxreac) / +c 1 proton neutron +c nCH t el ND pN* ND* DD DN* DD* + . 9, 16, 17, 1, 2, 3, 4, 5, 6, 7, 15, 0, + . 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, +c 2 proton proton (and neutron neutron) +c nCH t el ND pN* ND* DD DN* DD* + . 9, 18, 19, 1, 2, 3, 4, 5, 6, 7, 15, 0, + . 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 0, +c 3 D N (sigtot=-1 sum over branches for total cross section) + . 5, -1, 13, 30, 8, 35, 15, 0, 0, 0, 0, 0, + . 0, 0, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, +c 4 N* N (sigtot=-1 sum over branches for total cross section) + . 4, 12, 13, -2, 14, 15, 0, 0, 0, 0, 0, 0, + . 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, +c 5 D* N(sigtot=-1 sum over branches for total cross section) + . 4, 12, 13, -3, 14, 15, 0, 0, 0, 0, 0, 0, + . 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, +c 6 D D (sigtot=-1 sum over branches for total cross section) + . 5, -1, 13, 32, 31, 14, 15, 0, 0, 0, 0, 0, + . 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, +c 7 D N* (sigtot=-1 sum over branches for total cross section) + . 4, 12, 13, -5, 14, 15, 0, 0, 0, 0, 0, 0, + . 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, +c 8 D D* (sigtot=-1 sum over branches for total cross section) + . 4, 12, 13, -6, 14, 15, 0, 0, 0, 0, 0, 0, + . 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, +c 9 meson baryon + . 5, 25, 26, 10, 27, 28, 36, 0, 0, 0, 0, 0, + . 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 0, 0, +c10 meson meson (are automatically summed) + . 5, -1, 38, 11, 27, 28, 37, 0, 0, 0, 0, 0, + . 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, +c11 bbar-b + . 3, -1, 22, 23, 24, 0, 0, 0, 0, 0, 0, 0, + . 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, +c12 D*D* or D*N* or N*N* + . 4, 12, 13, -7, 14, 15, 0, 0, 0, 0, 0, 0, + . 0, 0, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, +c13 BB (for all that are not specified above: YY etc.) + . 2, 12, 13, 15, 0, 0, 0, 0, 0, 0, 0, 0, + . 0, 0, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0 / + + +cccccccccccccccccccc cross sections info ccccccccccccccccccccccccccccccccccccc +c IMPORTANT: +c In sigmainf(LINE,*) the following information is stored: +c column 1 : line# number for sigmas(line#,*) array (index(sig)) +c column 2 : flag for angular distribution in the out-channel +c 0 : isotropic scattering +c 1 : elastic scattering (ident. part.) ang. distrib. exp (-as) +c 2 : elastic scattering (non ident. part.) ang. distrib. +c 3 : f-b peaked N N to N Delta +c 3 : number of particles in the out-channel +c ( 0 for total cross sections) +c for <0 number of calls to crossx for sub-branches +c 4 - 8 : ITYPs of particles in the out-channel +c 9 - 15: 2*I3 of particles in the out-channel (-9 for isocgk call) +c DANGER: the entries have to be sorted in a way, that ALL +c unknown I3 components (those which are -9) are +c at the END of the list !!! +ccccccccccccccc +c IN sigmascal(LINE,*) the following information is stored: +c column 1 : scaling factor for cross section in sigmas(line#,*) +c column 2 : sqrt(s) value corresponding to entry sigmas(line#,1) +c column 3 : Delta(sqrt(s)) between sigmas(line#,n) and sigmas(line#,n+1) +c column 4,5 : undefined (optionally formation time for outgoing channel) +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c proton - neutron total cs. index(inf)=1, index(sig)=1 + data (sigmainf(1,i),i=1,20) / + @ 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, + @ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 / + + data(sigmascal(1,i),i=1,5) / + @ 1.0000000, 1.8964808, 0.0100000, 0.0000000, 0.0000000 / + + +c proton - neutron elastic cs. index(inf)=2, index(sig)=2 + data (sigmainf(2,i),i=1,20) / + @ 2, 2, 2, 1, 1, 0, 0, 0, -9, -9, + @ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 / + + data(sigmascal(2,i),i=1,5) / + @ 1.0000000, 1.8964808, 0.0100000, 0.0000000, 0.0000000 / + + +c proton - proton (neutron - neutron) total cs. index(inf)=3, index(sig)=3 +c low energy forward peak is subtracted + data (sigmainf(3,i),i=1,20) / + @ 3, 0, 0, 0, 0, 0, 0, 0, 0, 0, + @ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 / + + data(sigmascal(3,i),i=1,5) / + @ 1.0000000, 1.8964808, 0.0100000, 0.0000000, 0.0000000 / + + +c proton - proton (neutron-neutron) elastic cs. index(inf)=4, index(sig)=4 + data (sigmainf(4,i),i=1,20) / + @ 4, 1, 2, 1, 1, 0, 0, 0, -9, -9, + @ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 / + + data(sigmascal(4,i),i=1,5) / + @ 1.0000000, 1.8964808, 0.0100000, 0.0000000, 0.0000000 / + + +cccccccccccccccccccccccc cross sections sigmas() cccccccccccccccccccccccccc +c +c proton - neutron total cs. index=1 + data (sigmas(1,i),i=1,ITBLSZ) / + @248.20, 93.38, 55.26, 44.50, 41.33, 38.48, 37.20, 35.98, + @ 35.02, 34.47, 34.37, 34.67, 35.23, 35.97, 36.75, 37.37, + @ 37.77, 38.03, 38.40, 38.83, 39.26, 39.67, 40.06, 40.45, + @ 40.79, 41.06, 41.31, 41.52, 41.70, 41.81, 41.87, 41.98, + @ 42.12, 42.29, 42.55, 42.82, 43.01, 43.12, 43.16, 43.14, + @ 43.06, 42.95, 42.81, 42.67, 42.54, 42.45, 42.38, 42.33, + @ 42.30, 42.29, 42.28, 42.26, 42.24, 42.21, 42.17, 42.14, + @ 42.10, 42.07, 42.06, 42.05, 42.04, 42.03, 42.02, 42.00, + @ 41.97, 41.94, 41.89, 41.84, 41.79, 41.73, 41.67, 41.61, + @ 41.55, 41.49, 41.44, 41.38, 41.34, 41.31, 41.29, 41.28, + @ 41.27, 41.28, 41.30, 41.33, 41.36, 41.40, 41.44, 41.49, + @ 41.50, 41.51, 41.51, 41.51, 41.52, 41.51, 41.51, 41.50, + @ 41.50, 41.49, 41.47, 41.46 + @/ + +c proton - neutron elastic cs. index=2 + data (sigmas(2,i),i=1,ITBLSZ) / + @248.20, 93.38, 55.26, 44.50, 41.33, 38.48, 37.20, 35.98, + @ 35.02, 34.47, 32.48, 30.76, 29.46, 28.53, 27.84, 27.20, + @ 26.53, 25.95, 25.59, 25.46, 25.00, 24.49, 24.08, 23.86, + @ 23.17, 22.70, 21.88, 21.48, 20.22, 19.75, 18.97, 18.39, + @ 17.98, 17.63, 17.21, 16.72, 16.68, 16.58, 16.42, 16.22, + @ 15.98, 15.71, 15.42, 15.14, 14.87, 14.65, 14.44, 14.26, + @ 14.10, 13.95, 13.80, 13.64, 13.47, 13.29, 13.09, 12.89, + @ 12.68, 12.47, 12.27, 12.06, 11.84, 11.76, 11.69, 11.60, + @ 11.50, 11.41, 11.29, 11.17, 11.06, 10.93, 10.81, 10.68, + @ 10.56, 10.44, 10.33, 10.21, 10.12, 10.03, 9.96, 9.89, + @ 9.83, 9.80, 9.77, 9.75, 9.74, 9.74, 9.74, 9.76, + @ 9.73, 9.70, 9.68, 9.65, 9.63, 9.60, 9.57, 9.55, + @ 9.52, 9.49, 9.46, 9.43 + @/ + + +c proton - proton (neut - neut) total cs. index=3 +c low energy forward peak is subtracted + data (sigmas(3,i),i=1,ITBLSZ) / + @ 39.48, 31.76, 26.26, 24.05, 23.94, 23.77, 23.72, 23.98, + @ 24.48, 24.52, 28.72, 33.21, 37.33, 39.87, 42.14, 44.15, + @ 46.85, 48.56, 48.65, 48.97, 48.81, 48.43, 48.36, 48.19, + @ 47.89, 47.53, 47.42, 47.37, 47.17, 46.65, 46.48, 45.94, + @ 45.63, 45.75, 45.52, 45.24, 45.13, 44.96, 44.55, 44.44, + @ 44.10, 43.89, 43.77, 43.32, 43.30, 43.07, 42.95, 42.74, + @ 42.46, 42.28, 42.11, 41.96, 41.86, 41.74, 41.64, 41.54, + @ 41.44, 41.37, 41.29, 41.22, 41.14, 41.09, 41.01, 40.93, + @ 40.83, 40.74, 40.66, 40.58, 40.51, 40.47, 40.40, 40.35, + @ 40.47, 40.44, 40.38, 40.35, 40.32, 40.27, 40.25, 40.23, + @ 40.19, 40.13, 40.11, 40.09, 40.06, 40.02, 40.00, 39.95, + @ 39.94, 39.90, 39.87, 39.82, 39.77, 39.72, 39.67, 39.59, + @ 39.54, 39.48, 39.41, 39.32 + @/ + +c proton - proton (neut - neut) elastic cs. index=4 + data (sigmas(4,i),i=1,ITBLSZ) / + @ 39.48, 31.76, 26.26, 24.05, 23.94, 23.77, 23.72, 23.98, + @ 24.48, 24.52, 25.00, 25.40, 25.80, 26.00, 24.32, 23.81, + @ 24.37, 24.36, 23.13, 22.83, 22.50, 22.20, 21.83, 21.50, + @ 21.55, 21.25, 20.90, 20.55, 20.30, 20.15, 20.05, 19.90, + @ 19.50, 19.25, 19.00, 18.50, 18.10, 17.60, 17.20, 17.00, + @ 16.70, 16.50, 16.20, 15.80, 15.57, 15.20, 15.00, 14.60, + @ 14.20, 14.00, 13.80, 13.60, 13.40, 13.20, 13.00, 12.85, + @ 12.70, 12.60, 12.50, 12.40, 12.30, 12.20, 12.10, 12.00, + @ 11.90, 11.80, 11.75, 11.70, 11.64, 11.53, 11.41, 11.31, + @ 11.22, 11.13, 11.05, 10.97, 10.89, 10.82, 10.75, 10.68, + @ 10.61, 10.54, 10.48, 10.41, 10.35, 10.28, 10.22, 10.16, + @ 10.13, 10.10, 10.08, 10.05, 10.02, 9.99, 9.96, 9.93, + @ 9.90, 9.87, 9.84, 9.80 + @/ +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + end + + + +C####C##1#########2#########3#########4#########5#########6#########7## + integer function flbr(i,iir) + implicit none + integer i,iir,ir,l + include 'comres.f' + ir=iabs(iir) + l=0 + if(ir.gt.minnuc.and.ir.le.maxdel)then + l=lbr(i,ir) + else if(ir.gt.minlam.and.ir.le.maxsig)then + l=lbs1(i,ir) + else if(ir.gt.mincas.and.ir.le.maxcas)then + l=lbs2(i,ir) + else if(ir.gt.minmes.and.ir.le.maxmes)then + l=lbm(i,ir) + else + write(6,*)'*** error(flbr) *** i,ir:',i,ir + stop + endif + flbr=l*2 ! angular momentum of decay into ch.i(x2) + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function fbran(i,iir) + implicit none + integer i,iir,ir + real*8 b + include 'comres.f' + ir=iabs(iir) + b=0.d0 + if(ir.gt.minnuc.and.ir.le.maxdel)then + b=branres(i,ir) + else if(ir.gt.minlam.and.ir.le.maxsig)then + b=branbs1(i,ir) + else if(ir.gt.mincas.and.ir.le.maxcas)then + b=branbs2(i,ir) + else if(ir.gt.minmes.and.ir.le.maxmes)then + b=branmes(i,ir) + else + write(6,*)'*** error(fbran) *** i,ir:',i,ir + stop + endif + fbran=b ! branching ratio of decay into ch.i(x2) + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + integer function strit(i) + implicit none + integer i,is,ia + include 'comres.f' + if(i.eq.0) then + strit=0 + return + endif + ia=iabs(i) + if(ia.ge.minmes)then + is=strmes(ia) + else + is=strres(ia) + endif + strit=is*iabs(i)/i ! number of strange quarks in part. i + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + integer function fchg(i3,i) + integer i,i3,b,s,ia,strit + include 'comres.f' + if(i.eq.0) then + fchg=0 + return + endif + + s=strit(i) + ia=iabs(i) + if(ia.ge.minmes)then + b=0 + else + b=ia/i + endif + fchg =(i3+b-s)/2 ! i3 is multiplied whith 2 & s(s)=-1! + return ! charge of particle i + end + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function massit(i) + integer i,ia + include 'comres.f' + ia=iabs(i) + if(ia.ge.minmes)then + massit=massmes(ia) + else + massit=massres(ia) + endif + return ! mass of particle i + end + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function mminit(i) + implicit none + integer i,ia + real*8 massit,widit ! functions + real*8 cut,pcut + parameter(pcut=1d-3) ! keep pcut*mass for rel.kinetic energy + include 'comres.f' + if(i.eq.0) then + mminit=0.d0 + return + endif + + ia=iabs(i) + cut=pcut*massit(ia) + if(widit(ia).le.pcut)then ! narrow particle condition + mminit=massit(ia) + else if(ia.ge.minmes)then + mminit=mmesmn(ia)+cut + else if(ia.gt.minnuc.and.ia.le.maxdel)then + mminit=massit(minnuc)+massit(pimeson)+cut + else if(ia.gt.minlam.and.ia.le.maxlam)then + mminit=massit(minsig)+massit(pimeson)+cut + else if(ia.gt.minsig.and.ia.le.maxsig)then + mminit=massit(minsig)+massit(pimeson)+cut + else if(ia.gt.mincas.and.ia.le.maxcas)then + mminit=massit(mincas)+massit(pimeson)+cut + else + mminit=massit(ia) + endif + return ! minimal mass of particle i + end + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function widit(i) + implicit none + integer i,ia + include 'comres.f' + if(i.eq.0) then + widit=0.d0 + return + endif + + ia=iabs(i) + if(ia.ge.minmes)then + widit=widmes(ia) + else + widit=widres(ia) + endif + return ! width of particle i + end + +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine brange(i,mm,mp) + implicit none + integer mm,mp,ia,i + include 'comres.f' + ia=abs(i) + mm=0 + if(ia.ge.minmes)then + mp=maxbrm + else if(ia.gt.minnuc.and.ia.le.maxdel)then + mp=maxbra + else if(ia.gt.minlam.and.ia.le.maxsig)then + mp=maxbrs1 + else if(ia.gt.mincas.and.ia.le.maxcas)then + mp=maxbrs2 + else + mp=0 + endif + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine b3type(i,j,bi,b1,b2,b3,b4) +c i=itype j=number of decay channel bi=branching ratio b1-4 outgoing itypes + implicit none + integer ia,i,j,b1,b2,b3,b4 + real*8 bi + include 'comres.f' + ia=abs(i) + if(ia.gt.minmes)then + bi=branmes(j,ia) + b1=bmtype(1,j) + b2=bmtype(2,j) + b3=bmtype(3,j) + b4=bmtype(4,j) + else if(ia.gt.minnuc.and.ia.le.maxdel)then + bi=branres(j,ia) + b1=brtype(1,j) + b2=brtype(2,j) + b3=brtype(3,j) + b4=brtype(4,j) + else if(ia.gt.minlam.and.ia.le.maxsig)then + bi=branbs1(j,ia) + b1=bs1type(1,j) + b2=bs1type(2,j) + b3=bs1type(3,j) + b4=bs1type(4,j) + else if(ia.gt.mincas.and.ia.le.maxcas)then + bi=branbs2(j,ia) + b1=bs2type(1,j) + b2=bs2type(2,j) + b3=bs2type(3,j) + b4=bs2type(4,j) + else + bi=0d0 + endif + return + end + + +C####C##1#########2#########3#########4#########5#########6#########7## + integer function isoit(i) + implicit none + integer i,ia + include 'comres.f' + if(i.eq.0) then + isoit=0 + return + endif + ia=iabs(i) + if(ia.ge.minmes)then + isoit=isomes(ia) + else + isoit=isores(ia) + end if + return ! isospin of particle i + end + +C####C##1#########2#########3#########4#########5#########6#########7## + integer function jit(i) + implicit none + integer i,ia + include 'comres.f' + + if(i.eq.0) then + jit=0 + return + endif + + ia=iabs(i) + if(ia.ge.minmes)then + jit=jmes(ia) + else + jit=jres(ia) + endif + return ! spin of particle i + end diff --git a/Processes/UrQMD/boxinc.f b/Processes/UrQMD/boxinc.f new file mode 100644 index 0000000000000000000000000000000000000000..8d2eb827cbbca769a6da1cfe005d7ed7df583ccd --- /dev/null +++ b/Processes/UrQMD/boxinc.f @@ -0,0 +1,38 @@ +c $Id: boxinc.f,v 1.3 1999/01/18 09:56:53 ernst Exp $ +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c +c Unit : all modules using the box +c Version : 1.0 +c +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + +c max count of different species + integer bptmax + parameter(bptmax=20) + +c counter + integer cbox +c Flags + integer boxflag + integer edensflag, mbflag + integer para,solid,mtest +c number of different species + integer mbox +c particle counters + integer bptpart(bptmax),bptityp(bptmax),bptiso3(bptmax) + real*8 bptpmax(bptmax) + real*8 edens +c edge length of a cube in fm + real*8 lbox +c half edge lengt of a cube + real*8 lboxhalbe +c double edge length of a cube + real*8 lboxd +c momenta + real*8 mbp0, mbpx, mbpy, mbpz + + common /boxic/ cbox,boxflag, mbox, bptityp, bptiso3, bptpart + common /boxic/ edensflag, para, solid, mbflag, mtest + common /boxrc/ lbox, lboxhalbe, lboxd, bptpmax, edens + common /boxrc/ mbp0, mbpx, mbpy, mbpz + diff --git a/Processes/UrQMD/boxprg.f b/Processes/UrQMD/boxprg.f new file mode 100644 index 0000000000000000000000000000000000000000..2daa11ad2a1aba109c102dbb280c242e583aa45a --- /dev/null +++ b/Processes/UrQMD/boxprg.f @@ -0,0 +1,293 @@ +c $Id: boxprg.f,v 1.8 1999/01/18 09:56:53 ernst Exp $ +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine bptinit(ibox) +c +c Unit : Initis all the particles setted by the bpt command +c Version : 1.0 +c +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + + include 'coms.f' + include 'comres.f' + include 'boxinc.f' + include 'options.f' + +c Var +c counter, spin + integer i,ibox,fchg,getspin +c randomnumbergenerator, particlemass, deacy times + real*8 ranf,massit,dectim +c momentum, angle distribution + real*8 P,cost,sint,phi + + ecm=0.d0 + ebeam=0.d0 + +c main program + +c loop over all particles + do 42 i=npart+1,npart+bptpart(ibox) +c configuration space + r0(i)=0.d0 + rx(i)=lboxhalbe*(1-2*ranf(0)) + ry(i)=lboxhalbe*(1-2*ranf(0)) + rz(i)=lboxhalbe*(1-2*ranf(0)) + +c isospin and ityp + iso3(i)=bptiso3(ibox) + ityp(i)=bptityp(ibox) + +c set baryon and meson numbers + if(abs(ityp(i)).le.maxbar) then + nbar=nbar+1 + else + nmes=nmes+1 + endif + +c charge + charge(i)=fchg(iso3(i),ityp(i)) +c massarray + fmass(i)=massit(ityp(i)) +c Spin + spin(i)=getspin(ityp(i),-1) +c decaytime + dectime(i)=dectim(i,1) + + 42 continue +c End of loop + + if (edensflag.le.0) then +c homogenious momentum distribution, randomly distributed +c max momentum is a parameter + do 45 i=npart+1,npart+bptpart(ibox) + P=bptpmax(ibox)*ranf(0)**(1./3.) + cost = 1.-2.*ranf(0) + sint = sqrt(1.-cost**2) + phi = 2.*Pi*ranf(0) + px(i) = P*sint*cos(phi) + py(i) = P*sint*sin(phi) + pz(i) = P*cost + call setonshell(i) + 45 continue + elseif (edensflag.ge.1) then + +c energiedensity + +c loop over all particles + do 60 i=npart+1,npart+bptpart(ibox) + P=bptpmax(ibox)/bptpart(ibox)*ranf(0)**(1./3.) + + cost = 1.-2.*ranf(0) + sint = sqrt(1.-cost**2) + phi = 2.*Pi*ranf(0) + +c different initialisations + + if (para.eq.0) then + +c Boxmode + if (i.eq.1) write(*,*) 'Boxmode' + px(i) = P*sint*cos(phi) + py(i) = P*sint*sin(phi) + pz(i) = P*cost + + elseif(para.eq.1) then + +c stream over stream + if (i.eq.1) write(*,*) 'streammode' + px(i) = 0.d0 + py(i) = 0.d0 + pz(i) = bptpmax(ibox)/bptpart(ibox)*(-1.d0)**i + elseif(para.eq.2) then + +c slab on slab + if (i.eq.1) write(*,*) 'slabmode' + px(i)=0.d0 + py(i)=0.d0 + if (rz(i).gt.0) then + pz(i)=(-1.0d0)*bptpmax(ibox)/bptpart(ibox) + else + pz(i)=bptpmax(ibox)/bptpart(ibox) + endif + endif + 60 continue + endif +c sum of particles + npart=npart+bptpart(ibox) + Write(*,*) 'Particles = ',npart +cc + return + + end + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + function swapi(x,dx) +c +c Version: 1.0 +c +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + real*8 swapi, x, dx + + swapi = x + 1 if (swapi.lt.-dx) then + swapi = swapi + 2.0d0*dx + goto 1 + end if + 2 if (swapi.gt.dx) then + swapi = swapi - 2.0d0*dx + goto 2 + end if + end + + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + Function Energie(alpha,max) +c +c Unit : calculate the energy +c Version : 1.0 +c +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + + include 'coms.f' + integer i + + real*8 alpha,max + real*8 Energie, E + + E=0 + Do 42 i=1,npart + E=E+sqrt((alpha**2)*(px(i)*px(i)+py(i)*py(i)+pz(i)*pz(i))+ + $ fmass(i)**2) + 42 continue + + Energie=E-max + + Return + End + + + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + Function Regula(me) +c +c Unit : Searches for the zero of the function +c Version : 1.0 +c +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + + implicit none + + include 'coms.f' + + real*8 Regula,xn,xu,x0,me,Energie + integer i + real*8 E1,E2,E3 + +c init + xu=0.d0 + x0=3.d0 +c main + Write(*,*) 'Regula is running!' + i=0 + 10 Continue + i=i+1 + E1=Energie(x0,me) + E2=Energie(xu,me) + + xn=x0-(E1*(x0-xu))/(E1-E2) + E3=Energie(xn,me) + IF ((E2*E3).LE.0) then + x0=xn + else + xu=xn + EndIF + + IF ((ABS(x0-xu).GE.1.D-12).and.(i.le.1000).and.( + & ((E3.ge.1.D-12).or.(-E3.ge.1.D-12)))) goto 10 + Regula=xn + End + + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + real*8 function wallcoll(ipart,wall) +c +c Unit : Collisions with an imaginary wall +c Version : 1.0 +c +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + + include 'coms.f' + include 'boxinc.f' + include 'options.f' + +c var + real*8 betax,betay,betaz + real*8 ty,tz + real*8 tn + integer wall,ipart + integer wally,wallz + + +c Mainprogram +c init the variables + wall=0 + tn=0 + +c velocity + betax=px(ipart)/p0(ipart) + betay=py(ipart)/p0(ipart) + betaz=pz(ipart)/p0(ipart) + +c check which wall is reached next and sort by impact time +c wall presents the wall and tn the time + + if (betax.lt.0) then + wall=-4 + tn=(-lboxhalbe-rx(ipart))/(-max(-betax,1.d-13)) + else + wall=-1 + tn=((lboxhalbe-rx(ipart))/max(betax,1.d-13)) + endif + + if (betay.lt.0) then + wally=-5 + ty=(-lboxhalbe-ry(ipart))/(-max(-betay,1.d-13)) + else + wally=-2 + ty=((lboxhalbe-ry(ipart))/max(betay,1.d-13)) + endif + + if(ty.lt.tn) then + tn=ty + wall=wally + endif + + if (betaz.lt.0) then + wallz=-6 + tz=(-lboxhalbe-rz(ipart))/(-max(-betaz,1.d-13)) + else + wallz=-3 + tz=((lboxhalbe-rz(ipart))/max(betaz,1.d-13)) + endif + + if(tz.lt.tn) then + tn=tz + wall=wallz + endif + + +c sets the time for the earliest wall collision + wallcoll=tn + + return + End + + diff --git a/Processes/UrQMD/cascinit.f b/Processes/UrQMD/cascinit.f new file mode 100644 index 0000000000000000000000000000000000000000..121924e9ae895f7dcce781c3f7a5df0b9ff0e989 --- /dev/null +++ b/Processes/UrQMD/cascinit.f @@ -0,0 +1,511 @@ +c $Id: cascinit.f,v 1.11 2002/05/14 12:33:50 balazs Exp $ + subroutine cascinit(ZZ,AA,nucleus) + + implicit none + + include 'coms.f' + include 'options.f' + include 'inputs.f' + + integer Z,A,i,getspin,fchg,ZZ,AA,antia, j,k, nrjc,izcnt,nucleus + real*8 R,P,R2,ranf,sint,phi,nucrad,cost,drr + real*8 xcm,ycm,zcm,pxcm,pycm,pzcm,densnorm,add,avd,ws + real*8 r_long, r_short, rdef, ratio, alpha +c +c mass correction according to binding energy + real*8 meff +ce bcorr to prevent recycling odd nuclei + logical bcorr + common /ini/ bcorr + bcorr=.false. + +C averaged density of one Gaussian in units of central value + avd = 0.5**1.5 + + pxcm=0.d0 + pycm=0.d0 + pzcm=0.d0 + + A=abs(AA) + Z=abs(ZZ) + antia=A/AA + + PT_AA(nucleus)=A + + if(A.gt.AAmax) then + write(6,*)'***(E): Mass ',A,' exceeds initialization limit!' + write(6,*)' -> increase parameter AAmax=',AAmax + write(6,*)' in include-file inputs.f ' + write(6,*)' -> uqmd aborting ... ' + stop + endif + + if (A.eq.1) then ! proton or neutron + i = 1 + PT_iso3(i,nucleus) = antia*(-1+2*Z) + PT_ityp(i,nucleus) = antia*1 + uid_cnt=uid_cnt+1 + PT_uid(i,nucleus)=uid_cnt + PT_spin(i,nucleus) = 1 + PT_dectime(i,nucleus)=1.d31 + PT_charge(i,nucleus)=fchg(PT_iso3(i,nucleus), + & PT_ityp(i,nucleus)) + PT_fmass(i,nucleus) = EMNUC + PT_p0(i,nucleus)=sqrt(PT_fmass(i,nucleus)**2) + return + end if + +C +C Initialisation of A nucleons in configuration space +C + xcm=0.d0 + ycm=0.d0 + zcm=0.d0 + R2=0.d0 + if (CTOption(24).eq.1) then + R2 = nucrad(A) + 10.0 + elseif(CTOption(24).eq.0)then + R2 = nucrad(A) + endif + nrjc = 0 + if(CTOption(24).eq.2)then ! use fast method + call nucfast(A,nucleus) + do j=1,A + PT_dectime(j,nucleus)=1.d31 + xcm=xcm+PT_rx(j,nucleus) + ycm=ycm+PT_ry(j,nucleus) + zcm=zcm+PT_rz(j,nucleus) + enddo + else + do 1 j=1,A + PT_dectime(j,nucleus)=1.d31 +111 nrjc = nrjc+1 + R = R2*ranf(0)**(1./3.) + cost = 1.-2.*ranf(0) + sint = sqrt(1.-cost**2) + phi = 2.*Pi*ranf(0) + PT_r0(j,nucleus) = 0.d0 + PT_rx(j,nucleus) = R*sint*cos(phi) + PT_ry(j,nucleus) = R*sint*sin(phi) + PT_rz(j,nucleus) = R*cost + if (CTParam(21).gt.0.0) then + ratio = sqrt((1 + 4.0*CTParam(21)/3.0) / + $ (1 - 2.0*CTParam(21)/3.0) ) + alpha = atan( sqrt(PT_rx(j,nucleus)*PT_rx(j,nucleus) + $ + PT_ry(j,nucleus)*PT_ry(j,nucleus))/PT_rz(j,nucleus)) + r_short = nucrad(A)*(ratio**(-(1.0/3.0))) + r_long = nucrad(A)*(ratio**(2.0/3.0)) + rdef = r_short/sqrt(1-((r_long**2-r_short**2)/r_long**2) + $ *cos(alpha)*cos(alpha)) + else + rdef = nucrad(A) + endif + + + if (CTOption(24).eq.1) then + WS = 1 / ( 1 + dexp( ( R - rdef ) / 0.545 ) ) +cdh if (ranf(0) > WS ) then + if (ranf(0) .gt. WS ) then +c write (6,*) "rejected: ",R + goto 111 + endif + else + do 11 k=1,j-1 + drr=(PT_rx(j,nucleus)-PT_rx(k,nucleus))**2 + & +(PT_ry(j,nucleus)-PT_ry(k,nucleus))**2 + & +(PT_rz(j,nucleus)-PT_rz(k,nucleus))**2 + if (drr.lt.2.6.and.nrjc.lt.CTParam(46)) goto 111 + 11 continue + endif + xcm=xcm+PT_rx(j,nucleus) + ycm=ycm+PT_ry(j,nucleus) + zcm=zcm+PT_rz(j,nucleus) +1 continue + endif + + if (nrjc.ge.CTParam(46)) then +c write(6,*)'*** warning: initialisation corrupt ' + bcorr=.true. + end if + + xcm = xcm/dble(A) + ycm = ycm/dble(A) + zcm = zcm/dble(A) + do 13 j=1,A + if (CTOption(24).eq.0) then + PT_rx(j,nucleus) = PT_rx(j,nucleus)-xcm + PT_ry(j,nucleus) = PT_ry(j,nucleus)-ycm + PT_rz(j,nucleus) = PT_rz(j,nucleus)-zcm + endif + PT_rho(j,nucleus) = avd +13 continue + +C local proton density in nucleus A,Z + do 14 j=1,Z + do 15 k=j+1,Z + drr=(PT_rx(j,nucleus)-PT_rx(k,nucleus))**2 + & +(PT_ry(j,nucleus)-PT_ry(k,nucleus))**2 + & +(PT_rz(j,nucleus)-PT_rz(k,nucleus))**2 + add=exp(-(2.0*gw*drr)) + PT_rho(j,nucleus) = PT_rho(j,nucleus)+add + PT_rho(k,nucleus) = PT_rho(k,nucleus)+add +15 continue +14 continue + +C local neutron density in nucleus A,Z + do 16 j=Z+1,A + do 17 k=j+1,A + drr=(PT_rx(j,nucleus)-PT_rx(k,nucleus))**2 + & +(PT_ry(j,nucleus)-PT_ry(k,nucleus))**2 + & +(PT_rz(j,nucleus)-PT_rz(k,nucleus))**2 + add=exp(-(2.0*gw*drr)) + PT_rho(j,nucleus) = PT_rho(j,nucleus)+add + PT_rho(k,nucleus) = PT_rho(k,nucleus)+add +17 continue +16 continue + + densnorm = (2.0*gw/pi)**1.5 + do 18 j=1,A + PT_rho(j,nucleus) = PT_rho(j,nucleus)*densnorm + PT_pmax(j,nucleus) = hqc*(3.0*pi*pi*PT_rho(j,nucleus))**(1./3.) +18 continue + + izcnt=0 + do 12 j=1,A + P = PT_pmax(j,nucleus)*ranf(0)**(1./3.) + cost = 1.-2.*ranf(0) + sint = sqrt(1.-cost**2) + phi = 2.*Pi*ranf(0) + PT_px(j,nucleus) = P*sint*cos(phi) + PT_py(j,nucleus) = P*sint*sin(phi) + PT_pz(j,nucleus) = P*cost + pxcm=pxcm+PT_px(j,nucleus) + pycm=pycm+PT_py(j,nucleus) + pzcm=pzcm+PT_pz(j,nucleus) + if (j.le.Z) then + PT_iso3(j,nucleus)= 1*antia + PT_charge(j,nucleus)=1*antia + else + PT_iso3(j,nucleus)= -(1*antia) + PT_charge(j,nucleus)=0 + endif + + PT_spin(j,nucleus) = getspin(1,-1) + PT_ityp(j,nucleus) = 1*antia + uid_cnt=uid_cnt+1 + PT_uid(j,nucleus)=uid_cnt + +12 continue + +c perform CM-correction + pxcm=pxcm/A + pycm=pycm/A + pzcm=pzcm/A + do 2 i=1,A + PT_px(i,nucleus)=PT_px(i,nucleus)-pxcm + PT_py(i,nucleus)=PT_py(i,nucleus)-pycm + PT_pz(i,nucleus)=PT_pz(i,nucleus)-pzcm +c effective masses for initial energy corr. (CTOption(11).eq.0) + r=sqrt(PT_rx(i,nucleus)**2+PT_ry(i,nucleus)**2 + & +PT_rz(i,nucleus)**2) + p=sqrt(PT_px(i,nucleus)**2+PT_py(i,nucleus)**2 + & +PT_pz(i,nucleus)**2) +ctp060202 PT_fmass(i,nucleus) = meff(z,a,r,p) + PT_fmass(i,nucleus) = meff(z,a,p) + PT_p0(i,nucleus)=sqrt(PT_px(i,nucleus)**2+PT_py(i,nucleus)**2 + & +PT_pz(i,nucleus)**2+PT_fmass(i,nucleus)**2) + 2 continue +c end of CM-correction + + return + end + + subroutine nucfast(IA,JJ) + IMPLICIT DOUBLE PRECISION (A-H,O-Z) + + include 'inputs.f' + real*8 nucrad + + am=0.545 + rad=nucrad(ia)/am + cr1=1.+3./rad+6./rad**2+6./rad**3 + cr2=3./rad + cr3=3./rad+6./rad**2 + rimmax=0.0 + + DO I=1,IA + 1 zuk=ranf(0)*cr1-1. + if(zuk.le.0.)then + tt=rad*(ranf(0)**.3333-1.) + elseif(zuk.le.cr2 )then + tt=-log(ranf(0)) + elseif(zuk.lt.cr3 )then + tt=-log(ranf(0))-log(ranf(0)) + else + tt=-log(ranf(0))-log(ranf(0))-log(ranf(0)) + endif + if(ranf(0).gt.1./(1.+exp(-abs(tt))))goto 1 + rim=tt+rad + z=rim*(2D0*ranf(0)-1D0) + rim=dsqrt(rim*rim-z*z) +cc if(rimmax.lt.rim*AM)rimmax=rim*AM + PT_r0(I,JJ)=0d0 + PT_rz(I,JJ)=Z * AM + + 2 s1=2d0*ranf(0)-1d0 + s2=2d0*ranf(0)-1d0 + s3=s1*s1+s2*s2 + if(s3.gt.1d0)goto 2 + s3=dsqrt(s3) + c=s1/s3 + s=s2/s3 + PT_rx(I,JJ)=rim * C * AM + PT_ry(I,JJ)=rim * S * AM + enddo +cc print *,"rimmax",rimmax +cc if(debug.ge.3)then +cc write (*,*) "nucleons" +cc do i=1,ia +cc write (*,'(i3,3g12.6)')i,PT_rx(i,JJ),PT_ry(i,JJ),PT_rz(i,JJ) +cc enddo +cc write (*,*) +cc endif + return + END + + + function nucrad(AA) + implicit none + real*8 nucrad, r_0 + integer A,AA + include 'coms.f' + include 'options.f' + + A=abs(AA) +c root mean square radius of nucleus of mass A +c r_0 corresponding to rho0 + if (CTOption(24).ge.1) then +c root mean square radius of nucleus of mass A (Mayer-Kuckuck) + nucrad = 1.128 * a**(1./3.) - 0.89 * a**(-(1./3.)) + else + r_0 = (0.75/pi/rho0)**(1./3.) +c subtract gaussian tails, for distributing centroids correctly + nucrad = r_0*(0.5*(a + (a**(1./3.)-1.)**3.))**(1./3.) + endif + + return + end + + subroutine boostnuc(i1,i2,pin,b,dst) + implicit none + include 'coms.f' + include 'options.f' + integer i1,i2,i + real*8 b,dst,ei,ti + real*8 pin,beta,gamma + + do 1 i=i1,i2 + + beta = pin/sqrt(pin**2+fmass(i)**2) + gamma = 1.d0/sqrt(1.d0-beta**2) + +c Gallilei-Trafo in x-direction (impact parameter) +c projectile hits at POSITIVE x + rx(i) = rx(i) + b +c distance between nuclei: projectile at NEGATIVE z for dst < 0 + if(CTOption(23).eq.0)then + ti = r0(i) + rz(i) = rz(i)/gamma+dst/gamma + else + rz(i) = (rz(i) + dst) + end if + + + Ei = p0(i) + p0(i) = gamma*(p0(i) - beta*pz(i)) + pz(i) = gamma*(pz(i) - beta*Ei) + + 1 continue + return + end + +ctp060202 real*8 function meff(z,a,r,p) + real*8 function meff(z,a,p) +c mean binding energy of a nucleon in a nucleus according to weizaecker + implicit none + include 'options.f' + real*8 av,as,ac,aa,ap,mdef,p,e,EMNUC + integer z,a + parameter (av=0.01587,as=0.01834,ac=0.00071) + parameter (aa=0.09286,ap=11.46,EMNUC=0.938) + if(CTOption(11).ne.0.or.a.eq.1)then + meff=EMNUC + return + end if +c...mass defect + mdef=-(av*A)+as*A**0.66667+ac*z*z/a**0.33333+aa*(z-a/2.)**2/a +c...energy per nucleon = binding energy + nucleon mass + e=min(0d0,mdef/a)+EMNUC + meff=sqrt(e**2-p**2) + return + end + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine getnucleus(nucleus,offset) +c +c Revision: 1.0 +c +cinput nucleus : 1=projectile, 2=target +cinput offset : offset for location of nucleus in particle vectors +c +c output : via common blocks +c +c This subroutine read in a nucleus which has been initialized +c by {\tt cascinit} and stored in the {\tt PT\_ *(i,nucleus)} arrays. +c The respective nucleus is then rotated randomly in configuration +c and momentum space to yield a new initial state. +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + implicit none + include 'coms.f' + include 'options.f' + include 'inputs.f' + +c local variables + real*8 eul1,eul2,eul3,ceul1,seul1,ceul2,seul2,ceul3,seul3 + real*8 vecx0,vecy0,vecz0,vecx1,vecy1,vecz1,vecx2 + real*8 vecy2,vecz2 + integer k,nucleus,offset + +c functions + real*8 ranf + +c *** +c *** rotation around Euler-angles +c *** + if (CTParam(21).gt.0.0) then + eul1 = 0.0 + eul2 = 0.0 + eul3 = 0.0 + else + eul1 = ranf(0)*2.0*pi + eul2 = ranf(0)*2.0*pi + eul3 = ranf(0)*2.0*pi + endif + + ceul1 = cos(eul1) + seul1 = sin(eul1) + ceul2 = cos(eul2) + seul2 = sin(eul2) + ceul3 = cos(eul3) + seul3 = sin(eul3) + + do 178 k=1,PT_AA(nucleus) + +c rotate in configuration space + + vecx0 = PT_rx(k,nucleus) + vecy0 = PT_ry(k,nucleus) + vecz0 = PT_rz(k,nucleus) + + + vecx1 = ceul1*vecx0 + seul1*vecy0 + vecy1 = -(seul1*vecx0)+ ceul1*vecy0 + vecz1 = vecz0 + + vecx2 = ceul2*vecx1 + seul2*vecz1 + vecy2 = vecy1 + vecz2 = -(seul2*vecx1) + ceul2*vecz1 + + vecx0 = ceul3*vecx2 + seul3*vecy2 + vecy0 = -(seul3*vecx2)+ ceul3*vecy2 + vecz0 = vecz2 + + rx(k+offset) = vecx0 + ry(k+offset) = vecy0 + rz(k+offset) = vecz0 + +c rotate in momentum space + + vecx0 = PT_px(k,nucleus) + vecy0 = PT_py(k,nucleus) + vecz0 = PT_pz(k,nucleus) + + + vecx1 = ceul1*vecx0 + seul1*vecy0 + vecy1 = -(seul1*vecx0)+ ceul1*vecy0 + vecz1 = vecz0 + + vecx2 = ceul2*vecx1 + seul2*vecz1 + vecy2 = vecy1 + vecz2 = -(seul2*vecx1) + ceul2*vecz1 + + vecx0 = ceul3*vecx2 + seul3*vecy2 + vecy0 = -(seul3*vecx2) + ceul3*vecy2 + vecz0 = vecz2 + + px(k+offset) = vecx0 + py(k+offset) = vecy0 + pz(k+offset) = vecz0 + +c initialize the other quantum numbers + + iso3(k+offset)=PT_iso3(k,nucleus) + ityp(k+offset)=PT_ityp(k,nucleus) + uid(k+offset)=PT_uid(k,nucleus) + spin(k+offset)=PT_spin(k,nucleus) + dectime(k+offset)=PT_dectime(k,nucleus) + charge(k+offset)=PT_charge(k,nucleus) + fmass(k+offset)=PT_fmass(k,nucleus) + r0(k+offset)=PT_r0(k,nucleus) + p0(k+offset)=PT_p0(k,nucleus) + + 178 continue + + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function rnfWSX(AA,zmin,zmax) +c yields a $x^n$ distributet value for $x$ between mmin and mmax +cccccCcc1ccccccccc2ccccccccc3ccccccccc4ccccccccc5ccccccccc6ccccccccc7cc + + implicit none + + real*8 zmin,zmax,ranf,a,rr,yf,z,nucrad + integer AA + parameter (a=0.54d0) + + rr=nucrad(aa) + + if(zmax.lt.rr)then + write(6,*)'rnfwsx: maximum radius seems too low' + stop + end if + + 108 continue + z=zmin+ranf(0)*(zmax-zmin) + yf=z*z/((zmax-zmin)**3)*0.5d0/(1d0+exp(z-rr)/a) + rnfWSX=z + if(yf.gt.1d0)stop'rnfWSX: wrong normalisaton:' + if(yf.gt.ranf(0)) return + goto 108 + + end + + +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + subroutine setonshell(i) +c +c Revision : 1.0 +c This subroutine set particle i on-shell +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + include 'coms.f' + integer i + + p0(i) = sqrt(px(i)**2+py(i)**2+pz(i)**2+fmass(i)**2) + + return + end + diff --git a/Processes/UrQMD/colltab.f b/Processes/UrQMD/colltab.f new file mode 100644 index 0000000000000000000000000000000000000000..a16ee8129c5810a9702898baa0044300da61a434 --- /dev/null +++ b/Processes/UrQMD/colltab.f @@ -0,0 +1,29 @@ +c $Id: colltab.f,v 1.5 1999/11/24 19:47:48 ssoff Exp $ +c +cdes This file contains the uqmd collision tables +c + integer ncollmax + parameter (ncollmax = 100) ! maximum number of entries in collision table + integer nct,actcol,nsav,apt + real*8 cttime(0:ncollmax),ctsqrts(ncollmax),ctsigtot(ncollmax) + real*8 ctcolfluc(ncollmax) + logical ctvalid(ncollmax) + real*8 tmin + integer cti1(ncollmax),cti2(ncollmax),ctsav(ncollmax) +c integer updi1(ncollmax),updi2(ncollmax) +c +c cttime : collision time +c ctsqrts : $sqrt{s}$ of collision +c ctsigtot: total cross section in mbarn +c tmin : paramteter for {\tt collupd} +c cti1 : index of particle 1 +c cti2 : index of particle 2 +c nct : number of collisions in the table +c actcol : current collision +c ctvalid : tag whether collision is {\em true} or {\em false} +c ctsav : list of particles which lost their collision partner +c nsav : number of entries in {\tt ctsav} +c apt : mass of first particle/composite in the part. arrays + + common /colltab/cttime,ctsqrts,ctsigtot,tmin,cti1,cti2,nct,actcol, + & ctvalid,ctsav,nsav,apt,ctcolfluc diff --git a/Processes/UrQMD/coload.f b/Processes/UrQMD/coload.f new file mode 100644 index 0000000000000000000000000000000000000000..efe92e6469bcd564369412fa0ee8b95e76f5ebce --- /dev/null +++ b/Processes/UrQMD/coload.f @@ -0,0 +1,911 @@ +c $Id: coload.f,v 1.11 2001/04/06 21:48:16 weber Exp $ +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + real*8 function sigtot(ind1,ind2,sqrts) +c +c Revision : 1.0 +C +cinput ind1 : index of particle 1 +cinput ind2 : index of particle 2 +cinput sqrts: $\sqrt{s}$ of collision between part. 1 and 2 +c +c {\tt sigtot} returns the total cross section (in mbarn) for the collision +c between the particles with the indices {\tt ind1} and {\tt ind2}. +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + include 'coms.f' + include 'comres.f' + include 'newpart.f' +c + integer isigline + integer ind1,ind2,collclass + integer ityp1,ityp2,iso31,iso32 + real*8 sqrts,mminit +c for detailed-balance + integer nCh,ii + real*8 e1,e2,sigma + + +c reset sigtot, store often needed values in scalars + sigtot=0.d0 + ityp1=ityp(ind1) + ityp2=ityp(ind2) + iso31=iso3(ind1) + iso32=iso3(ind2) + +c now get collision class (line-number for sigmaLN array in blockres.f) +c isigline classifies the collision (pp,pn,Delta N, Meson-Baryon etc) + isigline=collclass(ityp1,iso31,ityp2,iso32) + + if(isigline.eq.0) return ! zero cross section for collclass=0 + +c get pointer for total cross section (column #2 in SigmaLN array) + iline=SigmaLn(2,1,isigline) ! flag of total cross section + +c if zero, cross section is zero, return + if(iline.eq.0) return + + if(iline.gt.0) then +c +c if gt zero we have a tabulated or parameterized total cross section, +c all table-lookups and parametrizations are accessed via crossx +c + call crossx(iline,sqrts,ityp1,iso31, + & max(fmass(ind1),mminit(ityp1)), + & ityp2,iso32, + & max(fmass(ind2),mminit(ityp2)), + & sigtot) + + else +c +c total cross section via sum of partial cross sections +c +c get number of exit-channels: + if (isigline.gt.maxreac) then + write (6,*) '4isigline: ',isigline + endif + nCh=SigmaLn(1,1,isigline) +c +c transformation quantities into NN system for proper kinematics +c (necessary for detailed balance cross sections) +c first compute transformation betas + e1=sqrt(fmass(ind1)**2+px(ind1)**2 + & +py(ind1)**2+pz(ind1)**2) + e2=sqrt(fmass(ind2)**2+px(ind2)**2 + & +py(ind2)**2+pz(ind2)**2) + betax=(px(ind1)+px(ind2))/(e1+e2) + betay=(py(ind1)+py(ind2))/(e1+e2) + betaz=(pz(ind1)+pz(ind2))/(e1+e2) +c now transform momenta + pxnn=px(ind1) + pynn=py(ind1) + pznn=pz(ind1) + p0nn=e1 +c call to Lorentz transformation + call rotbos(0d0,0d0,-betax,-betay,-betaz, + & pxnn,pynn,pznn,p0nn) + pnn=sqrt(pxnn*pxnn+pynn*pynn+pznn*pznn) +c end of transform part +c +c loop over exit channels for sum of partial cross sections +c partial cross sections start in column #3 of SigmaLN in blockres.f + do 10 ii=3,nCh+2 +c get pointer for partial cross section + iline=SigmaLn(ii,1,isigline) +c normal partial cross sections + if(iline.gt.0) then + call crossx(iline,sqrts,ityp1,iso31,fmass(ind1), + & ityp2,iso32,fmass(ind2),sigma) + else +c detailed balance partial cross section (must be computed now) +c (crossz delivers inelastic channel for SINGLE resonance) + call crossz(iline,sqrts,ityp1,iso31,fmass(ind1), + & ityp2,iso32,fmass(ind2),sigma) + endif +c perform summation of partial cross sections + sigtot=sigtot+sigma +c end of loop for partial cross sections + 10 continue +c end of total / sum of partial cross sections if + endif + +c return to caller + return + + end + + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine getnext(k) +c +c Revision : 1.0 +C +coutput k : index of next collison +c +c {\tt getnext} returns the index of the next collision or decay +c to be performed. +c If no further collisons occur in the timestep, {\tt getnext} returns +c {\tt k}=0 . +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC +C + implicit none + integer k + include 'coms.f' + include 'options.f' + include 'colltab.f' + +c shrink collision tables in case 80% load to counter possible overflow + if(dble(nct)/ncollmax.ge.0.8) call collshrink + +c +c set k to current collision/decay (which has already been performed and +c and is outdated by the time of this call) + k = actcol + + 1 continue +c increment counter, next entry in table is now the current one + k = k+1 +c if the end of the collision table has been reached, return with k=0 + if (k.gt.nct) then + k = 0 + actcol = k + return + endif + +c if the current entry in the collision table is marked "F" - false - +c (due to previous interaction of one of the collision partners) +c then find new collision partners for the particle(s) via calls +c to collupd + if (.not.ctvalid(k)) then + call collupd(cti1(k),1) +c second call only if not a decay entry + if(cti2(k).gt.0) call collupd(cti2(k),1) +c if the current collision is now marked "T" - true - return + if(ctvalid(k)) then + actcol = k + return + endif +c the current collision is still marked false, go to top of loop +c (and increment counter) + goto 1 + endif +c +c the current entry is marked "T" - true - this is the next +c collision to be perfomed + actcol = k + return + end + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine collshrink +c +c Revision : 1.0 +c +c This subroutine deletes all entries in the collision tables between +c 1 and {\tt actcol}-1. It's purpose is to counter a possible overflow +c of the collision tables. +c +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + implicit none + integer i + include 'colltab.f' + + do 104 i=actcol,nct + cttime(1+i-actcol) = cttime(i) + ctsqrts(1+i-actcol) = ctsqrts(i) + ctsigtot(1+i-actcol) = ctsigtot(i) + cti1(1+i-actcol) = cti1(i) + cti2(1+i-actcol) = cti2(i) + ctvalid(1+i-actcol) = ctvalid(i) + ctcolfluc(1+i-actcol) = ctcolfluc(i) + 104 continue +c recalculate number of collisions in tables + nct=1+nct-actcol +c reset pointer to current collision + actcol=1 + + return + end + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine colload +c +c Revision : 1.0 +c +c +c This routine fills the collision tables with all collisions and decays +c to be performed in the current timestep. Within the timestep, +c particle propagation is assumed on straight lines. This routine +c actually only performs the outer of the double particle loop and +c calls {\tt collupd} for the inner loop. +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + integer i + + include 'coms.f' + include 'colltab.f' + +c reset number of collisions in table and current collision pointer + nct = 0 + actcol = 0 + +c reset all collision arrays + do 10 i=1,ncollmax + cttime(i)=0.d0 + ctsqrts(i)=0.d0 + ctsigtot(i)=0.d0 + cti1(i)=0 + cti2(i)=0 + ctvalid(i)=.false. + ctcolfluc(i)=1.d0 + 10 continue + +c outer loop over all particles + do 20 i=1,npart +c call collupd for inner loop, -1: inner loop only from i+1 to npart + call collupd(i,-1) + 20 continue + return + end + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine collupd(i,all) +c +c Revision : 1.0 +C +cinput i : particle to be checked for collison or decay +cinput all : flag for update mode +c +c {\tt collupd} checks whether particle {\tt i} will collide or decay +c in the time interval between the current time {\tt acttime} +c and the end of the time step. +c {\tt collupd} uses the variable {\tt tmin} to find the {\bf earliest} +c interaction/decay of particle {\tt i} and store it in the +c collision arrays via a call to {\tt ctupdate}. +c For {\tt all}$>0$ all other particles from 1 to {\tt npart} are checked +c (necessary for update after a collision/decay), whereas for +c {\tt all}$<0$ only the particles with the indices from {\tt i+1} to +c {\tt npart} are checked (for calls via {\tt colload}). +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + + include 'coms.f' + include 'options.f' + include 'colltab.f' + include 'boxinc.f' + + real*8 dst2 + integer i,all + integer j,imin,jmin,j0,A + integer wall + integer stidx + logical isstable + real*8 tn, wallcoll +cc + real*8 tcoll,sqrs,sigt,sqrts,sigtot + real*8 smin,sigmin,sigfac + + real*8 colfaci,colfacj,colfac,colfacmin + +c number of "initial" particles in event + A = At+Ap +c initially tmin is set to the time-interval until the end of the timestep +c tmin is then minimized to the time of the first interaction of +c particle i +c +c acttime: current time +c time: time at beginning of timestep +c dtimestep: length of timestep + tmin=dtimestep-acttime+time +c +c other information to be stored together with tmin + smin = 0 ! sqrt(s) of interaction + sigmin = 0 ! total cross section of interaction + imin = 0 ! index of first particle + jmin = 0 ! index of second particle +c +c check, if particle i is a resonance, that might decay within the remaining +c part of the timestep. +c If so, than treat decay as collision (with particle 2= 0) + if (dectime(i)-acttime.lt.tmin) then + isstable = .false. + do 132 stidx=1,nstable + if (ityp(i).eq.stabvec(stidx)) then +c write (6,*) 'no decay of particle ',ityp(i) + isstable = .true. + endif + 132 enddo + if (.not.isstable) then + tmin = dectime(i) - acttime + smin=fmass(i) + imin = i + jmin = 0 + endif + endif + + +ccccccccccccccccccccccccccccccccc +c new walls selected if mbflag equals 2 + if ((mbox.gt.0).and.(mbflag.eq.2)) then + +c acttime is the ACTUAL time +c time is the time at the BEGINNING of the timestep +c tmin is being minimized RELATIVE to the beginning of the timestep + +c tn is the relativ time to the next wall colision + tn=wallcoll(i,wall) + +c comparison wheather a particle decays before a wall colision + if (tn.lt.tmin) then +c set the time + tmin=tn +c set the particle number + imin=i +c set the wall + jmin=wall + endif + endif +cc + + +c default setting: loop does only go from i+1 to npart + j0 = i+1 +c in case of "update mode" let loop run starting from 1 + if (all.gt.0) j0 = 1 +c +c Now check, which is the earliest collision of particle i +c + do 101 j=j0,npart + +c check for some exclusion cases + if ( +c 1. avoid "self-interaction" + & i.ne.j +c 2. particles which have interacted with each other in the past +c are only allowed to interact with each other if at least one +c of them has had an interaction in between. +c (due to string-decays the structure is a little complicated, since +c one particle can have multiple partners of it's last interaction) + & .AND. + & ((lstcoll(i).ne.j.and.lstcoll(i).ne.(nmax+strid(j)+1)) + & .or. + & (lstcoll(j).ne.i.and.lstcoll(j).ne.(nmax+strid(i)+1)) + & .or. + & (lstcoll(i).eq.0.and.lstcoll(j).eq.0)) +c 3. Particles within the projectile or target respectively are per +c default only allowed to interact with each other in case they +c have already had an interaction with a particle of the target +c or projectile respectively. This can be turned off by setting +c CTOption(6) to a nonzero value. +c This rule of course must not not apply to produced particles. +c In the case of a meson nucleus collision, projectile and +c target may be swapped in the particle vectors (therefore the +c use of Apt instead of Ap, because Apt has been then swapped +c accordingly) + & .AND. + & (CToption(6).ne.0.or.i.gt.A.or.j.gt.A.or. + & ncoll(i)+ncoll(j).gt.0.or. + & (i.le.Apt.and.j.gt.Apt).or.(j.le.Apt.and.i.gt.Apt)) + & ) then + +c +c determine time of minimal approach of particles i and j +c relative to current time + call nxtcoll(i,j,dst2,tcoll) +c +c are the particles close enough - check cut off +c (default: 250 mbarn, defined in coms.f) + if (dst2.lt.hit_sphere) then +c does the collision occur in the current time step? + if (tcoll.gt.0.d0.and.tcoll.lt.tmin) then +c get sqrt(s) and total cross section + sqrs = sqrts(i,j) +c +c reduced cross section for leading hadrons of string fragmentation +c within their formation time +c the scaling factor is sigfac which is determined by the +c individual particles scaling factors xtotfac + if(tform(i).le.acttime+tcoll + & .and.tform(j).le.acttime+tcoll) then + sigfac=1.d0 + else if(tform(i).le.acttime+tcoll + & .and.tform(j).gt.acttime+tcoll) then + sigfac=xtotfac(j) + else if(tform(j).le.acttime+tcoll + & .and.tform(i).gt.acttime+tcoll) then + sigfac=xtotfac(i) + else + sigfac=xtotfac(i)*xtotfac(j) + endif +c get total cross section via call to sigtot and rescale + sigt = sigfac*sigtot(i,j,sqrs) +c rescale sigtot due to color fluctuations +ctp060202 call colorfluc(ityp(i),ityp(j),sqrs, + call colorfluc(ityp(i),ityp(j), + & colfaci,colfacj) + colfac=colfaci*colfacj + sigt = sigt*colfac +c are we within the geometrical cross section + if (sigt.gt.max(1.d-8,(10.d0*pi*dst2))) then +c this collision is to beat, now + tmin = tcoll + smin = sqrs + sigmin = sigt + imin = i + jmin = j + colfacmin=colfac + endif + endif + endif + endif + 101 continue + if (imin.gt.0) then +c if we found something, then update table via call to ctupdate +c (keep in mind: tmin is relative to actual time!) + call ctupdate(imin,jmin,acttime+tmin,smin,sigmin,colfacmin) +c in case of "full load mode" after every collision +c only the first entry in the collision table is relevant + if(CTOption(17).ne.0) nct=1 + endif + + return + end + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine ctupdate(i,j,t,s,sig,cfac) +c +cinput i : index of 1st colliding particle +cinput j : index of 2nd colliding particle (0 for decay) +cinput t : (absolut) time of collision/decay +cinput s : $sqrt{s}$ (GeV) of collison +cinput sig : total cross section (mbarn) of collision +cinput cfac : scaling factor for color fluctuation +c +c This subroutine updates the collision arrays. +c It determines the (chonologically) correct position for the new +c entry in the collision arrays, creates the respective slot and +c inserts the new entry (via a call to {\tt ctset}. +c Then the arrays are scanned to tag the chonologically first collision +c of particle {\tt i} or {\tt j} {\em true} and all subsequent ones +c as {\em false}. +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + + implicit none + + integer i,j + real*8 t,s,sig,cfac + include 'colltab.f' + integer k,tfound,ncoll1 + + ncoll1 = nct + 1 + tfound = ncoll1 +c loop over all collisions in table + do 101 k=actcol+1,nct +c get the correct position for the new entry (chronologically sorted) + if (tfound.eq.ncoll1.and.t.le.cttime(k)) tfound = k +c the above construct works as follows: +c as long as t > cttime(k), the first term is true and teh +c the second is false. At the correct position for the new +c entry BOTH terms are true, for all later times the first +c term is false in order not to overwrite the value of tfound + 101 continue + +c make sure that collision is not already listed in the table + if (.not.(t.eq.cttime(tfound).and.(i.eq.cti1(tfound).and. + & j.eq.cti2(tfound).or.i.eq.cti2(tfound).and. + & j.eq.cti1(tfound)))) then +c then create slot for new entry + do 102 k=nct,tfound,-1 + cttime(k+1) = cttime(k) + ctsqrts(k+1) = ctsqrts(k) + ctsigtot(k+1) = ctsigtot(k) + cti1(k+1) = cti1(k) + cti2(k+1) = cti2(k) + ctvalid(k+1) = ctvalid(k) + ctcolfluc(k+1) = ctcolfluc(k) + 102 continue +c increment number of collisions/decays in table + nct = ncoll1 + endif +c insert new entry into the created slot via call to ctset + call ctset(tfound,i,j,t,s,sig,cfac) +c +c only the chonologically FIRST collision of particle i is set to true +c + do 103 k=actcol+1,nct,1 +c the newly found collision must be omitted in the following sequence + if (k.eq.tfound) goto 103 +c is there already a collision with i or j ? + if (cti1(k).eq.i.or.cti2(k).eq.i) then +c if the other collision is at an earlier time (the table is time-ordered, +c therefore k < tfound corresponds to an earlier time) +c then set the new one to false or vice versa + if (k.lt.tfound.and.ctvalid(k)) then + ctvalid(tfound) = .false. + else + ctvalid(k) = .false. + endif + endif +c do likewise for the second particle + if (j.gt.0.and.(cti1(k).eq.j.or.cti2(k).eq.j)) then + if (k.lt.tfound.and.ctvalid(k)) then + ctvalid(tfound) = .false. + else + ctvalid(k) = .false. + endif + endif + 103 continue + + return + end + + + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c + subroutine ctset(tfound,i,j,t,s,sig,cfac) +c +c Revision : 1.0 +C +cinput tfound : index in coll. array for coll. to be inserted +cinput i : index of first colliding particle +cinput j : index of second colliing particle (0 for decay, negative: wall) +cinput t : (absolute) time of collision +cinput s : $sqrt{s}$ (GeV) of collison +cinput sig : total cross section (mbarn) of collsion +cinput cfac : scaling factor for color fluctuation +c +c {\tt ctset} enters the collision of particles {\tt i} and {\tt j} +c into the collision arrays at index {\tt tfound}. +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + + implicit none + + integer tfound,i,j + + real*8 t,s,sig,cfac + include 'colltab.f' +c + cttime(tfound) = t + ctsqrts(tfound) = s + ctsigtot(tfound) = sig + cti1(tfound) = i + cti2(tfound) = j + ctvalid(tfound) = .true. + ctcolfluc(tfound) = cfac + return + end + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c + real*8 function sqrts(i,j) +c +c Revision : 1.0 +c +c input: i,j : numbers of colliding particles +c output: $\sqrt{s}$ of collision as return value +c +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + + implicit none + + include 'coms.f' + integer i,j + real*8 p10,p20 + p10 = sqrt((px(i)+ffermpx(i))**2 + + +(py(i)+ffermpy(i))**2 + + +(pz(i)+ffermpz(i))**2+fmass(i)**2) + p20 = sqrt((px(j)+ffermpx(j))**2 + + +(py(j)+ffermpy(j))**2 + + +(pz(j)+ffermpz(j))**2+fmass(j)**2) + sqrts = sqrt((p10+p20)**2 + + -(px(i)+ffermpx(i)+px(j)+ffermpx(j))**2 + + -(py(i)+ffermpy(i)+py(j)+ffermpy(j))**2 + + -(pz(i)+ffermpz(i)+pz(j)+ffermpz(j))**2) + return + end + + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine nxtcoll(j,k,dst,dtauc) +c +c Revision : 1.0 +c +c input: j,k : indices of colliding particles +coutput dst : impact parameter squared +coutput dtauc : collisiontime in the computational system +c +c {\tt nxtcoll} is the heart of the collision term. It determines +c the time in the computional system, when the collision between +c j and k took or will take place ({\tt dtauc}). The squared impact +c parameter of the collision is returned in {\tt dst}. {\tt dst} is +c independent of the computational system in which the coordinates +c of j and k are given. +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + integer j,k, i + include 'coms.f' + real*8 u1(0:3), u2(0:3), p1(0:3), p2(0:3) + real*8 dp(0:3), du(0:3), bt_com(3), bt(3) + real*8 du2, dp2, dudp, bt_du, bt_dp, btdr, bt2 + real*8 dst, gam_com, gam_com2, bt_com2, dtauc + +c +c do some assignments first +c + u1(0) = r0(j) + u1(1) = rx(j) + u1(2) = ry(j) + u1(3) = rz(j) + u2(0) = r0(k) + u2(1) = rx(k) + u2(2) = ry(k) + u2(3) = rz(k) + + p1(0) = sqrt(px(j)**2+py(j)**2+pz(j)**2+fmass(j)**2) + p1(1) = px(j) + p1(2) = py(j) + p1(3) = pz(j) + p2(0) = sqrt(px(k)**2+py(k)**2+pz(k)**2+fmass(k)**2) + p2(1) = px(k) + p2(2) = py(k) + p2(3) = pz(k) +c +c -velocity and gamma-factor of the two particle center of momentum +c frame (com) measured in the computational system +c + bt_com2 = 0.0d0 + do 1 i=1,3 + bt_com(i) = -((p1(i)+p2(i))/(p1(0)+p2(0))) + bt_com2 = bt_com2 + bt_com(i)**2 + 1 continue + gam_com = 1.0d0/sqrt(1.0d0-bt_com2) + gam_com2 = gam_com**2/(1.0d0+gam_com) +c +c calculate some numbers which are needed for the Lorentz-transformation +c + bt_du = 0.0d0 + bt_dp = 0.0d0 + do 2 i=1,3 + bt_du = bt_du + bt_com(i)*(u1(i) - u2(i)) + bt_dp = bt_dp + bt_com(i)*(p1(i) - p2(i)) + 2 continue +c +c calculate bt_com square and the dotproduct bt_com*(r(j)-r(k)), +c where the r's are given in the computational frame +c +c perform Lorentz-transformation of relative distance and relative +c momentum vectors of particles j and k into com-frame +c +c use the resulting 3-vectors du and dp to obtain du and dp squared +c and the dotproduct du*dp +c + du2 = 0.0d0 + dp2 = 0.0d0 + dudp = 0.0d0 + bt2 = 0.0d0 + btdr = 0.0d0 + do 3 i=1,3 + bt(i) = p1(i)/p1(0) - p2(i)/p2(0) ! Rechensystem rel. vel. + bt2 = bt2 + bt(i)**2 + btdr = btdr + bt(i)*(u1(i)-u2(i)) ! Rechensystem + du(i) = u1(i)-u2(i) + bt_com(i)* + * (gam_com2*bt_du+gam_com*(u1(0)-u2(0))) + dp(i) = p1(i)-p2(i) + bt_com(i)* + * (gam_com2*bt_dp+gam_com*(p1(0)-p2(0))) + du2 = du2 + du(i)*du(i) + dp2 = dp2 + dp(i)*dp(i) + dudp = dudp + du(i)*dp(i) + 3 continue +c +c obtain collision time and impact parameter squared +c + dtauc = -(btdr/bt2) + dst = du2 - dudp*dudp/dp2 + + end + + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine scantab(ind,offs) +c +c Revision : 1.0 +c +cinput ind : index of particle +cinput offs: offset +c +c {\tt scantab} adjusts the collision table to changed particle +c indices due to calls to {\tt addpart} or {\tt delpart}. +c +c In case of an annihilation a list is created of those particles +c which have lost their collision partner and have to be rechecked +c for possible collisions/decays. +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + include 'colltab.f' + include 'coms.f' + integer ind,offs,i,k + logical rescan + +c reset counters for the rechecking of particles due to lost collision +c partners + nsav=0 + rescan=.false. + +c call from addpart + if (offs.gt.0) then +c shift upwards, if necessary + do 1 i=1,nct + if (cti1(i).ge.ind) cti1(i) = cti1(i) + offs + if (cti2(i).ge.ind) cti2(i) = cti2(i) + offs + 1 continue +c +c call from delpart + else + +c omit scan, if last collision in table + if(actcol.eq.nct) return +c start loop with next collision in table + i=actcol+1 + 2 continue + if((cti1(i).eq.ind).or.(cti2(i).eq.ind)) then +c a dubious entry has been found, now +c look for particles with 'lost' collision partners + if(cti1(i).eq.ind.and.cti2(i).gt.0) then +c save particles with 'lost' partners in the ctsav array + nsav=nsav+1 + ctsav(nsav)=cti2(i) + if(ctsav(nsav).gt.ind) ctsav(nsav)=ctsav(nsav) + offs + elseif(cti2(i).eq.ind.and.cti1(i).gt.0) then + nsav=nsav+1 + ctsav(nsav)=cti1(i) + if(ctsav(nsav).gt.ind) ctsav(nsav)=ctsav(nsav) + offs + endif +c delete obsolete collision + do 4 k=i+1,nct + cttime(k-1) = cttime(k) + ctsqrts(k-1) = ctsqrts(k) + ctsigtot(k-1) = ctsigtot(k) + cti1(k-1) = cti1(k) + cti2(k-1) = cti2(k) + ctvalid(k-1) = ctvalid(k) + ctcolfluc(k-1) = ctcolfluc(k) + 4 continue +c decrement collision counter + nct = nct-1 + rescan=.true. + else +c else entry is OK + rescan=.false. + endif +c shift rest of table, in case entry has not been deleted + if(.not.rescan) then + if (cti1(i).gt.ind) cti1(i) = cti1(i) + offs + if (cti2(i).gt.ind) cti2(i) = cti2(i) + offs + i=i+1 + endif +c condinue procedure until all collisions have been scanned + if(i.le.nct) goto 2 + endif + + return + end + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine printtab +c +c Revision: 1.0 +c +c {\tt printtab} prints the contents of the collision arrays on +c unit 6 and marks the current collision with an *. This subroutine +c is used for debugging purposes only. +c +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + + include 'colltab.f' + integer i + character*1 c +c + write(6,*) 'colltab:' + do 101 i=1,nct + c = ' ' + if (i.eq.actcol) c = '*' + write(6,'(i4,1x,L1,A1,2(i4,1x),4(f6.3,1x))') + & i,ctvalid(i),c,cti1(i),cti2(i),cttime(i),ctsqrts(i) + 101 continue + return + end + + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +ctp060202 subroutine colorfluc(it1,it2,ws,fac1,fac2) + subroutine colorfluc(it1,it2,fac1,fac2) +c +c Revision : 1.0 +c +cinput it1 : ityp particle 1 +cinput it2 : ityp particle 2 +cinput ws : $\sqrt{s}$ of collision +coutput fac1 : x-section scaling factor of particle 1 +coutput fac2 : x-section scaling factor of particle 2 +c +c Modifies the hadron cross section due to color fluctuations, +c ref. L. Frankfurt et al.: Ann. Rev. Nucl. Part. Sc. 44 (1994)501 +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + include 'options.f' + +ctp060202 real*8 ws,fac1,fac2 + real*8 fac1,fac2 + real*8 x,y,Pmes,Pbar,ranf + integer it1,it2 + + + fac1=1d0 + fac2=1d0 + +c switched on ? + if (ctoption(42).eq.0) return + + +c particle 1 is baryon + if (abs(it1).lt.100) then + 1 x=ranf(0)*3d0 + y=ranf(0) + +c probability disrtibution for x-section factor + Pbar=(1.19+32.11*x-15.65*x**2-1.24*x**3+0.94*x**4)/18.d0 + Pbar=max(0d0,Pbar) + if(y.gt.Pbar) goto 1 + fac1=x +c particle 1 is meson + else + 2 x=ranf(0)*5d0 + y=ranf(0) + +c probability disrtibution for x-section factor + Pmes=(21.76+4.41*x-3-79*x**2+0.40*x**3)/25.d0 + Pmes=max(0d0,Pmes) + if(y.gt.Pmes) goto 2 + fac1=x + endif + +c particle 2 is baryon + if (abs(it2).lt.100) then + 3 x=ranf(0)*3d0 + y=ranf(0) + +c probability disrtibution for x-section factor + Pbar=(1.19+32.11*x-15.65*x**2-1.24*x**3+0.94*x**4)/18.d0 + Pbar=max(0d0,Pbar) + if(y.gt.Pbar) goto 3 + fac2=x +c particle 2 is meson + else + 4 x=ranf(0)*5d0 + y=ranf(0) + +c probability disrtibution for x-section factor + Pmes=(21.76+4.41*x-3-79*x**2+0.40*x**3)/25.d0 + Pmes=max(0d0,Pmes) + if(y.gt.Pmes) goto 4 + fac2=x + endif + + return + end + diff --git a/Processes/UrQMD/comnorm.f b/Processes/UrQMD/comnorm.f new file mode 100644 index 0000000000000000000000000000000000000000..fdc0b49e29569d3073c1e47a162b743e2f50758f --- /dev/null +++ b/Processes/UrQMD/comnorm.f @@ -0,0 +1,6 @@ +c $Id: comnorm.f,v 1.5 1999/01/18 09:56:55 ernst Exp $ + integer n + parameter (n = 400) + real*8 x_norm(0:3,1:n),y_norm(0:3,1:n) + real*8 y2a(0:3,1:n),y2b(0:3,1:n),dx + common /normsplin/ x_norm,y_norm,y2a,y2b,dx diff --git a/Processes/UrQMD/comres.f b/Processes/UrQMD/comres.f new file mode 100644 index 0000000000000000000000000000000000000000..e7a4a7cc393d06ad044df35dabbfa9364e7fd949 --- /dev/null +++ b/Processes/UrQMD/comres.f @@ -0,0 +1,172 @@ +c $Id: comres.f,v 1.15 2003/06/29 14:26:36 weber Exp $ +c +cdes This file contains definitions for the collision term +c + integer maxbar,maxbra,minbar + integer offmeson,maxmeson,pimeson,maxbrm,minnuc,mindel + integer maxbrs1,maxbrs2 + integer numnuc,numdel,nucleon,maxnuc,maxdel + integer minmes,maxmes + + + parameter (minnuc=1) ! lowest baryon particle ID + parameter (minmes=100) ! lowest meson particle ID + parameter (maxmes=132) ! hightest meson particle ID + +c number of resonances of a kind + parameter (numnuc=16) ! number of nucleon resonances + parameter (numdel=10) ! number of delta resonances +c indices of minimal and maximal itype of a kind (redundant but nice) + parameter (maxnuc=minnuc+numnuc-1) ! highest nucleon ID + parameter (mindel=minnuc+maxnuc) ! lowest delta ID + parameter (maxdel=mindel+numdel-1) ! highest delta ID + +c minres & maxres define the range of nonstable & nonstrange baryons + integer minres,maxres + parameter (minres=minnuc+1) ! lowest baryon resonance ID + parameter (maxres=maxdel) ! highest (nonstrange) baryon + ! resonance ID + +c strangenes.ne.0 baryon resonances + integer minlam,minsig,mincas,minome + integer numlam,numsig,numcas,numome + integer maxlam,maxsig,maxcas,maxome + parameter (numlam=13) ! number of lambda states + parameter (numsig=9) ! number of sigma states + parameter (numcas=6) ! number of cascade states + parameter (numome=1) ! number of omega states + parameter (minlam=mindel+numdel) ! ID of lowest lambda state + parameter (maxlam=minlam+numlam-1) ! ID of highest lambda state + parameter (minsig=minlam+numlam) ! ID of lowest sigma state + parameter (maxsig=minsig+numsig-1) ! ID of highest sigma state + parameter (mincas=minsig+numsig) ! ID of lowest cascade state + parameter (maxcas=mincas+numcas-1) ! ID of highest cascade state + parameter (minome=mincas+numcas) ! ID of lowest omega state + parameter (maxome=minome+numome-1) ! ID of highest omega state + +c minbar & maxbar define the range of all baryons + parameter (minbar=minnuc) ! ID of lowest baryon state + parameter (maxbar=maxome) ! ID of highest baryon state + + parameter (offmeson=minmes) ! offset between zero and lowest + ! meson state + parameter (maxmeson=maxmes) ! ID of highest meson state +c... these variables are in principal obsolete and should be exchanged +c were referenced + +c... avoid hard coded itypes + integer itrho,itome,iteta,itkaon,itphi,itetapr + parameter (itkaon=106) ! ID of kaon + parameter (itrho=104) ! ID of rho meson + parameter (itome=103) ! ID of omega meson + parameter (iteta=102) ! ID of eta + parameter (itphi=109) ! ID of phi + parameter (itetapr=107) ! ID of eta' + parameter (pimeson=101) ! ID of $\pi$ + parameter (nucleon=minnuc) ! ID of nucleon + + integer itmin,itmax + parameter (itmin=minnuc) ! lowest defined ID + parameter (itmax=maxmes) ! highest defined ID +c + parameter (maxbra=11) ! decay channels for $s=0$ baryon resonances + parameter (maxbrm=25) ! decay channels for meson resonances + parameter (maxbrs1=10)! decay channels for $s=1$ baryon resonances + parameter (maxbrs2=3) ! decay channels for $s=2$ baryon resonances + +c + integer mlt2it(maxmes-minmes) ! meson IDs sorted by multipletts + + + real*8 massoff,mresmin,mresmax + parameter (massoff=1d-4) ! offset for mass generation + parameter (mresmin=1.0765d0) ! minimum baryon resonance mass + parameter (mresmax=5d0) ! maximum baryon resonance mass + + character*45 versiontag + common /versioning/ versiontag + + real*8 massres(minbar:maxbar),widres(minbar:maxbar) + real*8 branmes(0:maxbrm,minmes+1:maxmes) + real*8 branres(0:maxbra,minnuc+1:maxdel) + real*8 branbs1(0:maxbrs1,minlam+1:maxsig) + real*8 branbs2(0:maxbrs2,mincas+1:maxcas) + integer Jres(minbar:maxbar) + integer Jmes(minmes:maxmes) + integer pares(minbar:maxbar),pames(minmes:maxmes) + integer Isores(minbar:maxbar), Isomes(minmes:maxmes) + integer brtype(4,0:maxbra),bmtype(4,0:maxbrm) + integer bs1type(4,0:maxbrs1),bs2type(4,0:maxbrs2) + real*8 massmes(minmes:maxmes) + real*8 mmesmn(minmes:maxmes) + real*8 widmes(minmes:maxmes) + integer strres(minbar:maxbar),strmes(minmes:maxmes) + + integer lbr(0:maxbra,minnuc+1:maxdel) + integer lbs1(0:maxbrs1,minlam+1:maxsig) + integer lbs2(0:maxbrs2,mincas+1:maxcas) + integer lbm(0:maxbrm,minmes+1:maxmes) + + common /resonances/ massres,widres,massmes,widmes,mmesmn, + , branres,branmes,branbs1,branbs2, + , bs1type,bs2type,lbs1,lbs2,lbm, + , jres,jmes,lbr,brtype,pares,pames, + , bmtype, + , Isores,Isomes,strres,strmes,mlt2it + +c massres : baryon mass table +c widres : baryon decay width table +c massmes : meson mass table +c widmes : meson decay width table +c mmesmn : table of minimum masses for meson resonances +c branres : branching ratios for $s=0$ baryon resonances +c branmes : branching ratios for meson resonances +c branbs1 : branching ratios for $s=1$ baryon resonances +c branbs2 : branching ratios for $s=2$ baryon resonances +c brtype : definitions of the decay branches for $s=0$ baryon resonances +c bmtype : definitions of the decay branches for meson resonances +c bs1type : definitions of the decay branches for $s=1$ baryon resonances +c bs2type : definitions of the decay branches for $s=2$ baryon resonances +c lbr : decay angular momenta for $s=0$ baryon decays +c lbm : decay angular momenta for meson decays +c lbs1 : decay angular momenta for $s=1$ baryon decays +c lbs2 : decay angular momenta for $s=2$ baryon decays +c jres : spin table for baryons +c jmes : spin table for mesons +c pares : parity table for baryons +c pames : parity table for mesons +c isores : isospin table for baryons +c isomes : isospin table for mesons +c strres : strangeness table for baryons +c strmes : strangeness table for mesons +c +c +ccccccccccccccccccccc sigtab-declarations cccccccccccccccccccccccccccccccccc + + integer itblsz,nsigs,maxreac,maxpsig,sigver +c VERSION NUMBER of SIGTAB + parameter (sigver = 1000) ! version number for collision + ! term and tables +ccccccccccccccccccccccccccccccccccccccc +c + + parameter (maxreac = 13) ! maximum number of collision classes + parameter (maxpsig = 12) ! maximum number of cross + ! sections per class + parameter (nsigs = 10) ! number of tabulated cross sections + + PARAMETER (ITBLSZ= 100) ! table size of cross section tables + + +c + integer sigmaLN(maxpsig,2,maxreac) + integer sigmainf(nsigs,20) + real*8 sigmascal(nsigs,5), sigmas(nsigs,itblsz) +c + common/sigtabi/sigmaln,sigmainf + common/sigtabr/sigmas,sigmascal + +c sigmaln : pointer array connecting collision classes with cross sections +c sigmainf : information related to tabulated cross sections +c sigmascal : information related to tabulated cross sections +c sigmas : tabulated cross sections diff --git a/Processes/UrQMD/coms.f b/Processes/UrQMD/coms.f new file mode 100644 index 0000000000000000000000000000000000000000..be4c3f43a1a91d7de36d7cb931f8938002e89060 --- /dev/null +++ b/Processes/UrQMD/coms.f @@ -0,0 +1,215 @@ +c $Id: coms.f,v 1.21 2003/06/29 14:26:36 weber Exp $ +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c +c standard common block for uQMD +c +cdes This file contains the standard commom blocks of UrQMD +c + real*8 emnuc + parameter (emnuc = 0.938) ! nucleon mass + + integer nmax, nspl + real*8 hit_sphere + parameter (nmax = 500) ! maximum number of particles + parameter (nspl = 500) ! dimension of spline arrays + parameter (hit_sphere = 8.d0) ! hard collision cutoff: 251 mbarn + +c debug and validity range + logical check, info, warn + parameter (check=.true., info=.false., warn=.false.) + + integer Ap, At, Zp, Zt, npart, nbar, nmes, ctag + integer nsteps,ranseed,event,eos,dectag,uid_cnt + integer NHardRes,NSoftRes,NDecRes,NElColl,NBlColl + real*8 time, acttime, bdist, ebeam, bimp,bmin,ecm +c 7 integer + + common /sys/ npart, nbar, nmes, ctag,nsteps,uid_cnt, + + ranseed,event,Ap,At,Zp,Zt,eos,dectag, + + NHardRes,NSoftRes,NDecRes,NElColl,NBlColl + common /rsys/ time,acttime,bdist,bimp,bmin,ebeam,ecm + +c Ap : projectile mass +c Zp : projectile charge +c At : target mass +c Zt : target charge +c npart : total number of particles +c nbar : number of baryons AND antibaryons +c nmes : number of mesons +c ctag : counter of All interactions (coll. and dec.) +c nsteps : number of timesteps +c uid_cnt : counter for assigning unique particle ID-tags +c ranseed : random number generator seed of event +c event : event counter +c eos : flag for the EoS chosen +c dectag : counter for decays +c NHardRes : counter for resonance excitation in BB collisions +c NSoftRes : counter for resonance excitation in MB collisions +c NElColl : counter for elastic collisions +c NBlColl : counter for Pauli-blocked collisions +c time : system time at beginning of timestep +c acttime : current system time +c bdist : maximum impact parameter (of event sample) +c bimp : actual impact parameter +c bmin : minimum impact parameter (of event sample) +c ebeam : incident beam energy (lab frame) +c ecm : initial projectile-hadron target-hadron c.m. energy + + logical firstseed + common /comseed/firstseed + + logical lsct(nmax), + + logSky, logYuk, logCb, logPau + common /logic/ lsct, logSky, logYuk, logCb, logPau +c 2*nmax*nmax logical + + integer spin(nmax),ncoll(nmax),charge(nmax),strid(nmax), + + ityp(nmax),lstcoll(nmax),iso3(nmax),origin(nmax),uid(nmax) +c 6*nmax integer + + + + real*8 eps, er0, pi, rho0,hqc + parameter (eps = 1.0E-12) ! small number + parameter (er0 = 1.128379167) ! used for error function + parameter (pi = 3.1415926535) ! useful constant + parameter (rho0 = 0.16) ! nuclear matter ground state density + parameter (hqc = 0.197327) ! value of $\hbar c$ + +c IMPORTANT: when you change the version number please change also +c the versiontag in blockres.f ! + integer version, laires + parameter ( version = 10035) ! version number + parameter ( laires = 10002) ! additional tag + +c MD temporary arrays + real*8 r0_t(nmax), rx_t(nmax), ry_t(nmax), rz_t(nmax) + + common/mdprop/ r0_t, rx_t, ry_t, rz_t + + real*8 + + gw, sgw, delr, fdel, dt, + + da, db, + + Cb0, Yuk0, Pau0, Sky20, Sky30, gamSky, gamYuk, drPau, dpPau, + + dtimestep +c 19 real*8 + + real*8 cutmax, cutPau, cutCb, cutYuk, cutSky, cutdww + common /cuts/ cutmax, cutPau, cutCb, cutYuk, cutSky, cutdww + + real*8 spx(nspl), spPauy(nspl), outPau(nspl), + + spCby(nspl), outCb(nspl), + + spYuky(nspl), outYuk(nspl), + + spSkyy(nspl), outSky(nspl), + + spdwwy(nspl), outdww(nspl) + + common /spdata/ spx, spPauy, outPau, spCby, outCb, + + spYuky, outYuk, spSkyy, outSky, + + spdwwy, outdww + + real*8 + + r0(nmax), rx(nmax), ry(nmax), rz(nmax), + + p0(nmax), px(nmax), py(nmax), pz(nmax), + + airx(nmax), airy(nmax), airz(nmax), + + aipx(nmax), aipy(nmax), aipz(nmax), + + aorx(nmax,4), aory(nmax,4), aorz(nmax,4), + + aopx(nmax,4), aopy(nmax,4), aopz(nmax,4), + + fmass(nmax), rww(nmax), + + dectime(nmax), tform(nmax), xtotfac(nmax) + + common/isys/spin,ncoll,charge,ityp,lstcoll,iso3,origin,strid, + + uid + common /coor/ r0, rx, ry, rz, p0, px, py, pz, fmass, rww, dectime + common /frag/ tform, xtotfac + +c spin : particle spin +c ncoll : particle number of collisions +c charge : particle charge +c strid : ID of last string, the particle was contained in +c ityp : particle ID +c lstcoll : tag of last interaction of particle +c iso3 : $2 \cdot I_3$ of particle +c origin : ID of last interaction of particle +c uid : unique particle ID tag +c r0 : particle time +c rx : $x$ coordinate +c ry : $y$ coordinate +c rz : $z$ coordinate +c p0 : particle energy +c px : $p_x$ momentum +c py : $p_y$ momentum +c pz : $p_z$ momentum +c fmass : mass of particle +c rww : ?? +c dectime : decay time of particle +c tform : formation time of particle +c xtotfac : cross section scaling factor during formation time +c + common /aios/ airx, airy, airz, aipx, aipy, aipz, + + aorx, aory, aorz, aopx, aopy, aopz + + common /pots/ Cb0, Yuk0, Pau0, Sky20, Sky30, gamSky, + + gamYuk, drPau, dpPau, gw, sgw, delr, fdel, + + dt,da, db,dtimestep + + +c spectator arrays + integer smax + parameter(smax=500) ! maximum number of spectators + real*8 r0s(smax), rxs(smax), rys(smax), rzs(smax), + + p0s(smax), pxs(smax), pys(smax), pzs(smax), + + sfmass(smax) + + + integer sspin(smax), scharge(smax), sityp(smax), siso3(smax), + + suid(smax) + + integer nspec + + common /scoor/ r0s, rxs, rys, rzs, p0s, pxs ,pys, pzs, sfmass + + common /sisys/ sspin, scharge, sityp, siso3, suid + + common /ssys/ nspec + +c sspin : spectator particle spin +c scharge : spectator particle charge +c sityp : spectator particle ID +c siso3 : $2 \cdot I_3$ of spectator particle +c r0s : spectator particle time +c rxs : spectator $x$ coordinate +c rys : spectator $y$ coordinate +c rzs : spectator $z$ coordinate +c p0s : spectator particle energy +c pxs : spectator $p_x$ momentum +c pys : spectator $p_y$ momentum +c pzs : spectator $p_z$ momentum +c sfmass : mass of spectator particle + + +c + real*8 p0td(2,nmax),pxtd(2,nmax),pytd(2,nmax),pztd(2,nmax), + + fmasstd(2,nmax) + integer ityptd(2,nmax),iso3td(2,nmax) + integer itypt(2),uidt(2),origint(2),iso3t(2) + + common /rtdelay/p0td,pxtd,pytd,pztd,fmasstd + common /itdelay/ityptd,iso3td + common /svinfo/itypt,uidt,origint,iso3t + +c p0td : energy of parent particles of resonace (DP formalism) +c pxtd : $p_x$ of parent particles of resonace (DP formalism) +c pytd : $p_y$ of parent particles of resonace (DP formalism) +c pztd : $p_z$ of parent particles of resonace (DP formalism) +c fmasstd : mass of parent particles of resonace (DP formalism) +c ityptd : ID of parent particles of resonace (DP formalism) +c iso3td : $2\cdot I_3$ of parent particles of resonace (DP formalism) + + real*8 ffermpx(nmax), ffermpy(nmax), ffermpz(nmax) + real*8 peq1, peq2 + common /ffermi/ ffermpx, ffermpy, ffermpz + common /peq/ peq1,peq2 + +c ffermpx : fermi momentum in $x$ direction +c ffermpy : fermi momentum in $y$ direction +c ffermpz : fermi momentum in $z$ direction diff --git a/Processes/UrQMD/comstr.f b/Processes/UrQMD/comstr.f new file mode 100644 index 0000000000000000000000000000000000000000..570effcc8fc4ae48ada2407999dc7b32228a368e --- /dev/null +++ b/Processes/UrQMD/comstr.f @@ -0,0 +1,23 @@ +c $Id: comstr.f,v 1.2 1999/01/18 09:56:58 ernst Exp $ + + parameter (njspin=8) + + real*8 PJSPNS,PMIX1S(3,njspin),PMIX2S(3,njspin),PBARS, + *PARQLS,PARRS + real*8 PJSPNC,PMIX1C(3,njspin),PMIX2C(3,njspin),PBARC + + + + COMMON/FRGSPA/ PJSPNS,PMIX1S,PMIX2S,PBARS, + *PARQLS,PARRS + COMMON/FRGCPA/ PJSPNC,PMIX1C,PMIX2C,PBARC + +c parm gives the probability for different meson multiplets according +c to spin degeneracy and average mass ratios +c spin-parity 0- : 1- : 0+ : 1+ : 2+ = parm(1):parm(2)...:parm(njspin) + real*8 parm(njspin) + + common/coparm/parm + + real*8 pi + COMMON/CONST/ PI diff --git a/Processes/UrQMD/comwid.f b/Processes/UrQMD/comwid.f new file mode 100644 index 0000000000000000000000000000000000000000..fe0b2b97f9928f70749910d5121eb760bfa0cbdb --- /dev/null +++ b/Processes/UrQMD/comwid.f @@ -0,0 +1,60 @@ +c $Id: comwid.f,v 1.13 2003/06/29 14:26:36 weber Exp $ +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c +c Revision : 1.0 +c +c common block for the tabulated branching ratios +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + +c number of points for the interpolation + integer widnsp +c the branching ratios are interpolated with high precision in the range +c from mintab to maxtab1 and from maxtab1 to maxtab2 with a smaller precision + +c version number of the table + integer tabver + real*8 mintab, maxtab1, maxtab2 + +c set the default values + parameter (widnsp=120) + parameter (mintab=0.1d0) + parameter (maxtab1=5.0d0) + parameter (maxtab2=50.0d0) +c increase this parameter, if you make changes, which require a new table + parameter (tabver=9) + +c tabulated x-values (i.e. sqrt(s) of the collision) + real*8 tabx (1:widnsp) +c tabulated y-values (i.e. the branching ratios) and the second +c derivatives of the function. +c full baryon ratio + real*8 fbtaby (1:widnsp,minbar:maxbar,1:2) +c partial baryon ratios +cdh real*8 pbtaby (1:widnsp,1:2,minbar:maxbar,0:maxbrs1) + real*8 pbtaby (1:widnsp,1:2,minbar:maxbar,0:maxbra) +c full meson ratio + real*8 fmtaby (1:widnsp,minmes:maxmes,1:2) +c partial meson ratios + real*8 pmtaby (1:widnsp,1:2,minmes:maxmes,0:maxbrm) + +c Breit-Wigner norms +c norm of Breit-Wigner with mass dependent widths baryons/mesons + real*8 bwbarnorm(minbar:maxbar),bwmesnorm(minmes:maxmes) + +c tabulated fppfit() +c tabulated x-values (i.e. sqrt(s) of the collision) + real*8 tabxnd (1:widnsp) +c 2-resonance channels +c x deriv ND N*..D* + real*8 frrtaby(1:widnsp,1:2,1:2,2:maxdel) + +c this flag indicates the progress of tabulating the function + integer wtabflg +c name of file containing the tables + character*77 tabname + + common /decaywidth/ tabx,fbtaby,pbtaby,fmtaby,pmtaby,wtabflg + common /brwignorm/ bwbarnorm,bwmesnorm + common /xsections/ tabxnd,frrtaby + common /tabnames/ tabname diff --git a/Processes/UrQMD/dectim.f b/Processes/UrQMD/dectim.f new file mode 100644 index 0000000000000000000000000000000000000000..5c803ee70ad6465360babe4bb5cc1b8dee868f52 --- /dev/null +++ b/Processes/UrQMD/dectim.f @@ -0,0 +1,77 @@ +c $Id: dectim.f,v 1.7 1999/01/18 09:56:59 ernst Exp $ +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + real*8 function dectim(ind,iproc) +c +c Revision : 1.0 +C +cinput ind : ID of particle +cinput iproc: process ID for resonance creation +couput dectim: time of decay +c +c This function computes a random choice for the time at which +c a resonance will decay and transformes it to the computational +c frame. +c +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + include 'coms.f' + include 'options.f' + include 'colltab.f' + + integer ind,iproc + real*8 gg,wid,tau,ranf,fwidth,widit,fbwnorm,mr,massit + real*8 tmp,factor +c +c first determine width of resonace +c + if(CTOption(1).eq.0.and.CTOption(34).ne.1) then +c mass dependent width + wid=fwidth(ityp(ind),iso3(ind),fmass(ind))*CTParam(1) + else +c fixed width + wid=widit(ityp(ind))*CTParam(1) + end if + +C ... REST FRAME DECAY TIME + if(WID .GT. 1.d-10) then + if(CTOption(34).lt.2) then +c "normal" life time tau=1/gamma + TAU=-(dLOG(1.d0-RANF(0))/WID) + else +c use Danielewicz delay + if(iproc.ne.36.and.iproc.ne.37) then +c delay for scattering wave + TAU=-(dLOG(1.d0-RANF(0))* + & fbwnorm(fmass(ind),ityp(ind),iso3(ind))*pi/2.d0) + else +c delay for forward wave + if(CTOption(34).eq.2) then + factor=1.d0/CTParam(58) + elseif(CTOption(34).eq.3) then + factor=(ctsigtot(actcol)-CTParam(58))/CTParam(58) + elseif(CTOption(34).eq.4) then + tmp=dsqrt(2.d0/(wid*3.14d0* + & fbwnorm(fmass(ind),ityp(ind),iso3(ind)))) + factor=1.d0/(CTParam(58)*tmp) + else + factor=1.d0 + endif + mr=massit(ityp(ind)) + TAU=-(dLOG(1.d0-RANF(0))*factor* + & 2.d0*pi*fbwnorm(fmass(ind),ityp(ind),iso3(ind))* + & (fmass(ind)-mr)**2/wid**2) + endif + endif + ELSE +c stable particle + DECTIM=1.d34 + RETURN + END IF +C ... APPLY TIME DILATION +C ... GAMMA FOR THE RESONANCE RESTFRAME <-> COMP. FRAME TRAFO + gg=p0(ind)/fmass(ind) + DECTIM=TAU*GG*hqc + + RETURN + END diff --git a/Processes/UrQMD/delpart.f b/Processes/UrQMD/delpart.f new file mode 100644 index 0000000000000000000000000000000000000000..73bbe76a36f1e711566acc916bd99089cc3f0f63 --- /dev/null +++ b/Processes/UrQMD/delpart.f @@ -0,0 +1,243 @@ +c $Id: delpart.f,v 1.5 2000/01/12 16:02:34 bass Exp $ +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + subroutine delpart(index) +c +c Revision : 1.0 +c +cinput index : index of particle to delete +c +c This subroutine deletes the entry of particle {\tt index} in all +c particle arrays. +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + include 'coms.f' + include 'comres.f' + include 'newpart.f' + include 'freezeout.f' + integer index,i,j,ind + + ind=index + if(ind.lt.1.or.ind.gt.npart) then + write(6,*)'***(E) delpart: ind out of bounds ',ind,npart + stop + endif + +c update nbar and nmes counters + if(iabs(ityp(ind)).le.maxbar) then + nbar=nbar-1 + elseif(iabs(ityp(ind)).ge.minmes)then + nmes=nmes-1 + endif + +c delete slot + do 10 i=ind+1,npart + r0(i-1)=r0(i) + rx(i-1)=rx(i) + ry(i-1)=ry(i) + rz(i-1)=rz(i) + p0(i-1)=p0(i) + px(i-1)=px(i) + py(i-1)=py(i) + pz(i-1)=pz(i) + fmass(i-1)=fmass(i) + ityp(i-1)=ityp(i) + iso3(i-1)=iso3(i) + ncoll(i-1)=ncoll(i) + lstcoll(i-1)=lstcoll(i) + charge(i-1)=charge(i) + spin(i-1)=spin(i) + dectime(i-1)=dectime(i) + tform(i-1)=tform(i) + xtotfac(i-1)=xtotfac(i) + origin(i-1)=origin(i) + strid(i-1)=strid(i) + uid(i-1)=uid(i) + frr0(i-1)=frr0(i) + frrx(i-1)=frrx(i) + frry(i-1)=frry(i) + frrz(i-1)=frrz(i) + frp0(i-1)=frp0(i) + frpx(i-1)=frpx(i) + frpy(i-1)=frpy(i) + frpz(i-1)=frpz(i) + ffermpx(i-1)=ffermpx(i) + ffermpy(i-1)=ffermpy(i) + ffermpz(i-1)=ffermpz(i) + r0_t(i-1)=r0_t(i) + rx_t(i-1)=rx_t(i) + ry_t(i-1)=ry_t(i) + rz_t(i-1)=rz_t(i) +ctd + do 11 j=1,2 + p0td(j,i-1)=p0td(j,i) + pxtd(j,i-1)=pxtd(j,i) + pytd(j,i-1)=pytd(j,i) + pztd(j,i-1)=pztd(j,i) + fmasstd(j,i-1)=fmasstd(j,i) + ityptd(j,i-1)=ityptd(j,i) + iso3td(j,i-1)=iso3td(j,i) + 11 continue + +c ... + 10 continue + npart=npart-1 + +c update entries of lstcoll vector + do 15 i=1,npart + if(lstcoll(i).le.nmax) then + if(lstcoll(i).eq.ind) then + lstcoll(i)=0 + elseif(lstcoll(i).gt.ind) then + lstcoll(i)=lstcoll(i)-1 + endif + endif + 15 continue + +c update collision tables +c and scan for particles which have lost their collision partner + call scantab(ind,-1) + +c update pointer array for new/scattered particles + do 20 i=1,nexit + if(inew(i).gt.ind) then + inew(i)=inew(i)-1 + elseif(inew(i).eq.ind) then + inew(i)=0 + endif + 20 continue + return + end + + + +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + subroutine adspec(index) +c +c Revision : 1.0 +c +cinput index : index of particle to delete +c +c This subroutine deletes the entry of particle {\tt index} in all +c particle arrays and writes it to file 14 and 16 by the call +c of specout +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + include 'coms.f' + include 'comres.f' + include 'newpart.f' + integer index,i,ind + + ind=index + if(ind.lt.1.or.ind.gt.npart) then + write(6,*)'***(E) adspec: ind out of bounds ',ind,npart + stop + endif + +cernst fill spectator-arrays + nspec=nspec+1 + r0s(nspec)=r0(ind) + rxs(nspec)=rx(ind) + rys(nspec)=ry(ind) + rzs(nspec)=rz(ind) + p0s(nspec)=p0(ind) + pxs(nspec)=px(ind) + pys(nspec)=py(ind) + pzs(nspec)=pz(ind) + sfmass(nspec)=fmass(ind) + sspin(nspec)=spin(ind) + scharge(nspec)=charge(ind) + sityp(nspec)=ityp(ind) + siso3(nspec)=iso3(ind) + suid(nspec)=uid(ind) + +c update nbar and nmes counters + if(iabs(ityp(ind)).le.maxbar) then + nbar=nbar-1 + elseif(iabs(ityp(ind)).ge.minmes)then + nmes=nmes-1 + endif + + i=ind + call specout(i,14) + call specout(i,16) + + do 10 i=ind+1,npart + r0(i-1)=r0(i) + rx(i-1)=rx(i) + ry(i-1)=ry(i) + rz(i-1)=rz(i) + p0(i-1)=p0(i) + px(i-1)=px(i) + py(i-1)=py(i) + pz(i-1)=pz(i) + fmass(i-1)=fmass(i) + ityp(i-1)=ityp(i) + iso3(i-1)=iso3(i) + ncoll(i-1)=ncoll(i) + lstcoll(i-1)=lstcoll(i) + charge(i-1)=charge(i) + spin(i-1)=spin(i) + dectime(i-1)=dectime(i) + tform(i-1)=tform(i) + xtotfac(i-1)=xtotfac(i) + uid(i-1)=uid(i) +c ... + 10 continue + npart=npart-1 + +c update entries of lstcoll vector + do 15 i=1,npart + if(lstcoll(i).eq.ind) then + lstcoll(i)=0 + elseif(lstcoll(i).gt.ind) then + lstcoll(i)=lstcoll(i)-1 + endif + 15 continue + +c update collision tables + call scantab(ind,-1) + +c update pointer array for new/scattered particles + do 20 i=1,nexit + if(inew(i).gt.ind) then + inew(i)=inew(i)-1 + elseif(inew(i).eq.ind) then + inew(i)=0 + endif + 20 continue + return + end + + +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine rmspec(bpro,btar) +cccccCcc1ccccccccc2ccccccccc3ccccccccc4ccccccccc5ccccccccc6ccccccccc7cc + implicit none + include 'coms.f' + include 'options.f' + integer i,n,nspc + real*8 sr1,sr2,srp,srt,bpro,btar,roff + real*8 nucrad + + n=npart + nspc=0 + roff=CTParam(35) + srp=(roff+nucrad(Ap))**2 + srt=(roff+nucrad(At))**2 + if(n.le.2)return + i=n + 108 continue + + sr1=ry(i)**2+(rx(i)-bpro)**2 + sr2=ry(i)**2+(rx(i)-btar)**2 + if((sr1.gt.srp.or.sr2.gt.srt).and.ityp(i).eq.1)then + write(6,*)'rmspec: ',rx(i),ry(i),i + call adspec(i) + end if + i=i-1 + if(i.ge.1)goto 108 + + return + end diff --git a/Processes/UrQMD/detbal.f b/Processes/UrQMD/detbal.f new file mode 100644 index 0000000000000000000000000000000000000000..eee1d770b8e6adf748c7d0380043face92fe2366 --- /dev/null +++ b/Processes/UrQMD/detbal.f @@ -0,0 +1,895 @@ +c $Id: detbal.f,v 1.12 1999/01/18 09:57:00 ernst Exp $ +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC +C + subroutine detbal(sqrts,ityp1,ityp2,iso31,iso32, + & em1,em2,itnew1,itnew2,dbfact) +c +c Revision : 1.0 +c +cinput sqrts : sqrt(s) +cinput ityp1 : ityp of incoming particle 1 +cinput ityp2 : ityp of incoming particle 2 +cinput iso31 : 2*I3 of incoming particle 1 +cinput iso32 : 2*I3 of incoming particle 2 +cinput em1 : mass of incoming particle 1 +cinput em2 : mass of incoming particle 2 +cinput itnew1 : ityp of outgoing particle 1 +cinput itnew2 : ityp of outgoing particle 2 +c +coutput dbfact : correction factor for cross section +c +c This subroutine calculates a correction factor for the +c partial crosssection based on the principle of detailed balance. +C +c For {\tt CTOption(3)=0} a modified detailed balance (default) is used +c which takes finite resonance widths into account. For +c {\tt CTOption(3)=1} the old standard detailed balance relation is used. +c +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC +c + implicit none + + include 'coms.f' + include 'options.f' + include 'comres.f' + include 'newpart.f' +c + + real*8 sqrts, dbfact + integer iso31, iso32 + real*8 em1, em2, clebweight + integer ityp1, ityp2, itnew1, itnew2 +c local vars for integration of Breit-Wigner: + real*8 mepsilon + real*8 oq, q, minwid, factor + integer inres, outres,idum1,idum2,idum3,idum4 +c called functions + real*8 pcms, dbweight, massit + real*8 pmean, widit, dgcgkfct + integer isoit + real*8 detbalin + external detbalin + +c +c 0.1 MeV shift for integrator-maxvalue + parameter(mepsilon=0.0001) +c minimal width for "unstable" particle + parameter( minwid=1.d-4 ) + +ctp060202 to avoid warnings with gfortran compilation + logical ctp060202 + ctp060202=.false. + if(ctp060202)write(*,*)em1,em2 +ctp060202 end + + idum1=0 + idum2=0 + idum3=0 + idum4=0 +c +c fix itypes, iso3 and phase-space for outgoing particles +c +c a) set up call to isocgk and getmass: determine outgoing isospins +c and masses + + +c +c clebweight: actually areduction of given isospin_summed cross_section +c to actual incoming channel - here it is used to probe +c wether the process in question is isospin allowed or not +c + clebweight=dbweight(isoit(ityp1),iso31,isoit(ityp2),iso32, + & isoit(itnew1),isoit(itnew2)) + if(clebweight.lt.0.00001) then + dbfact=0.d0 + return + endif + + +c +c b) determine momenta +c + pnnout=pcms(sqrts,massit(itnew1),massit(itnew2)) +c +c d) now calculate correction factor +c + +c +c call to dgcgkfct which calculates degeneracy factors and clebsches +c + factor=dgcgkfct(ityp1,ityp2,iso31,iso32,itnew1,itnew2) + + + if(CTOption(3).eq.0) then + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c modified detailed balance +c +c reference: Danielewicz and Bertsch: Nuclear Physics A533(1991) 712. +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + +c +c count resonances in the incoming channel: +c + inres=0 + if(widit(ityp1).gt.minwid) inres=inres+1 + if(widit(ityp2).gt.minwid) inres=inres+1 + +c +c count resonances in the outgoing channel: + outres=0 + if(widit(itnew1).gt.minwid) outres=outres+1 + if(widit(itnew2).gt.minwid) outres=outres+1 + + if(inres.eq.0) then +c in this case detbal without resonances, original prescription + dbfact=factor*pnnout**2/(pnn**2) +c +cccccccccccccccccccccccccccccc + elseif(inres.eq.1) then +c modified det-bal for one resonance +c + +c now generate the correction factor + dbfact=factor*pnnout**2/ + & pmean(sqrts,ityp1,iso31,ityp2,iso32, + & idum1,idum2,idum3,idum4,2) + +cccccccccccccccccccccccccc + else +c modified det-bal for two resonances +c reference: S.A. Bass, private calculation +c +ccccccccccccccccccccccccccccccccc + oq=0D0 + if(outres.gt.0) then + +c here we have B* B* to B* N + oq=pmean(sqrts,itnew1,-99,itnew2,-99, + & idum1,idum2,idum3,idum4,2) + + endif +ccccccccccccccccccccccccccccccccc + + q=pmean(sqrts,ityp1,iso31,ityp2,iso32, + & idum1,idum2,idum3,idum4,2) +c +c now generate the correction factor + if(outres.eq.0) then + dbfact=factor*pnnout**2/(max(1.d-12,q)) + else + dbfact=factor*oq/(max(1.d-12,q)) + endif + endif + + return +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c original detailed balance +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + elseif(CTOption(3).eq.1) then + dbfact=factor*pnnout**2/(pnn**2) +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c error processing +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + else + write(6,*)'undefined detailed balance mode in DETBAL' + dbfact=1. + endif +c + return + end + + +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC +C + real*8 function ppiso(pid,ityp1,iso31,ityp2,iso32,itnew1,itnew2) +c +c Revision : 1.0 +c +cinput pid : ID of process +cinput ityp1 : ityp of incoming particle 1 +cinput ityp2 : ityp of incoming particle 2 +cinput iso31 : 2*I3 of incoming particle 1 +cinput iso32 : 2*I3 of incoming particle 2 +cinput itnew1 : ityp of outgoing particle 1 +cinput itnew2 : ityp of outgoing particle 2 +c +coutput nniso : isospin-factor for the reaction $p p \to B B$ +c +c This subroutine calculates the isospin-factor for resonance +c excitation in inelastic proton proton collisions. +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC +c + implicit none + + real*8 dbweight,factor,dgcgkfct + integer isoit,pid,itag,iz1,iz2,i1,i2,im,jm,ityp1,ityp2 + integer iso31,iso32,itnew1,itnew2,itmp1,itmp2 + + include 'comres.f' + include 'newpart.f' + + + i1=ityp1 + i2=ityp2 + iz1=iso31 + iz2=iso32 + im=itnew1 + jm=itnew2 + + if(pid.gt.0) then + ppiso=dbweight(i1,iz1,i2,iz2,isoit(im),isoit(jm))/ + / dbweight(1,1,1,1,isoit(im),isoit(jm)) + else + + factor=dgcgkfct(i1,i2,iz1,iz2,nucleon,nucleon) + if(factor.le.1.d-8) then + ppiso=0.d0 + return + endif + + nexit=2 + itot(1)=isoit(nucleon) + itot(2)=isoit(nucleon) + call isocgk4(isoit(i1),iz1,isoit(i2),iz2,itot,i3new,itag) + itmp1=i3new(1) + itmp2=i3new(2) + ppiso=dbweight(nucleon,itmp1,nucleon,itmp2, + & isoit(im),isoit(jm))/ + / dbweight(1,1,1,1,isoit(im),isoit(jm)) + endif + + return + + end + +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC +C + real*8 function dgcgkfct(ityp1,ityp2,iso31,iso32,itnew1,itnew2) +c +c Revision : 1.0 +c +cinput ityp1 : ityp of incoming particle 1 +cinput ityp2 : ityp of incoming particle 2 +cinput iso31 : 2*I3 of incoming particle 1 +cinput iso32 : 2*I3 of incoming particle 2 +cinput itnew1 : ityp of outgoing particle 1 +cinput itnew2 : ityp of outgoing particle 2 +c +coutput dgcgkfct : product of degeneracy and cgk factor for detailed bal. +c +c This subroutine calculates the product of the spin and isospin +c degeneracy factors and the a isospin correction factor +c (isospin dependence of cross section) for the detailed balance +c cross section. +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC +c + implicit none + + include 'comres.f' +c + + integer iso31,iso32 + real*8 clebweight + integer ityp1, ityp2,stot(4),itnew1,itnew2 +c components of degeneracy factor + integer gin1,gin2,gout1,gout2 + real*8 dgfact +c called functions + real*8 dbweight + integer jit,isoit +c +c a) set up call to isocgk and getmass: determine outgoing isospins +c and masses + +c +c clebweight: reduction of given isospin_summed cross_section to actual +c incoming channel +c +c 1) reduction: + clebweight=dbweight(isoit(ityp1),iso31,isoit(ityp2),iso32, + & isoit(itnew1),isoit(itnew2)) + if(clebweight.lt.0.00001) then + dgcgkfct=0.d0 + return + endif + + +c c) calculate degeneracy factors +c reference: S. Bass, GSI-Report 93-13 p. 25 and references therein +c +c get spins: in-channel stot(1 and 2), out-channel stot(3 and 4) + stot(1)=jit(ityp1) + stot(2)=jit(ityp2) + stot(3)=jit(itnew1) + stot(4)=jit(itnew2) +c + + gout1=(stot(3)+1) + gout2=(stot(4)+1) + gin1=(stot(1)+1) + gin2=(stot(2)+1) +c +c +c the degeneracy factor is + dgfact=dble(gout1*gout2)/dble(gin1*gin2) +c +c d) now calculate correction factor +c +c + dgcgkfct=dgfact*clebweight +c + return + end + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + real*8 function pmean(sqrts,itp1,iz1,itp2,iz2, + & itp3,iz3,itp4,iz4,ipwr) +c +c Revision : 1.0 +c +cinput sqrts : $\sqrt{s}$ +cinput itp1 : ityp of particle 1 +cinput iz1 : $2 \cdot I_3$ of particle 1 +cinput itp2 : ityp of particle 2 +cinput iz2 : $2 \cdot I_3$ of particle 2 +cinput itp3 : ityp of particle 3 +cinput iz3 : $2 \cdot I_3$ of particle 3 +cinput itp4 : ityp of particle 4 +cinput iz4 : $2 \cdot I_3$ of particle 4 +cinput ipwr : power of $p_{mean}$ to integrate +c +c This function returns the value of the following integral: +c \begin{displaymath} +c \int\limits_{m_1= {\tt mmin}}^{\tt mmax} +c p_{CMS}^{\tt ipwr}(\sqrt{s},m_1,m_2) A_1(m_1) A_2(m_2) \; dm_1 dm_2 +c \end{displaymath} +c with $A_r(m)$ being the spectral function of the resonance: +c \begin{displaymath} +c A(m) = \displaystyle\frac{\Gamma(m)/2}{(m-m_0)^2+\Gamma(m)^2/4} +c \end{displaymath} +c +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + implicit none + +c include "comres.f" + + real*8 sqrts,minwid,q1,q2 + real*8 mmin1,mfix,mmin2,maxs1,maxs2,mepsilon,diverg1 + real*8 smass + integer itp1,ipwr,iz1,itp2,iz2,itp3,iz3,itp4,iz4 + integer inres,izz1,ind1,ind2 + +cfunctions + real*8 detbalin,widit,massit,detbalin2,mminit,pcms +c integer + external detbalin,detbalin2 + +c minimal width for "unstable" particle + parameter( minwid=1.d-3 ) +c 0.1 MeV shift for integrator-maxvalue + parameter(mepsilon=0.0001) +ctp060202 to avoid warnings with gfortran compilation + logical ctp060202 + ctp060202=.false. + if(ctp060202)write(*,*)iz3,iz4 +ctp060202 end + + + if(sqrts.le.mminit(itp1)+mminit(itp2)) then + pmean=0.d0 + return + endif + +c count broad particles and store number in inres +c NOTE: only particles 1 and 2 may be broad!!!! +c + inres=0 + if(widit(itp1).gt.minwid) inres=inres+1 + if(widit(itp2).gt.minwid) inres=inres+1 + + if(inres.eq.0) then +c in this case the Breit-Wigner distributions are Delta functions, +c no integrations necessary + smass=massit(itp2) + if(itp3.ne.0) smass=smass+massit(itp3) + if(itp4.ne.0) smass=smass+massit(itp4) + + pmean=pcms(sqrts,massit(itp1),smass)**ipwr + + return +c +cccccccccccccccccccccccccccccc + elseif(inres.eq.1) then +c modified det-bal for one resonance +c +c first determine which particle is the resonance and store ityp in ind1 + if(widit(itp1).gt.minwid) then + ind2=itp2 + ind1=itp1 + izz1=iz1 + else + ind2=itp1 + ind1=itp2 + izz1=iz2 + endif + +c now set integration boundaries + mmin1=mminit(ind1) + mfix=mminit(ind2) + + if(itp3.ne.0) mfix=mfix+massit(itp3) + if(itp4.ne.0) mfix=mfix+massit(itp4) + + maxs1=sqrts-mfix-mepsilon +c the integration might be divided by the pole of the Breit-Wigner +c then two integrations with diverg1 as upper or lower boundary +c respectively are necessary + diverg1=massit(ind1) +c +c now perform integration in function detbalin +c integrate f(m1)=pcms(sqrts,m1,m2)**ipwr*fbwnorm(m1,ityp1) + q1=0.d0 + q2=0.d0 + if(mmin1.le.diverg1) then + if(maxs1.gt.diverg1) then + call qsimp(detbalin,mmin1,diverg1, + & ind1,izz1,mfix,sqrts,ipwr,q1,-1) + call qsimp(detbalin,diverg1,maxs1, + & ind1,izz1,mfix,sqrts,ipwr,q2,1) + else + call qsimp(detbalin,mmin1,maxs1, + & ind1,izz1,mfix,sqrts,ipwr,q1,-1) + endif + else + call qsimp(detbalin,mmin1,maxs1, + & ind1,izz1,mfix,sqrts,ipwr,q2,1) + endif + + pmean=(q1+q2) + + return +c +cccccccccccccccccccccccccc + else +c 2 resonances to integrate over +c +c + if(itp3.ne.0) then + write(6,*) 'ERROR in pmean: only one broad particle allowed' + write(6,*) ' in case of 3 or 4 body decays!!' + stop + endif + + +c outer integration: +c set integration boundaries + mmin1=mminit(itp1) + mmin2=mminit(itp2) + maxs2=sqrts-mmin1 + diverg1=massit(itp2) + q1=0.d0 + q2=0.d0 + if(mmin2.le.diverg1) then + if(maxs2.gt.diverg1) then + call qsimp2(detbalin2,mmin2,diverg1, + & itp2,iz2,mmin1,itp1,iz1,ipwr,sqrts,q1,-1) + call qsimp2(detbalin2,diverg1,maxs2, + & itp2,iz2,mmin1,itp1,iz1,ipwr,sqrts,q1,1) + else + call qsimp2(detbalin2,mmin2,maxs2, + & itp2,iz2,mmin1,itp1,iz1,ipwr,sqrts,q1,-1) + endif + else + call qsimp2(detbalin2,mmin2,maxs2, + & itp2,iz2,mmin1,itp1,iz1,ipwr,sqrts,q1,1) + endif + + pmean=(q1+q2) + + return + endif + + + return + end + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c + real*8 function detbalin(m1,ityp1,iz1,m2,sqrts,ipwr) +c +c Revision : 1.0 +c +cinput m1 : mass of resonance (integration variable) +cinput ityp1 : ityp of Delta/N* resonance for fbwnorm() +cinput iz1 : $2\cdot I_3$ of resonance +cinput m2 : second mass for call to pcms +cinput sqrts : sqrt(s) +cinput ipwr : power for $p_mean$ +c +c This function is an integrand for the modified detailed balance: +c \begin{displaymath} +c detbalin(m1)=\, p_{CMS}^{\tt ipwr}(\sqrt{s},m_1,m_2) A_1(m_1) +c \end{displaymath} +c with $A_r(M)$ being the spectral function of the resonance: +c \begin{displaymath} +c A(m) = \displaystyle\frac{\Gamma(m)/2}{(m-m_0)^2+\Gamma(m)^2/4} +c \end{displaymath} +c +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + implicit none +c arguments + real*8 m1,m2,sqrts + integer ityp1,iz1,ipwr +c called functions + real*8 fbwnorm,pcms + + detbalin=pcms(sqrts,m1,m2)**ipwr*fbwnorm(m1,ityp1,iz1) + + return + end + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c + real*8 function detbalin2(m2,ityp2,iz2,min1, + & ityp1,iz1,ipwr,sqrts) +c +c Revision : 1.0 +c +c This function represents the integrand +c \begin{displaymath} +c detbalin2\,=\,A_2(m2)\; +c \int \limits_{m_N + m_{\pi}}^{\sqrt{s} - m_2} +c p_{rel}(\sqrt{s},m_1,m_2) A_1(m_1) \, d m_1 +c \end{displaymath} +c for the modified detailed balance with two resonances in the +c incoming channel. +c $A_r(M)$ is the spectral function of the resonance (see {\tt detbalin}). +c +c +cinput m2 : mass of resonance2 (outer integration in detbal) +cinput ityp1 : ityp of resonance1 +cinput ityp2 : ityp of resonance2 +cinput min1 : lower boundary for integration via {\tt qsimp} +ccinput max1 : upper boundary for integration via {\tt qsimp} +cinput iz1 : $2\cdot I_3$ of resonance 1 +cinput iz2 : $2\cdot I_3$ of resonance 2 +cinput ipwr : power for $p_mean$ +cinput sqrts : $\sqrt{s}$ +c +c output: +c detbalin2 : value of function +c +c function and subroutine calls: +c detbalin (referenced as external) +c fbwnorm +c qsimp +c +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + implicit none + integer ityp1,ityp2,iz1,iz2,ipwr + real*8 m2,min1,max1,sqrts,q1,q2,diverg1,fbwnorm,mepsilon + real*8 massit + real*8 detbalin + external detbalin +c 0.1 MeV shift for integrator-maxvalue + parameter(mepsilon=0.0001) + + max1=sqrts-m2-mepsilon + + diverg1=massit(ityp1) + q1=0.d0 + q2=0.d0 + if(min1.le.diverg1) then + if(max1.gt.diverg1) then + call qsimp(detbalin,min1,diverg1, + & ityp1,iz1,m2,sqrts,ipwr,q1,-1) + call qsimp(detbalin,diverg1,max1, + & ityp1,iz1,m2,sqrts,ipwr,q2,1) + else + call qsimp(detbalin,min1,max1, + & ityp1,iz1,m2,sqrts,ipwr,q1,-1) + endif + else + call qsimp(detbalin,min1,max1, + & ityp1,iz1,m2,sqrts,ipwr,q2,1) + endif + + detbalin2=fbwnorm(m2,ityp2,iz2)*(q1+q2) + + return + end + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + real*8 function fbwnorm(m,ires,iz1) +c +c Revision : 1.0 +c +cinput m : mass of resonance +cinput ires: ityp of resonance +cinput iz1 : $2\cdot I_3$ of resonance +c +c {\tt fbwnorm} returns a Breit-Wigner distribution (non-relativistic) +c which is normalized to 1 in the limit of mass-independent +c decay widths. However this function uses mass-dependent decay +c widths when available. The function only uses widths down to +c a lower boundary of 1 MeV, smaller widths are automatically set +c to 1 MeV. For {\tt iz=-99} fixed widths are used instead of +c a call to {\tt fwidth}. You should use {\tt fbrwig} for standard purpose +c since in case of mass dependent widths fbwnorm() is not very well +c defined for widths smaller than 1 MeV. +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + + implicit none + + real*8 m,gam2,mres,fwidth,massit,widit,gam,minwid + integer ires,ires1,iz1 + include 'comres.f' + include 'coms.f' + include 'comwid.f' + +c minimal width for "unstable" particle + parameter( minwid=1.d-3 ) + + ires1 = ires + mres = massit(ires1) + if(iz1.eq.-99.or.wtabflg.eq.0)then + gam = widit(ires1) + else + gam = fwidth(ires1,iz1,m) + end if +c cutoff for small widths + gam=max(gam,minwid) + gam2=gam**2 + fbwnorm = 0.5*gam/(pi*((m-mres)**2+gam2/4.0))!*norm + return + end + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c +c here start the numerical receipies routines for numerical integration +c no more physics beyond this point in the file!!! +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c(c) numerical receipies, adapted for f(x,idum,dum,dum) + SUBROUTINE qsimp(func,a,b,idum1,idum2,dum2,dum3,idum3,s,flag) +c +c Simpson integration via Numerical Receipies. +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + implicit none + include 'options.f' + + INTEGER JMAX,j,idum1,idum2,idum3,flag + REAL*8 a,b,func,s,EPS + REAL*8 os,ost,st,dum2,dum3 + EXTERNAL func + PARAMETER (JMAX=20) + + if(b-a.le.1.d-4) then + s=0.d0 + return + endif + + EPS = 6.d-2 + if (CTOption(35).eq.1) EPS=6.d-3 + + ost=-1.d30 + os= -1.d30 + do 11 j=1,JMAX + if(flag.eq.-1) then + call midsqu1(func,a,b,idum1,idum2,dum2,dum3,idum3,st,j) + elseif(flag.eq.1) then + call midsql1(func,a,b,idum1,idum2,dum2,dum3,idum3,st,j) + endif + s=(9.*st-ost)/8. + if (abs(s-os).le.EPS*abs(os)) return + os=s + ost=st +11 continue + write(6,*) 'too many steps in qsimp, increase JMAX!' + + return + END + +C (C) Copr. 1986-92 Numerical Recipes Software. + + + + SUBROUTINE midsqu1(funk,aa,bb,idum1,idum2,dum2,dum3,idum3,s,n) +c modified midpoint rule; allows singuarity at upper limit + implicit none + integer idum1,idum2,idum3 + real*8 dum2,dum3 + INTEGER n + REAL*8 aa,bb,s,funk + EXTERNAL funk + INTEGER it,j + REAL*8 ddel,del,sum,tnm,x,func,a,b,xx + + func(x)=2.*x*funk(bb-x**2,idum1,idum2,dum2,dum3,idum3) + + b=sqrt(bb-aa) + a=0.d0 + if (n.eq.1) then + xx=0.5d0*(a+b) + + s=(b-a)*func(0.5d0*(a+b)) + + else + it=3**(n-2) + tnm=it + del=(b-a)/(3.*tnm) + ddel=del+del + x=a+0.5*del + sum=0. + do 11 j=1,it + sum=sum+func(x) + x=x+ddel + sum=sum+func(x) + x=x+del +11 continue + s=(s+(b-a)*sum/tnm)/3. + endif + return + END + + SUBROUTINE midsql1(funk,aa,bb,idum1,idum2,dum2,dum3,idum3,s,n) +c modified midpoint rule; allows singularity at lower limit + implicit none + integer idum1,idum2,idum3 + real*8 dum2,dum3 + INTEGER n + REAL*8 aa,bb,s,funk + EXTERNAL funk + INTEGER it,j + REAL*8 ddel,del,sum,tnm,x,func,a,b + func(x)=2.*x*funk(aa+x**2,idum1,idum2,dum2,dum3,idum3) + b=sqrt(bb-aa) + a=0. + if (n.eq.1) then + s=(b-a)*func(0.5*(a+b)) + else + it=3**(n-2) + tnm=it + del=(b-a)/(3.*tnm) + ddel=del+del + x=a+0.5*del + sum=0. + do 11 j=1,it + sum=sum+func(x) + x=x+ddel + sum=sum+func(x) + x=x+del +11 continue + s=(s+(b-a)*sum/tnm)/3. + endif + return + END + + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c(c) numerical receipies, adapted for f(x,idum,dum,dum) + SUBROUTINE qsimp2(func,a,b,idum1,idum2,dum1,idum3,idum4, + & idum5,dum2,s,flag) +c +c Simpson integration via Numerical Receipies. +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + implicit none + + include 'options.f' + + INTEGER JMAX,j,idum1,idum2,idum3,idum4,idum5,flag + REAL*8 a,b,s,EPS + REAL*8 os,ost,st,dum1,dum2 + REAL*8 func + PARAMETER (JMAX=10) + external func + + if(b-a.le.1.d-4) then + s=0.d0 + return + endif + + EPS = 6.d-2 + if (CTOption(35).eq.1) EPS=6.d-3 + + ost=-1.d30 + os= -1.d30 + do 11 j=1,JMAX + if(flag.eq.-1) then + call midsqu2(func,a,b,idum1,idum2,dum1,idum3,idum4, + & idum5,dum2,st,j) + elseif(flag.eq.1) then + call midsql2(func,a,b,idum1,idum2,dum1,idum3,idum4, + & idum5,dum2,st,j) + endif + s=(9.*st-ost)/8. + + if (abs(s-os).le.EPS*abs(os)) return + os=s + ost=st +11 continue + + write(6,*) 'too many steps in qsimp2, increase JMAX!' + + return + END + + + SUBROUTINE midsqu2(funk,aa,bb,idum1,idum2,dum1,idum3,idum4, + & idum5,dum2,s,n) +c modified midpoint rule; allows singuarity at upper limit + implicit none + integer idum1,idum2,idum3,idum4,idum5 + real*8 dum1,dum2 + INTEGER n + REAL*8 aa,bb,s,funk + EXTERNAL funk + INTEGER it,j + REAL*8 ddel,del,sum,tnm,x,func,a,b + func(x)=2.*x*funk(bb-x**2, + & idum1,idum2,dum1,idum3,idum4,idum5,dum2) + b=sqrt(bb-aa) + a=0. + if (n.eq.1) then + s=(b-a)*func(0.5*(a+b)) + else + it=3**(n-2) + tnm=it + del=(b-a)/(3.*tnm) + ddel=del+del + x=a+0.5*del + sum=0. + do 11 j=1,it + sum=sum+func(x) + x=x+ddel + sum=sum+func(x) + x=x+del +11 continue + s=(s+(b-a)*sum/tnm)/3. + endif + return + END + + SUBROUTINE midsql2(funk,aa,bb,idum1,idum2,dum1,idum3,idum4, + & idum5,dum2,s,n) +c modified midpoint rule; allows singularity at lower limit + implicit none + integer idum1,idum2,idum3,idum4,idum5 + real*8 dum1,dum2 + INTEGER n + REAL*8 aa,bb,s,funk + EXTERNAL funk + INTEGER it,j + REAL*8 ddel,del,sum,tnm,x,func,a,b + func(x)=2.*x*funk(aa+x**2, + & idum1,idum2,dum1,idum3,idum4,idum5,dum2) + b=sqrt(bb-aa) + a=0. + if (n.eq.1) then + s=(b-a)*func(0.5*(a+b)) + else + it=3**(n-2) + tnm=it + del=(b-a)/(3.*tnm) + ddel=del+del + x=a+0.5*del + sum=0. + do 11 j=1,it + sum=sum+func(x) + x=x+ddel + sum=sum+func(x) + x=x+del +11 continue + s=(s+(b-a)*sum/tnm)/3. + endif + return + END diff --git a/Processes/UrQMD/dwidth.f b/Processes/UrQMD/dwidth.f new file mode 100644 index 0000000000000000000000000000000000000000..f1debcd42fe6c0618fa8ac02a9ed594dbc5ab35a --- /dev/null +++ b/Processes/UrQMD/dwidth.f @@ -0,0 +1,326 @@ +c $Id: dwidth.f,v 1.10 2001/04/06 22:08:24 weber Exp $ +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function mmean (io,m0,g,mmin,mmax) +c +cinput io : flag (see bleow) +cinput m0 : pole mass +cinput g : nominal width +cinput mmin : minimal mass +cinput mmax : maximal mass +c +c io=0 : Yields average mass between {\rm mmin} and {\rm mmax} +c according to a Breit-Wigner function with constant width {\rm g} +c and pole {\rm m0}.\\ +c io=1 : Chooses a mass randomly between {\rm mmin} and {\rm mmax} +c according to a Breit-Wigner function with constant +c width {\rm g} and pole {\rm m0}.\\ +c else: Integral of a Breit-Wigner function from {\rm mmin} to {\rm mmax}. +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + implicit none + + real*8 m0,g,mmin,mmax,x,i0,i1,inv,fmin,fmax,ranf,f,gcut + parameter(gcut=1d-10) + integer io + logical errchk + parameter (errchk=.true.) + + i0(x) =2.*g*atan( 2.* (x-m0)/ g ) + i1(x) =.5*g**2*log( (x-m0)**2+g**2/4. ) + m0*i0(x) + inv(x)=.5*g*tan( 0.5*x/g )+m0 + + +c...check for some error conditions + if(errchk)then + if(mmin.gt.mmax) + . write(6,*)'mmean: mass range negative (mmin>mmax)' + . ,mmin,mmax + if(g.le.gcut.and.(m0.gt.mmax.or.m0.lt.mmin)) + . write(6,*)'mmean: narrow particle out of mass range' + end if + + if(io.eq.0)then + if(g.le.gcut)then + mmean=0d0 + if(mmin.le.m0.and.m0.le.mmax)mmean=1d0 + else + mmean=(i1(mmax)-i1(mmin))/(i0(mmax)-i0(mmin)) + end if + else if(io.eq.1)then +c... determin a mass in a given interval + if(g.le.gcut)then + mmean=max(mmin,min(mmax,m0)) + else + fmin=i0(mmin) + fmax=i0(mmax) + f=fmin+(fmax-fmin)*ranf(0) + mmean=inv(f) + end if + else + mmean=i0(mmax)-i0(mmin) !this might not work for narrow part. + end if + return + end + + +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine getmas(m0,g0,i,iz,mmin,mmax,mrest,m) +c +cinput m0 : pole mass of resonance +cinput g0 : nominal width of resonance +cinput i : resonance ID +cinput iz : iso3 of resonance +cinput mmin : minimal mass +cinput mmax : maximal mass +coutput m : actual mass of the resonance +c +c {\tt getmas} (not $\rightarrow$ {\tt getmass}) first chooses the +c mass {\tt m} of resonance {\tt i} between {\tt mmin} and {\tt mmax} +c by a call of {\tt mmean}. Since {\tt mmean} only handles Breit-Wigners +c with constant widths it follows +c a correction such that {\tt m} is distributed according to mass +c dependent widths (corresponding to {\tt fbrwig(...,m,1)}). +c +C####C##1#########2#########3#########4#########5#########6#########7## + implicit none + include 'options.f' + include 'comres.f' + integer i,iz,nrej, nrejmax + real*8 m,m0,g0,mmin,mmax,x,x0,gg,f,g,h,pi,al,alpha,ce,mmax2 + real*8 phi,k,k0,mrest +c...functions + real*8 ranf,mmean,fbrwig,bwnorm,pcms + parameter(pi=3.1415926535d0) + parameter(alpha=3d0, ce=2d0, nrejmax=5000) + +c 'broadened' Breit-Wigner function with h(x0,al)=h(x0,1) +c normalised to alpha + h(x,x0,gg,al)=al*0.5/pi*(al*gg)/((x-x0)**2+0.25*(al*gg)**2) + +c cut-off for maximum resonance mass + mmax2=min(mresmax,mmax) + + + if(g0.lt.1d-4.or.CTOption(1).ne.0.or.CTOption(32).ne.0)then + m=mmean(1,m0,g0,mmin,mmax2) + return + else + nrej=0 + +c This is a Monte Carlo rejection method, where the invertable +c BW-distribution with constant widths is used to limit the BW-distribution +c with mass-dep. widths whose inverse is not known analytically. + +108 continue + m=mmean(1,m0,alpha*g0,mmin,mmax2) + if(m.gt.(mmax2+1d-8).or.m.lt.(mmin-1d-8))then + write(*,*)'getmas (W): m outside (mmin,mmax2)',m,mmin,mmax2 + write(*,*)'called as getmas(',m0,g0,i,mmin,mmax,')' + write(*,*)'Program stopped' + stop + endif +cdh if ((CTOption(25).eq.1).and.(mrest.gt.0.0)) then + if ((CTOption(25).eq.1).and.(mrest.gt.0.d0)) then + k=pcms(mmax2+mrest,mrest,m) + k0=pcms(mmax2+mrest,mrest,mmin) + phi = m*k / (mmin*k0) + else + phi = 1.0 + endif + +c Breit-Wigner with mass dependent widths and phase space correction + + f=fbrwig(i,iz,m,1)*phi/bwnorm(i) + g=ce*h(m,m0,g0,alpha) + + if(g.lt.f)then + write(*,*)'(W) getmas: C h(m) not limiting at m=',m + write(*,*)'->mass distribution of ',i,'might be corrupt' + endif + nrej=nrej+1 + if (nrej.le.nrejmax.and.(ranf(0)*g).gt.f) goto 108 + if (nrej.gt.nrejmax) then + write(*,*)'(W) getmas_space: too many rejections, m= ',m + write(*,*)'called with (',m0,g0,i,mmin,mmax,mrest,')' + write(*,*)'->mass distribution of ',i,' might be corrupt' + m=mmean(1,m0,alpha*g0,mmin,mmax2) + endif + + endif + + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function bwnorm(ires) +c +cinput ires : itype of resonance +c +c This function calculates the integral of {\tt fbrwig} +c between parameters {\tt mmin}(= 0~GeV) and {\tt mmax}(= 30~GeV) by +c calling {\tt qsimp3} resp. by table lookup. It's value shall +c serve as the norm of the Breit-Wigner function of particle {\tt ires} +c with mass dependent width. +c +C####C##1#########2#########3#########4#########5#########6#########7## + + implicit none + include 'comres.f' + include 'comwid.f' + include 'options.f' + integer ires,iz,isoit,it + real*8 mmin,mmax,pole,norm1,norm2 + real*8 widit,massit + parameter(mmin=0d0,mmax=50d0) + real*8 fbrwig + external fbrwig + + if((CTOption(36).ne.0.or.CTOption(1).ne.0).and.wtabflg.gt.1)then + bwnorm=1d0 + return + endif + + it=iabs(ires) + + if (wtabflg.ge.2.and.CTOption(33).eq.0) then +c table lookup + if (it.ge.minbar.and.it.le.maxbar) then + bwnorm=bwbarnorm(it) + else if (it.ge.minmes.and.it.le.maxmes) then + bwnorm=bwmesnorm(it) + else + write (6,*) '*** error(bwnorm) wrong id:',it + bwnorm=1d0 + endif + else +c calculate + if (widit(it).gt.1d-3)then + + pole=massit(it) +c arbitrary value of iz + iz=isoit(it) + +c the integration is divided by the pole of the Breit-Wigner - +c thus two integrations with pole as upper or lower boundary +c respectively are necessary + + call qsimp3(fbrwig,mmin,pole,it,iz,norm1,-1) + call qsimp3(fbrwig,pole,mmax,it,iz,norm2,+1) + bwnorm=norm1+norm2 + else + bwnorm=1d0 + endif + endif + + return + end + + +c no physics after these routines! +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c(c) numerical receipies, adapted for f(idum1,idum2,x) + SUBROUTINE qsimp3(func,a,b,idum1,idum2,s,flag) +c +c Simpson integration via Numerical Receipies. +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + implicit none + + include 'options.f' + + INTEGER JMAX,j,idum1,idum2,flag + REAL*8 a,b,func,s,EPS + REAL*8 os,ost,st + PARAMETER (JMAX=100) + external func + if(b-a.le.1.d-4) then + s=0.d0 + return + endif + + EPS = 5d-3 + if (CTOption(35).eq.1) EPS=5d-4 + + ost=-1.d30 + os= -1.d30 + do 11 j=1,JMAX + if(flag.eq.-1) then + call midsqu3(func,a,b,idum1,idum2,st,j) + elseif(flag.eq.1) then + call midsql3(func,a,b,idum1,idum2,st,j) + endif + s=(9.*st-ost)/8. + + if (abs(s-os).le.EPS*abs(os)) return + os=s + ost=st +11 continue + + write(6,*) 'too many steps in qsimp3, increase JMAX!' + + return + END + + + SUBROUTINE midsqu3(funk,aa,bb,idum1,idum2,s,n) +c modified midpoint rule; allows singuarity at upper limit + implicit none + integer idum1,idum2 + INTEGER n + REAL*8 aa,bb,s,funk + EXTERNAL funk + INTEGER it,j + REAL*8 ddel,del,sum,tnm,x,func,a,b + func(x)=2.*x*funk(idum1,idum2,bb-x**2,1) + b=sqrt(bb-aa) + a=0. + if (n.eq.1) then + s=(b-a)*func(0.5*(a+b)) + else + it=3**(n-2) + tnm=it + del=(b-a)/(3.*tnm) + ddel=del+del + x=a+0.5*del + sum=0. + do 11 j=1,it + sum=sum+func(x) + x=x+ddel + sum=sum+func(x) + x=x+del +11 continue + s=(s+(b-a)*sum/tnm)/3. + endif + return + END + + SUBROUTINE midsql3(funk,aa,bb,idum1,idum2,s,n) +c modified midpoint rule; allows singularity at lower limit + implicit none + integer idum1,idum2 + INTEGER n + REAL*8 aa,bb,s,funk + EXTERNAL funk + INTEGER it,j + REAL*8 ddel,del,sum,tnm,x,func,a,b + func(x)=2.*x*funk(idum1,idum2,aa+x**2,1) + b=sqrt(bb-aa) + a=0. + if (n.eq.1) then + s=(b-a)*func(0.5*(a+b)) + else + it=3**(n-2) + tnm=it + del=(b-a)/(3.*tnm) + ddel=del+del + x=a+0.5*del + sum=0. + do 11 j=1,it + sum=sum+func(x) + x=x+ddel + sum=sum+func(x) + x=x+del +11 continue + s=(s+(b-a)*sum/tnm)/3. + endif + return + END diff --git a/Processes/UrQMD/error.f b/Processes/UrQMD/error.f new file mode 100644 index 0000000000000000000000000000000000000000..694f15fc22a7c3ea8de7028d5cf708149dcf9750 --- /dev/null +++ b/Processes/UrQMD/error.f @@ -0,0 +1,47 @@ +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine error (function_name, message, value, level) +c +c Revision : 1.0 +c +c output of errors and warnings +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + + character function_name*(*) + character message*(*) + real*8 value + integer level + + include 'inputs.f' + + integer errdev + + errdev=6 + + if ((level.lt.1).or.(level.gt.3)) then + write (errdev,*) '*** Error in Subroutine error:' + write (errdev,*) '*** Message: Wrong Errorlevel' + write (errdev,*) '*** Related Value: ', level + endif + + if (level.eq.1) then + write (errdev,*) '*** Warning in Subroutine ',function_name,':' + elseif (level.eq.2) then + write (errdev,*) '*** Error in Subroutine ',function_name,':' + else + write (errdev,*) '*** Fatal Error in Subroutine ', + $ function_name,':' + endif + write (errdev,*) '*** Message: ',message + write (errdev,*) '*** Related Value: ',value + + if (level.ge.3) then + write (errdev,*) + write (errdev,*) '*** Program stopped.' + stop + endif + + return + end diff --git a/Processes/UrQMD/freezeout.f b/Processes/UrQMD/freezeout.f new file mode 100644 index 0000000000000000000000000000000000000000..f40e492055fe190e665c0aad160e955029abd7ec --- /dev/null +++ b/Processes/UrQMD/freezeout.f @@ -0,0 +1,13 @@ +c $Id: freezeout.f,v 1.4 1999/01/18 09:57:01 ernst Exp $ +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c +c freezeout common block for uQMD +c +c Revision : 1.0 +c +c + + real*8 frr0(nmax), frrx(nmax), frry(nmax), frrz(nmax), + + frp0(nmax), frpx(nmax), frpy(nmax), frpz(nmax) + + common /frcoor/ frr0, frrx, frry, frrz, frp0, frpx, frpy, frpz diff --git a/Processes/UrQMD/getmass.f b/Processes/UrQMD/getmass.f new file mode 100644 index 0000000000000000000000000000000000000000..85d92d97e0fda06d9f53627612dd13a6c350995d --- /dev/null +++ b/Processes/UrQMD/getmass.f @@ -0,0 +1,113 @@ +c $Id: getmass.f,v 1.9 1999/01/18 09:57:02 ernst Exp $ +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + real*8 function getmass(ssqrt,type) +c +c Revision : 1.0 +c +cinput ssqrt : maximum energy available +cinput type : class of resonance defined in getrange +coutput getmass: mass of the resonance +c +C DETERMINES MASS OF A non-strange baryon RESONANCE. +c +c function calls: massdist ranf +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + real*8 ssqrt,mdice,mm,mmax + integer type + real*8 ranf + include 'comnorm.f' + include 'comres.f' + +c... only n*,d,d* included in n_splint + + mmax=min(mresmax,ssqrt) + +c get probability mdice + call n_splint(x_norm,y_norm,y2a,n,mmax,mdice,type) + if(mdice.eq.0)write(6,*)'getmass:mdice=',mdice +c for this probability choose mass mm + call n_splint(y_norm,x_norm,y2b,n,mdice*ranf(0),mm,type) + + if(mm.lt.mresmin) then + write(6,*)'(W) getmass-error - m, mmin',mm,mresmin + mm=mresmin + else if(mm.gt.mresmax) then + write(6,*)'(W) getmass-error - m, ,max',mm,mresmax + mm=mresmax + endif + + getmass=mm + + return + end + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine norm_init +c +coutput : via common-block comnorm +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + implicit none + include 'comres.f' + include 'comnorm.f' + real*8 massdist + real*8 x(n),y(n),y21(n),y22(n) + integer i,j +c linear weighting restored +c in comnorm.f n is set to 400 again + dx = (mresmax-mresmin)/dble(n-1) ! (n-1)**2 for quad. weight + do 1 i=0,3 + y_norm(i,1) = 0.0 + y(1) = 0.0 + x_norm(i,1) = mresmin + x(1) = mresmin + do 2 j=2,n + x_norm(i,j) = mresmin+dble(j-1)*dx ! (j-1)**2 for quad. weight + x(j) = x_norm(i,j) + y(j) = y(j-1) + (x(j)-x(j-1)) ! valid for both weights + & *(massdist(x(j-1),i)+massdist(x(j),i) + & + 4.0*massdist(0.5*(x(j)+x(j-1)),i))/6.0 + y_norm(i,j) = y(j) +2 continue + call spline(x,y,n,massdist(mresmin,i), + & massdist(mresmax,i),y21) + call spline(y,x,n,1.0/massdist(mresmin,i), + & 1.0/massdist(mresmax,i),y22) + do 3 j=1,n + y2a(i,j) = y21(j) + y2b(i,j) = y22(j) +3 continue +1 continue + return + end + +c Numerical recipies: +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c (modified) + SUBROUTINE n_splint(xa,ya,y2a,n,x,y,m) + implicit none + INTEGER n,m + real*8 x,y,xa(0:3,n),y2a(0:3,n),ya(0:3,n) + INTEGER k,khi,klo + real*8 a,b,h + klo=1 + khi=n +1 if (khi-klo.gt.1) then + k=(khi+klo)/2 + if(xa(m,k).gt.x)then + khi=k + else + klo=k + endif + goto 1 + endif + h=xa(m,khi)-xa(m,klo) + if (h.eq.0.)pause 'bad xa input in splint' + a=(xa(m,khi)-x)/h + b=(x-xa(m,klo))/h + y=a*ya(m,klo)+b*ya(m,khi)+((a**3-a)*y2a(m,klo)+ + * (b**3-b)*y2a(m,khi))*(h**2)/6. + return + END +C (C) Copr. 1986-92 Numerical Recipes Software. diff --git a/Processes/UrQMD/getspin.f b/Processes/UrQMD/getspin.f new file mode 100644 index 0000000000000000000000000000000000000000..7b34e1ec1a91b5d48bbe1629f1831c683a1dbe95 --- /dev/null +++ b/Processes/UrQMD/getspin.f @@ -0,0 +1,48 @@ +c $Id: getspin.f,v 1.3 1999/01/18 09:57:03 ernst Exp $ +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC +C + integer function getspin(iityp,itag) +c +c Revision : 1.0 +c +cinput ityp : ID of particle +cinput itag : flag for return value +c +c output: $2*J_{tot}$ of particle +c +c This subroutine converts global ityp to maximum spin and optionally +c chooses a random projection ({\tt itag=-1}). +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC +c + implicit none + include 'comres.f' +c + integer ityp,iityp,jtot,itag + real*8 ranf +c + ityp=abs(iityp) + + jtot=0 + if(ityp.ge.nucleon.and.ityp.le.maxbar) then + jtot=Jres(ityp) + elseif(ityp.ge.offmeson.and.ityp.le.maxmeson) then + jtot=Jmes(ityp) + else + write(6,*)'undefined total isospin in getspin:' + write(6,*)'ityp: ',ityp + stop + endif +c + getspin=0 + if(itag.eq.1) then + getspin=jtot + elseif(itag.eq.-1) then + getspin=jtot-2*int(ranf(0)*(jtot+1)) + else + write(6,*)'itag-error in getspin.f' + stop + endif + + return + end diff --git a/Processes/UrQMD/init.f b/Processes/UrQMD/init.f new file mode 100644 index 0000000000000000000000000000000000000000..76afc9dfa30f7c5b0032beae0657c95f4f8b2ec8 --- /dev/null +++ b/Processes/UrQMD/init.f @@ -0,0 +1,551 @@ +c $Id: init.f,v 1.20 2002/05/14 12:33:50 balazs Exp $ +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine init +c +c Revision : 1.0 +c This subroutine calls initialization procedures for different +c equations of state and calculation modi. + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + include 'coms.f' + include 'options.f' + include 'comres.f' + include 'inputs.f' + include 'freezeout.f' + include 'newpart.f' + include 'boxinc.f' + include 'colltab.f' + + integer j,k,icount,npold,getspin,fchg,indsp(2),isrt,ipbm + real*8 nucrad,dstt,dstp,pcm,eb,embeam,emtarget + real*8 massit,ranf,pcms,dectim + real*8 gaeq,beeq,galab,belab,ppeq,pteq + real*8 pboost + real*8 ratio + integer AAp, AAt + integer nnuc + parameter (nnuc=11) + save isrt,ipbm + logical bcorr + common /ini/ bcorr + + integer i,flagy + real*8 alf,regula +c momenta + real*8 mx,my,mz +c important: never change! + npart = 0 + npold = 0 + nbar=0 + nmes=0 + apt=0 + uid_cnt=0 +c reset counters +c all collisions/decays + ctag = 0 +c all decays + dectag = 0 +c number of prod. hard resonances + NHardRes=0 +c number of prod. soft resonances + NSoftRes=0 +c number of prod. resonances via decay + NDecRes=0 +c number of blocked collisions + NBlColl=0 +c number of elastic collisions + NElColl=0 +c number of strings + strcount=1 +c + nspec = 0 !hjd +c + eb=0D0 +c icount is the number of EXTRAordinary pro/tar combinations (i.e. pion ...) + icount = 0 +c reset particle vectors + do 20 j=1,nmax + spin(j) = 0 + ncoll(j) = 0 + lstcoll(j)=0 + r0(j) = 0.0 + rx(j) = 0.0 + ry(j) = 0.0 + rz(j) = 0.0 + p0(j) = 0.0 + px(j) = 0.0 + py(j) = 0.0 + pz(j) = 0.0 + frr0(j) = 0.0 + frrx(j) = 0.0 + frry(j) = 0.0 + frrz(j) = 0.0 + frp0(j) = 0.0 + frpx(j) = 0.0 + frpy(j) = 0.0 + frpz(j) = 0.0 + fmass(j) = 0.0 + charge(j)= 0 + iso3(j) = 0 + ityp(j) = 0 + dectime(j)= 0.0 + origin(j)=0 + tform(j)=0.0 + xtotfac(j)=1.0 + strid(j)=0 + uid(j)=0 + ffermpx(j) = 0.0 + ffermpy(j) = 0.0 + ffermpz(j) = 0.0 +ctd + do 21 k=1,2 + p0td(k,j)=0.d0 + pxtd(k,j)=0.d0 + pytd(k,j)=0.d0 + pztd(k,j)=0.d0 + fmasstd(k,j)=0.d0 + ityptd(k,j)=0 + iso3td(k,j)=0 + 21 continue + 20 continue + + + if(CTOption(40).eq.1) then + call getoldevent + return + endif + + + if (boxflag.eq.1) then + mbpx=0 + mbpy=0 + mbpz=0 + mx=0 + my=0 + mz=0 + + nbar=0 + nmes=0 + flagy=edensflag + ctoption(30)=0 ! no frozen fermi for box + do 100 cbox=1,mbox + if (flagy.ge.1) then + bptpmax(cbox)=edens/mbox + endif + call bptinit(cbox) + 100 Continue + +c prevents a collective motion in the box + do 143 i=1,npart + mbpx=mbpx+px(i) + mbpy=mbpy+py(i) + mbpz=mbpz+pz(i) + 143 continue + do 142 i=1,npart + px(i)=px(i)-mbpx/npart + py(i)=py(i)-mbpy/npart + pz(i)=pz(i)-mbpz/npart + call setonshell(i) + 142 continue + + if (flagy.ge.1) then + alf=Regula(edens) + do 42 i=1,npart + px(i) = alf*px(i) + py(i) = alf*py(i) + pz(i) = alf*pz(i) + call setonshell(i) + 42 continue + endif + Write(*,*) 'walls selected' + mbflag=2 + if (solid.gt.0) Write(*,*)'solid walls selected' + + Return + EndIf + + if(At.ne.0) then + if (CTParam(21).eq.0.0) then + dstp = nucrad(Ap)+CTParam(41) + dstt = nucrad(At)+CTParam(41) + else + ratio = sqrt((1 + 4.0*CTParam(21)/3.0) / + $ (1 - 2.0*CTParam(21)/3.0) ) + dstp = nucrad(Ap)*ratio**(2.0/3.0)+CTParam(41) + dstt = nucrad(At)*ratio**(2.0/3.0)+CTParam(41) + endif +c add radius offset + dstp=dstp+CTParam(30) + dstt=dstt+CTParam(30) +c +c dst=0.5d0*(dstt+dstp) + else +c dst=0.d0 + dstp=0d0 + dstt=0d0 + endif + +ce For anti nuclei: + AAp = abs(Ap) + AAt = abs(At) + +c +c fix masses of projectile and target for calculation of pbeam,ecm,pcm + if(prspflg.eq.0) then + embeam=AAp*EMNUC + elseif(prspflg.eq.1) then + icount=icount+1 +c!!! sofar only pro/tar with fixed masses allowed + embeam=massit(spityp(1)) + endif + if(trspflg.eq.0) then + emtarget=AAt*EMNUC + elseif(trspflg.eq.1) then + icount=icount+1 + emtarget=massit(spityp(2)) + endif +c +c p(equal_speed) with given elab cccccccccccccccccccccccccccccccccccccc + + if(srtflag.eq.0) then + + ebeam=AAp*ebeam + eb=ebeam+embeam + pbeam=sqrt(ebeam*(ebeam+2.0d0*embeam)) + +c p(equal_speed) with given sqrt(s) ccccccccccccccccccccccccccccccccccccc + + elseif(srtflag.eq.1) then + +c in this mode, everything has to calculated on a per particle basis + embeam=embeam/dble(AAp) + emtarget=emtarget/dble(AAt) + + if(emtarget+embeam.gt.srtmin)then + srtmin=emtarget+embeam+1d-2 + write(6,*)' *** error:initial energy below treshold' + write(6,*)' c.m. energy will be increased to:', + & srtmin + srtmax=max(srtmax,srtmin) + end if + if(efuncflag.eq.0) then + ecm=srtmin + else ! if(efuncflag.eq.1) then +c excitation function + if(mod((event-1)*nsrt,nevents).eq.0 + & .and.firstev.gt.0)then + if(efuncflag.eq.1)then + ecm=ecm+(srtmax-srtmin)/dble(nsrt-1) + else if(efuncflag.eq.2)then + isrt=isrt+1 + ecm=srtmin*exp( + & (dlog(srtmax/srtmin)) + & *isrt/(nsrt-1)) + end if + elseif(firstev.eq.0) then + isrt=0 + firstev=1 + ecm=srtmin + endif + endif +c +c this is all on a per particle basis + pcm=pcms(ecm,embeam,emtarget) + ebeam=sqrt(embeam**2 + (pcm*ecm/emtarget)**2) - embeam + pbeam=pcm*ecm/emtarget +c now revert to full quantities + ebeam=AAp*ebeam + pbeam=AAp*pbeam + embeam=embeam*AAp + emtarget=emtarget*AAt + eb=sqrt(embeam**2+pbeam**2) + + + +c p(equal_speed) with given plab ccccccccccccccccccccccccccccccccccc + elseif(srtflag.eq.2) then + if(efuncflag.gt.0) then +c excitation function +c calculate the next pbeam if number of events at current pbeam exceeds nevents/npb + if (mod((event-1)*npb,nevents).eq.0 + & .and.firstev.gt.0) then +c excitation function linear in pbeam + if (efuncflag.eq.1) then + pbeam=pbeam+(pbmax-pbmin)/dble(npb-1) +c else use a logaritmic excitation function + else if(efuncflag.eq.2) then + ipbm=ipbm+1 + pbeam=pbmin*exp( + & (dlog(pbmax/pbmin)) + & *ipbm/(npb-1)) + end if + else if (firstev.eq.0) then + ipbm=0 + firstev=1 + pbeam=pbmin + endif + endif +c input was pbeam per particle + pbeam=AAp*pbeam + eb=sqrt(embeam**2+pbeam**2) + ebeam=eb-embeam + endif + +c now do the calculation of equal_speed quantities + + galab=eb/embeam ! gamma_lab + belab=pbeam/eb ! beta_lab + gaeq=sqrt(0.5*(1+galab)) ! gamma_equal_speed + beeq=belab*galab/(1+galab) ! beta_equal_speed + ppeq=gaeq*beeq*embeam ! p_projectile(eq) + pteq=-(gaeq*beeq*emtarget) ! p_target(eq) + +c reduce to per particle quantities + ppeq=ppeq/dble(AAp) + if(AAt.ne.0) then + pteq=pteq/dble(AAt) + emtarget=emtarget/dble(AAt) + endif + embeam=embeam/dble(AAp) + pbeam=pbeam/dble(AAp) + ebeam=ebeam/dble(AAp) +c the following is the NN sqrt(s) + ecm=sqrt(embeam**2+2*eb/dble(AAp)*emtarget+emtarget**2) + +ccccccccccccccccccccccccccccccccccccccccccccc +c compute transformation betas for output + + pcm=max(1d-10,pbeam*emtarget/ecm) + + if(CTOption(27).eq.0) then + betann=0.d0 + betatar=pcm/sqrt(pcm**2+emtarget**2) + betapro=-(1.*pcm/sqrt(pcm**2+embeam**2)) + elseif(CTOption(27).eq.1) then + betann=-(1*pcm/sqrt(pcm**2+emtarget**2)) + betatar=0.d0 + betapro=-(1*pbeam/sqrt(pbeam**2+embeam**2)) + elseif(CTOption(27).eq.2) then + betann=pcm/sqrt(pcm**2+emtarget**2) + betatar=pbeam/sqrt(pbeam**2+embeam**2) + betapro=0.d0 + endif + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c determine impact parameter + if(CTOption(5).eq.0) then + bimp=bdist + elseif(CTOption(5).eq.1) then +C M.R. we don't truncate bdist here, logic happens in CORSIKA +c hjd1 +c if(bdist.gt.(nucrad(Ap)+nucrad(At)+2*CTParam(30))) +c & bdist=nucrad(Ap)+nucrad(At)+2*CTParam(30) +c hjd1 +C M.R. 2019-04-24: updated sampling procedure from UrQMD 3.4 + bimp=sqrt(bmin**2 + ranf(0) * (bdist**2 - bmin**2)) + +cdh if (bimp<bmin) goto 215 + elseif(CTOption(5).eq.2) then +CMR if(bdist.gt.(nucrad(Ap)+nucrad(At)+2*CTParam(30))) +CMR & bdist=nucrad(Ap)+nucrad(At)+2*CTParam(30) + bimp=bmin+ranf(0)*(bdist-bmin) + else + write(6,*)'illegal CTOption(5) :',CTOption(5) + stop + endif + + if(At.eq.0) bimp=0.d0 + +c initialize normal projectile + if(prspflg.eq.0) then + if(mod(event,nnuc).eq.0)then + call cascinit(Zp,Ap,1) + endif + call getnucleus(1,npart) + npart=npart+AAp +c change reference frame + if (CTOption(27).eq.1) then + pboost = -pbeam + elseif (CTOption(27).eq.2) then + pboost = 0.d0 + else + pboost = -ppeq + endif + call boostnuc(npold+1,npold+AAp, + & pboost,0.5*bimp,-dstp) +c save fermi motion + if (CTOption(30).eq.1) then + call savefermi(npold+1,npold+AAp,-pboost) + endif + npold=npart + nbar=nbar+AAp + if (CTParam(20).ne.0) then + call getnucleus(1,npart) + npart=npart+AAp + call boostnuc(npold+1,npold+AAp, + & pboost,0.5*bimp,-dstp+CTParam(20)) + if (CTOption(30).eq.1) then + call savefermi(npold+1,npold+AAp,-pboost) + endif + npold=npart + nbar=nbar+AAp + endif + endif + + +c initialize normal target + if(At.ne.0) then + if(trspflg.eq.0) then + if(mod(event,nnuc).eq.0)then + call cascinit(Zt,At,2) + endif + call getnucleus(2,npart) + npart=npart+AAt +c change ref. frame + if(CTOption(27).eq.1) then + pboost = 0.d0 + elseif(CTOption(27).eq.2) then + pboost = pbeam + else + pboost = -pteq + endif + call boostnuc(npold+1,npold+AAt, + & pboost,-(0.5*bimp),dstt) +c save fermi motion + if (CTOption(30).eq.1) then + call savefermi(npold+1,npold+AAt,-pboost) + endif + npold=npart + nbar = nbar + AAt + endif + endif + +c set unique ID-tag counter (is not initialized with getnucleus calls) + uid_cnt=npart + + if(icount.eq.0) then +c set counter for collupd + apt=Ap + return +c initialize special PRO/TAR combinations + elseif(icount.eq.1) then + if(prspflg.eq.1) then + indsp(1)=1 +c the "regular" target sits first in the arrays + apt=At + else + indsp(1)=2 + apt=Ap + endif + elseif(icount.eq.2) then + if(abs(spityp(1)).le.abs(spityp(2))) then + indsp(1)=1 + indsp(2)=2 + apt=Ap + else + indsp(1)=2 + indsp(2)=1 + apt=At + endif + endif + do 40 j=1,icount + npart=npart+1 + if(abs(spityp(indsp(j))).lt.minmes) then + nbar=nbar+1 + else + nmes=nmes+1 + endif + iso3(npart) = spiso3(indsp(j)) + ityp(npart) = spityp(indsp(j)) + uid_cnt=uid_cnt+1 + uid(npart)=uid_cnt + spin(npart) = getspin(ityp(npart),-1) + charge(npart)=fchg(iso3(npart),ityp(npart)) + fmass(npart) = massit(ityp(npart)) + rx(npart) = 0.d0 + ry(npart) = 0.d0 + rz(npart) = 0.d0 + px(npart) = 0.d0 + py(npart) = 0.d0 +c pz ist stored in pbeam,p?eq! + pz(npart) = 0.d0 + p0(npart)=sqrt(px(npart)**2+py(npart)**2+pz(npart)**2 + & +fmass(npart)**2) + if(indsp(j).eq.1) then + if(CTOption(27).eq.1) then + call boostnuc(npart,npart,-pbeam,0.5*bimp,-dstp) + elseif(CTOption(27).eq.2) then + call boostnuc(npart,npart,0.d0,0.5*bimp,-dstp) + else + call boostnuc(npart,npart,-ppeq,0.5*bimp,-dstp) + endif + elseif(indsp(j).eq.2) then + if(CTOption(27).eq.1) then + call boostnuc(npart,npart,0.d0,-(0.5*bimp),dstt) + elseif(CTOption(27).eq.2) then + call boostnuc(npart,npart,pbeam,-(0.5*bimp),dstt) + else + call boostnuc(npart,npart,-pteq,-(0.5*bimp),dstt) + endif + endif + dectime(npart) = dectim(npart,1) + + 40 continue + return + end + + subroutine savefermi(i1,i2,p) +c +c Revision : 1.0 +c Store fermi momentum in fferm +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + include 'coms.f' + + integer i,i1,i2 + real*8 p + + if (i1.eq.0) return + + if (ncoll(i1).gt.0) return + + do i=i1,i2 + ffermpx(i)=px(i) + ffermpy(i)=py(i) + ffermpz(i)=pz(i)-p + px(i)=0.0 + py(i)=0.0 + pz(i)=p + enddo + + return + end + +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + subroutine addfermi(ind,p) +c +c Revision : 1.0 +c Restore fermi momentum from fferm +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + include 'coms.f' + + integer ind + real*8 p + + if (ind.eq.0) return + + p = pz(ind) + px(ind) = px(ind)+ffermpx(ind) + py(ind) = py(ind)+ffermpy(ind) + pz(ind) = pz(ind)+ffermpz(ind) + ffermpx(ind) = 0.0 + ffermpy(ind) = 0.0 + ffermpz(ind) = 0.0 + + return + end diff --git a/Processes/UrQMD/inputs.f b/Processes/UrQMD/inputs.f new file mode 100644 index 0000000000000000000000000000000000000000..206ea9981eb537295a0e77498d32a12c1d67cb47 --- /dev/null +++ b/Processes/UrQMD/inputs.f @@ -0,0 +1,30 @@ +c $Id: inputs.f,v 1.4 2000/01/12 16:02:36 bass Exp $ +c include file for data from the input subroutine + integer nevents,spityp(2),prspflg + integer trspflg,spiso3(2),outsteps,bflag,srtflag,efuncflag + integer nsrt,npb,firstev + real*8 srtmin,srtmax,pbeam,betann,betatar,betapro + real*8 pbmin,pbmax + + common /inputs/nevents,spityp,prspflg,trspflg, + & spiso3,outsteps,bflag,srtflag,efuncflag,nsrt, + & firstev, npb + common /input2/ srtmin,srtmax,pbeam,betann,betatar,betapro, + & pbmin, pbmax + +c +c maximum mass for projectile and target + integer AAmax + parameter(AAmax=300) +c storage arrays for projectile and target nuclei + integer PT_iso3(AAmax,2),PT_ityp(AAmax,2),PT_spin(AAmax,2) + integer PT_charge(AAmax,2),PT_AA(2),PT_uid(AAmax,2) + real*8 PT_r0(AAmax,2),PT_rx(AAmax,2),PT_ry(AAmax,2),PT_rz(AAmax,2) + real*8 PT_p0(AAmax,2),PT_px(AAmax,2),PT_py(AAmax,2),PT_pz(AAmax,2) + real*8 PT_dectime(AAmax,2),PT_fmass(AAmax,2),PT_rho(AAmax,2) + real*8 PT_pmax(AAmax,2) +c common blocks (data transfer between cascinit and getinit) + common/ProTarInts/PT_iso3,PT_ityp,PT_spin,PT_charge,PT_AA,PT_uid + common/ProTarReals/PT_r0,PT_rx,PT_ry,PT_rz,PT_fmass,PT_dectime, + & PT_p0,PT_px,PT_py,PT_pz,PT_rho,PT_pmax +c diff --git a/Processes/UrQMD/iso.f b/Processes/UrQMD/iso.f new file mode 100644 index 0000000000000000000000000000000000000000..681b2c3b3e343b53c771213b2b2f4eb0dba363fc --- /dev/null +++ b/Processes/UrQMD/iso.f @@ -0,0 +1,814 @@ +c $Id: iso.f,v 1.7 1999/01/18 09:57:06 ernst Exp $ +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + SUBROUTINE ISOCGK4(J1,M1,J2,M2,Jnew,Mnew,ITAG) +c +c Revision : 1.0 +c +c This subroutine determines according to probabilities given by +c Clebsch Gordan cefficients the total and 3-component of the +c isospin of up to 4 outgoing particles +C +c input: +c (isocgk: two part. in and two part. out) +c J1 : 2*I of ingoing particle 1 +c M1 : 2*I3 of ingoing particle 1 +c J2 : 2*I of ingoing particle 2 +c M2 : 2*I3 of ingoing particle 2 +c Jnew : 2*I of outgoing particles (array) +c +c +c (isonew: one part. in and two part. out) +c J : 2*I of ingoing particle +c M : 2*I3 of ingoing particle +c Jnew : 2*I of outgoing particles (array) +c ITAG=-50 << necessary for correct functioning of routine +c +c input/output: +c Mnew : 2*I3 of outgoing particles (array) +c Mnew(i)=-9 to determine the I3 component of the +c i-th particle randomly +c ITAG : = -1 then no possible isospin combination has been found +c +c +c function calls: +c ranf() +c clebsch +c +c important global variables: +c nexit : number of outgoing particles +c +c important local variables: +C JMINOL/JMINNW THE MINIMAL POSSIBLE TOTAL ISOSPIN IN IN-/OUT-STATE +C M TOTAL I3 OF IN-/OUT-STATE +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + implicit none + include 'newpart.f' + integer m1,j1,m2,j2,itag,Jnew,Mnew + integer Jtot,M,Jminol,Jmaxol,Jminnw,Jmaxnw,i,j,k,l,il,jp,jpr + integer jmin,jmax,Nj,ifind + integer m1pr,m1p,m1pos,m1out + integer m2pr,m2p,m2pos,m2out + integer m3pr,m3p,m3pos,m3out + integer m4pr,m4p,m4pos,m4out,Mmin,Mmax + integer m12,m34,j12,j34 + integer Jin,Min + real*8 pjin,prbout,prbsum,zrand,c12,c34,c_tot + DIMENSION pjin(20),prbout(20,20,20,20) + DIMENSION m1out(20),m2out(20),m3out(20),m4out(20) + DIMENSION JNEW(mprt),Mnew(mprt),Mmin(mprt),Mmax(mprt) + real*8 ranf,clebsch + + ITAG=0 + M=M1+M2 + + +c 1.) first treat some special cases + if(nexit.gt.4)then + write(6,*)'ISOCGK: only <=4 outgoing Isospins can be coupled' + itag=-1 + stop + return + endif + + if(nexit.eq.3)Jnew(4)=0 + + if(nexit.eq.2)then !nexit.eq.2 + Jnew(3)=0 + Jnew(4)=0 +c check for zero in out-channel: + if(Jnew(1).eq.0) then + Mnew(1)=0 + Mnew(2)=m + return + elseif(Jnew(2).eq.0) then + Mnew(2)=0 + Mnew(1)=m + return + endif + endif !nexit.eq.2 + +c 2.) determine possible min and max isospins for in/out state +c +c determine number of possible in-states + Jminol= MAX0(IABS(J1-J2),IABS(M)) + Jmaxol= J1+J2 + +c determine number of possible out-states +c JMINNW= MAX0(IABS(J1NEW-J2NEW),IABS(M)) + Jminnw=1000 + do 1 i=-1,1,2 + do 2 j=-1,1,2 + do 3 k=-1,1,2 + do 4 l=-1,1,2 + jp=IABS(i*Jnew(1)+j*Jnew(2)+k*Jnew(3)+l*Jnew(4)) + if(jp.lt.Jminnw)Jminnw=jp +4 continue +3 continue +2 continue +1 continue + Jminnw=MAX0(Jminnw,IABS(M)) + +c JMAXNW= J1NEW+J2NEW + Jmaxnw=0 + do 5 i=1,nexit + Jmaxnw=Jmaxnw+Jnew(i) +5 continue + +c check which possible states match (are common for in AND out state) + Jmin = MAX0(Jminol,Jminnw) + Jmax = MIN0(Jmaxol,Jmaxnw) +c error check for unphysical input + if(Jmin.gt.Jmax) then + itag=-1 + write(6,*)'isocgk: jmin > jmax : unphysical input!' + write(6,*) J1,M1,J2,M2,jnew(1),jnew(2),jmin,jmax + return + endif + +c 3.) calculate number of possible isospins + nj = (Jmax-Jmin)/2 +1 + if(J1.eq.0.or.J2.eq.0)then + if(Jmin.ne.Jmax) then + itag=-1 + write(6,*) 'J1(2)=0,Jmin.ne.Jmax IN ISOCGK - check calling' + return + endif + if(J1.eq.0.and.J2.eq.0) then + write(6,*) "J1,J2=0 IN ISOCGK - can't couple this" + itag=-1 + return + endif +c here only one total isospin is possible (probability is unity) + pjin(1)=1. + goto 310 + END IF !J1.EQ.0.OR.J2.EQ.0 +c if no overlap between in and out state, return with itag=-1 + if(nj.le.0) then + itag=-1 + write(6,*)'Isocgk: nj.le.0 - no combination possible' + return + endif + + ifind=0 +c 4) loops over all possible combinations of J1,J2,M1,M2,Jtot +c to get the probabilities of the in-channel couplings + DO 6 jpr=Jmin,Jmax,2 + ifind=ifind+1 + pjin(ifind)=clebsch(J1,J2,m1,m2,jpr) +6 CONTINUE + +C +c error message, if not all possible Jtot's have been found +c if(ifind.ne.nj) then +c write(6,*)'ERROR IN ISOCGK IFIND.NE.NJ' +c stop +c endif +c sum CGKs over all possible Jtots (-> probabilities) + prbsum=0. + do 7 il=1,nj + prbsum=prbsum+pjin(il) +7 continue + +c check for nonsense + IF(prbsum.le.0.) THEN + write(6,*)'ERROR IN ISOCGK 30:PRBSUM.LE.0.' + stop + END IF +c normalize PJIN(.) to 1 +c now PJIN contains CGK-based probabilities for the different possible Jtots + Do 8 il=1,nj + pjin(il)=pjin(il)/prbsum +8 Continue +310 continue +c 5) now throw dice to determine one of the possible Jtots + zrand=ranf(0) + Do 9 il=1,nj + if(zrand.lt.pjin(il))then +c this is now the "real Jtot" + Jtot= Jmin +2*(il-1) + goto 11 + else + zrand=zrand-pjin(il) + endif +9 Continue +11 Continue + + + goto 111 + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c this is the entry for one in and >= two out particles +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + ENTRY ISONEW4(JIN,MIN,JNEW,MNEW,ITAG) + + IF(ITAG.EQ.-50) THEN + + Jtot=Jin + M=Min + itag=0 + + END IF !itag=-50 + +c here now both cases (one/two-in particles) together +c now the in-channel is determined -> get out-channel + 111 continue + +c special cases + if(nexit.gt.4)then + write(6,*)'ISONEW: only <=4 outgoing Isospins can be coupled' + itag=-1 + stop + return + endif + + if(nexit.eq.3)then + Jnew(4)=0 + Mnew(4)=0 + endif + + if(nexit.eq.2)then + Jnew(3)=0 + Jnew(4)=0 + Mnew(3)=0 + Mnew(4)=0 +c check for zero in out-channel: + if(Jnew(1).eq.0) then + mnew(1)=0 + mnew(2)=m + return + elseif(Jnew(2).eq.0) then + mnew(2)=0 + mnew(1)=m + return + endif + endif !nexit=2 + + +c reset counters + m1pos=2*Jnew(1)+1 + m2pos=2*Jnew(2)+1 + m3pos=2*Jnew(3)+1 + m4pos=2*Jnew(4)+1 + Do 161 m1p=1,20 + m1out(m1p)=0 + m2out(m1p)=0 + m3out(m1p)=0 + m4out(m1p)=0 + Do 162 m2p=1,m2pos + Do 163 m3p=1,m3pos + Do 164 m4p=1,m4pos + prbout(m1p,m2p,m3p,m4p)=0d0 +164 Continue +163 Continue +162 Continue +161 Continue + +c get min/maximal M + Do 100 i=1,4 + Mmin(i)=-Jnew(i) + Mmax(i)=Jnew(i) +100 Continue + +c calculate the possible |J_i M_i> combinations and their probability + do 112 j12=Iabs(Jnew(1)-Jnew(2)),(Jnew(1)+Jnew(2)),2 + do 134 j34=Iabs(Jnew(3)-Jnew(4)),(Jnew(3)+Jnew(4)),2 + m1pos=0 + Do 41 m1pr=Mmin(1),Mmax(1),2 + m1pos=m1pos+1 + m1out(m1pos)=m1pr + m2pos=0 + Do 42 m2pr=Mmin(2),Mmax(2),2 + m2pos=m2pos+1 + m2out(m2pos)=m2pr + m3pos=0 + Do 43 m3pr=Mmin(3),Mmax(3),2 + m3pos=m3pos+1 + m3out(m3pos)=m3pr + m4pos=0 + Do 44 m4pr=Mmin(4),Mmax(4),2 + m4pos=m4pos+1 + m4out(m4pos)=m4pr +c m4pr=m-m1pr-m2pr-m3pr + If(m1pr+m2pr+m3pr+m4pr.ne.m)goto 44 + m12=m1pr+m2pr + m34=m3pr+m4pr + + c12=clebsch(Jnew(1),Jnew(2),m1pr,m2pr,J12) + c34=clebsch(Jnew(3),Jnew(4),m3pr,m4pr,J34) + c_tot= clebsch(J12,J34,m12,m34,Jtot) + + prbout(m1pos,m2pos,m3pos,m4pos)= + + prbout(m1pos,m2pos,m3pos,m4pos)+c12*c34*c_tot + + + 44 Continue + 43 Continue + 42 Continue + 41 Continue + 134 continue + 112 continue + +c error check + if(m1pos.eq.0.or.m2pos.eq.0.or.m3pos.eq.0.or.m4pos.eq.0)then + write(6,*)'IN ISOCGK/ISONEW: MPOS=0 ERROR' + write(6,*)"Can't couple Jin, Min=",Jtot,M + write(6,*)'To J1,J2,J3,J4=',Jnew(1),Jnew(2),Jnew(3),Jnew(4) + itag=-1 + return + endif + +c sum up all CGKs + prbsum=0. + Do 51 m1p=1,m1pos + Do 52 m2p=1,m2pos + Do 53 m3p=1,m3pos + Do 54 m4p=1,m4pos + prbsum=prbsum+prbout(m1p,m2p,m3p,m4p) +54 Continue +53 continue +52 continue +51 continue + +c error check + IF(prbsum.le.0.) then + write(6,*)'ERROR IN ISOCGK/ISONEW:PRBSUM.LE.0.' + write(6,*)"Can't couple Jin, Min=",Jtot,M + write(6,*)'To J1,J2,J3,J4=',Jnew(1),Jnew(2),Jnew(3),Jnew(4) + stop + endif + +c normalize to 1 (now we have real probabilities for different Mout combis) + Do 61 m1p=1,m1pos + Do 62 m2p=1,m2pos + Do 63 m3p=1,m3pos + Do 64 m4p=1,m4pos + prbout(m1p,m2p,m3p,m4p)=prbout(m1p,m2p,m3p,m4p)/prbsum +c write(*,*)'!p= ',m1out(m1p),m2out(m2p),m3out(m3p), +c & m4out(m4p),prbout(m1p,m2p,m3p,m4p) +64 Continue +63 Continue +62 Continue +61 Continue + +c now determine according to the PRBOUT values the outgoing M combination + zrand=ranf(0) + Do 71 m1p=1,m1pos + Do 72 m2p=1,m2pos + Do 73 m3p=1,m3pos + Do 74 m4p=1,m4pos + if(zrand.lt.prbout(m1p,m2p,m3p,m4p)) then + Mnew(1)= M1out(m1p) + Mnew(2)= M2out(m2p) + Mnew(3)= M3out(m3p) + Mnew(4)= M4out(m4p) + goto 70 + else + zrand=zrand-prbout(m1p,m2p,m3p,m4p) + endif +74 Continue +73 Continue +72 Continue +71 Continue +70 Continue + RETURN + END + + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function fcgk(i1,i2,iz1,iz2,i) !L.A.W. Tue Aug 15 1995 +c returns the normalized clebsch gorden factor also for combinations +c involving strange mesons and antibaryons +C####C##1#########2#########3#########4#########5#########6#########7## + implicit none + include 'comres.f' + real*8 c + integer i1,i2,iz1,iz2,i,iz,isoit,i12,i12a,ir,strit,icnt + logical nombbb + + fcgk=0D0 + icnt=0 + c=0d0 + iz=iz1+iz2 + if(isoit(i).lt.iabs(iz))goto 1008 + if(isoit(i1)*isoit(i2).eq.0)then + c=1d0 + goto 1008 + end if + + call cgknrm(isoit(i),iz,isoit(i1),isoit(i2),iz1,iz2,ir,c) + if(i1.eq.i2.and.iz1.ne.iz2.and.iz1+iz2.eq.0)c=2d0*c +c... particle exchange + + if(ir.ne.0)then + icnt=icnt+1 + if(icnt.le.1)then + write(6,*)'fcgk: no iso-spin decomposition found for:', + @ i,iz,' to ',i1,iz1,'+',i2,iz2 + write(6,*)' please check this channel' + end if + return + end if + + if(strit(i).eq.0)then +c... this is now for particle+antiparticle (except nonstrange mesons) + i12=i1*i2 + i12a=iabs(i12) + nombbb=i12a.lt.maxbar**2.or.i12a.gt.minmes**2 +c... the charge conjugated states have the same weight + if(i12.lt.0.and.nombbb)then +c... for example anti-K* + K + if(i1.ne.-i2)c=c*5d-1 + end if + end if +1008 fcgk=c + return + end +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine cgknrm(JIN,MIN,J1NEW,J2NEW,M1IN,M2IN,ierr,cf) +C gives the normalized cg-factor i.e. poosibility into a given +C iso-spin decomposition of JIN,MIN into J1NEW,J2NEW,M1IN,M2IN +C ierr equals 0 if there is any alowed J1,J2,M1,M2 (not necessaryly +C equal to J1NEW,J2NEW,M1IN,M2). +C ierr is not equal 0 if all channels are iso-spin forbidden +C for specific couplings possibly involving strange particles or +C anti-particles function fcgk should be used (see beyond) +Coutput cf : normalized cg-factor +C####C##1#########2#########3#########4#########5#########6#########7## + implicit integer (i - n) + implicit real*8 (a - h , o - z) + DIMENSION PRBOUT(20),M1OUT(20) + real*8 clebsch + +c the in particle of course defines Jtot and Mtot + cf =0d0 + ierr = 0 +ctp060202 1 JTOT=JIN + JTOT=JIN + M=MIN + ITAG=0 +c check for zero in out-channel: + if(j1new.eq.0) then + m1new=0 + m2new=m + return + elseif(j2new.eq.0) then + m2new=0 + m1new=m + return + endif + +c here now both cases (one/two in particles) together +c reset counters + M1POS=0 +c loop over all J1,J2,Jtot,M1,M2 combinations + do 39 m1pr=-j1new,j1new,2 + m2pr=m-m1pr +c if J1new and J2new and Jtot and Mtot create a match then store M1new +c inM1OUT array and the CGK in PRBOUT array; the counter for possible +c Mnew combinations is M1POS + M1POS=M1POS+1 + M1OUT(M1POS)=M1PR + PRBOUT(M1POS)=clebsch(j1new,j2new,m1pr,m2pr,jtot) + if( ! (m1pr.eq.m2in.and.m2pr.eq.m1in).or. + @ (m2pr.eq.m2in.and.m1pr.eq.m1in))cf=cf+PRBOUT(M1POS) + 39 continue +c error check + IF(M1POS.EQ.0) then + write(6,*)'IN ISOCGK: M1POS=0 ERROR' + write(6,*)'jtot,j1new,j2new,m',jtot,j1new,j2new,m + itag=-1 + return + endif +c sum over all CGKs + PRBSUM=0. + DO 50 M1P=1,M1POS + PRBSUM=PRBSUM+PRBOUT(M1P) + 50 continue + +c error check + IF(PRBSUM.LT.1d-3) then + ierr = 1 + cf = 0d0 + return + endif +c normalize to 1 (now we have real probabilities for different Mout combis) + cf=cf/PRBSUM + + RETURN + END + + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + real*8 function dbweight(j1,m1,j2,m2,j1new,j2new) +c +c Revision : 1.0 +c +c This function delivers a weight, based on a Clebsch Gordan +c coefficient, for detailed balance cross sections +C +c input: +c J1 : 2*I of ingoing particle 1 +c J2 : 2*I of ingoing particle 2 +c M1 : 2*I3 of ingoing particle 1 +c M2 : 2*I3 of ingoing particle 2 +c J1new : 2*I of outgoing particle 1 +c J2new : 2*I of outgoing particle 2 +c +c output: +c weight : weight factor +c +c function calls: +c clebsch +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + integer j1,m1,j2,m2,j1new,j2new,jminol,jmaxol,jminnw,jmaxnw + integer nj,jpr,m,jmax,jmin,ind + real*8 clebsch,weight(10) + + dbweight=0.d0 + m=m1+m2 +c determine number of possible states +c fist the in state + JMINOL= MAX0(IABS(J1-J2),IABS(M)) + JMAXOL= J1+J2 +c now the out state + JMINNW= MAX0(IABS(J1NEW-J2NEW),IABS(M)) + JMAXNW= J1NEW+J2NEW +c which possible states match (are common for in AND out state) + JMIN = MAX0(JMINOL,JMINNW) + JMAX = MIN0(JMAXOL,JMAXNW) + NJ = (JMAX-JMIN)/2 +1 + if(nj.lt.1) return + ind=0 + do 18 jpr=jmin,jmax,2 + ind=ind+1 + weight(ind)=clebsch(j1,j2,m1,m2,jpr) + dbweight=dbweight+weight(ind) + 18 continue + + return + end + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + real*8 function clebsch(j1,j2,m1,m2,j3) +c +c Revision : 1.0 +c +c This function delivers a Clebsch Gordan Coefficient, which has been +c calculated by w3j. +C +c input: +c J1 : 2*I of ingoing particle 1 +c J2 : 2*I of ingoing particle 2 +c M1 : 2*I3 of ingoing particle 1 +c M2 : 2*I3 of ingoing particle 2 +c J3 : 2*I of projection requested +c (i.e. resonance to be formed) +c +c output: +c clebsch : CGK**2 +c +c function calls: +c w3j +c !!! first call function after intialization with loginit +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + real*8 LogFak( 0 : 100 ),dj1,dj2,dj3,dm1,dm2,dm3,w3j + real*8 cfct,cgk + integer j1,j2,j3,m1,m2,ipot,jmm,jmm1 + common /FACTORIALS/LogFak + + integer jmax + parameter(jmax=7) + real*8 cgktab(0:jmax,0:jmax,-jmax:jmax,-jmax:jmax,0:jmax) + common /cgks/cgktab + +c each cgk for j's in the range up to jmax is calculated only once +c and then stored in the cgktab table for further use + jmm1=max(j1,j2) + jmm=max(j3,jmm1) + if(jmm.gt.jmax.or.(cgktab(j1,j2,m1,m2,j3).lt.-8.d0)) then + + dj1=dble(j1)/2.d0 + dj2=dble(j2)/2.d0 + dj3=dble(j3)/2.d0 + dm1=dble(m1)/2.d0 + dm2=dble(m2)/2.d0 + dm3=-(dm1+dm2) + ipot=(j1+m1+j2-m2)/2 + cfct=sqrt(2*dj3+1.d0)/(-(1.d0**ipot)) + cgk=cfct*w3j(dj1,dj2,dj3,dm1,dm2,dm3) + clebsch=cgk**2 + if(jmm.le.jmax) then + cgktab(j1,j2,m1,m2,j3)=clebsch + endif + else + clebsch=cgktab(j1,j2,m1,m2,j3) + endif + return + END + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + function W3j( J1, J2, J3, M1, M2, M3 ) +c +c +c This program calculates the 3-j wigner symbols according to the +c representation of A. Lindner. +c +c Reference: +c A. Lindner, Drehimpulse in der Quantenmechanik, Teubner 1984, P.39 +c +c====================================================================== + implicit none +c Program input + + real*8 J1, J2, J3, M1, M2, M3 + +c Program returns + + real*8 W3j + +c Global variables + + real*8 LogFak( 0 : 100 ) + common /FACTORIALS/ LogFak + +c Program variables + + real*8 R1, R2, R3, R4, R5, R6, R7, R8, R9 + real*8 N( 1 : 3, 1 : 3 ) + real*8 Sum1, Sum2 + real*8 Sigma + real*8 LF_R1, LF_R2, LF_R3, LF_R4, LF_R5, LF_R6 + real*8 LF_R7, LF_R8, LF_R9 + real*8 LF_Sigma + real*8 Hlp1, Hlp2, Pre + real*8 Summe, S( 0 : 100 ) + integer*4 Signum + integer*4 in + real*8 minimal + integer*4 imin, jmin + integer*4 i, j + real*8 dn + real*8 dummy + +c Start of calculation + +c Evaluation due to equivalence with Regge symbol + +c call LogInit +C + Sigma = J1 + J2 + J3 + + N( 1, 1 ) = -J1 + J2 + J3 + N( 1, 2 ) = J1 - J2 + J3 + N( 1, 3 ) = J1 + J2 - J3 + N( 2, 1 ) = J1 - M1 + N( 2, 2 ) = J2 - M2 + N( 2, 3 ) = J3 - M3 + N( 3, 1 ) = J1 + M1 + N( 3, 2 ) = J2 + M2 + N( 3, 3 ) = J3 + M3 + + do 20 i = 1, 3 + do 10 j = 1, 3 + if ( nint( N( i, j ) ) .lt. 0 ) goto 99999 + 10 continue + Sum1 = N( i, 1 ) + N( i, 2 ) + N( i, 3 ) + Sum2 = N( 1, i ) + N( 2, i ) + N( 3, i ) + if ( nint( Sum1 ) .ne. nint( Sigma ) ) goto 99999 + if ( nint( Sum2 ) .ne. nint( Sigma ) ) goto 99999 + 20 continue + +c do 101 i=1, 3 +c write(6,'(3f14.5)') (N(i,j), j=1, 3 ) +c 101 continue + + imin = 1 + jmin = 1 + Signum = 1 + minimal = N( 1, 1 ) + +c Looking for the smallest N( i, j ) + + do 40 i = 1, 3 + do 30 j = 1, 3 + if ( N(i,j) .lt. minimal ) then + minimal = N( i, j ) + imin = i + jmin = j + endif + 30 continue + 40 continue + + Signum = 1 + + if ( imin .gt. 1 ) then + do 50 j = 1, 3 + dummy = N( 1, j ) + N( 1, j ) = N( imin, j ) + N( imin, j ) = dummy + 50 continue + Signum = (-1)**nint( Sigma ) + endif + + if ( jmin .gt. 1 ) then + do 60 i = 1, 3 + dummy = N( i, 1 ) + N( i, 1 ) = N( i, jmin ) + N( i, jmin ) = dummy + 60 continue + Signum = (-1)**nint( Sigma ) * Signum + endif + + + R1 = N( 1, 1 ) + R2 = N( 1, 2 ) + R3 = N( 1, 3 ) + R4 = N( 2, 1 ) + R5 = N( 2, 2 ) + R6 = N( 2, 3 ) + R7 = N( 3, 1 ) + R8 = N( 3, 2 ) + R9 = N( 3, 3 ) + + LF_R1 = LogFak( nint( R1 ) ) + LF_R2 = LogFak( nint( R2 ) ) + LF_R3 = LogFak( nint( R3 ) ) + LF_R4 = LogFak( nint( R4 ) ) + LF_R5 = LogFak( nint( R5 ) ) + LF_R6 = LogFak( nint( R6 ) ) + LF_R7 = LogFak( nint( R7 ) ) + LF_R8 = LogFak( nint( R8 ) ) + LF_R9 = LogFak( nint( R9 ) ) + LF_Sigma = LogFak( nint( Sigma+1.d0 ) ) + + Hlp1 = ( LF_R2 + LF_R3 + LF_R4 + LF_R7 - LF_Sigma - + & LF_R1 - LF_R5 - LF_R9 - LF_R6 - LF_R8 ) / 2.d0 + + Pre = dexp( Hlp1 ) * (-1)**( nint( R6 + R8 ) ) + + Hlp2 = LF_R6 - LogFak( nint(R6-R1) ) + & + LF_R8 - LogFak( nint(R8-R1) ) + S( 0 ) = dexp( Hlp2 ) + Summe = S( 0 ) + + do 70 in = 1, nint( R1 ) + dn = dble( in ) + S( in ) = (-1)*S( in-1 ) * ( R1+1.d0-dn ) * ( R5+1.d0-dn ) + & * ( R9+1.d0-dn ) / dn / ( R6-R1+dn ) / ( R8-R1+dn ) + Summe = Summe + S( in ) + 70 continue + + W3j = Pre * Summe * Signum + return + +99999 W3j = 0.d0 + return + + end +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine LogInit +c===================================================================== +c +c This function computes the logarithm of the factorials and +c stores it in the array LogFak. +c +c===================================================================== + + implicit none + +c Program output + integer jmax + parameter(jmax=7) ! must be identical to value in clebsch!!! + real*8 cgktab(0:jmax,0:jmax,-jmax:jmax,-jmax:jmax,0:jmax) + common /cgks/cgktab + + real*8 LogFak( 0 : 100 ) + + common / FACTORIALS / LogFak + +c Program variables + + integer*4 i,j1,j2,j3,m1,m2 + +c Program start + do 1 j1=0,jmax + do 1 j2=0,jmax + do 1 m1=-jmax,jmax + do 1 m2=-jmax,jmax + do 1 j3=0,jmax + cgktab(j1,j2,m1,m2,j3)=-9.d0 + 1 continue + + + LogFak( 0 ) = 0.d0 + do 10 i = 1, 100 + LogFak( i ) = LogFak( i-1 ) + dlog( dble( i ) ) + 10 continue + + end diff --git a/Processes/UrQMD/ityp2pdg.f b/Processes/UrQMD/ityp2pdg.f new file mode 100644 index 0000000000000000000000000000000000000000..aa8c2fff2660759cd6602e2527a58ca65729115f --- /dev/null +++ b/Processes/UrQMD/ityp2pdg.f @@ -0,0 +1,361 @@ +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + function pdgid (ityp, iso3) +c +c Revision : 1.0 +c +coutput pdgid : Particle-ID according to Particle Data Group +c +c converts UrQMD-Id to PDG-Id +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + + include 'comres.f' + + integer pdgid + integer ityp + integer iso3 + + integer tab_size + parameter (TAB_SIZE = 165) + + logical anti + integer abs_ityp + integer norm_iso3 + integer idtab(3,TAB_SIZE) + integer first + integer last + integer next + + data idtab/ +c Neutron + . 1, -1, 2112, +c Proton + . 1, 1, 2212, +c N* + . 2, -1, 12112, 2, 1, 12212, + . 3, -1, 1214, 3, 1, 2124, + . 4, -1, 22112, 4, 1, 22212, + . 5, -1, 32112, 5, 1, 32212, + . 6, -1, 2116, 6, 1, 2216, + . 7, -1, 12116, 7, 1, 12216, + . 8, -1, 21214, 8, 1, 22124, + . 9, -1, 42112, 9, 1, 42212, + . 10, -1, 31214, 10, 1, 32124, + . 14, -1, 1218, 14, 1, 2128, +c Delta + . 17, -3, 1114, 17, -1, 2114, 17, 1, 2214, 17, 3, 2224, + . 18, -3, 31114, 18, -1, 32114, 18, 1, 32214, 18, 3, 32224, + . 19, -3, 1112, 19, -1, 1212, 19, 1, 2122, 19, 3, 2222, + . 20, -3, 11114, 20, -1, 12114, 20, 1, 12214, 20, 3, 12224, + . 21, -3, 11112, 21, -1, 11212, 21, 1, 12122, 21, 3, 12222, + . 22, -3, 1116, 22, -1, 1216, 22, 1, 2126, 22, 3, 2226, + . 23, -3, 21112, 23, -1, 21212, 23, 1, 22122, 23, 3, 22222, + . 24, -3, 21114, 24, -1, 22114, 24, 1, 22214, 24, 3, 22224, + . 25, -3, 11116, 25, -1, 11216, 25, 1, 12126, 25, 3, 12226, + . 26, -3, 1118, 26, -1, 2118, 26, 1, 2218, 26, 3, 2228, +c Lambda + . 27, 0, 3122, + . 28, 0, 13122, + . 29, 0, 3124, + . 30, 0, 23122, + . 31, 0, 33122, + . 32, 0, 13124, + . 33, 0, 43122, + . 34, 0, 53122, + . 35, 0, 3126, + . 36, 0, 13126, + . 37, 0, 23124, + . 38, 0, 3128, + . 39, 0, 23126, +c Sigma + . 40, -2, 3112, 40, 0, 3212, 40, 2, 3222, + . 41, -2, 3114, 41, 0, 3214, 41, 2, 3224, + . 42, -2, 13112, 42, 0, 13212, 42, 2, 13222, + . 43, -2, 13114, 43, 0, 13214, 43, 2, 13224, + . 44, -2, 23112, 44, 0, 23212, 44, 2, 23222, + . 45, -2, 3116, 45, 0, 3216, 45, 2, 3226, + . 46, -2, 13116, 46, 0, 13216, 46, 2, 13226, + . 47, -2, 23114, 47, 0, 23214, 47, 2, 23224, + . 48, -2, 3118, 48, 0, 3218, 48, 2, 3228, +c Xi + . 49, -1, 3312, 49, 1, 3322, + . 50, -1, 3314, 50, 1, 3324, + . 52, -1, 13314, 52, 1, 13324, +c Omega + . 55, 0, 3334, +c gamma + . 100, 0, 22, +c pion + . 101, -2, -211, 101, 0, 111, 101, 2, 211, +c eta + . 102, 0, 221, +c omega + . 103, 0, 223, +c rho + . 104, -2, -213, 104, 0, 113, 104, 2, 213, +c f0(980) + . 105, 0, 10221, +c kaon + . 106, -1, 311, 106, 1, 321, +c eta' + . 107, 0, 331, +c k*(892) + . 108, -1, 313, 108, 1, 323, +c phi + . 109, 0, 333, +c k0*(1430) + . 110, -1, 10313, 110, 1, 10323, +c a0(980) + . 111, -2,-10211, 111, 0, 10111, 111, 2, 10211, +c f0(1370) + . 112, 0, 20221, +c k1(1270) + . 113, -1, 10313, 113, 1, 10323, +c a1(1260) + . 114, -2,-20213, 114, 0, 20113, 114, 2, 20213, +c f1(1285) + . 115, 0, 20223, +c f1'(1510) + . 116, 0, 40223, +c k2*(1430) + . 117, -1, 315, 117, 1, 325, +c a2(1329) + . 118, -2, -215, 118, 0, 115, 118, 2, 215, +c f2(1270) + . 119, 0, 225, +c f2'(1525) + . 120, 0, 335, +c k1(1400) + . 121, -1, 20313, 121, 1, 20323, +c b1 + . 122, -2,-10213, 122, 0, 10113, 122, 2, 10213, +c h1 + . 123, 0, 10223, +c K* (1410) + . 125, -1, 30313, 125, 1, 30323, +c rho (1450) + . 126, -2,-40213, 126, 0, 40113, 126, 2, 40213, +c omega (1420) + . 127, 0, 50223, +c phi(1680) + . 128, 0, 10333, +c k*(1680) + . 129, -1, 40313, 129, 1, 40323, +c rho(1700) + . 130, -2,-30213, 130, 0, 30113, 130, 2, 30213, +c omega(1600) + . 131, 0, 60223, +c phi(1850) + . 132, 0, 337 / + +cb check for antiparticles + if (ityp.lt.0) then +cl its an antiparticle + anti = .true. + abs_ityp = abs(ityp) + norm_iso3 = -iso3 +cl only mesons with odd isospin can have a negative ITYPE + if (abs_ityp.gt.minmes)then + if(mod(isomes(abs_ityp),2).eq.0) then + call error ('pdgid','Negative ITYP not allowed', + . dble(ityp),3) + pdgid = 0 + return + endif + endif + else + anti = .false. + abs_ityp = ityp + norm_iso3 = iso3 + endif + +cb search for the ITYP in IDTAB + + first = 1 + last = TAB_SIZE + if (idtab(1,first).eq.abs_ityp) then + next = first + goto 200 + endif + if (idtab(1,last).eq.abs_ityp) then + next = last + goto 200 + endif + + 100 continue + +cl ITYP not found in IDTAB + if (last.le.(first+1)) then + pdgid = 0 + return + endif + + next = (first+last)/2 + + if (idtab(1,next).lt.abs_ityp) then + first = next + goto 100 + elseif (idtab(1,next).gt.abs_ityp) then + last = next + goto 100 + endif + + 200 continue + +cl calculate the entry with the wanted ISO3 + next = next - (idtab(2,next)-norm_iso3)/2 + +cl check if we found the correct values in IDTAB + if ((idtab(1,next).eq.abs_ityp).and. + . (idtab(2,next).eq.norm_iso3)) then + if (anti) then + pdgid = -idtab(3,next) + else + pdgid = idtab(3,next) + endif + else +! M.R 2019-04-27, error to be handled in CORSIKA instead of here +! call error ('pdgid','Error in tablelookup',dble(next),3) + pdgid = 0 + endif + + return + end + + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + function partname (ityp) +c +c Revision : 1.0 +c +coutput partname : Name of the Particle as a character string +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + + include 'comres.f' + + character*15 partname + integer ityp + + integer abs_ityp + character*7 baryon_names(maxbar-minbar+1) + character*11 meson_names(maxmes-minmes+1) + character*1 prefix + + data baryon_names/ + . 'Nukleon', + . 'N(1440)', + . 'N(1520)', + . 'N(1535)', + . 'N(1650)', + . 'N(1675)', + . 'N(1680)', + . 'N(1700)', + . 'N(1710)', + . 'N(1720)', + . 'N(1900)', + . 'N(1990)', + . 'N(2080)', + . 'N(2190)', + . 'N(2220)', + . 'N(2250)', + . 'D(1232)', + . 'D(1600)', + . 'D(1620)', + . 'D(1700)', + . 'D(1900)', + . 'D(1905)', + . 'D(1910)', + . 'D(1920)', + . 'D(1930)', + . 'D(1950)', + . 'Lambda', + . 'L(1405)', + . 'L(1520)', + . 'L(1600)', + . 'L(1670)', + . 'L(1690)', + . 'L(1800)', + . 'L(1810)', + . 'L(1820)', + . 'L(1830)', + . 'L(1890)', + . 'L(2100)', + . 'L(2110)', + . 'Sigma', + . 'S(1385)', + . 'S(1660)', + . 'S(1670)', + . 'S(1750)', + . 'S(1775)', + . 'S(1915)', + . 'S(1940)', + . 'S(2030)', + . 'Xi', + . 'X(1530)', + . 'X(1690)', + . 'X(1820)', + . 'X(1950)', + . 'X(2030)', + . 'Omega' / + + + data meson_names/ + . 'gamma', + . 'pion', + . 'eta', + . 'omega', + . 'rho', + . 'f0(980)', + . 'kaon', + . 'eta''', + . 'k*(892)', + . 'phi', + . 'k0(1430)', + . 'a0(980)', + . 'f0(1370)', + . 'k1(1270)', + . 'a1(1260)', + . 'f1(1285)', + . 'f1(1510)', + . 'k2*(1430)', + . 'a2(1329)', + . 'f2(1270)', + . 'f2''(1525)', + . 'k1(1400)', + . 'b1', + . 'h1', + . 'h1''', + . 'k*(1410)', + . 'rho(1450)', + . 'omega(1420)', + . 'phi(1680)', + . 'k*(1680)', + . 'rho(1700)', + . 'omega(1600)', + . 'phi3(1850)' / + + abs_ityp = abs(ityp) + +c set the prefix for anti-particles + if (ityp.lt.0) then + prefix = '*' + else + prefix = ' ' + endif + + if ((abs_ityp.ge.minbar).and.(abs_ityp.le.maxbar)) then + partname = prefix//baryon_names (abs_ityp) + elseif ((abs_ityp.ge.minmes).and.(abs_ityp.le.maxmes)) then + partname = prefix//meson_names (abs_ityp-99) + else + call error ('partname','ITYP out of range',dble(ityp),3) + partname = '---' + endif + + return + end diff --git a/Processes/UrQMD/jdecay2.f b/Processes/UrQMD/jdecay2.f new file mode 100644 index 0000000000000000000000000000000000000000..a69c70a940ca75e89846603b4775561381645bd6 --- /dev/null +++ b/Processes/UrQMD/jdecay2.f @@ -0,0 +1,344 @@ + subroutine nbodydec(rm) +c +c Revision : 1.0 +c +c input: rm: Resonance mass +c +c {\tt nbodydec} performs the decay of a resonance with mass rm in +c its local rest frame into nexit particles with 4-momenta and +c masses stored in the array pnew (see comment to SUB jdecay). +c The accessible many-body phase-space is homogenously populated, +c i.e. each configuration has equal probability. The theory behind +c this approach can be found in M.M. Block and J.D. Jackson, Z. +c Phys. C 3, 255 (1980). The original routine is contained in CPC +c (Code ACGJ). It has been modified for uQMD purposes. +c More documentation and better readability are to follow. + + implicit none + integer j,i,imin1 + include 'newpart.f' + real*8 rm + real*8 p4loc(0:3), p1loc(3), ploc(3) + real*8 M(mprt), MEFFloc(mprt), MASS + real*8 M1,F1,M11 + + + real*8 z3, v2, ptot, costheta, z4, v1, reci1, z9, delx2, xi, + + z10, pp1dot,ener1,p2, p1s, z5, sintheta, phii,psin, + + p1sq, u, u1, ximin,ximax,delu,energy,pi,wmax,w,esys,z2,s, + + z8,reci,b, delxi,a,delz,ranf + + LOGICAL MASSLESS + integer ntry + + p4loc(0) = rm + p4loc(1) = 0d0 + p4loc(2) = 0d0 + p4loc(3) = 0d0 + wmax = 1d0 + + PI=4d0*ATAN(1d0) +C + M1=0d0 !Initialize M1=sum of all masses. + MASSLESS=.FALSE. +C Read masses. + DO I=1,nexit + m(i) = pnew(5,i) + M1=M1+M(I) ! M1= sum of all masses. + ENDDO + IF (M1.EQ.0.) THEN ! If massless. + MASSLESS=.TRUE. + WMAX=1d0 + ENDIF + MEFFloc(1)=M(1) !Initialize Meff(1) +C Initialize ESYS. + ESYS=SQRT(p4loc(0)*p4loc(0)+p4loc(1)*p4loc(1)+ + + p4loc(2)*p4loc(2)+p4loc(3)*p4loc(3)) +C + +C Main Calculation +C + ntry=0 +60 W=1d0 !Initial weight, for each new event. + ntry=ntry+1 + MASS=M1 !Initial M=total mass of ALL particles. + ENERGY=p4loc(0) !Initialize E to E*=cms energy. + + DO I=nexit-1,2,-1 !Loop over all N-2 effective masses needed. + U1=M(I+1)/ENERGY + U=U1**2 + MASS=MASS-M(I+1) +C MASS=SUM of all rest masses of the REMAINING particles. + XIMIN=(MASS/ENERGY)**2 !This is Xi,minimum. + DELU=1d0-U1 + XIMAX=DELU**2 !This is Xi,maximum,where + !XIMIN <= XI <= XIMAX. + DELXI=XIMAX-XIMIN ! DELXI=delta (XI)=XIMAX-XIMIN. + B=(1d0+U-XIMIN) ! Used in FAST event generator. + A=dble(I)*B ! A=commonly used factor. + IMIN1=I-1 ! IMIN1=commonly used factor. + DELZ=(A-dble(IMIN1)*DELXI)*DELXI**IMIN1 ! DELZ=Zmax-Zmin +C +C Here, we introduce the FAST generators. +C + RECI=1d0/dble(I) + S=1d0/(dble(I)-dble(IMIN1)*DELXI/B) ! The probability + ! for the distribution i*(i-1)*y**(i-2)*(1-y). +100 Z2=ranf(0) + IF (Z2.LT.S) THEN ! The distribution i*(i-1)*y**(i-2)*(1-y). + Z8=ranf(0) + Z9=ranf(0) + RECI1=1d0/dble(IMIN1) + DELX2=DELXI*Z8**RECI*Z9**RECI1 + ELSE + Z10=ranf(0) + DELX2=DELXI*Z10**RECI ! The probability distribution + ! i*y**(i-1) + ENDIF + IF (DELX2.EQ.0.) GOTO 100 ! Guards against division by 0. +ctp060202 110 XI=XIMIN+DELX2 ! XI=XImin+deltaXI. + XI=XIMIN+DELX2 ! XI=XImin+deltaXI. + ! We reweight (multiply) W by + ! DELZ*F1*[(XI/(XI-XIMIN))**(I-2)]/(1+U-XI) . + W=W*DELZ*F1(U,XI)*((XI/DELX2)**(I-2))/(1d0+U-XI) + MEFFloc(I)=ENERGY*SQRT(XI) ! Store effective mass I, and + ! update E for next effective mass. + ENERGY=MEFFloc(I) + ENDDO + V1=(M(1)/ENERGY)**2 ! Set up final weight, with particles 1 and 2. + V2=(M(2)/ENERGY)**2 + W=W*F1(V1,V2) ! We now have the FINAL weight. + !We find WMAX, the max weight, here. +c IF (W.GT.WMAX) WMAX=W ! Update WMAX. + ! This routine selects W=1 (unweighted events). + Z3=ranf(0) + IF (W.LT.WMAX*Z3.and.ntry.le.1000) THEN + GOTO 60 + ENDIF + ! We have accepted event, so see if we Lorentz transform it. + + M11=p4loc(0) + p1loc(1)=p4loc(1) + p1loc(2)=p4loc(2) + p1loc(3)=p4loc(3) + + !Iterate over all blob masses, MEFF(I), where MEFF(1)=M(1),MEFF(N)=E*. + DO 2500 I=nexit,2,-1 + ENERGY=.5d0*(M11+(M(I)**2-MEFFloc(I-1)**2)/M11) + PTOT=SQRT(ENERGY**2-M(I)**2) + !Find RANDOM cos(theta*)=COSTHETA, random PHI*=PHI + ! SINTHETA=SIN(THETHA*) + Z4=ranf(0) + COSTHETA=2d0*Z4-1d0 ! -PI <= THETA* <= PI + SINTHETA=SQRT(1d0-COSTHETA**2) + Z5=ranf(0) + PHII=2d0*PI*Z5 ! 0 <= PHI* <= 2*PI, random PHII + PSIN=PTOT*SINTHETA !Commonly used combination. + ! Calculate momentum compon. of particle I, ploc(k), k=1 to 3. + ploc(1)=PSIN*COS(PHII) ! x-component. + ploc(2)=PSIN*SIN(PHII) !y-component. + ploc(3)=PTOT*COSTHETA ! z-component. + P1SQ=p1loc(1)**2+p1loc(2)**2+p1loc(3)**2 + P1S=SQRT(P1SQ) + ENER1=SQRT(P1SQ+M11**2) + ! Calculate Plab(i) = + !P*(i) + betagamma(i)* + ! [Energy + betagamma(j).ploc(j)/(gamma+1)], + !where . means DOT product, i,j=x,y,z. + PP1DOT=ploc(1)*p1loc(1)+ploc(2)*p1loc(2)+ploc(3)*p1loc(3) ! DOT product. + A=(ENERGY+PP1DOT/M11/(1d0+ENER1/M11))/M11 + ! Plab=P1 for particle I;store in matrix OUT(K,I,3), update + ! new M11 and new p1loc()=ploc()-p1loc(). + P2=0d0 + DO J=1,3 + ploc(J)=ploc(J)+A*p1loc(J) !Store new ploc(). + P2=P2+ploc(J)*ploc(J) !Get square of ploc() vector. + p1loc(J)=p1loc(J)-ploc(J) !Update p1loc() + ENDDO + ENERGY=SQRT(P2+M(I)**2) !Store new ENERGY. + M11=MEFFloc(I-1) ! Update M11. +c WRITE (5,2600) M(I),ENERGY,ploc(1),ploc(2),ploc(3) + pnew(5,i) = m(i) + pnew(4,i) = sqrt(m(i)**2+ploc(1)**2+ploc(2)**2+ploc(3)**2) + pnew(1,i) = ploc(1) + pnew(2,i) = ploc(2) + pnew(3,i) = ploc(3) +2500 ENDDO +c2600 FORMAT(0P,F7.4,2X,G13.7,5X,G13.7,3X,G13.7,3X,G13.7) + P2=0d0 ! Do LAST particle here. + DO J=1,3 + ploc(J)=p1loc(J) ! Store last ploc(). + P2=P2+ploc(J)*ploc(J) + ENDDO + ENERGY=SQRT(P2+M(1)**2) ! Store last ENERGY. +c WRITE (5,2600) M(1),ENERGY,ploc(1),ploc(2),ploc(3) +c WRITE (5,*) + pnew(5,1) = m(1) + pnew(4,1) = sqrt(m(1)**2+ploc(1)**2+ploc(2)**2+ploc(3)**2) + pnew(1,1) = ploc(1) + pnew(2,1) = ploc(2) + pnew(3,1) = ploc(3) + + RETURN + END +!------------------------------------------------------------------------- + FUNCTION F1(V1,V2) + ! Function F1(V1,V2)=SQR(1+(V1-V2)**2-2*(V1+V2))=2*(P*)/(E*). + implicit none + REAL*8 F1, F2, V1, V2 + F2=1d0+(V1-V2)**2-2d0*(V1+V2) + IF (F2.LE.0d0) THEN + F1=0d0 + ELSE + F1=SQRT(F2) ! Guard against sqr(-). + ENDIF + END + + + function M_inv_2(v01,vx1,vy1,vz1, + + v02,vx2,vy2,vz2) + real*8 M_inv_2,v01,vx1,vy1,vz1, + + v02,vx2,vy2,vz2 + + M_inv_2 = sqrt((v01+v02)**2 + + -(vx1+vx2)**2 + + -(vy1+vy2)**2 + + -(vz1+vz2)**2) + return + end + + function M_inv_3(v01,vx1,vy1,vz1, + + v02,vx2,vy2,vz2, + + v03,vx3,vy3,vz3) + real*8 M_inv_3,v01,vx1,vy1,vz1, + + v02,vx2,vy2,vz2, + + v03,vx3,vy3,vz3 + + M_inv_3 = sqrt((v01+v02+v03)**2 + + -(vx1+vx2+vx3)**2 + + -(vy1+vy2+vy3)**2 + + -(vz1+vz2+vz3)**2) + return + end + + + + + + + subroutine jdecay(rm) +C input px,py,pz : CM-momenta of total system +C rm: Mass of resonance (sqrt(s)) +c for pnew and pgen : +c first index: 1=px, 2=py, 3=pz, 4=E, 5=m0 +c second index: particle number + implicit none + include 'newpart.f' + real*8 pgen(5,mprt),rnd(mprt),u(3),beta(3),wt,tmp + real*8 wtmax,rm,sum,pi,sum1,sum2,pcms,ranf,gamma,bp,phi,qcm,r1234 + + parameter(pi=3.141592654) + integer n,nadd1,i,j,ii,k +c + pgen(1,1)=0d0 + pgen(2,1)=0d0 + pgen(3,1)=0d0 + pgen(5,1)=rm + pgen(4,1)=rm +c + nadd1=nexit-1 +c + pgen(5,nexit)=pnew(5,nexit) + +c Two body decay +c --------------- + if(nexit.eq.2) goto 400 + sum=0d0 +c sum: sum of masses in the outgoing channel + do 20 n=1,nexit + sum=sum+pnew(5,n) + 20 continue + +c calculate maximum phase-space weight wtmax +c ------------------------------------ + wtmax=0.5d0 + sum1=pgen(5,1) + sum2=sum-pnew(5,1) + do 200 i=1,nadd1 + wtmax=wtmax*pcms(sum1,sum2,pnew(5,i)) + sum1=sum1-pnew(5,i) + sum2=sum2-pnew(5,i+1) + 200 continue + +c generate uniform nexit-body phase space +c -------------------------------------- +300 continue +c first generate nexit random numbers with decreasing value +c as excess energy distribution weights + rnd(1)=ranf(1) + do 110 i=2,nexit + rnd(i)=ranf(1) + do 120 j=i,2,-1 + if(rnd(j).gt.rnd(j-1)) then + tmp=rnd(j-1) + rnd(j-1)=rnd(j) + rnd(j)=tmp + endif + 120 continue + 110 continue +c last weight has to be zero + rnd(nexit)=0d0 +c now ? + wt=1d0 + sum1=sum + do 330 i=2,nexit + sum1=sum1-pnew(5,i-1) + pgen(5,i)=sum1+rnd(i)*(pgen(5,1)-sum) + if(pgen(5,1)-sum.lt.0.0) write(6,*)'glrrrrrp' + wt=wt*pcms(pgen(5,i-1),pgen(5,i),pnew(5,i-1)) + 330 continue + r1234=ranf(1) + if(wt.lt.r1234*wtmax) goto 300 + +c carry out two-body decays in pgen frames +c ---------------------------------------- + 400 continue + do 410 i=1,nadd1 + qcm=pcms(pgen(5,i),pgen(5,i+1),pnew(5,i)) +c u(3) is cos(theta) + u(3)=2d0*ranf(1)-1d0 + phi=2d0*pi*ranf(1) + u(1)=sqrt(1d0-u(3)**2)*cos(phi) + u(2)=sqrt(1d0-u(3)**2)*sin(phi) + do 420 j=1,3 + pnew(j,i)=qcm*u(j) + pgen(j,i+1)=-pnew(j,i) + 420 continue + pnew(4,i)=sqrt(qcm**2+pnew(5,i)**2) + pgen(4,i+1)=sqrt(qcm**2+pgen(5,i+1)**2) + 410 continue + do 430 j=1,4 + pnew(j,nexit)=pgen(j,nexit) + 430 continue + +c boost pgen frames to lab frame +c ------------------------------------------------- + do 500 ii=1,nadd1 + i=nexit-ii + do 510 j=1,3 + beta(j)=pgen(j,i)/pgen(4,i) + 510 continue + gamma=pgen(4,i)/pgen(5,i) + do 520 k=i,nexit + bp=beta(1)*pnew(1,k)+beta(2)*pnew(2,k)+beta(3)*pnew(3,k) + do 530 j=1,3 + pnew(j,k)=pnew(j,k)+gamma*beta(j)*(pnew(4,k) + & +bp*gamma/(gamma+1d0)) + 530 continue + pnew(4,k)=gamma*(pnew(4,k)+bp) + 520 continue + 500 continue + + return + end + diff --git a/Processes/UrQMD/make22.f b/Processes/UrQMD/make22.f new file mode 100644 index 0000000000000000000000000000000000000000..72c02a21e03b8642d64ddb888f37addf78e50617 --- /dev/null +++ b/Processes/UrQMD/make22.f @@ -0,0 +1,2951 @@ +c$Id: make22.f,v 1.36 2003/05/02 11:06:54 weber Exp $ +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine make22(iio,e,ii1,iiz1,mm1,xfac1,ii2,iiz2,mm2,xfac2) +c +cinput iio : label for exit-channel +cinput e : $\sqrt{s}$ of process +cinput ii1 : ID of incoming particle 1 +cinput iiz1 : $2\cdot I_3$ of incoming particle 1 +cinput mm1 : mass of incoming particle 1 +cinput xfac1 : scaling factor for preformed hadron +cinput ii2 : ID of incoming particle 2 +cinput iiz2 : $2\cdot I_3$ of incoming particle 2 +cinput mm2 : mass of incoming particle 2 +cinput xfac2 : scaling factor for preformed hadron +c +c output: exit channel via common-blocks in {\tt newpart.f} +c +c {\tt make22} generates the final state for all scatterings and +c decays. Due to the diverse nature of the interactions handled +c many special cases have to be taken care of. The label {\tt iio} +c matches in most cases the respective label in subroutine {\tt crossx}, +c which returns the respective partial cross sections. +c +C####C##1#########2#########3#########4#########5#########6#########7## + implicit none + + include 'coms.f' + include 'options.f' + include 'newpart.f' + include 'comres.f' + + + + integer io,iio,i1,i2,i3,i4,i,k,i1p,i1m,i2p,i2m + integer ifqrk1,ifqrk2,ifdiq1,ifdiq2,ifqrk3,ifqrk4,ifdiq3,ifdiq4 + integer iq1(2),iq2(3),kq1,kq2,kqq1,kqq2,iii,iff(3) + real*8 sig,e,m1,m2,m3,m4,gam,mm1,mm2,m1m,m2m,xfac1,xfac2 + + integer iz1,iz2,iz3,iz4,errflg,icnt,ntry,ib1,ib2,i1old,i2old + + logical bit + + +c...functions + integer isoit,whichres + real*8 getmass,fmsr,ranf,pcms,massit,widit,mminit + +c...vacuum quantumnumber(s) for special string decay (don't touch) + real*8 valint(1) + common /values/ valint + +c...string + real*8 b1,b2,ba1(3),ba2(3) + integer j,l,ii1,ii2,iiz1,iiz2,iexopt,iddum,ibar,jbar + logical fboost,switips + + + + integer ident(2,mprt) + real*8 part(9,mprt),ms1,ms2,msmin1,msmin2,tau,esum + + + bit=.true. + switips=.false. + io=mod(iio,200) + i1=ii1 + i2=ii2 + iz1=iiz1 + iz2=iiz2 + m1=mm1 + m2=mm2 + icnt=0 + ntry=0 + ibar=0 + + if(iabs(i1).lt.minmes)ibar=ibar+isign(1,i1) + if(iabs(i2).lt.minmes)ibar=ibar+isign(1,i2) + +c in case of a MB-reaction, sort particles (but keep track of +c any id-switch with the 'switips'-flag) + if(iabs(i1).ge.minmes.and.iabs(i1).le.maxmes.and. + & iabs(i2).ge.minbar.and.iabs(i2).le.maxbar)then + call swpizm(i1,iz1,m1,i2,iz2,m2) + switips=.true. + endif + + if(i1+i2.eq.0.and.iz1+iz2.eq.0.and.CTOption(20).ne.0.and. + . io.gt.20)goto 27 !e+e- + + if(io.lt.0)goto(100,100,100,100,100,100,100,29)-io + +c if(i1+i2.gt.2)write(6,*)'make22:',i1,i2 +ctp060202 1007 continue + goto(1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,9,17,9,17,20, + ,9,13,23,14,12,26,27,15,14,100,29,100,14,15,14,36,36,13)io + + write(6,*)'make22: unknown channel requested io:',io + write(6,*)' ',e,i1,iz1,m1,i2,iz2,m2 + stop + + 1 continue +c...pp->ND + i3=minnuc + i4=mindel + m3=massit(i3) + + call getmas(massit(i4),widit(i4),i4,isoit(i4),mminit(i4), + . e-m3,m3,m4) + + if(ranf(0).gt.0.5d0)call swpizm(i3,iz3,m3,i4,iz4,m4) + goto 1008 + + 2 continue +c...pp->pp* + i3=minnuc + m3=massit(i3) + if(bit)call getres(io,e,minnuc+1,maxnuc,i4) + call getmas(massit(i4),widit(i4),i4,isoit(i4),mminit(i4), + . e-m3,m3,m4) + + if(ranf(0).gt.0.5d0)call swpizm(i3,iz3,m3,i4,iz4,m4) + goto 1008 + + 3 continue +c...pp->ND* + i3=minnuc + m3=massit(i3) + if(bit)call getres(io,e,mindel+1,maxdel,i4) + call getmas(massit(i4),widit(i4),i4,isoit(i4),mminit(i4), + . e-m3,m3,m4) + + if(ranf(0).gt.0.5d0)call swpizm(i3,iz3,m3,i4,iz4,m4) + goto 1008 + + 4 continue +c...pp->DD + i3=mindel + i4=mindel + call getmas(massit(i3),widit(i3),i3,isoit(i3), + . mminit(i4),e-mminit(i4),mminit(i4),m3) + call getmas(massit(i4),widit(i4),i4,isoit(i4),mminit(i4), + . e-m3,m3,m4) + + if(ranf(0).gt.0.5d0)call swpizm(i3,iz3,m3,i4,iz4,m4) + goto 1008 + + 5 continue +c...pp->DN*, DN* with factor 4/3 + i3=mindel + if(bit)call getres(io,e,minnuc+1,maxnuc,i4) + call getmas(massit(i3),widit(i3),i3,isoit(i3), + . mminit(i3),e-mminit(i4),mminit(i4),m3) + call getmas(massit(i4),widit(i4),i4,isoit(i4),mminit(i4), + . e-m3,m3,m4) + + if(ranf(0).gt.0.5d0)call swpizm(i3,iz3,m3,i4,iz4,m4) + goto 1008 + + 6 continue +c...pp->DD*, DN* with factor 4/3 + i3=mindel + if(bit)call getres(io,e,mindel+1,maxdel,i4) + call getmas(massit(i3),widit(i3),i3,isoit(i3), + . mminit(i3),e-mminit(i4),mminit(i4),m3) + call getmas(massit(i4),widit(i4),i4,isoit(i4),mminit(i4), + . e-m3,m3,m4) + + if(ranf(0).gt.0.5d0)call swpizm(i3,iz3,m3,i4,iz4,m4) + goto 1008 + + 7 continue +c...pp -> generate N*N*,N*D*,D*D* + m3=fmsr(mminit(mindel),e-mresmin) + m4=fmsr(mminit(mindel),e-m3) + if(bit)i3=whichres(m3,3) + if(bit)i4=whichres(m4,3) + if(ranf(0).gt.0.5d0)call swpizm(i3,iz3,m3,i4,iz4,m4) + goto 1008 + + 8 continue +c...ND->DD + i3=mindel + i4=mindel + call getmas(massit(i3),widit(i3),i3,isoit(i3), + . mminit(i4),e-mminit(i4),mminit(i4),m3) + call getmas(massit(i4),widit(i4),i4,isoit(i4),mminit(i4), + . e-m3,m3,m4) + + if(ranf(0).gt.0.5d0)call swpizm(i3,iz3,m3,i4,iz4,m4) + goto 1008 + + 9 continue + write(6,*)'make22: channel no.',io,'not implemented.' + stop + + 10 continue +c...MB->B',MM->M* annihilations + call anndec(0,m1,i1,iz1,m2,i2,iz2,e,sig,gam) + + goto 2002 +c return + + 11 continue +c...MM->M' + call anndec(0,m1,i1,iz1,m2,i2,iz2,e,sig,gam) + + goto 2002 +c return + + + 12 continue + write(6,*)'make22: channel no.',io,'should correspond to', + ,'total cross section, i.e. make22 should not be called.' + stop + + 13 continue +c...elastic scattering +c + if(switips)then + call swpizm(i1,iz1,m1,i2,iz2,m2) + switips=.false. + endif + + call setizm(i1,iz1,m1,i2,iz2,m2,i3,iz3,m3,i4,iz4,m4) + + if(mminit(i4)+mminit(i3).gt.e)then +ctp060926 write(6,*)'make22(el):threshold violated' +ctp060926 write(6,*)'m3:',m3,mminit(i3) +ctp060926 write(6,*)'m4:',m4,mminit(i4) + else +c +c + if(m3.lt.mminit(i3))m3=mminit(i3) + if(m4.lt.mminit(i4))m4=mminit(i4) + end if + + goto 2001 + + 14 continue +c...inelastic scattering (aqm for nonstrange resonances) +c for arbitrary resonances getinw should be modified +c arbitrary particles are excited (whithout charge exchange) + +c...get minimal masses + call getirg(i1,i1m,i1p) + m1m=mminit(i1m) + call getirg(i2,i2m,i2p) + m2m=mminit(i2m) + + if(e-m1m-m2m.le.0d0)then +c...elastic scattering + call setizm(i1,iz1,m1,i2,iz2,m2,i3,iz3,m3,i4,iz4,m4) + goto 2001 +c return + end if + +c...masses + if(ranf(0).lt.5d-1)then + m3=fmsr(m1m,e-m2m) + m4=fmsr(m2m,e-m3) + else + m4=fmsr(m2m,e-m1m) + m3=fmsr(m1m,e-m4) + end if + + if(e-m3-m4.lt.0d0)goto 13 + +c...itype3 + if(i1m.lt.i1p.and.widit(i1m).lt.1d-3.and. + . m3.le.massit(i1m+1)-0.5*widit(i1m+1))then +c...lowest itype of this kind of particles is stable +c & mass .lt. approximate minimal mass of lowest itype + 1 + m3=massit(i1m) + i3=i1m + else if(i1m.eq.i1p.and.widit(i1m).lt.1d-3) then +c...class with only one narrow particle + i3=i1 + m3=massit(i3) + else +c...itypes of this kind are all unstable + call whichi(i3,i1m,i1p,m3) + end if + +c...itype4 + if(i2m.lt.i2p.and.widit(i2m).lt.1d-3.and. + . m4.le.massit(i2m+1)-0.5*widit(i2m+1))then +c...lowest itype of this kind of particles is stable + m4=massit(i2m) + i4=i2m + else if(i2m.eq.i2p.and.widit(i2m).lt.1d-3) then +c...class with only one narrow particle + i4=i2 + m4=massit(i4) + else +c...itypes of this kind are all unstable + call whichi(i4,i2m,i2p,m4) + end if + +c...no charge transfer + iz3=iz1 + iz4=iz2 + i3=isign(i3,ii1) + i4=isign(i4,ii2) + goto 2001 +c return + + 15 continue +c...XX -> 2 strings + if(CTOption(12).ne.0)then + write(6,*)' *** error(make22): string section is called ', + . 'while strings are switched off:CTOption(12).ne.0' + stop + end if + +c + if(switips)then + call swpizm(i1,iz1,m1,i2,iz2,m2) + switips=.false. + endif + + +c store old itypes + i1old=i1 + i2old=i2 + + 155 continue + +c allow for deexcitation: 'excitation' starts from groundstate + + if(iabs(i1).ge.minmes)then +c.. meson resonances may also be deexcitated: assign the particle +c id's of the lowest multiplet (with the same quark content) + call ityp2id(i1,iz1,iq1(1),iq1(2)) + if(iabs(iq1(1)).gt.iabs(iq1(2)))then + iddum=iq1(1) + iq1(1)=iq1(2) + iq1(2)=iddum + endif + iddum=isign(100*iabs(iq1(1))+10*iabs(iq1(2)),iq1(1)) + call id2ityp(iddum,0d0,i1,iz1) + else + call getirg(i1,i1m,i1p) + endif + +c same for second particle + if(iabs(i2).ge.minmes)then + call ityp2id(i2,iz2,iq1(1),iq1(2)) + if(iabs(iq1(1)).gt.iabs(iq1(2)))then + iddum=iq1(1) + iq1(1)=iq1(2) + iq1(2)=iddum + endif + iddum=isign(100*iabs(iq1(1))+10*iabs(iq1(2)),iq1(1)) + call id2ityp(iddum,0d0,i2,iz2) + else + call getirg(i2,i2m,i2p) + endif + +c +c BEWARE: now i1 and i2 do not contain anymore the ityps of the ingoing +c particles, but the ityps of the lowest possible states (groundstates). +c This is needed in order for the string-excitation to be able to +c excite ALL states and not only those above the state of the ingoing +c particle. +c If you need the old ityps (i.e. for elastic scattering) then reset them +c via i1old and i2old + + +c if the incoming masses are changed due to excitation, then the +c new masses should not be lower than: + m1m=mminit(i1) + m2m=mminit(i2) + +c..discriminate between BB and MB collisions: + ib1=1 + ib2=1 + if(iabs(i1).ge.minmes)ib1=0 + if(iabs(i2).ge.minmes)ib2=0 + + +c set minimum energy for the two strings + msmin1=m1m+CTParam(2) + msmin2=m2m+CTParam(2) + +c no (meson) string below 1 gev: + if(msmin1.lt.1d0)msmin1=1d0 + if(msmin2.lt.1d0)msmin2=1d0 + +c if energy too low: do elastic collision + if(m1m+m2m+CTParam(34).ge.e)then +ctp060926 write(*,*)'make22: not enough energy for string exc. ->elastic/ +ctp060926 &deexcitation' +ctp060926 write(*,*)' i1, i2, m1, m2, e: ',i1,i2,m1,m2,e + i1=i1old + i2=i2old + goto 13 + endif + + +c convert to quark-IDs + call ityp2id(i1,iz1,ifdiq1,ifqrk1) + call ityp2id(i2,iz2,ifdiq2,ifqrk2) + + iexopt=CTOption(22) + 81 continue +c 100 tries for excitation, otherwise elastic scattering + ntry=ntry+1 + if(ntry.gt.100)then +ctp060926 write(*,*)'make22: too many tries for string exc. ->elastic/ +ctp060926 & deexcitation' +ctp060926 write(*,*)' i1, i2, m1, m2, e: ',i1,i2,m1,m2,e + i1=i1old + i2=i2old + goto 13 + endif + +c string-excitation: +c get string masses ms1,ms2 and the leading quarks + call STREXCT(IFdiq1,IFqrk1,ib1,M1m, + & ifdiq2,ifqrk2,ib2,M2m,E, + & iexopt, + & ba1,ms1,ba2,ms2, + & ifdiq3,ifqrk3,ifdiq4,ifqrk4) +c the boost parameters are now fixed for the masses ms1, ms2. If the +c masses will be changed, set the parameter fboost to "false": + fboost=.true. + +c accept deexcitation of one of the hadrons: + if(ms1.le.msmin1.and.ms2.ge.msmin2)then + ms1=massit(i1) + fboost=.false. + else if(ms2.le.msmin2.and.ms1.ge.msmin1)then + ms2=massit(i2) + fboost=.false. +c don't accept elastic-like (both masses too low): + else if(ms1.lt.msmin1.and.ms2.lt.msmin2)then + goto 81 + endif + +c in case of deexcitation new masses are necessary +c single diffractive, mass excitation according 1/m + if(ms1.le.msmin1)then + ms2=fmsr(msmin2,e-ms1) + fboost=.false. + elseif(ms2.le.msmin2)then + ms1=fmsr(msmin1,e-ms2) + fboost=.false. + endif + +c quark-quark scattering -> only elastic ! + if(xfac1.lt..999d0.and.xfac2.lt..999d0 + & .and.ranf(0).lt..25) then + i1=i1old + i2=i2old + goto 13 + endif + +c single diffractive if one particle is a quark state, +c mass excitation according 1/m + if(xfac1.lt..999d0.and.ranf(0).lt..5)then + ms1=massit(i1) + ms2=fmsr(msmin2,e-ms1) + fboost=.false. + elseif(xfac2.lt..999d0.and.ranf(0).lt..5)then + ms2=massit(i2) + ms1=fmsr(msmin1,e-ms2) + fboost=.false. + endif + +c take care that the particles will be able to decay lateron: + if(ms1.lt.m1m)then + ms1=m1m + fboost=.false. + endif + if(ms2.lt.m2m)then + ms2=m2m + fboost=.false. + endif + +c avoid energy conservation violation + if(ms1+ms2.gt.e)goto 155 + + if(CTOption(22).ne.1.or..not.fboost)then +c the boost parameters have to be calculated: + b1=2.*e*pcms(e,ms1,ms2)/(e**2+ms1**2-ms2**2) + b2=2.*e*pcms(e,ms1,ms2)/(e**2-ms1**2+ms2**2) + ba1(3)=+b1 + ba2(3)=-b2 + do 151 j=1,2 + ba1(j)=0d0 + 151 ba2(j)=0d0 + end if + +c now write information to newpart common-blocks + mstring(1)=ms1 + mstring(2)=ms2 + +c string#1 + if(ms1.le.msmin1)then + nstring1=1 + l=1 + do j=1,3 + part(j,l)=0d0 + part(j+5,l)=0d0 + enddo + part(4,l)=ms1 + part(4+5,l)=0d0 + part(5,l)=ms1 + ident(1,l)=i1 + ident(2,l)=iz1 + else + call qstring(ifdiq3,ifqrk3,ms1,part,ident,nstring1) + if(nstring1.eq.0) goto 155 + end if + + esum=0d0 + + jbar=0 + + do l=1,nstring1 + pnew(5,l)=part(5,l) + itypnew(l)=ident(1,l) + + if(iabs(ident(1,l)).lt.minmes)jbar=jbar+isign(1,ident(1,l)) + + i3new(l)=ident(2,l) + do j=1,4 + pnew(j,l)=part(j,l) + xnew(j,l)=part(j+5,l) + enddo + pnew(3,l)=part(3,l) + xnew(3,l)=part(3+5,l) + call rotbos(0d0,0d0,ba1(1),ba1(2),ba1(3), + , pnew(1,l),pnew(2,l),pnew(3,l),pnew(4,l)) + call rotbos(0d0,0d0,ba1(1),ba1(2),ba1(3), + , xnew(1,l),xnew(2,l),xnew(3,l),xnew(4,l)) + esum=esum+pnew(4,l) + enddo + call leadhad(1,nstring1,1) + + +c string #2 + if(ms2.le.msmin2) then + nstring2=1 + l=1 + do j=1,3 + part(j,l)=0d0 + part(j+5,l)=0d0 + enddo + part(4,l)=ms2 + part(4+5,l)=0d0 + part(5,l)=ms2 + ident(1,l)=i2 + ident(2,l)=iz2 + else + call qstring(ifdiq4,ifqrk4,ms2,part,ident,nstring2) + if(nstring2.eq.0) goto 155 + end if + + esum=0d0 + do l=1,nstring2 + pnew(5,nstring1+l)=part(5,l) + itypnew(nstring1+l)=ident(1,l) + + if(iabs(ident(1,l)).lt.minmes)jbar=jbar+isign(1,ident(1,l)) + + i3new(nstring1+l)=ident(2,l) + do j=1,4 + pnew(j,nstring1+l)=part(j,l) + xnew(j,nstring1+l)=part(j+5,l) + enddo + pnew(3,nstring1+l)=-pnew(3,nstring1+l) + xnew(3,nstring1+l)=-xnew(3,nstring1+l) + call rotbos(0d0,0d0,ba2(1),ba2(2),ba2(3), + , pnew(1,nstring1+l),pnew(2,nstring1+l),pnew(3,nstring1+l), + , pnew(4,nstring1+l)) + call rotbos(0d0,0d0,ba2(1),ba2(2),ba2(3), + , xnew(1,nstring1+l),xnew(2,nstring1+l),xnew(3,nstring1+l), + , xnew(4,nstring1+l)) + esum=esum+pnew(4,nstring1+l) + enddo + call leadhad(nstring1+1,nstring1+nstring2,1) + +c error check +ctp060926 if(ibar.ne.jbar)then +ctp060926 write(6,*)' *** (E) no baryon number conservation', ibar,jbar +ctp060926 write(6,*)' ',i1,i2,ms1,ms2 +ctp060926 write(6,'(5i4)')(itypnew(l),l=1,nstring1+nstring2) +ctp060926 end if + + + return + + +ctp060202 718 format(i2,i4,i3,1x,10(f10.4,1x)) + + + + 17 continue + + iz3=iz1 + iz4=iz2 + i3=i1 + i4=i2 + + + m3=m1 + m4=m2 + +c the following lines MUST be there in order to set nucleons on-shell +c after their first collision + if(m3.lt.mminit(i3))m3=mminit(i3) + if(m4.lt.mminit(i4))m4=mminit(i4) + + + goto 2001 + + 20 continue +c...decays + if(ityptd(1,pslot(1)).eq.0) then +c normal decay +c note: m4,i4 and iz4 are dummies in this call + call anndec(1,m1,i1,iz1,m4,i4,iz4,e,sig,gam) + else +c forward time-delay + pnew(5,1)=fmasstd(1,pslot(1)) + itypnew(1)=ityptd(1,pslot(1)) + i3new(1)=iso3td(1,pslot(1)) + pnew(5,2)=fmasstd(2,pslot(1)) + itypnew(2)=ityptd(2,pslot(1)) + i3new(2)=iso3td(2,pslot(1)) + endif + + if(nexit.eq.2) then + i3=itypnew(1) + iz3=i3new(1) + m3=pnew(5,1) + i4=itypnew(2) + iz4=i3new(2) + m4=pnew(5,2) + goto 2001 + else +c three or four body decay + nstring1=1 + nstring2=nexit-1 + do i=1,4 + do j=1,nexit + pnew(i,j)=0d0 + xnew(i,j)=0d0 + end do + end do + mstring(1)=pnew(5,1) +c + mstring(2)=pnew(5,2) + do 91 j=3,nexit + mstring(2)=mstring(2)+pnew(5,j) + 91 continue +c +c now call routine for momentum phase space... + call nbodydec(e) + return + endif + + 23 continue +c...annihilation -> string + if(CTOption(12).ne.0)then + write(6,*)' *** error(make22): string section is called ', + . 'while strings are switched off:CTOption(12).ne.0' + stop + end if + + ms1=e/2. + ms2=e/2. + mstring(1)=ms1 + mstring(2)=ms2 + +c determine flavour content of b-bbar-system + call ityp2id(i1,iz1,ifdiq1,ifqrk1) + call ityp2id(i2,iz2,ifdiq2,ifqrk2) +c...create string 1 out of quark-antiquark pair + call qstring(ifqrk1,ifqrk2,ms1,part,ident,nstring1) + esum=0d0 + + do k=1,nstring1 + l=k + do j=1,4 + pnew(j,l)=part(j,l) + xnew(j,l)=part(j+5,l) + enddo + esum=esum+pnew(4,l) + pnew(5,l)=part(5,l) + itypnew(l)=ident(1,l) + i3new(l)=ident(2,l) + tau=part(9,l)/ (part(4,l)/part(5,l)) + enddo + call leadhad(1,nstring1,0) + +c...create string 2 out of diquark-antidiquark-pair +c use one quark and one antiquark for the string-ends: + ifqrk1=int(ifdiq1/1000) + ifqrk2=int(ifdiq2/1000) +c...store remaining flavour quantum numbers in ctp(26), they will +c be passed to the 'clustr'-routine: + ifdiq1=mod(ifdiq1/100,10) + ifdiq2=mod(ifdiq2/100,10) + valint(1)=dble(((abs(ifdiq1*10.d0)+abs(ifdiq2*1.d0)) + & *isign(1,ifdiq1))) + valint(1)=sign(valint(1),dble(ifdiq1)) + call qstring(ifqrk1,ifqrk2,ms2,part,ident,nstring2) + valint(1)=0.d0 + esum=0d0 + + do l=1,nstring2 + do j=1,4 + pnew(j,nstring1+l)=part(j,l) + xnew(j,nstring1+l)=part(j+5,l) + enddo + esum=esum+pnew(4,nstring1+l) + pnew(5,nstring1+l)=part(5,l) + itypnew(nstring1+l)=ident(1,l) + i3new(nstring1+l)=ident(2,l) + tau=part(9,nstring1+l)/ (part(4,l)/part(5,l)) + enddo + call leadhad(nstring1+1,nstring1+nstring2,0) + + return + + 26 continue +c...elastic MB scattering (the outgoing particle id's must not be +c assigned randomly like at label 2001) +c + if(switips)then + call swpizm(i1,iz1,m1,i2,iz2,m2) + switips=.false. + endif + + call setizm(i1,iz1,m1,i2,iz2,m2,i3,iz3,m3,i4,iz4,m4) + + if(mminit(i4)+mminit(i3).gt.e)then +ctp060926 write(6,*)'make22(el):threshold violated' +ctp060926 write(6,*)'m3:',m3,mminit(i3) +ctp060926 write(6,*)'m4:',m4,mminit(i4) + else + if(m3.lt.mminit(i3))m3=mminit(i3) + if(m4.lt.mminit(i4))m4=mminit(i4) + end if + +c... get momenta & fill newpart, 2 particle exit-channel + + nstring1=1 + nstring2=1 + nexit=2 + do i=1,4 + do j=1,2 + pnew(i,j)=0d0 + xnew(i,j)=0d0 + end do + end do + +c...boost to 2-particle cms + + pnew(3,1)=pcms(e,m3,m4) + pnew(3,2)=-pcms(e,m3,m4) + + pnew(4,1)=sqrt(m3**2+pnew(3,1)**2) + pnew(4,2)=sqrt(m4**2+pnew(3,2)**2) + + pnew(5,1)=m3 + mstring(1)=m3 + itypnew(1)=i3 + i3new(1)=iz3 + + pnew(5,2)=m4 + mstring(2)=m4 + itypnew(2)=i4 + i3new(2)=iz4 + + return + + 27 continue +c XX-> 1 string : e+e- , MB + if(CTOption(12).ne.0)then + write(6,*)' *** error(make22): string section is called ', + . 'while strings are switched off:CTOption(12).ne.0' + stop + end if + +c quark-quark scattering -> only elastic ! + if(xfac1.lt..999d0.and.xfac2.lt..999d0 + & .and.ranf(0).lt.0.25) goto 26 + + ms1=e + mstring(1)=ms1 + mstring(2)=0d0 + +c determine flavour content of string + if(CTOption(20).eq.1)then +c..e+e- annihilation + if(ranf(0).lt.CTParam(6))then + ifqrk1=3 ! ssbar + ifqrk2=-3 + else + call ityp2id(104,0,ifqrk1,ifqrk2) ! qqbar + end if + else +c...MB annihilation. the quark content must be known: + call ityp2id(i2,iz2,iq1(1),iq1(2)) + call ityp2id(i1,iz1,ifdiq2,iq2(3)) + + if(abs(i1).ge.minmes) then + iq2(1)=ifdiq2 + iq2(2)=iq2(3) + iq2(3)=0 + else + iq2(1)=mod(ifdiq2/100,10) + iq2(2)=int(ifdiq2/1000) + endif + + do 312 kq1=1,2 + do 412 kq2=1,3 +c..two of the quarks must be able to annihilate: + if(iq1(kq1)+iq2(kq2).eq.0) then + kqq1=kq1 + kqq2=kq2 + goto 414 + endif + 412 continue + 312 continue + goto 26 ! could not create double charged strange baryon string + 414 continue +c.. the 'iff'-quarks constitute the produced (anti-)baron + iff(1)=iq1(3-kqq1) + iii=1 + do 512 kq2=1,3 + if (kq2.ne.kqq2) then + iii=iii+1 + iff(iii)=iq2(kq2) + endif + 512 continue + + if(abs(i1).lt.minmes) then + call mquarks(iff,ifqrk1,ifqrk2) + else + ifqrk1=iff(1) + ifqrk2=iff(2) + endif + + endif + +c...create string 1 out of quark-antiquark pair + call qstring(ifqrk1,ifqrk2,ms1,part,ident,nstring1) + esum=0d0 + +c primitive bug-fix: + if(nstring1.eq.0)then +ctp060926 write(6,*)'make22: iline 27 not completed. ->elastic' + goto 26 + endif + + do 101 k=1,nstring1 + l=k +c no leading hadron in e+e- + if(CTOption(20).eq.1)then + leadfac(l)=0.0d0 + endif + do 102 j=1,4 + pnew(j,l)=part(j,l) + xnew(j,l)=part(j+5,l) + 102 continue + esum=esum+pnew(4,l) + pnew(5,l)=part(5,l) + itypnew(l)=ident(1,l) + i3new(l)=ident(2,l) + tau=part(9,l)/ (part(4,l)/part(5,l)) + 101 continue + if(CTOption(20).eq.1)then + call leadhad(1,nstring1,3) + else + call leadhad(1,nstring1,1) + endif + + nstring2=0 + return + + + 29 continue +c...DD->ND detailed balance + i3=minnuc + i4=mindel + m3=massit(i3) + m4=getmass(e-m3,0) + if(iabs(iz1+iz2).gt.isoit(i3)+isoit(i4))then + iz3=-9 + iz4=-9 + else + nexit=2 + itot(1)=isoit(i3) + itot(2)=isoit(i4) + call isocgk4(isoit(i1),iz1,isoit(i2),iz2,itot,i3new,errflg) + i3=isign(i3,ii1) + i4=isign(i4,ii2) + iz3=i3new(1) + iz4=i3new(2) + end if + + if(ranf(0).gt.0.5d0)call swpizm(i3,iz3,m3,i4,iz4,m4) + goto 2001 + + + 100 continue +c...??->NN detailed balance inverse channels +c iso3 are assigned in detbal + nexit=2 + i3=minnuc + i4=minnuc + m3=massit(minnuc) + m4=massit(minnuc) + itot(1)=isoit(i3) + itot(2)=isoit(i4) + call isocgk4(isoit(i1),iz1,isoit(i2),iz2,itot,i3new,errflg) + i3=isign(i3,ii1) + i4=isign(i4,ii2) + iz3=i3new(1) + iz4=i3new(2) + + if(ranf(0).gt.0.5d0)call swpizm(i3,iz3,m3,i4,iz4,m4) + goto 2001 + + + 36 continue +c...MB->B',MM->M* annihilations (forward time delay) + call anndec(0,m1,i1,iz1,m2,i2,iz2,e,sig,gam) + goto 2003 + + 1008 continue +c...get isospin-3 components + + nexit=2 + itot(1)=isoit(i3) + itot(2)=isoit(i4) + call isocgk4(isoit(i1),iz1,isoit(i2),iz2,itot,i3new,errflg) + iz3=i3new(1) + iz4=i3new(2) + +ctp060926 if(errflg.ne.0)then +ctp060926 write(6,*)'make22: iso-spin conservation ', +ctp060926 , 'not possible in isocgk: error-flag=',errflg +ctp060926 write(6,*)' ',isoit(i1),iz1,isoit(i2),iz2,'>', +ctp060926 , isoit(i3),isoit(i4),iz3,iz4, +ctp060926 , ' process:',e,i1,m1,i2,m2,'>',i3,m3,i4,m4,'io=',io +ctp060926 end if + i3=isign(i3,ii1) + i4=isign(i4,ii2) + + 2001 continue + + +c... get momenta & fill newpart, 2 particle exit-channel + + nstring1=1 + nstring2=1 + nexit=2 + do i=1,4 + do j=1,2 + pnew(i,j)=0d0 + xnew(i,j)=0d0 + end do + end do + +c...boost to 2-particle cms + + + if(.not.(ityptd(1,pslot(1)).ne.0.and.CTOption(34).eq.2.and. + & iline.eq.20)) then +c normal decay + + pnew(3,1)=pcms(e,m3,m4) + pnew(3,2)=-pcms(e,m3,m4) + + pnew(4,1)=sqrt(m3**2+pnew(3,1)**2) + pnew(4,2)=sqrt(m4**2+pnew(3,2)**2) + else +c forward time delay + pnew(1,1)=pxtd(1,pslot(1)) + pnew(1,2)=pxtd(2,pslot(1)) + pnew(2,1)=pytd(1,pslot(1)) + pnew(2,2)=pytd(2,pslot(1)) + pnew(3,1)=pztd(1,pslot(1)) + pnew(3,2)=pztd(2,pslot(1)) + pnew(4,1)=p0td(1,pslot(1)) + pnew(4,2)=p0td(2,pslot(1)) + endif + + pnew(5,1)=m3 + mstring(1)=m3 + itypnew(1)=i3 + i3new(1)=iz3 + + pnew(5,2)=m4 + mstring(2)=m4 + itypnew(2)=i4 + i3new(2)=iz4 + + return + + 2002 continue +c... fill newpart, one particle exit channel + nstring1=1 + nstring2=0 + nexit=1 + do i=1,4 + pnew(i,1)=0d0 + xnew(i,1)=0d0 + end do + pnew(4,1)=e + mstring(1)=e +c the rest of the relevant new particle data have been +c filled into the newpart arrays by anndex + + return + + 2003 continue +c bookkeeping for forward time-delay + do 204 j=1,2 + if(pslot(j).lt.1) goto 204 + pold(1,j)=px(pslot(j)) + pold(2,j)=py(pslot(j)) + pold(3,j)=pz(pslot(j)) + pold(4,j)=p0(pslot(j)) + pold(5,j)=fmass(pslot(j)) + itypold(j)=ityp(pslot(j)) + iso3old(j)=iso3(pslot(j)) + 204 continue + +c... fill newpart, one particle exit channel + nstring1=1 + nstring2=0 + nexit=1 + do i=1,4 + pnew(i,1)=0d0 + xnew(i,1)=0d0 + end do + pnew(4,1)=e + mstring(1)=e + + return + end + + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function rnfxf(b,xm,xp) +c +cinput b : parameter +cinput xm : lower interval boundary +cinput xp : upper interval boundary +c +c {\tt rnfxf} yields a value $x$ between {\tt xm} and {\tt xp} +c distributetd like $(1-x)^b/x$. +c +cccccCcc1ccccccccc2ccccccccc3ccccccccc4ccccccccc5ccccccccc6ccccccccc7cc + implicit none + real*8 xm,xp,i,inv,x,fmin,fmax,f,ranf,b + + i(x)=log(x) + inv(x)=exp(x) + + fmin=i(xm) + fmax=i(xp) + 3 f=fmin+(fmax-fmin)*ranf(0) + x=inv(f) + if(ranf(0).gt.(1d0-x/xp)**b)goto 3 + rnfxf=x + + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine setizm(i1,iz1,m1,i2,iz2,m2,i3,iz3,m3,i4,iz4,m4) +c +c input : {\tt i1,iz1,m1,i2,iz2,m2} +c output : {\tt i3,iz3,m3,i4,iz4,m4} +c +c This subroutine simply maps {\tt iz1} $\to$ {\tt iz3} $\ldots$ +c {\tt m2} $\to$ {\tt m4} +c +cccccCcc1ccccccccc2ccccccccc3ccccccccc4ccccccccc5ccccccccc6ccccccccc7cc + real*8 m1,m2,m3,m4 + integer i1,iz1,i2,iz2,i3,iz3,i4,iz4 + i3=i1 + i4=i2 + m3=m1 + m4=m2 + iz3=iz1 + iz4=iz2 + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine swpizm(i1,iz1,m1,i2,iz2,m2) +c +c +c input : {\tt i1,iz1,m1,i2,iz2,m2} +c output : {\tt i1,iz1,m1,i2,iz2,m2} +c +c This subroutine simply swaps {\tt 1} $\to$ {\tt 2} and vice versa. +c +c +cccccCcc1ccccccccc2ccccccccc3ccccccccc4ccccccccc5ccccccccc6ccccccccc7cc + real*8 m1,m2,ms + integer i1,iz1,i2,iz2,is,izs + is=i1 + i1=i2 + ms=m1 + m1=m2 + izs=iz1 + iz1=iz2 + i2=is + iz2=izs + m2=ms + return + end + + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function rnfpow(n,mmin,mmax) +c +cinput n : parameter +cinput mmin : lower interval boundary +cinput mmax : upper interval boundary +c +c {\tt rnfpow} yields a value $x$ between {\tt mmin} and {\tt mmax} +c distributetd like $x^n$. +c +cccccCcc1ccccccccc2ccccccccc3ccccccccc4ccccccccc5ccccccccc6ccccccccc7cc + implicit none + real*8 mmin,mmax,i,inv,ii,iinv,x,fmin,fmax,f,ranf + integer n + + i(x)=x**(n+1)/(n+1) + inv(x)=((n+1)*x)**(1/(n+1)) + ii(x)=log(x) + iinv(x)=exp(x) + + if(n.eq.-1)then + fmin=ii(mmin) + fmax=ii(mmax) + f=fmin+(fmax-fmin)*ranf(0) + rnfpow=iinv(f) + else + fmin=i(mmin) + fmax=i(mmax) + f=fmin+(fmax-fmin)*ranf(0) + rnfpow=inv(f) + end if + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function fmsr(mmin,mmax) +c +cinput mmin : minimum mass +cinput mmax : maximum mass +c +c {\tt fmsr} yields a mass according to the finite mass sum rule (FMSR) +c A.I.Sanda Phys.~Rev.~{\bf D6}~(1973)~231 and +c M.B.Einhorn et al., Phys. Rev. {\bf D5}~(1972)~2063 +c +cccccCcc1ccccccccc2ccccccccc3ccccccccc4ccccccccc5ccccccccc6ccccccccc7cc + implicit none + real*8 mmin,mmax,rnfpow!,x + ! i(x)=log(x) + ! inv(x)=exp(x) + + fmsr=rnfpow(-1,mmin,mmax) + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine getfmsr(io,mmin,mmax,ir,mr) +c +cinput io : class of resonance +cinput mmin : minimum mass +cinput mmax : maximum mass +coutput ir : ID of resonance +coutput mr : mass of resonance +c +c {\tt getfmsr} is an extension of {\tt fmsr} to simulate +c a resonance structure at low masses +c +cccccCcc1ccccccccc2ccccccccc3ccccccccc4ccccccccc5ccccccccc6ccccccccc7cc + + implicit none + integer io,ir,whichres + real*8 mmin,mmax,mr,massit,widit + include 'comres.f' + real*8 fmsr,mmean + + mr=fmsr(mmin,mmax) +c...if strings come into play > modify whichres! + ir=whichres(mr,io) + mr=mmean(1,massit(ir),widit(ir),mmin,mmax) + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + SUBROUTINE STREXCT(IFL11,IFL12,IB1,AM1,IFL21,IFL22,IB2,AM2,ECM, + *IOPT,ba1,ams1,ba2,ams2,ifl31,ifl32,ifl41,ifl42) +c +cinput ifl11 : ID of (di)quark of projectile hadron +cinput ifl12 : ID of remaining quark of projectile hadron +cinput ib1 : baryon number of projectile hadron +cinput am1 : mass of projectile hadron +cinput ifl21 : ID of (di)quark of target hadron +cinput ifl22 : ID of remaining quark of target hadron +cinput ib2 : baryon number of target hadron +cinput am2 : mass of target hadron +cinput ecm : $\sqrt{s}$ of excitation +cinput iopt : flag for excitation ansatz (1: Fritiof, 2:QGSM) +coutput ba1 : velocity of 1st string +coutput ams1 : mass of 1st string +coutput ba2 : velocity vector of 2nd string +coutput ams2 : mass of 2nd string +coutput ifl31 : (di)quark content of 1st string +coutput ifl32 : remainig quark content of 1st string +coutput ifl41 : (di)quark content of 2nd string +coutput ifl42 : remaining quark content of 2nd string +c +c output : particle IDs, masses and momenta via common block {\tt newpart} +c +c This routine performs the excitation of two strings according +c to different ansatzes defined via parameter {\tt iopt} +c +cccccCcc1ccccccccc2ccccccccc3ccccccccc4ccccccccc5ccccccccc6ccccccccc7cc + implicit real*8 (a-h,o-z) + implicit integer (i-n) + include 'options.f' + + real*8 ba1(3),ba2(3),P(2,5),ranf + integer IFLS(2,2) + + PARAMETER(PI=3.14159)! value of Pi + PARAMETER(XMAX=1.0) + LOGICAL SPINT,bt + + sigma=CTParam(31) + alpha=CTParam(32) + betav=CTParam(33) + ampit=CTParam(34) + betas=CTParam(40) +c +C CHECK INITIAL ENERGY + IF(AM1+AM2+ampit.gt.ECM) THEN + WRITE(6,*) '....STOP! Initial energy is too low for string + * excitation, ECM=', ECM,'<',am1,'+',am2 + STOP + ENDIF + + bt=.false. + if(ranf(0).lt.5d-1)bt=.true. + +C COMPUTE XMIN + XMIN=AMPIT/ECM + +C COMPUTE C.M.S. HADRON MOMENTUM AND ENERGIES + PCMS=SQRT(ALAMB(ECM**2,AM1**2,AM2**2))/(2.0*ECM) + ECMS1=SQRT(PCMS**2+AM1**2) + ECMS2=SQRT(PCMS**2+AM2**2) + +C COMPUTE LIGHT-CONE VARIABLES FOR HADRON-PROJECTILE : +C (PPLS01,PMINS01,PTX01,PTY01) + PPLS01=ECMS1+PCMS + PMINS01=ECMS1-PCMS + PTX01=0. + PTY01=0. + +C COMPUTE LIGHT-CONE VARIABLES FOR HADRON-TARGET : +C (PPLS02,PMINS02,PTX02,PTY02) + PPLS02=ECMS2-PCMS + PMINS02=ECMS2+PCMS + PTX02=0. + PTY02=0. + +C COMPUTE TRANSFERRED TRANSVERSE MOMENTUM : +C (QX,QY) +100 CALL GAUSPT(QT,SIGMA) + PHI=2.*PI*ranf(0) + QX=QT*COS(PHI) + QY=QT*SIN(PHI) + +C COMPUTE XPLUS AND XMINUS VALUES FOR INTERACTING PARTONS +c IF(IOPT.EQ.1) THEN + if(IOPT.eq.1.or.dabs(alpha).lt.1d-4)then + CALL XSDIS(XPLUS,XMIN,XMAX,BETAS) + CALL XSDIS(XMINUS,XMIN,XMAX,BETAS) + else ! IF(IOPT.EQ.2) THEN + XPLUS=XVDIS(XMIN,ALPHA,BETAV) + XMINUS=XVDIS(XMIN,ALPHA,BETAV) +c else +c write(6,*)'strexct: undefined excitation model' +c stop + ENDIF +C COMPUTE LIGHT-CONE PARAMETERS OF INTERACTING PARTONS : +C (PPRPLS1,PPRMINS1,PPRX1,PPRY1) + PPRPLS1=XPLUS*PPLS01 + PPRMINS1=0. + PPRX1=0. + PPRY1=0. +C +C (PPRPLS2,PPRMINS2,PPRX2,PPRY2) + PPRPLS2=0. + PPRMINS2=XMINUS*PMINS02 + PPRX2=0. + PPRY2=0. +C +C COMPUTE LIGHT-CONE COMPONENT OF TRANSFERRED MOMENTUM : +C (QPLS,QMINS) + QPLS=-(QT**2/PPRMINS2) + QMINS= QT**2/PPRPLS1 +C +C COMPUTE LIGHT-CONE PARAMETERS AND QUARK CONTENTS FOR EXCITED STRINGS + IF(IOPT.EQ.1) THEN +C FRITIOF ANSATZ : +C P1 ---> P1 + Q +C P2 ---> P2 - Q + PPLS1=PPLS01+QPLS + PMINS1=PMINS01+QMINS + PTX1=PTX01+QX + PTY1=PTY01+QY +C + PPLS2=PPLS02-QPLS + PMINS2=PMINS02-QMINS + PTX2=PTX02-QX + PTY2=PTY02-QY +C +C NO QUARK REARRANGEMENT + IFLS(1,1)=IFL11 + IFLS(1,2)=IFL12 + IFLS(2,1)=IFL21 + IFLS(2,2)=IFL22 + ELSEIF(IOPT.EQ.2) THEN +C QGSM ANSATZ : +C P1 ---> P1 - PPR1 + PPR2 - Q +C P2 ---> P2 - PPR2 + PPR1 + Q +C + PPLS1=PPLS01-PPRPLS1+PPRPLS2-QPLS + PMINS1=PMINS01-PPRMINS1+PPRMINS2-QMINS + PTX1=PTX01-PPRX1+PPRX2-QX + PTY1=PTY01-PPRY1+PPRY2-QY +C + PPLS2=PPLS02-PPRPLS2+PPRPLS1+QPLS + PMINS2=PMINS02-PPRMINS2+PPRMINS1+QMINS + PTX2=PTX02-PPRX2+PPRX1+QX + PTY2=PTY02-PPRY2+PPRY1+QY + +C QUARK REARRANGEMENT IS NEEDED TO CREATE COLOUR NEUTRAL STRINGS +C (In case of Baryon-Baryon or Meson-Meson or +C Antibaryon-Antibaryon or Meson-Antibaryon or Antibaryon-Meson +C interaction) + IF((IB1.EQ.1.AND.IB2.EQ.1).OR. + . (IB1.EQ.-1.AND.IB2.EQ.-1).OR. + . (IB1.EQ.0.AND.IB2.EQ.0).OR. + . (IB1.EQ.0.AND.IB2.EQ.-1).OR. + . (IB1.EQ.-1.AND.IB2.EQ.0)) THEN + IFLS(1,1)=IFL11 + IFLS(1,2)=IFL22 + IFLS(2,1)=IFL21 + IFLS(2,2)=IFL12 + ENDIF + +C QUARK REARRANGEMENT (In case of Meson-Baryon or Antibaryon-Baryon or v.v. +C interaction) + IF((IB1.EQ.0.AND.IB2.EQ.1).OR. + . (IB1.EQ.1.AND.IB2.EQ.0).OR. + . (IB1.EQ.-1.AND.IB2.EQ.1).OR. + . (IB1.EQ.1.AND.IB2.EQ.-1)) THEN + IFLS(1,1)=IFL11 + IFLS(1,2)=IFL21 + IFLS(2,1)=IFL22 + IFLS(2,2)=IFL12 + ENDIF + ELSE + PPLS1=0 + PMINS1=0 + PTX1=0 + PTY1=0 +C + PPLS2=0 + PMINS2=0 + PTX2=0 + PTY2=0 +C + WRITE(6,*) 'ERROR IN MAKE22: WRONG IOPT' + STOP + ENDIF + +C COMPUTE OUTGOING STRING MASSES. They should be more than stable hadron +C (with the same quark content) masses. In the contrary case generation +C should be repeated + AMS1S=PPLS1*PMINS1-QT**2 + SPINT=.TRUE. + AMS0=0 +C COMPUTE AMS0 + IF(MOD(IFLS(1,1),100).EQ.0.AND.MOD(IFLS(1,2),100).EQ.0) THEN +C qq-qqbar string + IFLU=1 ! add u- quark to construct hadron +C AMS0 is sum of masses of lowest baryon states + IFLH1=IDPARS(IFLS(1,1), -ISIGN(IFLU,IFLS(1,1)),SPINT,2) + IFLH2=IDPARS(IFLS(1,2), -ISIGN(IFLU,IFLS(1,2)),SPINT,2) + AMS0=amass(IFLH1)+amass(IFLH2) + ENDIF + IF(.NOT.(MOD(IFLS(1,1),100).EQ.0 + . .AND.MOD(IFLS(1,2),100).EQ.0))THEN +C AMS0 is mass of lowest hadron state + IKH=IDPARS(IFLS(1,1),IFLS(1,2),SPINT,2) + AMS0=amass(IKH) + ENDIF +C + IF(AMS1S.LT.AMS0**2) GO TO 100 +C + AMS2S=PPLS2*PMINS2-QT**2 + SPINT=.TRUE. +C COMPUTE AMS0 + IF(MOD(IFLS(2,1),100).EQ.0.AND.MOD(IFLS(2,2),100).EQ.0) THEN +C qq-qqbar string + IFLU=1 ! add u- quark to construct hadron +C AMS0 is sum of masses of lowest baryon states + IFLH1=IDPARS(IFLS(2,1),-ISIGN(IFLU,IFLS(2,1)),SPINT,2) + IFLH2=IDPARS(IFLS(2,2),-ISIGN(IFLU,IFLS(2,2)),SPINT,2) + AMS0=amass(IFLH1)+amass(IFLH2) + ENDIF + IF(.NOT.(MOD(IFLS(2,1),100).EQ.0 + . .AND.MOD(IFLS(2,2),100).EQ.0)) THEN +C AMS0 is mass of lowest hadron state + IKH=IDPARS(IFLS(2,1),IFLS(2,2),SPINT,2) + AMS0=amass(IKH) + ENDIF +C + IF(AMS2S.LT.AMS0**2) GO TO 100 +C + AMS1=SQRT(AMS1S) + AMS2=SQRT(AMS2S) +C +C SUM OF MASSES OF EXCITED STRINGS SHOULD BE LESS THAN INITIAL ENERGY + IF(AMS1+AMS2.GT.ECM) GO TO 100 +C + P(1,1)=PTX1 + P(1,2)=PTY1 + P(1,3)=0.5*(PPLS1-PMINS1) + P(1,4)=0.5*(PPLS1+PMINS1) + P(1,5)=AMS1 + P(2,1)=PTX2 + P(2,2)=PTY2 + P(2,3)=0.5*(PPLS2-PMINS2) + P(2,4)=0.5*(PPLS2+PMINS2) + P(2,5)=AMS2 +c + do 152 j=1,3 + ba1(j)=p(1,j)/p(1,4) + 152 ba2(j)=p(2,j)/p(2,4) + + ifl31=ifls(1,1) + ifl32=ifls(1,2) + ifl41=ifls(2,1) + ifl42=ifls(2,2) + +C +C CHECK ENERGY-MOMENTUM CONSERVATION + ESTR=P(1,4)+P(2,4) + PSTRX=PTX1+PTX2 + PSTRY=PTY1+PTY2 + PSTRZ=P(1,3)+P(2,3) +C +ctp060926 if(abs(estr-ecm).gt.1d-12)then +ctp060926 WRITE(6,*) 'ECM=',ECM +ctp060926 WRITE(6,*) 'ESTR=',ESTR +ctp060926 end if +ctp060926 if(pstrx.gt.1d-12)WRITE(6,*) 'PSTRX=',PSTRX +ctp060926 if(pstry.gt.1d-12)WRITE(6,*) 'PSTRY=',PSTRY +ctp060926 if(pstrz.gt.1d-12)WRITE(6,*) 'PSTRZ=',PSTRZ +C Note! One should also check flavour conservation! +C + RETURN + END +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 FUNCTION ALAMB(X,Y,Z) +c +c input : {\tt x,y,z} +c +C THIS ROUTINE COMPUTES KINEMATICAL FUNCTION +cccccCcc1ccccccccc2ccccccccc3ccccccccc4ccccccccc5ccccccccc6ccccccccc7cc + implicit none + real*8 x,y,z + + ALAMB=max(0d0,(X-Y-Z)*(X-Y-Z) - 4.D0*Y*Z) + + RETURN + END + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 FUNCTION XVDIS(XMIN,ALFA,BETA) +c +cinput xmin : lower boundary +cinput alfa : parameter +cinput beta : parameter +c +C This function returns {\tt xmin}$ < x < 1$ +c values distributed according to the Beta-function +C +cccccCcc1ccccccccc2ccccccccc3ccccccccc4ccccccccc5ccccccccc6ccccccccc7cc + implicit none + real*8 x,xmin,alfa,beta + + 100 CALL SBETA(X,ALFA,BETA) + IF(X.LE.XMIN) GO TO 100 + XVDIS=X + RETURN + END + +C####C##1#########2#########3#########4#########5#########6#########7## + SUBROUTINE SBETA(X,ALFA,BETA) +c +coutput x : Beta-distributed value +cinput alfa : parameter +cinput beta : parameter + +C THIS ROUTINE GENERATES X ACCORDING TO BETA DISTRIBUTION +C $U(X)=C*X**(ALFA-1)*(1-X)**(BETA-1)$ +C IONK,S METHOD IS USED +c +cccccCcc1ccccccccc2ccccccccc3ccccccccc4ccccccccc5ccccccccc6ccccccccc7cc + implicit none + real*8 ran1,ran2,alfa,beta,r1a,r2b,r12,x,ranf + + 1 RAN1=ranf(0) + RAN2=ranf(0) + R1A=RAN1**(1./ALFA) + R2B=RAN2**(1./BETA) + R12=R1A+R2B + IF(R12.GE.1.) GO TO 1 + X=R1A/R12 + RETURN + END + + + +C####C##1#########2#########3#########4#########5#########6#########7## + SUBROUTINE XSDIS(X,XMIN,XMAX,BETA) +c +cinput xmin : lower boundary +cinput xmax : upper boundary +cinput beta : parameter +c +C THIS FUNCTION GENERATES $XMIN < X < XMAX$ ACCORDING TO +C DISTRIBUTION $U(X)= 1./X*(1.-X)**(BETA+1)$ DISTRIBUTION +C PARAMETER $BETA > 0$ +c +cccccCcc1ccccccccc2ccccccccc3ccccccccc4ccccccccc5ccccccccc6ccccccccc7cc + implicit real*8 (a-h,o-z) + implicit integer (i-n) + + PE1=(1.-XMIN)**(BETA+1.)/(BETA+1.)-(1.-XMAX)**(BETA+1.)/ + *(BETA+1.) + PE=PE1+DLOG(XMAX/XMIN) + PE1=PE1/PE + 108 RND=ranf(0) + RNDMPE1=ranf(0) + IF(RNDMPE1.GT.PE1) GO TO 200 + X=1.-((1.-XMIN)**(BETA+1.)*(1.-RND)+(1.-XMAX)**(BETA+1.)* + *RND)**(1./(BETA+1.)) + GO TO 300 +200 X=XMIN*(XMAX/XMIN)**RND +300 PPE1=(1.-X)**BETA + PPE2=1./X + PPE1=PPE1+PPE2 + PPE2=PPE1*PPE2 + IF(PPE1*ranf(0).GT.PPE2) GO TO 108 + RETURN + END + + +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine getres(io,e,im,ip,ir) +c +cinput io : resonance class +cinput e : $\sqrt{s}$ of excitation process +cinput im : lower boundary for resonance ID's +cinput ip : upper boundary for resonance ID's +coutput ir : ID of resonance +c +c This subroutine randomly selects a resonance ID for a given +c resonance class ({\tt io}), collision $\sqrt{s}$ and ID possible range. +c The selected resonance choice is weighted according to the respective +c partial cross section for the excitation of such a resonance. +c +C####C##1#########2#########3#########4#########5#########6#########7## + implicit none + include 'comres.f' + include 'options.f' + integer io,i,im,ip,ir + real*8 e,x(minnuc:maxmes),xmax + + do i=im,ip + call crossf(io,e,i,x(i)) + end do + call getbran(x,minnuc,maxmes,xmax,im,ip,ir) + +ctp060926 if(ir.gt.ip.or.ir.lt.im) then +ctp060926 write(6,*)'***(E) getres: no final state selected...' +ctp060926 write(6,*)io,e,xmax,im,ip,ir +ctp060926 endif + + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine aqm(i1,i2,xt,xel) +c +cinput : {\tt i1,i2} : ID's of particle 1 and 2 +coutput : {\tt xt,xel}: total and elastic cross section +c +c This subroutine returns cross sections according +c to the additive quark model. +c +C####C##1#########2#########3#########4#########5#########6#########7## + integer i(2),ij,j,i1,i2,strit + real*8 s(2),xt,xel,mn(2) + integer ifa, ifb, isoit + include 'comres.f' + + i(1)=i1 + i(2)=i2 + do 108 j=1,2 + ij=i(j) + if(iabs(ij).ge.minmes)then + s(j)=1d0*abs(strit(ij)) + call ityp2id(ij, isoit(ij), ifa, ifb) +c take care of hidden strangeness + if (abs(ifa).eq.3 .and. abs(ifb).eq.3) s(j)=2 + mn(j)=1.d0 + else + s(j)=1d0*abs(strit(ij)) + mn(j)=0.d0 + end if + 108 continue + + xt=max(0d0,40d0*0.666667**(mn(1)+mn(2)) + * *( 1d0-0.4*s(1)/(3d0-mn(1)) ) + * *( 1d0-0.4*s(2)/(3d0-mn(2)) ) ) + xel=0.039*xt**1.5d0 + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + real* 8 function fppfit(iio,e,i3,i4) +c +c Version: 1.0 +c +cinput iio : tag for cross section class +cinput e : $\sqrt{s}$ of collision +cinput i3 : ID of first outgoing particle +cinput i4 : ID of second outgoing particle +c +c +c {\tt fppfit} returns the isospin-independent part +c of the production cross section +c for one or two outgoing resonances ({\tt i3} and {\tt i4}) +c in a proton-proton +c collision. {\tt io} sets the class of cross section +c which is returned (i.e. $p p \rightarrow N \Delta$). If +c {\tt io} is set 99 the class will be determined according +c to {\tt i3} and {\tt i4}. +c +C####C##1#########2#########3#########4#########5#########6#########7## + implicit none + include 'comres.f' + include 'comwid.f' + include 'options.f' + + real*8 e,tmp + integer i,iio,io,im,jm,id1,id2,id3,id4,i3,i4 + integer i1m,i1p,i2m,i2p,class1,class2,iim +c funct. + real*8 pmean,widit,massit,splint + integer jit,isoit + +c...parameters for resonance production in NN + integer nfit + parameter (nfit=7) + real*8 ar(nfit) + integer rr(2,nfit) +c io = 1 2 3 4 5 6 7 +c nd nn* nd* dd dn* dd* B*B* + data ar/ 4d4, 6.3d0, 12d0, 2.8d0, 3.5d0, 3.5d0, 0.d0 / + data rr/ 4,0, 4,1, 4,2, 0,0, 0,1, 0,2, 3,3 / +c rr tells of which particle class the out particles are +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + +c hard cut: no resonant cross section at highest energies + if(e.gt.maxtab2)then + fppfit=0d0 + return + endif +c + + id1=0 + id2=0 + id3=0 + id4=0 + im=i3 + jm=i4 + + if(iio.eq.99)then +c determine iline + +c get class of 1 particle + do 101 i=0,4 + call getrange(i,i1m,i1p) + class1=0 + if(im.ge.i1m.and.im.le.i1p)then + class1=i + goto 102 + endif +101 continue + write(*,*)'(E) fppfit: no x-section parametrized for ',im + stop +102 continue +c get class of 2 particle + do 103 i=0,4 + call getrange(i,i2m,i2p) + class2=0 + if(jm.ge.i2m.and.jm.le.i2p)then + class2=i + goto 104 + endif +103 continue + write(*,*)'(E) fppfit: no x-section parametrized for ',jm + stop +104 continue +c get iline corrsponding to pp->i3,i4 + do 105 i=1,nfit + if((rr(1,i).eq.class1.and.rr(2,i).eq.class2).or. + v (rr(1,i).eq.class2.and.rr(2,i).eq.class1))then + io=i + goto 106 + endif +105 continue +c maybe we have an R*R* reaction? + if(im.ge.minres.and.im.le.maxres + & .and.jm.ge.minres.and.jm.le.maxres)then + io=7 + goto 106 + endif + write(*,*)'(E) fppfit: no iline found for particles',im,jm + stop +106 continue + else + io=iio + endif + +c sort particles acc. to itypes + if(io.ne.5.and.im.gt.jm)then + im=i4 + jm=i3 + endif + if(io.eq.5.and.im.lt.jm)then + im=i4 + jm=i3 + endif + +c consistency checks + call getrange(rr(1,io),i1m,i1p) + if(im.lt.i1m.or.im.gt.i1p)then + write(*,*)'(E) fppfit: wrong iline for outgoing particles', + & io,im,jm + stop + endif + call getrange(rr(2,io),i2m,i2p) + if(jm.lt.i2m.or.jm.gt.i2p)then + write(*,*)'(E) fppfit: wrong iline for outgoing particles', + & io,im,jm + stop + endif + + + goto(1,2,2,2,2,2,4) io + write(6,*) '****(E) wrong x-section ID in fppfit *****',io + stop + +c pp ->ND + 1 continue + if(wtabflg.ge.3.and.CTOption(9).eq.0)then +c table lookup + iim=0 + if(im.eq.minnuc)then + iim=1 + elseif(im.eq.mindel)then + iim=2 + else + write(*,*)'(E) fppfit: First particle should be N or Delta' + stop + endif + fppfit=max(0d0,splint(tabxnd,frrtaby(1,1,iim,jm), + & frrtaby(1,2,iim,jm),widnsp,e)) + else +c calculate cross section + fppfit=pmean(e,im,isoit(im),jm,isoit(jm),id1,id2,id3,id4,1) + & /(pmean(e,1,1,1,1,id1,id2,id3,id4,1) + & *e*e)*ar(io) + & *(massit(jm)**2*widit(jm)**2/((e**2-massit(jm)**2)**2 + & +widit(jm)**2*massit(jm)**2)) + & *dble((jit(im)+1)*(jit(jm)+1)) + endif + + return + +c pp->NN* pp->ND* pp->DD pp->DN* pp->DD* + 2 continue + if(wtabflg.ge.3.and.CTOption(9).eq.0)then +c table lookup + iim=0 + if(im.eq.minnuc)then + iim=1 + elseif(im.eq.mindel)then + iim=2 + else + write(*,*)'(E) fppfit: First particle should be N or Delta' + stop + endif + fppfit=max(0d0,splint(tabxnd,frrtaby(1,1,iim,jm), + . frrtaby(1,2,iim,jm),widnsp,e)) + else +c calculate cross section + tmp=pmean(e,im,isoit(im),jm,isoit(jm),id1,id2,id3,id4,1) + & /(pmean(e,1,1,1,1,id1,id2,id3,id4,1) + & *e*e)*ar(io) + & *dble((jit(im)+1)*(jit(jm)+1)) + if(im.ne.jm) then + tmp=tmp + & /((massit(jm)-massit(im))**2*(massit(jm)+massit(im))**2) + endif + fppfit=tmp + endif + return + +c pp->B*B* + 4 continue +c sofar set to zero + fppfit=0d0 + return + + end + + + +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine crossx(iio,e,ii1,iiz1,mm1,ii2,iiz2,mm2,sig) +c +cinput iio : pointer to cross section +cinput e : $\sqrt{s}$ of collision +cinput ii1 : ID of particle 1 +cinput iiz1 : $2\cdot I_3$ of particle 1 +cinput mm1 : mass of particle 1 +cinput ii2 : ID of particle 2 +cinput iiz2 : $2\cdot I_3$ of particle 2 +cinput mm2 : mass of particle 2 +coutput sig : cross section +c +c This routine returns cross sections which are accessed via tags (pointers) +c {\tt iio}. The cross sections can either be partial ones for specific +c exit channels or total cross sections for the two incoming hadrons +c +C####C##1#########2#########3#########4#########5#########6#########7## + implicit none + + include 'comres.f' + include 'options.f' + include 'newpart.f' + + integer io,iio,i1,i2,iz1,iz2 + integer i,im,ip,j,jm,jp,ii1,iiz1,ii2,iiz2 +c integer itmp1,itmp2,itag + real*8 sig,e,e0,sum,m1,m2,m3,gam,dum,s1,s2,s3 + real*8 c1,c2,mm1,mm2,aaqm,dbfact,cgkcor,qflg,factor,ggam + real*8 sighelp,meltpoint2,pfrome,pmelt,pmelt2,plab + logical kplflag +c...functions + real*8 clebsch,siglookup,bcms,massit,widit,mminit,xmelt + real*8 fppfit,fwidth,fbwnorm,ppiso +c...additional functions and variables for ppbar&pp scattering: + real*8 bbphi,nnphi,sighera,sapptot, + & sappela,sappann,sappdiff,dgcgkfct + integer isoit,iq1(2),iq2(3),ifdiq2,kq1,kq2 + +c + real*8 sigheramb,sigmb,meltpoint + + logical excl + + real*8 ef,sigf,ee + integer jf,if + +c...parameters for resonance production in NN + integer nfit + parameter (nfit=7) +c real*8 er(nfit) + integer rr(2,nfit),in(nfit) + real*8 x,x0,xa,xb,xc,bf + real*8 f + + save kplflag + + f(x,x0,xa,xb,xc)=max(0d0,2.*xb*xa*(x-x0)/(xb**2+(x-x0)**2))* + * ((x0+xb)/(x))**xc + + +c io = 1 2 3 4 5 6 7 +c nd nn* nd* dd dn* dd* B*B* +c data er/ 4d-2, 0d0, 0d0, 0d0, 0d0, 0d0, 0d0/ + data rr/ 4,0, 4,1, 4,2, 0,0, 0,1, 0,2, 3,3 / +c rr tells of which particle class the out particles are + data in/ 1, 1, 1, 1, -1, 1, 1 / +c in tells which out particle has the higher itype + + + excl=.false. !flag for exclusive cross section(detailed balance) + + kplflag=.false. ! flag for k+ p total x-section + + goto 107 + + entry crossf(if,ef,jf,sigf) + io=if + ee=ef + j=jf + call getrange(rr(1,io),i,ip) ! call getrange(rr(2,io),jm,jp) + + sigf=fppfit(io,ee,i,j) + + return + + entry crossz(iio,e,ii1,iiz1,mm1,ii2,iiz2,mm2,sig) + + excl=.true. !flag for exclusive cross section(detailed balance) + + 107 continue + +c...some settings for all channels enter here + sig=0d0 + io=iabs(iio) + aaqm=CTParam(3) !exponent for bcm scaled AQM-cross sections + + call setizm(ii1,iiz1,mm1,ii2,iiz2,mm2, + ,i1,iz1,m1,i2,iz2,m2) + +c in case of a MB-reaction, sort particles: meson must be second (i2) + if(iabs(i1).ge.minmes.and.iabs(i1).le.maxmes.and. + & iabs(i2).ge.minbar.and.iabs(i2).le.maxbar)then + call swpizm(i1,iz1,m1,i2,iz2,m2) + endif + + + goto(1,1,1,1,1,1,1,8,9,10, + , 11,12,13,14,15,16,17,18,19,9,21,22,23,24, + , 25,26,27,28,29,30,31,32,33,34,35,36,37,38)io + + + write(6,*)'cross[x,z]: ', + ,' unknown channel requested, wrong io:',io + stop + + + 1 continue +c...pp-> ND pp->NN* pp->ND* pp->DD pp->DN* pp->DD* + call setizm(iabs(ii1),iiz1,mm1,iabs(ii2),iiz2,mm2, + ,i1,iz1,m1,i2,iz2,m2) +c fist outgoing particle has lower ID + if(i1.gt.i2)call swpizm(i1,iz1,m1,i2,iz2,m2) + +c determine range for first outgoing particle + call getrange(rr(1,io),im,ip) + + + if(excl)then +cut down the loop to one resonance for inverse exclusive processes + jm=in(io)*max0(in(io)*i1,in(io)*i2) + jp=jm + else + call getrange(rr(2,io),jm,jp) + + end if + sum=0. + + do i=im,ip +c...loop over i3 (1st outgoing particle) + do j=jm,jp +c...loop over i4 (2nd outgoing particle) +c sum over x-section + +c explicit isospin dependence + cgkcor=ppiso(iio,i1,iz1,i2,iz2,i,j) + + sum=sum+fppfit(io,e,i,j)*cgkcor + end do + end do + sig=sum +c +c detailed balance + if(iio.lt.0.and.sig.gt.1.d-12) then + + + call detbal(e,i1,i2,iz1,iz2,max(mminit(i1),m1), + & max(mminit(i2),m2),1,1,dbfact) + sig=sig*dbfact + endif + +c check energy conservation (cut-off is one 1 MeV) + if(max(m1,mminit(i1))+max(m2,mminit(i2))+1.d-3.gt.e) sig=0.d0 + + return + + + 8 continue +c...ND->DD iso-spin summed value + call setizm(iabs(ii1),iiz1,mm1,iabs(ii2),iiz2,mm2, + ,i1,iz1,m1,i2,iz2,m2) + + e0=2.*massit(mindel)-widit(mindel) + + c1=clebsch(isoit(i1),isoit(i2),iz1,iz2,1) + c2=clebsch(isoit(i1),isoit(i2),iz1,iz2,2) + +ctp060926 if(io.lt.0)write(6,*)'crossz(DD->ND):c1,c2=',c1,c2, +ctp060926 , isoit(i1),isoit(i2),iz1,iz2,'itypes:',i1,i2 + sig=f(e,e0,12.0d0,0.02d0,2d0)*(0.66667*c1+4d0/dsqrt(20d0)*c2) + + if(iio.lt.0.and.sig.gt.1.d-12) then + call detbal(e,i1,i2,iz1,iz2,max(mminit(i1),m1), + & max(mminit(i2),m2),minnuc,mindel,dbfact) + sig=sig*dbfact + endif + return + + 9 continue + write(6,*)'crossx: channel no.',io,'not implemented.' + stop + + 10 continue +c...MB->B' + call anndec(0,m1,i1,iz1,m2,i2,iz2,e,sig,gam) + return + + 11 continue +c...MM->M' + call anndec(0,m1,i1,iz1,m2,i2,iz2,e,sig,gam) + return + + 12 continue +c...??->X => additive quark model total cross section + call aqm(i1,i2,sig,dum) + if(sig.gt.1d3)then + write(6,*)'sig=',sig + end if + +c check energy conservation (cut-off is one 1 MeV) + if(max(m1,mminit(i1))+max(m2,mminit(i2))+1.d-3.gt.e) sig=0.d0 + + return + + 13 continue +c...??->X => additive quark model elastic cross section + call aqm(i1,i2,dum,sig) + +c check energy conservation (cut-off is one 1 MeV) + if(max(m1,mminit(i1))+max(m2,mminit(i2))+1.d-3.gt.e) sig=0.d0 + + return + + 14 continue +c...??->X => additive quark model inelastic cross section + call aqm(i1,i2,s1,s2) + s3=s1-s2 + s1=s3 +c DD->DD is possible only for e<4gev, then DD->Strings (15) is used + e0=mminit(i1)+mminit(i2)+2d0*CTParam(4) + bf=2d0*dabs(CTParam(4)-CTParam(2)) + s2=f(e,e0,s3,bf,1d0) + sig=xmelt(e,s1,s2,max(mminit(i1),m1)+max(mminit(i2),m2), + @ e0+2d0*CTparam(2)) + +c check energy conservation (cut-off is one 1 MeV) + if(max(m1,mminit(i1))+max(m2,mminit(i2))+1.d-3.gt.e) sig=0.d0 + + return + + 15 continue +c...??->X => additive quark model string cross section + if(CTOption(12).ne.0)return + if(CTOption(12).eq.0)then + call aqm(i1,i2,sig,dum) + sig=sig-dum +c dum is the inelastic xsec +c string threshold is at 3.2 GeV by default + if(e.gt.2d0*(1.08d0+ctparam(2)))then + sig=sig*bcms(e,1.08d0+ctparam(2),1.08d0+ctparam(2))**(aaqm) + else + sig=0.d0 + end if + end if + +c check energy conservation (cut-off is one 1 MeV) + if(max(m1,mminit(i1))+max(m2,mminit(i2))+1.d-3.gt.e) sig=0.d0 + + return + + 16 continue +c...pn-total...low energy tables & high energy fit + sig=xmelt(e,siglookup(1,e),sighera(.938d0,.938d0,e,3),3.d0,5.d0) + return + + 17 continue +c...pn-elastic...low energy tables & high energy fit (then pn=pp) + sig=xmelt(e,siglookup(2,e),sighera(.938d0,.938d0,e,2),3.d0,5.d0) + return + + 18 continue +c...pp-total...low energy tables & high energy fit + sig=xmelt(e,siglookup(3,e),sighera(.938d0,.938d0,e,1),3.d0,5.d0) + return + + 19 continue +c...pp-elastic...low energy tables & high energy fit + sig=xmelt(e,siglookup(4,e),sighera(.938d0,.938d0,e,2),3.d0,5.d0) + return + +ctp060202 20 continue + write(6,*)'crossx: cross section for decay(io=20) requested' + stop + return + + 21 continue +c...bbar total...from ppbar via AQM & phase-space + call aqm(1,-1,nnphi,dum) + call aqm(i1,i2,bbphi,dum) + sig=sapptot(e,m1,m2)*bbphi/nnphi + return + + + 22 continue +c...bbar elastic...from ppbar via AQM & phase-space + call aqm(1,-1,nnphi,dum) + call aqm(i1,i2,bbphi,dum) + sig=sappela(e,m1,m2)*bbphi/nnphi + return + + 23 continue +c...bbar annihilation from ppbar via AQM & phase-space + call aqm(1,-1,nnphi,dum) + call aqm(i1,i2,bbphi,dum) + sig=sappann(e,m1,m2)*bbphi/nnphi + return + + 24 continue +c...bbar diffractive...from ppbar via AQM & phase-space + call aqm(1,-1,nnphi,dum) + call aqm(i1,i2,bbphi,dum) + sig=sappdiff(e,m1,m2)*bbphi/nnphi + return + + 25 continue +c...pi^+ +p + if ((i2.eq.minmes+1).and.(iz2.eq.2) + & .and.(i1.eq.1).and.(iz1.eq.1)) then + sigheramb=sighera(m2,m1,e,7) + meltpoint=2.00d0 +c...pi^- +p + elseif ((i2.eq.minmes+1).and.(iz2.eq.-2) + & .and.(i1.eq.1).and.(iz1.eq.1)) then + sigheramb=sighera(m2,m1,e,9) + meltpoint=2.18d0 +c...K^+ +p + elseif ((i2.eq.minmes+6).and.(iz2.eq.1) + & .and.(i1.eq.1).and.(iz1.eq.1)) then + sigheramb=sighera(m2,m1,e ,11) + meltpoint=1.84d0 +C here second meltpoint to enable linear interpolation between +C meltpoint2 and meltpoint (in plab) + meltpoint2=1.7d0 + kplflag=.true. +c...K^- +p + elseif ((i2.eq.-(minmes+6)).and.(iz2.eq.-1) + & .and.(i1.eq.1).and.(iz1.eq.1)) then + sigheramb=sighera(m2,m1,e,14) + meltpoint=2.12d0 +c...K^+ +n + elseif ((i2.eq.minmes+6).and.(iz2.eq.1) + & .and.(i1.eq.1).and.(iz1.eq.-1)) then + sigheramb=sighera(m2,m1,e,13) + meltpoint=1.75d0 +c...K^- +n + elseif ((i2.eq.-(minmes+6)).and.(iz2.eq.-1) + & .and.(i1.eq.1).and.(iz1.eq.-1)) then + sigheramb=sighera(m2,m1,e,16) + meltpoint=1.6d0 +c...gamma + p + elseif ((i2.eq.minmes).and.(iz2.eq.0) + & .and.iabs(i1).le.maxbar) then + sigheramb=sighera(m2,m1,e,6) + meltpoint=1.75d0 + else +c...MB total (->B*/->Strings/el.) + call anndec(0,m1,i1,iz1,m2,i2,iz2,e,sigmb,gam) + if (sigmb.gt.1d-8) then +c meltpoint for resonant meson absorption moved to higher energies + meltpoint=max(1.7d0, m1+m2+.2d0) + else + meltpoint=1.7d0 + endif + call aqm(pimeson,nucleon,dum,nnphi) + call aqm(i1,i2,dum,bbphi) + sigheramb=sighera(m2,m1,e,7)*bbphi/nnphi +C + endif +C +C +c...breit-wigners... + call anndec(0,m1,i1,iz1,m2,i2,iz2,e,sigmb,gam) +c now melt the low energy resonance x-sec and the high energy hera-fits: + if (e.lt.meltpoint) then +C +c cross section for Danielewicz forward delay +c here the DP-cross section has the same form as the normal one +C + if(CTOption(34).eq.2) then + sig=sigmb+CTParam(58)*sigmb + elseif(CTOption(34).eq.3) then + m3=e + call anndec(0,m1,i1,iz1,m2,i2,iz2,e,sigmb,gam) + if(sig.gt.1d-5) sig=sigmb+CTParam(58) + elseif(CTOption(34).eq.4) then + m3=e + call anndec(0,m1,i1,iz1,m2,i2,iz2,e,sigmb,gam) + if(sigmb.gt.1d-5)then + ggam=fwidth(itypnew(1),i3new(1),m3) + sig=sigmb+CTParam(58)* + & sig*dsqrt(2.d0/(ggam*3.1415d0*fbwnorm(m3, + & itypnew(1),i3new(1)))) + endif + else +C +C actually default for e.lt.meltpoint +C take result from anndec as sigma +C + sig=sigmb +C + endif +C +c-- nonres adds s-channel strings for strange meson baryon reactions +c-- resonances are not sufficient to fit data - sig gets modified in nonres !!! +C-- so that k- p cross section describes data reasonable. +C-- nonres call only below meltpoint +C + call nonres(e,i1,iz1,i2,iz2,sig) +C + else +C +C for e.ge.meltpoint +C + sig=sigheramb +C + endif +C + + +c.. is annihilation possible ? (quark content?) + call ityp2id(i2,iz2,iq1(1),iq1(2)) + call ityp2id(i1,iz1,ifdiq2,iq2(3)) + if(abs(i1).ge.minmes) then + iq2(1)=ifdiq2 + iq2(2)=iq2(3) + iq2(3)=0 + else + iq2(1)=mod(ifdiq2/100,10) + iq2(2)=int(ifdiq2/1000) + endif + qflg=0.d0 + do 7312 kq1=1,2 + do 7412 kq2=1,3 +c.. annihilation ? + if(iq1(kq1)+iq2(kq2).eq.0) qflg=1.d0 + 7412 continue + 7312 continue +c..--> elastic X-section gets minimum val. of 12.5 mb (K+ P) +c.. if annihilation is not possible +c.. (exclude gamma baryon elastic) + if (i2.ne.minmes) then + sig=max(sig,12.5d0*(1d0-qflg)) + +C for k+ p linear interpolation between meltpoint2 and meltpoint + if (kplflag.and. + & qflg.eq.0.d0.and.e.lt.meltpoint + & .and.e.gt.meltpoint2) then + sighelp=sighera(m2,m1,meltpoint,11) + pfrome=plab(m2,m1,e) + pmelt2=plab(m2,m1,meltpoint2) + pmelt=plab(m2,m1,meltpoint) + sig=xmelt(pfrome,1.25d1,sighelp,pmelt2,pmelt) + endif + endif + +c check energy conservation (cut-off is one 1 MeV) + if(max(m1,mminit(i1))+max(m2,mminit(i2))+1.d-3.gt.e) sig=0.d0 + + +C +C end of MB total +C + return + + 26 continue + if(i2.eq.minmes)then +c..no elastic gamma B scattering: + sig=0.d0 + return + endif +c...MB->MB elastic (pi+ p scaled with aqm) + if(mminit(i1)+mminit(i2).gt.e) then +c no collision if sqrts is insufficient to put particles on-shell + sig=0.d0 + else + call aqm(pimeson,nucleon,dum,nnphi) + call aqm(i1,i2,dum,bbphi) + sig=sighera(m2,m1,e,8)*bbphi/nnphi + endif + return + + 27 continue +c..MB-> 1 String (s-channel) (pi+ p scaled with aqm) + if(CTOption(12).ne.0)return + call aqm(pimeson,nucleon,nnphi,dum) + call aqm(i1,i2,bbphi,dum) + sig=sighera(m2,m1,e,7)*bbphi/nnphi +c-- minus elastic x-sect. (scaled with el. aqm) + call aqm(pimeson,nucleon,dum,nnphi) + call aqm(i1,i2,dum,bbphi) + sig=sig-sighera(m2,m1,e,8)*bbphi/nnphi +c.. is s-channel possible ? (quark content?) + call ityp2id(i2,iz2,iq1(1),iq1(2)) + call ityp2id(i1,iz1,ifdiq2,iq2(3)) + if(abs(i1).ge.minmes) then + iq2(1)=ifdiq2 + iq2(2)=iq2(3) + iq2(3)=0 + else + iq2(1)=mod(ifdiq2/100,10) + iq2(2)=int(ifdiq2/1000) + endif + qflg=0.d0 + do 312 kq1=1,2 + do 412 kq2=1,3 +c..two of the quarks must be able to annihilate: + if(iq1(kq1)+iq2(kq2).eq.0) qflg=1.d0 + 412 continue + 312 continue + sig=xmelt(e,sig,0.d0,3d0,6.d0)*qflg + if(e.le.1.7d0)sig=0.d0 + call nonres(e,i1,iz1,i2,iz2,sig) + + return + + 28 continue +c..MB-> 2 Strings (t-channel) (pi+ p scaled with aqm) + if(CTOption(12).ne.0)return + call aqm(pimeson,nucleon,nnphi,dum) + call aqm(i1,i2,bbphi,dum) + sig=sighera(m2,m1,e,7)*bbphi/nnphi +c-- minus elastic x-sect. (scaled with el. aqm) + call aqm(pimeson,nucleon,dum,nnphi) + call aqm(i1,i2,dum,bbphi) + sig=sig-sighera(m2,m1,e,8)*bbphi/nnphi +c-- melting + sig=xmelt(e,0d0,sig,3d0,6.d0) + return + + 29 continue +c...??->X => additive quark model inelastic cross section +c specially reduced to avoid double-counting in case of DN and DD +c cross sections + call aqm(i1,i2,sig,dum) + sig=sig-dum + sig=sig*bcms(e,max(mminit(i1),m1),max(mminit(i2),m2))**aaqm + sig=xmelt(e,sig,0d0,2d0*(1.08d0+ctparam(2)),5.0d0) +c here comes the reduction + sig=xmelt(e,0d0,sig,2.75d0,3.4d0) + return + + 30 continue +c parameterized detailed balance cross sections for ND->NN + factor=dgcgkfct(i1,i2,iz1,iz2,nucleon,nucleon) + if(factor.le.1.d-8) then + sig=0.d0 + return + endif + cgkcor=ppiso(-1,i1,iz1,i2,iz2,nucleon,nucleon) + + sig=factor*cgkcor*(1.3d8*(e**(-17.5d0))+3.6d4*(e**(-7d0))) + +c write(6,*)factor,cgkcor,sig + + return + + 31 continue +c parameterized detailed balance cross sections for DD->DN + e0=massit(i1)-0.5*widit(i1)+massit(i2)-0.5*widit(i2) + + factor=dgcgkfct(i1,i2,iz1,iz2,nucleon,mindel) + if(factor.le.1.d-8.or.e.lt.e0)then + sig=0.d0 + else + c1=clebsch(isoit(i1),isoit(i2),iz1,iz2,1) + c2=clebsch(isoit(i1),isoit(i2),iz1,iz2,2) + +c param + sig= + & (2.5d56*exp(-(50.0d0*e)) + & +4.9d14*exp(-(12.d0*e)) + & +1.1d6*exp(-(4.50d0*e))) + & *factor +c the following factors are from Heinz Sorge's Habilitation + & *(0.66667*c1+4d0/dsqrt(20d0)*c2) + + endif + return + + 32 continue +C parameterized detailed balance cross sections for DD->NN + factor=dgcgkfct(i1,i2,iz1,iz2,nucleon,nucleon) + if(factor.le.1.d-8.or.e.lt.2.15d0) then + sig=0.d0 + return + endif + cgkcor=ppiso(-4,i1,iz1,i2,iz2,nucleon,nucleon) +c param + sig=(7.27d0*(e-2.14d0)**(-1.2176d0)+0.05d0*(e-2.14d0)**(-3.257d0)) + & *factor*cgkcor + + return + + 33 continue +c...??->X => additive quark model resonance cross section + call aqm(i1,i2,sig,dum) + sig=sig-dum ! dum is the elastic xsec + if(e.gt.mminit(i1)+mminit(i2))then +c x_string+x_resonances + sig=sig*bcms(e,mminit(i1),mminit(i2))**(aaqm*3) +c get x_string + sig=xmelt(e,sig,0d0,mminit(i1)+mminit(i2)+1.5d0, + @ mminit(i1)+mminit(i2)+3d0) + + end if + + return + + 34 continue +c...??->X => additive quark model string cross section + if(CTOption(12).ne.0)return + call aqm(i1,i2,sig,dum) + sig=sig-dum ! dum is the elastic xsec + if(e.gt.mminit(i1)+mminit(i2))then +c x_string+x_resonances + sig=sig*bcms(e,mminit(i1),mminit(i2))**(aaqm*3) +c get x_resonances + sig=xmelt(e,0d0,sig,mminit(i1)+mminit(i2)+1.5d0, + @ mminit(i1)+mminit(i2)+3d0) + end if + return + + 35 continue + e0=mminit(i1)+mminit(i2)+CTParam(4)*2d0 + call aqm(i1,i2,sig,dum) + sig=f(e,e0,sig-dum,1d0,1d0) + return + + 36 continue +c cross section for Danielewicz forward delay +c...MB->B' + if(CTOption(34).eq.2) then + call anndec(0,m1,i1,iz1,m2,i2,iz2,e,sig,gam) + sig=CTParam(58)*sig + elseif(CTOption(34).eq.3) then + m3=e + call anndec(0,m1,i1,iz1,m2,i2,iz2,e,sig,gam) + if(sig.gt.1d-5) sig=CTParam(58) + elseif(CTOption(34).eq.4) then + m3=e + call anndec(0,m1,i1,iz1,m2,i2,iz2,e,sig,gam) + if(sig.gt.1d-5)then + ggam=fwidth(itypnew(1),i3new(1),m3) + sig=CTParam(58)* + & sig*dsqrt(2.d0/(ggam*3.1415d0* + & fbwnorm(m3,itypnew(1),i3new(1)))) + endif + else + sig=0.d0 + endif + return + + 37 continue +c cross section for Danielewicz forward delay +c...MM->M' + if(CTOption(34).eq.2) then + call anndec(0,m1,i1,iz1,m2,i2,iz2,e,sig,gam) + sig=CTParam(58)*sig + elseif(CTOption(34).eq.3) then + m3=e + call anndec(0,m1,i1,iz1,m2,i2,iz2,e,sig,gam) + if(sig.gt.1d-5) sig=CTParam(58) + elseif(CTOption(34).eq.4) then + m3=e + call anndec(0,m1,i1,iz1,m2,i2,iz2,e,sig,gam) + if(sig.gt.1d-5)then + ggam=fwidth(itypnew(1),i3new(1),m3) + sig=CTParam(58)* + & sig*dsqrt(2.d0/(ggam*3.1415d0* + & fbwnorm(m3,itypnew(1),i3new(1)))) + endif + else + sig=0.d0 + endif + return + 38 continue +c elastic meson-meson cross section + sig=5.d0 + +c check energy conservation (cut-off is one 1 MeV) + if(max(m1,mminit(i1))+max(m2,mminit(i2))+1.d-3.gt.e) sig=0.d0 + + return + +ctp060202 99 continue +c...single diffr. pp + sig=.68*(1.+36/e**2)*log(0.6+0.1*e**2) + return + + end + +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine nonres(e,ii1,iiz1,ii2,iiz2,sig) +c +cinput e : $\sqrt{s}$ of collision +cinput ii1 : ID of particle 1 +cinput iiz1 : $2\cdot I_3$ of particle 1 +cinput ii2 : ID of particle 2 +cinput iiz2 : $2\cdot I_3$ of particle 2 +coutput sig : cross section +c +c {\tt nonres} adds s-channel strings for strange meson baryon reactions, +c since +c resonances are not sufficient to fit data - +c {\tt sig} gets modified in {\tt nonres}, +C so that $k^- p$ cross section describes data reasonable. +C {\tt nonres} should be only called below {\tt meltpoint} +c +C####C##1#########2#########3#########4#########5#########6#########7## + implicit none + logical b + real*8 m1,m2,e,sig + integer strit,i1,i2,iz1,iz2,ii1,ii2,iiz1,iiz2 + + b=.false. + call setizm(ii1,iiz1,0d0,ii2,iiz2,0d0, + @ i1,iz1,m1,i2,iz2,m2) + if(iabs(i1).gt.iabs(i2)) + @ call swpizm(i1,iz1,m1,i2,iz2,m2) + +C check wether sigma should be modified +C 1) strange meson required +C 2) nonstrange baryon required +C 3) combination of strange meson + baryon (k- p) +C or antistrange meson + antibaryon (k+ pbar) required +C + if(strit(i2).ne.0.and.i1*i2.lt.0.and.strit(i1).eq.0)b=.true. +C if this condition is fullfilled modify sigma +C add exponential underground and corrections +C (two gaussians,constant,low energy cut off) +C to describe experimental k- p cross section +C four cases for different corrections +C + if ((b).and.e.gt.1.433.and.e.lt.1.4738188) then + sig=sig+120. + elseif ((b).and.e.ge.1.4738188.and.e.lt.1.485215) then + sig=sig-1.296457765d7*(e-1.433)**4+ + & 2.160975431d4*(e-1.433)**2+120. + elseif ((b).and.e.ge.1.485215.and.e.lt.1.977) then + sig=sig+1.07769d+06*exp(-(6.44463d0*e))- + & 10.*exp(-(((e-1.644)**2)/0.004))+ + & 10.*exp(-(((e-1.977)**2)/0.004)) + elseif ((b).and.e.ge.1.977.and.e.lt.2.12) then +C keep maximum value of gaussian above e=1.977 GeV +C (e=2.12 GeV is meltpoint) + sig=sig+1.07769d+06*exp(-(6.44463d0*e))+10. + endif + +C + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function sappann(sroot,m1,m2) +c +cinput sroot : $\sqrt{s}$ of collision +cinput m1 : mass of 1st (anti-)baryon +cinput m2 : mass of 2nd (anti-)baryon +c +c OUTPUT: {\ttsappann} = annihilation cross section for $\bar N N$ +c +c Taken from: P. Koch, C.B. Dover, Phys. Rev. {\bf C40} (1989) 145 +c +C####C##1#########2#########3#########4#########5#########6#########7## + + implicit none + + include 'options.f' + + real*8 sroot,m1,m2,s0,a,b,sig0,s,srootnn,snn + parameter(a=0.05d0,b=0.6d0,sig0=120.d0,s0=3.52) + + if (CTOption(38).eq.1) then +c evaluate the parametrization at the same relative momentum as in nbar-n + srootnn=snn(sroot,m1,m2) + s=srootnn**2 + else +c evaluate parametrization now at the same sqrts + s=sroot**2 + endif + sappann=sig0*(s0/s)*(a**2*s0/((s-s0)**2+a**2*s0)+b) + + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function sapptot(sroot,m1,m2) +c +cinput sroot : $\sqrt{s}$ of collision +cinput m1 : mass of 1st (anti-)baryon +cinput m2 : mass of 2nd (anti-)baryon +c +c OUTPUT: {\ttsapptot} = total cross section for $\bar N N$ +c high energy paramametrization and data taken from PRD 50 (1994)\\ +c $p_{lab} > 5 $GeV: CERN/HERA parametrization\\ +c 0.3 GeV $< p_{lab} <$ 5 GeV: polynomial fit to the data (by C.S.)\\ +c $p_{lab} <0.3$ GeV: another fit, only constrained by sigma annihilation +c +C####C##1#########2#########3#########4#########5#########6#########7## + + implicit none + + include 'options.f' + + real*8 p,sroot,plab,sighera,m1,m2,srootnn,snn + + if (CTOption(38).eq.1) then +c evaluate the parametrization at the same relative momentum as in nbar-n + srootnn=snn(sroot,m1,m2) + else +c evaluate parametrization now at the same sqrts + srootnn=sroot + endif + + p=plab(0.938d0,0.938d0,srootnn) + + if(p.ge.5.d0)then + sapptot=sighera(0.938d0,0.938d0,srootnn,4) + return + else if(p.ge.0.3d0)then + sapptot=75.0146d0+43.1276d0/p+2.58298d0/p**2-3.90783d0*p + return + else + sapptot=271.6d0*exp(-(1.1d0*p**2)) + return + endif + + end + + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function sappela(sroot,m1,m2) +c +cinput sroot : $\sqrt{s}$ of collision +cinput m1 : mass of 1st (anti-)baryon +cinput m2 : mass of 2nd (anti-)baryon +c +c OUTPUT: {\tt sappela} = elastic cross section for $\bar N N$ +c high energy paramametrization and data taken from PRD 50 (1994)\\ +c $p_{lab} > 5 $GeV: CERN/HERA parametrization\\ +c 0.3 GeV $< p_{lab} <$ 5 GeV: polynomial fit to the data (by C.S.)\\ +c $p_{lab} <0.3$ GeV: no data, set constant +c +C####C##1#########2#########3#########4#########5#########6#########7## + + implicit none + + include 'options.f' + + real*8 p,sroot,plab,sighera,m1,m2,srootnn,snn + + if (CTOption(38).eq.1) then +c evaluate the parametrization at the same relative momentum as in nbar-n + srootnn=snn(sroot,m1,m2) + else +c evaluate parametrization now at the same sqrts + srootnn=sroot + endif + + p=plab(0.938d0,0.938d0,srootnn) + if(p.ge.5.d0)then + sappela=sighera(0.938d0,0.938d0,srootnn,5) + return + else if(p.ge.0.3d0)then + sappela=31.6166d0+18.2842d0/p-1.14896d0/p**2-3.79508d0*p + return + else + sappela=78.6d0 + return + endif + + end + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function sappdiff(sroot,m1,m2) +c +cinput sroot : $\sqrt{s}$ of collision +cinput m1 : mass of 1st (anti-)baryon +cinput m2 : mass of 2nd (anti-)baryon +c +c OUTPUT: {\tt sappdiff} = diffractive cross section for $\bar N N$ +c +c This cross section is totally determined by +c $ \sigma_{diff}=\sigma_{tot}-\sigma_{elast.}-\sigma_{annihil.}$ +c +C####C##1#########2#########3#########4#########5#########6#########7## + implicit none + real*8 p,sroot,m1,m2,plab,sappann,sapptot,sappela + + p=plab(0.938d0,0.938d0,sroot) + if(p.le.0.1d0)then + sappdiff=0.d0 + return + else + sappdiff=max(0.d0,sapptot(sroot,m1,m2) + & -sappela(sroot,m1,m2)-sappann(sroot,m1,m2)) + return + endif + end + +C####C##1#########2#########3#########4#########5#########6#########7## + blockdata herafits +c cross section parameters for specific collsion type +c CERN/HERA fits, taken from PRD 50 (1994) +c see: function 'sighera' +C####C##1#########2#########3#########4#########5#########6#########7## + implicit none + integer nfit +c integer io + parameter (nfit=16) + real*8 a(nfit),b(nfit),n(nfit),c(nfit),d(nfit) + & ,p1(nfit),p2(nfit) + common /HERA/ a,b,n,c,d,p1,p2 + +c io = 1 2 3 4 5 6 +c pp(tot) pp(ela) pn(tot) app(tot) app(ela) gammap(tot) +c 7 8 9 10 11 12 +c pi+p(tot) pi+p(el) pi-p(tot) pi-p(el) k+p(tot) k+p(el) +c 13 14 15 16 +c k+n(tot) k-p(tot) k-p(ela) k-n(tot) +c +c p1 (p2) give the momentum range (lab momentum) of the fit + + data a/ 48.0, 11.9, 47.3, 38.4, 10.2, 0.147, + @ 16.4, 0., 33.0, 1.76, 18.1, 5.0, + @ 18.7, 32.1, 7.3, 25.2/ + data b/ 0., 26.9, 0., 77.6, 52.7, 0., + @ 19.3, 11.4, 14.0, 11.2, 0., 8.1, + @ 0., 0., 0., 0./ + data n/ 0., -1.21, 0., -0.64, -1.16, 0., + @ -.42, -.4, -1.36, -0.64, 0., -1.8, + @ 0., 0., 0., 0./ + data c/ 0.522, 0.169, 0.513, 0.26, 0.125, .0022, + @ .19, .079, .456, .043, .26, .16, + @ .21, .66, .29, .38/ + data d/ -4.51, -1.85, -4.27, -1.2, -1.28, -.017, + @ 0., 0., -4.03, 0., -1., -1.3, + @ -.89, -5.6, -2.4, -2.9/ + data p1/ 3., 2., 3., 5., 5., 3., + @ 3., 2., 1.8, 1.8, 2., 2., + @ 2., 1.75, 3., 1.8/ +c for (k- p) p1=1.75 GeV/c works reasonable + data p2/2100., 2100., 370., 1.7d6, 1.7d6, 183., + @ 340., 200., 370., 360., 310., 175., + @ 310., 310., 175., 310./ + + end + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function sighera(m1,m2,sroot,io) +c +c +cinput sroot : $\sqrt{s}$ of collision +cinput m1 : mass of 1st (anti-)baryon +cinput m2 : mass of 2nd (anti-)baryon +cinput io : flag for respective cross section +c +c OUTPUT: {\tt sighera} = cross section for specific collsion type +c +c {\tt io} can have the following values: +c \begin{tabular}{rl} +c 1 & $pp$ total \\ +c 2 & $pp$ elastic \\ +c 3 & $pn$ total \\ +c 4 & $\bar p p$ total\\ +c 5 & $\bar p p$ elastic\\ +c 6 & $\gamma p$ (tot) \\ +c 7 & $\pi^+ p$ (tot) \\ +c 8 & $\pi^+ p$ (el) \\ +c 9 & $\pi^- p$ (tot)\\ +c 10 & $\ pi- p$ (el) \\ +c 11 & $k^+ p$ (tot)\\ +c 12 & $k^+ p$ (el)\\ +c 13 & $k^+ n$ (tot)\\ +c 14 & $k^- p$ (tot)\\ +c 15 & $k^- p$ (ela)\\ +c 16 & $k^- n$ (tot)\\ +c \end{tabular} +c +c This subroutine returns CERN/HERA parametrizations for cross sections +c {\tt p1} and {\tt p2} in the {\tt blockdata} routine +c give the momentum range (lab momentum) of the fit. +c The fits have been taken from +c Phys. Rev. {\bf D50} (1994). +c +C####C##1#########2#########3#########4#########5#########6#########7## + implicit none + include 'coms.f' + include 'comres.f' + integer nfit,io + parameter (nfit=16) + real*8 a(nfit),b(nfit),n(nfit),c(nfit),d(nfit),sroot,p,plab + & ,p1(nfit),p2(nfit),m1,m2,massit + common /HERA/ a,b,n,c,d,p1,p2 + +c p=plab(m1,m2,sroot) + p=0.d0 + if(io.ge.1.and.io.le.5)then + p=plab(massit(minnuc),massit(minnuc),sroot) + elseif(io.eq.6)then + p=plab(massit(minmes),massit(minnuc),sroot) + elseif(io.ge.7.and.io.le.10)then + p=plab(massit(pimeson),massit(minnuc),sroot) + elseif(io.ge.11.and.io.le.16)then + p=plab(massit(itkaon),massit(minnuc),sroot) + else + write(*,*)'#make22 error. sighera called with io=',io + stop + endif + + if(p.lt.1d-15) then +c if energy conservation is not possible (p.eq.0) then return zero + sighera=0.d0 + return + endif +C + if(p.lt.p1(io))then + p=p1(io) +C + elseif (p.gt.p2(io).and.(warn)) then + write(6,*)'sighera: sroot=',sroot,' high!, io=',io + write(6,*)' m1,m2,plab,p2(io)=',m1,m2,p,p2(io) + write(6,*)'sighera fit used above upper limit (extrapolation)' + endif + sighera=a(io)+b(io)*p**n(io)+c(io)*log(p)**2+d(io)*log(p) + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function xmelt(e,x1,x2,em,ep) +c +cinput e : $\sqrt{s}$ of process +cinput x1 : value at {\tt em} +cinput x2 : value at {\tt ep} +cinput em : lower boundary in $\sqrt{s}$ +cinput ep : upper boundary in $\sqrt{s}$ +c +c {\tt xmelt } yields an interpolation beween {\tt x1} and {\tt x2} +c in the $\sqrt{s}$ range beween {\tt em} and {\tt ep}. +c For {\tt e < em} it equals {\tt x2}, if {\tt e > em} it yields +c a combination of both {\tt x1} and {\tt x2} such that there is a +c continuous transition from {\tt x1} to {\tt x2}. +c +c For parameter b=.false. a linear combination is used, +c for parameter b=.true. a sin-form is used. +c +C####C##1#########2#########3#########4#########5#########6#########7## + implicit none + real*8 e,x1,x2,em,ep,lam,pi + logical b + parameter(b=.false.,pi=.31415927d-1) + + + lam=max(0d0,min(1d0,(e-min(em,ep))/abs(ep-em))) + if(b)lam=5d-1*sin((lam-5d-1)*pi)+5d-1 + + xmelt=(1d0-lam)*x1+lam*x2 + + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function plab(m1,m2,sroot) +c +cinput sroot : $\sqrt{s}$ of collision +cinput m1 : mass of 1st (anti-)baryon +cinput m2 : mass of 2nd (anti-)baryon +c +c {\tt plab} returns the lab-momentum of particle 1 +c +C####C##1#########2#########3#########4#########5#########6#########7## + implicit none + real*8 sroot,m1,m2 + if(sroot-m1-m2.lt.0d0)then + plab=0d0 + else + plab=sqrt((sroot**2-(m1+m2)**2)*(sroot**2-(m1-m2)**2))/(2*m2) + end if + return + end +C####C##1#########2#########3#########4#########5#########6#########7## + real*8 function snn(sbb,m1,m2) +c +cinput sbb : $\sqrt{s}$ of a $BB$ collision +cinput m1 : mass of 1st (anti-)baryon +cinput m2 : mass of 2nd (anti-)baryon +c +c {\tt snn} returns the equivalent c.o.m. energy of a $NN$-collision +c with the same relative momentum +c +C####C##1#########2#########3#########4#########5#########6#########7## + implicit none + real*8 sbb,prel,m1,m2 + prel=sqrt((sbb**2-(m1+m2)**2)*(sbb**2-(m1-m2)**2))/sbb + snn=sqrt(prel**2+3.52d0) + return + end diff --git a/Processes/UrQMD/newpart.f b/Processes/UrQMD/newpart.f new file mode 100644 index 0000000000000000000000000000000000000000..5feec4c429f1e1f79328483dca028c289f1d82fd --- /dev/null +++ b/Processes/UrQMD/newpart.f @@ -0,0 +1,66 @@ +c $Id: newpart.f,v 1.6 1999/01/18 09:57:09 ernst Exp $ +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c +c include-file newpart +c +cdes this file contains arrays for scattered or new created particles +cdes and is used to communicate between the different routines which +cdes are involved in hadling the kinematics +c +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + integer mprt,oprt +c maximum number of new particles: + parameter(mprt=200) ! maximum number of produced particles + parameter(oprt=2) ! maximum number of incoming particles +c pslot : slots of incoming particles +c itypnew: ityps of new particles +c i3new: $2*I_3$ of new particles +c inew: array-indices of new particles (will be assigned in scatter-routines) +c nexit: number of particles in exit-channel +c iline: tag for out-channel process +c nstring1 : number of particles in string 1 +c nstring2 : number of particles in string 2 +c strcount : ?? +c sidnew : stringID for produced particles +c pslot : slots of incoming particles +c itot: $2*I_{tot}$ of new particles (will be assigned in scatter-routines) +c pnew(5,mprt) : momenta, energy and mass of produced particles +c pnew(1,*) = px +c pnew(2,*) = py +c pnew(3,*) = pz +c pnew(4,*) = e +c pnew(5,*) = mass +c xnew(4,mprt) : locations and time of produced particles +c xnew(1,*) = rx +c xnew(2,*) = ry +c xnew(3,*) = rz +c xnew(4,*) = r0 +c pold(5,oprt) : momenta, defined like pnew +c itypold : incoming itypes +c iso3old : incoming iso3's +c xtotfacold: xtotfacs of incoming particles +c mstring() masses of strings 1 and 2 (or particles 1 and 2) +c leadfac(mprt): (1-leadfac) is the factor, by which the total cross +c section of a hadron is multiplied within its formation +c time (.ne.1 only for leading hadrons) + integer itypnew(mprt),i3new(mprt),itot(mprt),inew(mprt),nexit + integer nstring1, nstring2,iline,itypold(oprt),iso3old(oprt) + integer pslot(oprt),strcount + real*8 pnew(5,mprt),xnew(4,mprt),mstring(2),leadfac(mprt) + real*8 pold(5,oprt),xtotfacold(oprt) + integer sidnew(mprt) + + +c relative velocity/between comp. frame and two particle rest frame +c is betax, betay, betaz (needed for lotrans) +c momentum vector in two particle restframe is p0nn,pxnn,pynn,pznn + + real*8 betax,betay,betaz,p0nn,pxnn,pynn,pznn,pnn,pnnout + + common /inewpart/ itypnew,i3new,itot,inew,nexit,iline,strcount, + & pslot,nstring1,nstring2,sidnew,itypold,iso3old + common /rnewpart/ pnew,xnew,betax,betay,betaz,pold, + & p0nn,pxnn,pynn,pznn,pnn,mstring,pnnout, + & xtotfacold + common /fnewpart/ leadfac diff --git a/Processes/UrQMD/numrec.f b/Processes/UrQMD/numrec.f new file mode 100644 index 0000000000000000000000000000000000000000..e8ba84680d441badb3941228c7830319bf823566 --- /dev/null +++ b/Processes/UrQMD/numrec.f @@ -0,0 +1,76 @@ +c$Id: numrec.f,v 1.5 1999/01/18 09:57:10 ernst Exp $ +C======================================================================= +C Routines taken from Numerical Recipes +C +C + +c + SUBROUTINE spline(x,y,n,yp1,ypn,y2) + implicit integer (i - n) + implicit real*8 (a - h , o - z) + INTEGER n,NMAXsp + PARAMETER (NMAXsp=500) + REAL*8 yp1,ypn,x(NMAXsp),y(NMAXsp),y2(NMAXsp) + INTEGER i,k + REAL*8 p,qn,sig,un,u(NMAXsp) + if (yp1.gt..99e30) then + y2(1)=0. + u(1)=0. + else + y2(1)=-0.5 + u(1)=(3./(x(2)-x(1)))*((y(2)-y(1))/(x(2)-x(1))-yp1) + endif + do 11 i=2,n-1 + sig=(x(i)-x(i-1))/(x(i+1)-x(i-1)) + p=sig*y2(i-1)+2. + y2(i)=(sig-1.)/p + u(i)=(6.*((y(i+1)-y(i))/(x(i+ + *1)-x(i))-(y(i)-y(i-1))/(x(i)-x(i-1)))/(x(i+1)-x(i-1))-sig* + *u(i-1))/p +11 continue + if (ypn.gt..99e30) then + qn=0. + un=0. + else + qn=0.5 + un=(3./(x(n)-x(n-1)))*(ypn-(y(n)-y(n-1))/(x(n)-x(n-1))) + endif + y2(n)=(un-qn*u(n-1))/(qn*y2(n-1)+1.) + do 12 k=n-1,1,-1 + y2(k)=y2(k)*y2(k+1)+u(k) +12 continue + return + END + + FUNCTION ran1(idum) + implicit integer (i - n) +c real*4 is on purpose, do not change!!! + implicit real*4 (a - h , o - z) + INTEGER*4 idum,IA,IM,IQ,IR,NTAB,NDIV + REAL*4 AM,EPS,RNMX + real*8 ran1 + PARAMETER (IA=16807,IM=2147483647,AM=1./IM,IQ=127773,IR=2836, + *NTAB=32,NDIV=1+(IM-1)/NTAB,EPS=1.2e-7,RNMX=1.-EPS) + INTEGER*4 j,k,iv(NTAB),iy + SAVE iv,iy + DATA iv /NTAB*0/, iy /0/ + if (idum.le.0.or.iy.eq.0) then + idum=max(-idum,1) + do 11 j=NTAB+8,1,-1 + k=idum/IQ + idum=IA*(idum-k*IQ)-IR*k + if (idum.lt.0) idum=idum+IM + if (j.le.NTAB) iv(j)=idum +11 continue + iy=iv(1) + endif + k=idum/IQ + idum=IA*(idum-k*IQ)-IR*k + if (idum.lt.0) idum=idum+IM + j=1+iy/NDIV + iy=iv(j) + iv(j)=idum + ran1=dble(min(AM*iy,RNMX)) + return + END +C (C) Copr. 1986-92 Numerical Recipes Software . diff --git a/Processes/UrQMD/options.f b/Processes/UrQMD/options.f new file mode 100644 index 0000000000000000000000000000000000000000..7500864dc940d99698270fc893d7c8af7068bc3d --- /dev/null +++ b/Processes/UrQMD/options.f @@ -0,0 +1,22 @@ +c $Id: options.f,v 1.9 2001/04/06 21:48:16 weber Exp $ +c... law: include file (only) for global parameters & options + integer numcto,numctp,maxstables + parameter(numcto=400) ! maximum number of options + parameter(numctp=400) ! maximum number of parameters + parameter(maxstables=20) ! maximum number of stable particles +c... + integer CTOption(numcto) + character ctodc(numcto)*2 +c... + real*8 CTParam(numctp) + character ctpdc(numctp)*2 + + integer nstable + integer stabvec(maxstables) + + logical bf13,bf14,bf15,bf16,bf17,bf18,bf19,bf20,fixedseed + common /options/CTOption,CTParam + common /optstrings/ctodc,ctpdc + common /loptions/fixedseed,bf13,bf14,bf15,bf16,bf17,bf18, + . bf19,bf20 + common /stables/nstable,stabvec diff --git a/Processes/UrQMD/outcom.f b/Processes/UrQMD/outcom.f new file mode 100644 index 0000000000000000000000000000000000000000..67ccc0dd2a8f739d74dce5f53f76de751d50bbe2 --- /dev/null +++ b/Processes/UrQMD/outcom.f @@ -0,0 +1,13 @@ +c $Id: outcom.f,v 1.3 2000/01/12 16:02:39 bass Exp $ +c temporary storage for in-channel + real*8 tsqrts,tstot,tsigpart + real*8 tr0(3),trx(3),try(3),trz(3),ttform(3),txtotfac(3), + @ tp0(3),tpx(3),tpy(3),tpz(3),tm(3) + integer tind(3),tityp(3),tiso3(3),tcoll(3),tstrange(3) + integer tlcoll(3),tcharge(3),torigin(3),tstrid(3),tuid(3) + + common/outcom/tsqrts,tstot,tsigpart, + & tr0,trx,try,trz,ttform,txtotfac, + @ tp0,tpx,tpy,tpz,tm, + & tind,tityp,tiso3,tcoll,tstrange, + & tlcoll,tcharge,torigin,tstrid,tuid diff --git a/Processes/UrQMD/output.f b/Processes/UrQMD/output.f new file mode 100644 index 0000000000000000000000000000000000000000..efcef27473f23ef404e9a87c41059fb84fe9729c --- /dev/null +++ b/Processes/UrQMD/output.f @@ -0,0 +1,864 @@ +c $Id: output.f,v 1.19 2003/05/02 11:19:18 weber Exp $ +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC +C + subroutine output(iunit) +c +c Revision : 1.0 +c +c This subroutine writes the event-header to file(iunit) +C +c +cinput iunit : output-unit +c +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC +c + implicit none + + include 'comres.f' + include 'coms.f' + include 'options.f' + include 'inputs.f' + include 'newpart.f' + include 'freezeout.f' + include 'boxinc.f' + +c + integer iunit,i,ttime,iu,app,att,zpp,ztt + integer iiunit,isunit +cdh integer id, pdgid + integer timestep,itotcoll,iinelcoll + real*8 sigmatot,ptsigtot,stot,otime + common /outco2/sigmatot + + + character*4 reffram + character*20 aa,ah,ai,ak + character*36 ae,abt + character*31 aee + character*15 ab,aj,al,am + character*13 ac,ag,pds,tds + character*12 ad + character*7 af + character*9 ag2 + character*1 add + character*191 apa14,apa15,apav + character*2 apa,aop + +c file15out + integer ind,ind1,ind2,nin + integer istr,ich,ii + + real*8 sqrts, sigpart, colldens, cdens,cdens_ + logical bdum,paulibl,ctp060202 + + include 'outcom.f' + + integer fchg,strit + character*1 echar + + integer iou(13:20) + + save + +cdh data iou/13,14,15,16,17,18,19,20/ + data iou/ 6, 6, 6,16,17,18,19,20/ + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c output formats +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c +c fileheader + 101 format(a20,3i7,a15,i2) + 301 format(a13,a13,i4,i4,a12,a13,i4,i4,a1) +c 305 format(a36,3f10.7) + 304 format(a36,3f6.2,a31,1f9.2) + 302 format (a7,i9,a13,i12,a9,a20,i4,a20,f7.3) +c 303 format(a20,i3,a15,e10.4,a15,e10.4,a15,e10.4) + 102 format(a2,15(i3,a2)) +c 103 format(a2,12(e10.4,a2)) + 306 format(a171) + + 305 format(a36,3f11.7) + 303 format(a20,i3,a15,e11.4,a15,e11.4,a15,e11.4) + 103 format(a2,12(e11.4,a2)) + +c standard particle information vector + 201 format(9e16.8,i5,2i3,i6,i5,i4) +c special output for cto40 (restart of old event) + 210 format(9e16.8,i5,2i3,i6,i5,i10,3e16.8,i8) +c special output for mmaker +ctp060202 203 format(9e16.8,i5,2i3,i6,i5,i4,i5,2e16.8) +c same with index for file15 + 501 format(i5,9e16.8,i5,2i3,i6,i5,i3,i15) +c enhanced file16 + 503 format(9e15.7,i5,2i3,i6,i5,i4,2i4) +c same including freeze-out coordinates + 213 format(9e16.8,i5,2i3,i6,i5,i4,8e16.8) + +c collsision stats for file14 + 202 format(8i8) +c same with EndOfEvent tag for file16 + 602 format(a1,8i8) + +c header-line for each collision in file15 + 502 format(i1,i8,i4,i7,f8.3,4e12.4) + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c + if(iunit.eq.17)return + if(bf13.and.(iunit.eq.13)) return + if(bf14.and.(iunit.eq.14)) return + if(bf15.and.(iunit.eq.15)) return + if(bf16.and.(iunit.eq.16)) return + +c copy projectile/target info to local vars + app=ap + zpp=zp + att=at + ztt=zt + + if(iunit.eq.19) return +c + aa='UQMD version: ' + ab=' output_file ' + abt='transformation betas (NN,lab,pro) ' + ac='projectile: ' + ad=' target: ' + add=' ' + ae='impact_parameter_real/min/max(fm): ' + aee=' total_cross_section(mbarn): ' + af='event# ' + ag=' random seed:' + ah='equation_of_state: ' + ai=' total_time(fm/c): ' + aj=' E_lab(GeV/u):' + ak=' Delta(t)_O(fm/c): ' + al=' sqrt(s)(GeV):' + am=' p_lab(GeV/u):' + apa='pa' + aop='op' + + apa14='pvec: '// + & 'r0 rx ry rz '// + & ' p0 px py pz '// + & ' m ityp 2i3 chg lcl# ncl or' + apa15='pvec:ind '// + & 'r0 rx ry rz '// + & ' p0 px py pz '// + & ' m ityp 2i3 chg lcl# ncl st' + if(iunit.eq.15) then + apav=apa15 + else + apav=apa14 + endif + + if(fixedseed) then + ag2=' (fixed) ' + else + ag2=' (auto) ' + endif + if(prspflg.eq.1) then + pds='(ityp, char) ' + app=spityp(1) + zpp=fchg(spiso3(1),app) + else + pds='(mass, char) ' + endif + if(trspflg.eq.1) then + tds='(ityp, char) ' + att=spityp(2) + ztt=fchg(spiso3(2),att) + else + tds='(mass, char) ' + endif + +c determine cross section of the projectile-target system + sigmatot = ptsigtot() +ccccccccccccccccccccccccccccccccccccccccccccccccccccc + + otime=outsteps*dtimestep + ttime=int(nsteps*dtimestep+0.01) + + if(iunit.eq.15)then + write(iou(15),502)0,event,Ap,At,bimp,ecm + , ,sigmatot,ebeam,pbeam + else + write(iou(iunit),101) aa,version, sigver, laires, ab,iunit + write(iou(iunit),301) ac,pds, App, Zpp, ad,tds, Att, Ztt,add + write(iou(iunit),305) abt,betann,betatar,betapro + write(iou(iunit),304) ae,bimp,bmin,bdist,aee,sigmatot + write(iou(iunit),303) ah,eos,aj,ebeam,al,ecm,am,pbeam + write(iou(iunit),302) af,event,ag,ranseed,ag2,ai,ttime,ak,otime + write(iou(iunit),102) aop,(CTOption(i),CTOdc(i),i=1,15) + write(iou(iunit),102) aop,(CTOption(i),CTOdc(i),i=16,30) + write(iou(iunit),102) aop,(CTOption(i),CTOdc(i),i=31,45) + write(iou(iunit),103) apa,(CTParam(i),CTPdc(i),i=1,12) + write(iou(iunit),103) apa,(CTParam(i),CTPdc(i),i=13,24) + write(iou(iunit),103) apa,(CTParam(i),CTPdc(i),i=25,36) + write(iou(iunit),103) apa,(CTParam(i),CTPdc(i),i=37,48) + write(iou(iunit),306) apav + end if + +c + return +c..... + entry uounit(iiunit,isunit) + iou(iiunit)=isunit + return + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + entry file14out(timestep) +c +c Revision : 1.0 +c +c This subroutine writes the standard output-file (unit 14) +c +cinput timestep : timestep of output +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC +c + +c + if(bf14)return + ttime=int(timestep*dtimestep+0.01) + itotcoll=ctag-dectag + iinelcoll=itotcoll-NBlColl-NElColl + write(iou(14),*) npart,ttime + write(iou(14),202) itotcoll,NElColl,iinelcoll,NBlColl,dectag, + @ NHardRes,NSoftRes,NDecRes + +c now write particle-output + +c write spectators + if(CTOption(28).eq.2)then + if(CTOption(41).eq.0) then + do 141 i=1,nspec + write(iou(14),201) r0s(i),rxs(i),rys(i),rzs(i),p0s(i), + @ pxs(i),pys(i),pzs(i),sfmass(i), + @ sityp(i),siso3(i),scharge(i), + @ -1,-1,0 + 141 continue + else + do 142 i=1,nspec + write(iou(14),210) r0s(i),rxs(i),rys(i),rzs(i),p0s(i), + @ pxs(i),pys(i),pzs(i),sfmass(i), + @ sityp(i),siso3(i),scharge(i), + @ -1,-1,0,1d34,0d0,1d0,0 + 142 continue + endif + endif + if(CTOption(41).eq.0) then + do 13 i=1,npart + write(iou(14),201) r0(i),rx(i),ry(i),rz(i),p0(i), + @ px(i)+ffermpx(i),py(i)+ffermpy(i), + @ pz(i)+ffermpz(i),fmass(i), + @ ityp(i),iso3(i),charge(i), + @ lstcoll(i),ncoll(i),mod(origin(i),100) + 13 continue + else + do 31 i=1,npart + write(iou(14),210) r0(i),rx(i),ry(i),rz(i),p0(i), + @ px(i)+ffermpx(i),py(i)+ffermpy(i), + @ pz(i)+ffermpz(i),fmass(i), + @ ityp(i),iso3(i),charge(i), + @ lstcoll(i),ncoll(i),origin(i), + @ dectime(i),tform(i),xtotfac(i),uid(i) + 31 continue + endif +c + return + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + entry file13out(timestep) +c +c Revision : 1.0 +c +c This subroutine writes the standard output-file (unit 13), +c including the freeze-out configuration of the particles +c +cinput timestep : timestep of output +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC +c + +c + if(bf13)return + ttime=int(timestep*dtimestep+0.01) + itotcoll=ctag-dectag + iinelcoll=itotcoll-NBlColl-NElColl + write(iou(13),*) npart,ttime + write(iou(13),202) itotcoll,NElColl,iinelcoll,NBlColl,dectag, + @ NHardRes,NSoftRes,NDecRes + +c now write particle-output + +c write spectators + if(CTOption(28).eq.2)then + do 191 i=1,nspec + write(iou(13),213) r0s(i),rxs(i),rys(i),rzs(i),p0s(i), + @ pxs(i),pys(i),pzs(i),sfmass(i), + @ sityp(i),siso3(i),scharge(i), + @ -1,-1,0,r0s(i),rxs(i),rys(i),rzs(i),p0s(i), + @ pxs(i),pys(i),pzs(i) + 191 continue + endif + + + do 90 i=1,npart + if(ncoll(i).eq.0) then + write(iou(13),213) r0(i),rx(i),ry(i),rz(i),p0(i), + @ px(i)+ffermpx(i),py(i)+ffermpy(i), + @ pz(i)+ffermpz(i),fmass(i), + @ ityp(i),iso3(i),charge(i), + @ lstcoll(i),ncoll(i),mod(origin(i),100), + @ r0(i),rx(i),ry(i),rz(i),p0(i),px(i)+ffermpx(i), + @ py(i)+ffermpy(i),pz(i)+ffermpz(i) + else + write(iou(13),213) r0(i),rx(i),ry(i),rz(i),p0(i), + @ px(i)+ffermpx(i),py(i)+ffermpy(i), + @ pz(i)+ffermpz(i),fmass(i), + @ ityp(i),iso3(i),charge(i), + @ lstcoll(i),ncoll(i),mod(origin(i),100), + @ frr0(i),frrx(i),frry(i),frrz(i),frp0(i),frpx(i), + @ frpy(i),frpz(i) + endif + 90 continue +c + return + +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + entry file15out(ind1,ind2,sqrts,stot,sigpart) +c +c Revision : 1.0 +c +c This subroutine writes information about the in-channel to file15 +c (the collision statistics file) +c +cinput ind1 : index of particle 1 +cinput ind2 : index of particle 2 (=0 for decay of {\tt ind1}) +cinput sqrts : $\sqrt{s}$ of collision +cinput stot : total cross section +cinput sigpart : partial cross section +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + +c determine tag for scatter-input or decay-input +c and store entry channel in temporary observables + bdum=paulibl(ind1,cdens) + tsqrts=sqrts + tstot=stot + tsigpart=sigpart + + tind(1)=ind1 + tr0(1)=r0(ind1) + trx(1)=rx(ind1) + try(1)=ry(ind1) + trz(1)=rz(ind1) + tp0(1)=p0(ind1) + tpx(1)=px(ind1) + tpy(1)=py(ind1) + tpz(1)=pz(ind1) + tm(1)=fmass(ind1) + tityp(1)=ityp(ind1) + tiso3(1)=iso3(ind1) + tstrange(1) = strit(tityp(1)) + tcoll(1) = ncoll(ind1) + tlcoll(1)=lstcoll(ind1) + torigin(1)=origin(ind1) + tuid(1)=uid(ind1) + if(ind2.le.0) then + nin=1 + elseif(ind2.gt.0) then + bdum=paulibl(ind2,cdens_) + cdens=5d-1*(cdens+cdens_) + nin=2 + tind(2)=ind2 + tr0(2)=r0(ind2) + trx(2)=rx(ind2) + try(2)=ry(ind2) + trz(2)=rz(ind2) + tp0(2)=p0(ind2) + tpx(2)=px(ind2) + tpy(2)=py(ind2) + tpz(2)=pz(ind2) + tm(2)=fmass(ind2) + tityp(2)=ityp(ind2) + tiso3(2)=iso3(ind2) + tstrange(2)=strit(tityp(2)) + tcoll(2) = ncoll(ind2) + tlcoll(2)=lstcoll(ind2) + torigin(2)=origin(ind2) + tuid(2)=uid(ind2) + endif + + return + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + entry f15outch(colldens) + +ctp060202 to avoid warnings with gfortran compilation + ctp060202=.false. + if(ctp060202)write(*,*)colldens +ctp060202 end + + if (bf15) return +c This entry writes information about the collision to file15 +c one line for each particle: +c format: x y z px py pz ityp iso3... + + write(iou(15),502) nin,nexit,iline,ctag,acttime,tsqrts + , ,tstot,tsigpart,cdens + do 11 i=1,nin + istr=strit(tityp(i)) + ich = fchg(tiso3(i),tityp(i)) + + write(iou(15),501) tind(i),tr0(i),trx(i),try(i),trz(i), + @ tp0(i),tpx(i),tpy(i),tpz(i),tm(i), + @ tityp(i),tiso3(i),ich,tlcoll(i), + @ tcoll(i),istr,torigin(i) + 11 continue + do 20 ii=1,nexit + i=inew(ii) + istr=strit(ityp(i)) + write(iou(15),501) i,r0(i),rx(i),ry(i),rz(i), + @ p0(i),px(i),py(i),pz(i),fmass(i), + @ ityp(i),iso3(i),charge(i),lstcoll(i), + @ ncoll(i),istr,origin(i) + 20 continue + + return + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + entry f16outch + + if (bf16.or.(CTOption(13).eq.0)) return + if (nin.eq.1) then + tityp(2)=0 + endif + + do 22 ii=1,nexit + i=inew(ii) + write(iou(16),503) r0(i),rx(i),ry(i),rz(i), + @ p0(i),px(i)+ffermpx(i),py(i)+ffermpy(i), + @ pz(i)+ffermpz(i),fmass(i), + @ ityp(i),iso3(i),charge(i),lstcoll(i), + @ ncoll(i),mod(origin(i),100),tityp(1),tityp(2) + 22 continue + + return + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + entry file16out + + echar='E' + itotcoll=ctag-dectag + iinelcoll=itotcoll-NBlColl-NElColl + +c + if(bf16) return + +c now write particle-output + if (CToption(13).eq.0) then +c write spectators + if (CTOption(28).eq.2)then + do 151 i=1,nspec + write(iou(16),201)r0s(i),rxs(i),rys(i),rzs(i),p0s(i), + @ pxs(i),pys(i),pzs(i),sfmass(i), + @ sityp(i),siso3(i),scharge(i), + @ -1,-1,0 + 151 continue + endif + + do 12 i=1,npart + write(iou(16),201) r0(i),rx(i),ry(i),rz(i),p0(i), + @ px(i)+ffermpx(i),py(i)+ffermpy(i), + @ pz(i)+ffermpz(i),fmass(i), + @ ityp(i),iso3(i),charge(i), + @ dectag+lstcoll(i),ncoll(i),mod(origin(i),100) + + 12 continue + else + do 14 i=1,npart + write(iou(16),503) r0(i),rx(i),ry(i),rz(i),p0(i), + @ px(i)+ffermpx(i),py(i)+ffermpy(i), + @ pz(i)+ffermpz(i),fmass(i), + @ ityp(i),iso3(i),charge(i), + @ dectag+lstcoll(i),ncoll(i),mod(origin(i),100),-99,-99 + 14 continue + endif +c +c write collision counters etc. + write(iou(16),602) echar,itotcoll,NElColl,iinelcoll,NBlColl, + @ dectag,NHardRes,NSoftRes,NDecRes + return + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + entry file16entry(ind) +c +c This entry stores one decay for later output (must be done, in case +c of pauli-blocked decay) +c + tr0(3)=r0(ind) + trx(3)=rx(ind) + try(3)=ry(ind) + trz(3)=rz(ind) + tp0(3)=p0(ind) + tpx(3)=px(ind) + tpy(3)=py(ind) + tpz(3)=pz(ind) + tm(3)=fmass(ind) + tityp(3)=ityp(ind) + tind(3)=ind + tiso3(3)=iso3(ind) + tcharge(3)=charge(ind) + +c lstcoll is negative to identify decayed particles + + + tlcoll(3)=-(1*lstcoll(ind)) + tcoll(3)=ncoll(ind) + torigin(3)=origin(ind) + tuid(3)=uid(ind) + + return +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + entry file16write + +c This entry writes the decay to file + i=3 + + if(bf16)return + if (CTOption(13).eq.0) then + + write(iou(16),201) tr0(i),trx(i),try(i),trz(i),tp0(i),tpx(i), + @ tpy(i),tpz(i),tm(i),tityp(i),tiso3(i),tcharge(i), + @ tlcoll(i),tcoll(i),mod(torigin(i),100) + else + write(iou(16),503) tr0(i),trx(i),try(i),trz(i),tp0(i),tpx(i), + @ tpy(i),tpz(i),tm(i),tityp(i),tiso3(i),tcharge(i), + @ tlcoll(i),tcoll(i),mod(torigin(i),100),-98,-98 + endif + + return + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + entry osc_header + + if (bf19) return + + write (19,901) 'OSC1997A ' + write (19,901) 'final_id_p_x' + + 901 format (a12) + + if (CTOption(27).eq.0) then + reffram='eqsp' + elseif (CTOption(27).eq.1) then + reffram='tar' + elseif (CTOption(27).eq.2) then + reffram='pro' + else + call error ('osc_header','Unknown Ref-Frame', + . dble(CTOption(27)),2) + reffram='----' + endif + + write (19,902) 'UrQMD', '1.2', app, zpp, att, ztt, + . reffram, ebeam, 1 + + 902 format (2(a8,2x),'(',i3,',',i6,')+(',i3,',',i6,')',2x,a4,2x, + & e10.4,2x,i8) + + return + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + entry osc99_header + +c header for OSCAR 99A output format + + if (bf20) return + + write (20,991) + write (20,992) + + 991 format ('# OSC1999A') + 992 format ('# full_event_history') + + if (CTOption(27).eq.0) then + reffram='nncm' + elseif (CTOption(27).eq.1) then + reffram='tar' + elseif (CTOption(27).eq.2) then + reffram='pro' + else + call error ('osc_header','Unknown Ref-Frame', + . dble(CTOption(27)),2) + reffram='----' + endif + + write (20,993) + 993 format ('# UrQMD 1.2') + + write (20,994) app, zpp, att, ztt,reffram, ebeam, 1 + + 994 format ('# (',i3,',',i6,')+(',i3,',',i6,')',2x,a4,2x, + & e10.4,2x,i8) + + return + + + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + entry osc_event + +c body for OSCAR 97A format + + if (bf19) return + + write (19,903) event, npart, bimp, 0D0 + + 903 format (i10,2x,i10,2x,f8.3,2x,f8.3) + +c particles + + do 99 i=1,npart +cdh id = pdgid(ityp(i), iso3(i)) +cdh write(19,904) i, id, +cdh . px(i)+ffermpx(i), py(i)+ffermpy(i), pz(i)+ffermpz(i), +cdh . p0(i), fmass(i), +cdh . frrx(i), frry(i), frrz(i), frr0(i) + 99 continue + +cdh 904 format (i10,2x,i10,2x,9(e12.6,2x)) + + return + + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + entry osc99_event(ind) + +c full event info for OSCAR 99A format + + if (bf20) return + + if(ind.eq.-1) then + write (20,995) 0, npart, event, bimp, 0D0 + elseif(ind.eq.1) then + write (20,996) npart, 0 + else + write(6,*) 'fatal error in osc_99_event: wrong tag' + stop + endif + + 995 format (3(i7,2x),2(f8.3,2x)) + 996 format (2(i7,2x)) + +c particles + + do 88 i=1,npart +cdh id = pdgid(ityp(i), iso3(i)) +cdh write(20,997) uid(i), id, 0, +cdh . px(i)+ffermpx(i), py(i)+ffermpy(i), pz(i)+ffermpz(i), +cdh . p0(i), fmass(i), +cdh . frrx(i), frry(i), frrz(i), frr0(i) + 88 continue + +cdh 997 format (3(i10,2x),9(e12.6,2x)) + + return + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + entry osc99_coll + + if (bf20) return +c This entry writes information about the collision to file20 +c one line for each particle: +c format: x y z px py pz ityp iso3... + + write(iou(20),999) nin,nexit,iline,ctag,acttime,tsqrts + , ,tstot,tsigpart,cdens + + do 911 i=1,nin +cdh id = pdgid(tityp(i), tiso3(i)) +cdh write(20,997) tuid(i), id, 0, +cdh . tpx(i), tpy(i), tpz(i),tp0(i),tm(i), +cdh . trx(i), try(i), trz(i), tr0(i) + 911 continue + do 912 ii=1,nexit + i=inew(ii) +cdh id = pdgid(ityp(i), iso3(i)) +cdh write(20,997) uid(i), id, 0, +cdh . px(i), py(i), pz(i),p0(i),fmass(i), +cdh . rx(i), ry(i), rz(i), r0(i) + 912 continue + + + 999 format(3(i7,2x),i7,f8.3,4e12.4) + return + + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + entry osc99_eoe + +c end of event tag for OSCAR 99A format + if (bf20) return + + write(20,996) 0,0 + + return + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + entry getoldevent + +c read event header + read(10,*,end=666) + @ aa + + read(10,301) ac,pds, App, Zpp, ad,tds, Att, Ztt,add + read(10,305) abt,betann,betatar,betapro + read(10,304) ae,bimp,bmin,bdist,aee,sigmatot + read(10,303) ah,eos,aj,ebeam,al,ecm,am,pbeam + read(10,302) af,event,ag,ranseed,ag2,ai,ttime,ak,otime + read(10,102) aop,(CTOption(i),CTOdc(i),i=1,15) + read(10,102) aop,(CTOption(i),CTOdc(i),i=16,30) + read(10,102) aop,(CTOption(i),CTOdc(i),i=31,45) + read(10,103) apa,(CTParam(i),CTPdc(i),i=1,12) + read(10,103) apa,(CTParam(i),CTPdc(i),i=13,24) + read(10,103) apa,(CTParam(i),CTPdc(i),i=25,36) + read(10,103) apa,(CTParam(i),CTPdc(i),i=37,48) + read(10,306) apav +c reset option 40 + CTOption(40)=1 + +c read event body + read(10,*) npart,ttime + read(10,202) itotcoll,NElColl,iinelcoll,NBlColl,dectag, + @ NHardRes,NSoftRes,NDecRes +c timestep=dble(ttime)/dtimestep + ctag=itotcoll+dectag +c now read particle-output + nbar=0 + do 39 i=1,npart + read(10,210) r0(i),rx(i),ry(i),rz(i),p0(i), + @ px(i),py(i),pz(i),fmass(i), + @ ityp(i),iso3(i),charge(i), + @ lstcoll(i),ncoll(i),origin(i), + @ dectime(i),tform(i),xtotfac(i) + if(abs(ityp(i)).le.maxbar)nbar=nbar+1 + 39 continue + nmes=npart-nbar + acttime=r0(1) +c read options-file +cdh call getparams + return +c stop in case of EoF + 666 stop + + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + entry specout(ind,iu) + i=ind + if (CTOption(28).lt.0) return + if (iu.eq.16.and.bf16) return + if (iu.eq.14.and.bf14) return + write(iu,201) r0(i),rx(i),ry(i),rz(i),p0(i), + @ px(i)+ffermpx(i),py(i)+ffermpy(i), + @ pz(i)+ffermpz(i),fmass(i), + @ ityp(i),iso3(i),charge(i), + @ dectag+lstcoll(i),ncoll(i),mod(origin(i),100) + + return + + end + + + + +cccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine spectrans(tstep) +c +c (when cto 28 is set to 2 this subroutine is called +c to propagate the spectators along straight lines) +c +cinput tstep : timestep +c +ccccccccccccccccccccccccccccccccccccccccccccccccccccc + implicit none + real*8 dtime,energ,tstep + integer j + include 'coms.f' + + dtime=tstep + + do 1 j=1,nspec + energ = p0s(j) + r0s(j) = r0s(j) + dtime + rxs(j) = rxs(j) + pxs(j)/energ*dtime + rys(j) = rys(j) + pys(j)/energ*dtime + rzs(j) = rzs(j) + pzs(j)/energ*dtime +1 continue + + return + end + +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + real*8 function ptsigtot() +c +c Revision : 1.0 +c +c This function caculates the total cross section of the reaction. +c (Projectile - target total cross section) +C +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + + include 'comres.f' + include 'coms.f' + include 'options.f' + + integer indmn,indmx,itypmn,iso3mn,itypmx,iso3mx + integer isigline,iline,collclass + real*8 stot,sigel + real*8 sigtot + +c determine total cross section for reaction: + if(abs(Ap)+abs(At).gt.2) then + stot=10.d0*pi*(bdist**2-bmin**2) + elseif(abs(Ap)+abs(At).eq.2) then + stot=sigtot(1,2,ecm) +cccccccc for CTOption(7)=1 no elastic cross section: + if(CTOption(7).eq.1) then +c first sort the two itypes for call to collclass and anndec + if(abs(ityp(1)).lt.abs(ityp(2))) then + indmn=1 + indmx=2 + else + indmn=2 + indmx=1 + endif + + itypmn=ityp(indmn) + iso3mn=iso3(indmn) + itypmx=ityp(indmx) + iso3mx=iso3(indmx) + isigline=collclass(itypmx,iso3mx,itypmn,iso3mn) +c the elastic cross section is always the first entry (#3) + iline=SigmaLn(3,1,isigline) +c!!!!DANGER: does not work for unstable particles (-> detailed balance) + call crossx(iline,ecm,ityp(1),iso3(1), + & fmass(1),ityp(2),iso3(2),fmass(2),sigel) +c + if(stot-sigel.gt.0) then + stot=stot-sigel + else + stot=sigel + endif + endif + else + stot=0.d0 + endif +c + ptsigtot=stot + return + end diff --git a/Processes/UrQMD/paulibl.f b/Processes/UrQMD/paulibl.f new file mode 100644 index 0000000000000000000000000000000000000000..55f07f278f2e68bf775dc850181ef2a91388b7d2 --- /dev/null +++ b/Processes/UrQMD/paulibl.f @@ -0,0 +1,97 @@ +c $Id: paulibl.f,v 1.4 1999/01/18 09:57:11 ernst Exp $ +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + logical function paulibl(i,rhob) +c +c Revision : 1.0 +c +c This function determines wether the final state of particle i +c is pauli-blocked ({\tt .true.}) or not ({\tt .false.}). +c The baryon-density at the location of particle i is returned in {\tt rhob} +c +c +cinput i : Index of particle to be added +c +coutput rhob : baryon density at location of i +c +c +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + integer i, j + real*8 afit, bfit, rho, f, rhob, test, r2, p2, pgw, rhob0 + parameter (afit=1.49641d0, bfit=0.208736d0) + + real*8 qij(4),pij(4),pr2,q2,qp + + include 'coms.f' + include 'comres.f' + include 'options.f' + + rho = 0.0d0 + rhob = 0.0d0 + rhob0 = 0d0 + f = 0.0d0 + pgw = 1.0d0/hqc/hqc/gw + + if(CTOption(23).eq.0)goto 3 + + do 1 j=1,nbar + r2 = (rx(i)-rx(j))**2+(ry(i)-ry(j))**2+(rz(i)-rz(j))**2 + if ((ityp(i).eq.ityp(j)).and.(iso3(i).eq.iso3(j))) then + p2 = (px(i)+ffermpx(i)-px(j)-ffermpx(j))**2 + & +(py(i)+ffermpy(i)-py(j)-ffermpy(j))**2 + & +(pz(i)+ffermpz(i)-pz(j)-ffermpz(j))**2 + p2 = 0.25d0*p2 + rho = rho + dexp(-(2.0d0*gw*r2)) + f = f + dexp(-(gw*r2)-pgw*p2) + end if + rhob = rhob + dexp(-(2.0d0*gw*r2)) + 1 continue + paulibl = .true. + test = afit + bfit*rho + if (test.gt.f) paulibl = .false. + if (CTOption(10).eq.1) paulibl=.false. + + rhob = rhob*(2.0d0*gw/pi)**1.5/rho0 + if(ityp(i).eq.104)write(6,*)'**',rhob + + return + + 3 continue + do 108 j=1,nbar + qij(4)=r0(i)-r0(j) + qij(1)=rx(i)-rx(j) + qij(2)=ry(i)-ry(j) + qij(3)=rz(i)-rz(j) + pij(4)=p0(i)+p0(j) + pij(1)=px(i)+ffermpx(i)+px(j)+ffermpx(j) + pij(2)=py(i)+ffermpy(i)+py(j)+ffermpy(j) + pij(3)=pz(i)+ffermpz(i)+pz(j)+ffermpz(j) + q2=qij(4)**2-qij(1)**2-qij(2)**2-qij(3)**2 + p2=pij(4)**2-pij(1)**2-pij(2)**2-pij(3)**2 + qp=qij(4)*pij(4)-qij(1)*pij(1)-qij(2)*pij(2) + . -qij(3)*pij(3) + r2=qp**2/p2 - q2 + if(r2.lt.0) then + write(6,*)'***(E) negative transverse distance !!',r2 + write(6,*)r0(j),rx(j),ry(j),rz(j),p0(j),px(j),py(j),pz(j) + write(6,*)r0(i),rx(i),ry(i),rz(i),p0(i),px(i),py(i),pz(i) + r2=1000.d0 + endif + pr2 = (px(i)-px(j))**2+(py(i)-py(j))**2+(pz(i)-pz(j))**2 + if ((ityp(i).eq.ityp(j)).and.(iso3(i).eq.iso3(j))) then + rho=rho+dexp(-(2.0d0*gw*r2)) + f=f+dexp(-(gw*r2)-.25d0*pgw*pr2) + end if +c baryon density in rest frame of particle + if(j.ne.lstcoll(i))rhob=rhob+dexp(-(2.0d0*gw*r2)) + 108 continue + paulibl=.true. + test=afit+bfit*rho + if (test.gt.f) paulibl=.false. + if (CTOption(10).eq.1) paulibl=.false. + + rhob=max(0d0,min(.1d3,rhob*(2.0d0*gw/pi)**1.5/rho0)) + + return + end diff --git a/Processes/UrQMD/proppot.f b/Processes/UrQMD/proppot.f new file mode 100644 index 0000000000000000000000000000000000000000..bc5960586ccb799742576f53596e3304934eede0 --- /dev/null +++ b/Processes/UrQMD/proppot.f @@ -0,0 +1,950 @@ +c $Id: proppot.f,v 1.10 1999/01/18 09:57:12 ernst Exp $ +c Setting of global paramters +c + subroutine params + implicit none + real*8 A0, chi + include 'coms.f' + +c gw = 0.25 fm^-2 width of the gaussian + + logSky = .true. + logYuk = .true. + logCb = .true. + logPau = .false. + + gw = 0.25 + sgw = sqrt(gw) + Cb0 = 1.44 + Yuk0 = 0.0 !-85.0 + gamYuk = 1.4 + drPau = 9.0 + dpPau = 0.0144 + Pau0 = 0.0 !99.5*(hqc/sqrt(drPau*dpPau))**3 + +C +C hard Skyrme EOS (usual stuff) +C +c Sky30 = 70.5 +c gamSky = 2.0 +c A0 = -124.2 * 0.5 +C +C hard Skyrme EOS (JK parametrisation corrected for Gausswidth gw=0.25) +C + Sky30 = 125.93 + gamSky = 1.676 + A0 = -87.67 + chi = 0.93 + +c Sky30 = 303.0 !188.18 +c gamSky = 7.0/6.0 !1.457 +c A0 = -356.0 * 0.5 + + + Sky20 = chi*2.0*A0 + Yuk0 = (1.0-chi)/(2.0*pi*gamYuk**2)*A0 + +c Sky20 = 0.0d0 +c Sky30 = 0.0d0 +c Yuk0 = 0.0d0 +c Cb0 = 0.0d0 + + delr = 0.2 + fdel = delr*delr/6.0 + da = -(1.0/delr) + db = -da + + cutdww = 20.0 + cutPau = 20.0 + cutYuk = 20.0 + cutCb = 20.0 + + dtimestep=0.2 + dt = 0.02 +c dt2 = 0.5*dt +c dt6 = dt/6.0 + + return + end + + +c Reset of all indexed variables +c + subroutine set0 + implicit none + integer i, j + include 'coms.f' + + do 10 i=1,nspl + spPauy(i) = 0.0 + outPau(i) = 0.0 + spCby(i) = 0.0 + outCb(i) = 0.0 + spYuky(i) = 0.0 + outYuk(i) = 0.0 + spSkyy(i) = 0.0 + outSky(i) = 0.0 + spdwwy(i) = 0.0 + outdww(i) = 0.0 + 10 continue + + do 20 j=1,nmax + spin(j) = 0 + iso3(j) = 0 + ncoll(j) = 0 + rx(j) = 0.0 + ry(j) = 0.0 + rz(j) = 0.0 + px(j) = 0.0 + py(j) = 0.0 + pz(j) = 0.0 + fmass(j) = 0.0 + 20 continue + return + end + + + + subroutine derivs(row) + implicit none + integer j, k, index, row + real*8 spu, spo, outu, outo, tmp, a, b, dy, dp, drdp, dpj + real*8 rxjku, ryjku, rzjku, rjku, pxjku, pyjku, pzjku, pjku + logical iPau + include 'coms.f' + +C aopx(j,?) = -dH/dx_j +C aorx(j,?) = dH/dpx_j + + do 10 j=1,nbar + rww(j) = 0.0 + 10 continue + if(logSky) then + do 20 j=1,nbar + do 30 k=j+1,nbar + rxjku = (airx(j)-airx(k)) + ryjku = (airy(j)-airy(k)) + rzjku = (airz(j)-airz(k)) + rjku = sqrt(rxjku**2+ryjku**2+rzjku**2) + if(rjku.lt.cutdww) then + index = int(rjku/delr)+1 + a = dble(index) - rjku/delr + b = 1.0 - a + tmp = a*spdwwy(index)+b*spdwwy(index+1)+ + + ((a**3-a)*outdww(index)+(b**3-b)*outdww(index+1))*fdel + rww(j) = rww(j) + tmp + rww(k) = rww(k) + tmp + end if + 30 continue + 20 continue + end if + + do 40 j=1,nbar + aopx(j,row) = 0.0 + aopy(j,row) = 0.0 + aopz(j,row) = 0.0 + dpj = 1.0/sqrt(aipx(j)*aipx(j)+aipy(j)*aipy(j)+aipz(j)*aipz(j)+ + + fmass(j)*fmass(j)) + aorx(j,row) = aipx(j)*dpj + aory(j,row) = aipy(j)*dpj + aorz(j,row) = aipz(j)*dpj + 40 continue + + do 50 j=1,nbar + do 60 k=j+1,nbar + rxjku = (airx(j)-airx(k)) + ryjku = (airy(j)-airy(k)) + rzjku = (airz(j)-airz(k)) + rjku = sqrt(rxjku**2+ryjku**2+rzjku**2) + if (rjku.ge.1.0E-8) then + rxjku = rxjku/rjku + ryjku = ryjku/rjku + rzjku = rzjku/rjku + else + rxjku = 0.0 + ryjku = 0.0 + rzjku = 0.0 + end if + spu = 0.0 + spo = 0.0 + outu = 0.0 + outo = 0.0 + dy = 0.0 + index = int(rjku/delr)+1 + a = dble(index)-rjku/delr + b = 1.0-a + if(logYuk.and.rjku.lt.cutYuk) then + spu = spu + spYuky(index) + spo = spo + spYuky(index+1) + outu = outu + outYuk(index) + outo = outo + outYuk(index+1) + end if + if(logSky.and.rjku.lt.cutdww) then + tmp = Sky20 + Sky30*gamSky/(gamSky+1.0)* + * (rww(j)**(gamSky-1.0)+rww(k)**(gamSky-1.0)) + spu = spu + spdwwy(index)*tmp + spo = spo + spdwwy(index+1)*tmp + outu = outu + outdww(index)*tmp + outo = outo + outdww(index+1)*tmp + end if + dy = da*spu+db*spo+ + + ((3.0*a**2-1.0)*da*outu+(3.0*b**2-1.0)*db*outo)*fdel + if(logCb) then + if(rjku.lt.cutCb) then + dy = dy + (da*spCby(index)+db*spCby(index+1)+ + + ((3.0*a**2-1.0)*da*outCb(index)+ + + (3.0*b**2-1.0)*db*outCb(index+1))*fdel)* + * dble(charge(j)*charge(k)) + else + dy = dy - Cb0/rjku/rjku*dble(charge(j)*charge(k)) + end if + end if + if(logPau.and.iPau(j,k)) then + pxjku = (aipx(j)-aipx(k)) + pyjku = (aipy(j)-aipy(k)) + pzjku = (aipz(j)-aipz(k)) + pjku = sqrt(pxjku**2+pyjku**2+pzjku**2) + if (pjku.ge.1.0E-8) then + pxjku = pxjku/pjku + pyjku = pyjku/pjku + pzjku = pzjku/pjku + else + pxjku = 0.0 + pyjku = 0.0 + pzjku = 0.0 + end if + drdp = 0.5*(pjku*pjku/dpPau+rjku*rjku/drPau) + if(drdp.lt.cutPau) then + index = int(drdp/delr)+1 + a = dble(index)-drdp/delr + b = 1.0-a + tmp = da*spPauy(index)+db*spPauy(index+1)+ + + ((3.0*a**2-1.0)*da*outPau(index)+ + + (3.0*b**2-1.0)*db*outPau(index+1))*fdel + dy = dy+tmp*rjku/drPau + dp = tmp*pjku/dpPau*0.001 + aorx(j,row) = aorx(j,row)+dp*pxjku + aory(j,row) = aory(j,row)+dp*pyjku + aorz(j,row) = aorz(j,row)+dp*pzjku + aorx(k,row) = aorx(k,row)-dp*pxjku + aory(k,row) = aory(k,row)-dp*pyjku + aorz(k,row) = aorz(k,row)-dp*pzjku + end if + end if + dy = -(0.001*dy) + aopx(j,row) = aopx(j,row)+dy*rxjku + aopy(j,row) = aopy(j,row)+dy*ryjku + aopz(j,row) = aopz(j,row)+dy*rzjku + aopx(k,row) = aopx(k,row)-dy*rxjku + aopy(k,row) = aopy(k,row)-dy*ryjku + aopz(k,row) = aopz(k,row)-dy*rzjku + 60 continue + 50 continue + return + end + + real*8 function Ekintot() + implicit none + integer j + real*8 Ekin + include 'coms.f' + + Ekintot = 0.0 + do 3 j=1,npart + Ekintot= Ekintot+Ekin(j) + 3 continue + return + end + + real*8 function EtotJK() + implicit none + real*8 Etot + integer j + include 'coms.f' + + EtotJK = Etot() + do 3 j=1,npart + EtotJK= EtotJK-fmass(j) + 3 continue + EtotJK = EtotJK/npart + return + end + + + real*8 function Etot() + implicit none + integer j, k, index + real*8 a, b, y, drdp, tp, tr, tmp, Ekintot + real*8 Ekinbar, Ekinmes, ESky2, ESky3, EYuk, ECb, EPau, Ekin + real*8 rxjku, ryjku, rzjku, rjku, pxjku, pyjku, pzjku, pjku + logical iPau + include 'coms.f' + common /energies/ Ekinbar, Ekinmes, ESky2, ESky3, EYuk, ECb, EPau + + Etot = 0.0 + Ekinbar = 0.0 + Ekinmes = 0.0 + ESky2 = 0.0 + ESky3 = 0.0 + EYuk = 0.0 + ECb = 0.0 + EPau = 0.0 + + if(EoS.eq.0) then + +c CASCADE mode + Etot=Ekintot() + return + else +c with potentials +c kinetic energies of mesons first + do 4 j=nbar+1,npart + Etot= Etot+Ekin(j) + Ekinmes = Ekinmes+Ekin(j) + 4 continue + + do 10 j=1,nbar + rww(j) = 0.0 + 10 continue + if(logSky) then + do 20 j=1,nbar + do 30 k=j+1,nbar + rxjku = (rx(j)-rx(k)) + ryjku = (ry(j)-ry(k)) + rzjku = (rz(j)-rz(k)) + rjku = sqrt(rxjku**2+ryjku**2+rzjku**2) + if(rjku.lt.cutdww) then + index = int(rjku/delr)+1 + a = dble(index) - rjku/delr + b = 1.0 - a + tmp = a*spdwwy(index)+b*spdwwy(index+1)+ + + ((a**3-a)*outdww(index)+(b**3-b)*outdww(index+1))*fdel + rww(j) = rww(j) + tmp + rww(k) = rww(k) + tmp + end if + 30 continue + 20 continue + end if + + do 40 j=1,nbar + Etot = Etot + Ekin(j) + 0.0005*Sky20*rww(j) + + + 0.001*Sky30/(gamSky+1.0)*rww(j)**gamSky + Ekinbar = Ekinbar + Ekin(j) + ESky2 = ESky2 + 0.0005*Sky20*rww(j) + ESky3 = ESky3 + 0.001*Sky30/(gamSky+1.0)*rww(j)**gamSky + do 50 k=j+1,nbar + rxjku = (rx(j)-rx(k)) + ryjku = (ry(j)-ry(k)) + rzjku = (rz(j)-rz(k)) + rjku = sqrt(rxjku**2+ryjku**2+rzjku**2) + index = int(rjku/delr)+1 + a = dble(index)-rjku/delr + b = 1.0-a + if(logYuk.and.rjku.lt.cutYuk) then + y = a*spYuky(index)+b*spYuky(index+1)+ + + ((a**3-a)*outYuk(index)+(b**3-b)*outYuk(index+1))*fdel + Etot = Etot + 0.001*y + EYuk = EYuk + 0.001*y + end if + if(logCb) then + if(rjku.lt.cutCb) then + y = (a*spCby(index)+b*spCby(index+1)+ + + ((a**3-a)*outCb(index)+(b**3-b)*outCb(index+1))*fdel)* + * dble(charge(j)*charge(k)) + else + y = Cb0/rjku*dble(charge(j)*charge(k)) + end if + Etot = Etot + 0.001*y + ECb = ECb + 0.001*y + end if + if(logPau.and.iPau(j,k)) then + pxjku = (px(j)-px(k)) + pyjku = (py(j)-py(k)) + pzjku = (pz(j)-pz(k)) + pjku = sqrt(pxjku**2+pyjku**2+pzjku**2) + tp = pjku + tr = rjku + drdp = 0.5*(pjku*pjku/dpPau+rjku*rjku/drPau) + if(drdp.lt.cutPau) then + index = int(drdp/delr)+1 + a = dble(index)-drdp/delr + b = 1.0-a + y = a*spPauy(index)+b*spPauy(index+1)+ + + ((a**3-a)*outPau(index)+(b**3-b)*outPau(index+1))*fdel + Etot = Etot + 0.001*y + EPau = EPau + 0.001*y + end if + end if + 50 continue + 40 continue + Ekinbar = Ekinbar/dble(nbar) + Ekinmes = Ekinmes/dble(max(1,npart-nbar)) + ESky2 = ESky2/dble(nbar) + ESky3 = ESky3/dble(nbar) + EYuk = EYuk/dble(nbar) + ECb = ECb/dble(nbar) + EPau = EPau/dble(nbar) + end if + return + end + + + subroutine cascstep(tim,dtime) + implicit none + real*8 tim,dtime,energ + integer j + include 'coms.f' + include 'boxinc.f' + include 'options.f' +ctp060202 to avoid warnings with gfortran compilation + logical ctp060202 + ctp060202=.false. + if(ctp060202)write(*,*)tim +ctp060202 end + + do 1 j=1,npart + energ = sqrt(px(j)**2+py(j)**2+pz(j)**2+fmass(j)**2) + r0(j) = r0(j) + dtime + rx(j) = rx(j) + px(j)/energ*dtime + rz(j) = rz(j) + pz(j)/energ*dtime + ry(j) = ry(j) + py(j)/energ*dtime +1 continue + return + end + + subroutine proprk(tim,dtime) + + implicit none + real*8 tim,dtime,energ,dt2, dt6 + integer j + + include 'coms.f' + include 'boxinc.f' + include 'options.f' +ctp060202 to avoid warnings with gfortran compilation + logical ctp060202 + ctp060202=.false. + if(ctp060202)write(*,*)tim +ctp060202 end + + if (EoS.eq.0) then +c cascade mode + do 1 j=1,npart + energ = p0(j) ! sqrt(px(j)**2+py(j)**2+pz(j)**2+fmass(j)**2) + r0(j) = r0(j) + dtime + rx(j) = rx(j) + px(j)/energ*dtime + ry(j) = ry(j) + py(j)/energ*dtime + rz(j) = rz(j) + pz(j)/energ*dtime +1 continue + return + else +c propagation with potentials +c propagate mesons on straight lines + do 2 j=nbar+1,npart + energ = p0(j) ! sqrt(px(j)**2+py(j)**2+pz(j)**2+fmass(j)**2) + r0(j) = r0(j) + dtime + rx(j) = rx(j) + px(j)/energ*dtime + ry(j) = ry(j) + py(j)/energ*dtime + rz(j) = rz(j) + pz(j)/energ*dtime +2 continue + +c propagate baryons +c adjust time-step parameters + dt = dtime + dt2 = dtime/2.0d0 + dt6 = dtime/6.0d0 + + do 10 j=1,nbar + airx(j) = rx(j) + airy(j) = ry(j) + airz(j) = rz(j) + aipx(j) = px(j) + aipy(j) = py(j) + aipz(j) = pz(j) + 10 continue + + call derivs(1) + do 20 j=1,nbar + airx(j) = rx(j) + dt2*aorx(j,1) + airy(j) = ry(j) + dt2*aory(j,1) + airz(j) = rz(j) + dt2*aorz(j,1) + aipx(j) = px(j) + dt2*aopx(j,1) + aipy(j) = py(j) + dt2*aopy(j,1) + aipz(j) = pz(j) + dt2*aopz(j,1) + 20 continue + + call derivs(2) + + do 30 j=1,nbar + airx(j) = rx(j) + dt2*aorx(j,2) + airy(j) = ry(j) + dt2*aory(j,2) + airz(j) = rz(j) + dt2*aorz(j,2) + aipx(j) = px(j) + dt2*aopx(j,2) + aipy(j) = py(j) + dt2*aopy(j,2) + aipz(j) = pz(j) + dt2*aopz(j,2) + 30 continue + + call derivs(3) + + do 40 j=1,nbar + airx(j) = rx(j) + dt*aorx(j,3) + airy(j) = ry(j) + dt*aory(j,3) + airz(j) = rz(j) + dt*aorz(j,3) + aipx(j) = px(j) + dt*aopx(j,3) + aipy(j) = py(j) + dt*aopy(j,3) + aipz(j) = pz(j) + dt*aopz(j,3) + 40 continue + + call derivs(4) + + do 50 j=1,nbar + r0(j) = r0(j) + dtime + rx(j)=rx(j)+dt6*(aorx(j,1)+2.0*(aorx(j,2)+aorx(j,3))+aorx(j,4)) + ry(j)=ry(j)+dt6*(aory(j,1)+2.0*(aory(j,2)+aory(j,3))+aory(j,4)) + rz(j)=rz(j)+dt6*(aorz(j,1)+2.0*(aorz(j,2)+aorz(j,3))+aorz(j,4)) + px(j)=px(j)+dt6*(aopx(j,1)+2.0*(aopx(j,2)+aopx(j,3))+aopx(j,4)) + py(j)=py(j)+dt6*(aopy(j,1)+2.0*(aopy(j,2)+aopy(j,3))+aopy(j,4)) + pz(j)=pz(j)+dt6*(aopz(j,1)+2.0*(aopz(j,2)+aopz(j,3))+aopz(j,4)) + p0(j)=sqrt(px(j)**2+py(j)**2+pz(j)**2+fmass(j)**2) + 50 continue + end if + + return + end + + + subroutine potPau + implicit none + integer i, ncut, index + real*8 Ecut, dr, abl0, abln, a, b, y, dy, Pau + include 'coms.f' + + rx(1) = 0.0d0 + ry(1) = 0.0d0 + rz(1) = 0.0d0 + ry(2) = 0.0d0 + rz(2) = 0.0d0 + px(1) = 0.0d0 + py(1) = 0.0d0 + pz(1) = 0.0d0 + px(1) = 0.0d0 + py(2) = 0.0d0 + pz(2) = 0.0d0 + Ecut = 1.0E-5 + i = 0 + 99 i = i+1 + dr = delr*dble(i-1) + rx(2) = sqrt(2.0*dr*drPau) + spx(i) = dr + spPauy(i) = Pau(1,2) + if(spPauy(i).lt.Ecut) then + spPauy(i) = 0.0 + cutPau = dr + abl0 = -Pau0 + abln = 0.0 + ncut = i + else + goto 99 + end if + call spline(spx,spPauy,ncut,abl0,abln,outPau) + + write(6,'(''Pauli-Potential '',e10.3,i5,f7.1)') + + Ecut, ncut, cutPau + + do 10 i=0,20 + dr = 0.323*dble(i) + if(dr.gt.cutPau) then + y = 0.0 + dy = 0.0 + else + rx(2) = dr + dr = 0.5*dr*dr/drPau + index = int(dr/delr)+1 + a = dble(index) - dr/delr + b = 1.0 - a + y = a*spPauy(index)+b*spPauy(index+1)+ + + ((a**3-a)*outPau(index)+ + + (b**3-b)*outPau(index+1))*fdel + dy = da*spPauy(index)+db*spPauy(index+1)+ + + ((3.0*a**2-1.0)*da*outPau(index)+ + + (3.0*b**2-1.0)*db*outPau(index+1))*fdel + dy = dy*sqrt(2.0*dr*drPau)/drPau + end if + 10 continue + return + end + + subroutine potCb + implicit none + integer i, ncut, index + real*8 Ecut, dr, abl0, abln, a, b, y, dy, dCb, Cb + include 'coms.f' + + rx(1) = 0.0d0 + ry(1) = 0.0d0 + rz(1) = 0.0d0 + ry(2) = 0.0d0 + rz(2) = 0.0d0 + Ecut = 1.0E-5 + iso3(1) = 1 + iso3(2) = 1 + i = 0 + 99 i = i+1 + dr = delr*dble(i-1) + rx(2) = dr + spx(i) = dr + spCby(i) = Cb(1,2) + if(abs(spCby(i)*dr-Cb0)/max(dr,1.0d-5).lt.Ecut) then + spCby(i) = Cb0/dr + cutCb = dr + abln = dCb(1,2) + abl0 = 0.0 + ncut = i + else + goto 99 + end if + call spline(spx,spCby,ncut,abl0,abln,outCb) + + write(6,'(''Coulomb-Potential '',e10.3,i5,f7.1)') + + Ecut, ncut, cutCb + + do 10 i=0,20 + dr = 0.2*dble(i)+0.01212 + rx(2) = dr + if(dr.ge.cutCb) then + y = Cb0/dr + dy = -(Cb0/dr/dr) + else + index = int(dr/delr)+1 + a = dble(index) - dr/delr + b = 1.0 - a + y = a*spCby(index)+b*spCby(index+1)+ + + ((a**3-a)*outCb(index)+(b**3-b)*outCb(index+1))*fdel + dy = da*spCby(index)+db*spCby(index+1)+ + + ((3.0*a**2-1.0)*da*outCb(index)+ + + (3.0*b**2-1.0)*db*outCb(index+1))*fdel + end if + 10 continue + return + end + + subroutine potYuk + implicit none + integer i, ncut, index + real*8 Ecut, dr, abl0, abln, a, b, y, dy + real*8 Yuk + include 'coms.f' + + rx(1) = 0.0d0 + ry(1) = 0.0d0 + rz(1) = 0.0d0 + ry(2) = 0.0d0 + rz(2) = 0.0d0 + Ecut = 1.0E-5 + i = 0 + 99 i = i+1 + dr = delr*dble(i-1) + rx(2) = dr + spx(i) = dr + spYuky(i) = Yuk(1,2) + if(abs(spYuky(i)).lt.Ecut) then + spYuky(i) = 0.0 + cutYuk = dr + abl0 = 0.0 + abln = 0.0 + ncut = i + else + goto 99 + end if + call spline(spx,spYuky,ncut,abl0,abln,outYuk) + + write(6,'(''Yukawa-Potential '',e10.3,i5,f7.1)') + + Ecut, ncut, cutYuk + + do 10 i=0,40 + dr = 0.2*dble(i) + rx(2) = dr + if(dr.gt.cutYuk) then + y = 0.0 + dy = 0.0 + else + index = int(dr/delr)+1 + a = dble(index) - dr/delr + b = 1.0 - a + y = a*spYuky(index)+b*spYuky(index+1)+ + + ((a**3-a)*outYuk(index)+(b**3-b)*outYuk(index+1))*fdel + dy = da*spYuky(index)+db*spYuky(index+1)+ + + ((3.0*a**2-1.0)*da*outYuk(index)+ + + (3.0*b**2-1.0)*db*outYuk(index+1))*fdel + end if + 10 continue + return + end + + + subroutine potdww + implicit none + integer i, ncut, index + real*8 Ecut, dr, abl0, abln, a, b, y, dy + real*8 dww + include 'coms.f' + + rx(1) = 0.0d0 + ry(1) = 0.0d0 + rz(1) = 0.0d0 + ry(2) = 0.0d0 + rz(2) = 0.0d0 + Ecut = 1.0E-8 + i = 0 + 99 i = i+1 + dr = delr*dble(i-1) + rx(2) = dr + spx(i) = dr + spdwwy(i) = dww(1,2) + if(abs(spdwwy(i)).lt.Ecut) then + spdwwy(i) = 0.0 + cutdww = dr + abl0 = 0.0 + abln = 0.0 + ncut = i + else + goto 99 + end if + call spline(spx,spdwwy,ncut,abl0,abln,outdww) + + write(6,'(''Interaction-Density'',e10.3,i5,f7.1)') + + Ecut, ncut, cutdww + + do 10 i=0,20 + dr = 0.295*dble(i) + rx(2) = dr + if(dr.gt.cutdww) then + y = 0.0 + dy = 0.0 + else + index = int(dr/delr)+1 + a = dble(index) - dr/delr + b = 1.0 - a + y = a*spdwwy(index)+b*spdwwy(index+1)+ + + ((a**3-a)*outdww(index)+(b**3-b)*outdww(index+1))*fdel + dy = da*spdwwy(index)+db*spdwwy(index+1)+ + + ((3.0*a**2-1.0)*da*outdww(index)+ + + (3.0*b**2-1.0)*db*outdww(index+1))*fdel + end if + 10 continue + return + end + +c Kinetic Energy +c + function Ekin(j) + implicit none + integer j + real*8 Ekin + include 'coms.f' + + Ekin = sqrt((px(j)+ffermpx(j))*(px(j)+ffermpx(j))+ + + (py(j)+ffermpy(j))*(py(j)+ffermpy(j))+ + + (pz(j)+ffermpz(j))*(pz(j)+ffermpz(j))+ + + fmass(j)*fmass(j)) + + return + end + +c Derivative for Kinetic Energy +c + function dEkin(j) + implicit none + integer j + real*8 dEkin + include 'coms.f' + + dEkin = 1.0/sqrt(px(j)*px(j)+py(j)*py(j)+pz(j)*pz(j)+ + + fmass(j)*fmass(j)) + return + end + +c Skyrme Potential (3-body) rwwterm +c + function dww(j,k) + implicit none + integer j, k + real*8 dww, rjk + include 'coms.f' + + dww = gw/pi*sqrt(gw/pi)*exp(-(gw*rjk(j,k)*rjk(j,k)))/ + / rho0 + return + end + +cc Skyrme Potential +cc + function Sky(j,k) + implicit none + integer j, k + real*8 Sky, rjk + include 'coms.f' + + Sky = Sky20*gw/pi*sqrt(gw/pi)*exp(-(gw*rjk(j,k)*rjk(j,k))) + return + end + +c Coulomb Potential +c + function Cb(j,k) + implicit none + integer j, k + real*8 Cb, rjk + real*8 erf + include 'coms.f' + + if (iso3(j).eq.1.and.iso3(k).eq.1) then + if (rjk(j,k).lt.eps) then + Cb = Cb0*er0*sgw + else + Cb = Cb0/rjk(j,k)*erf(sgw*rjk(j,k)) + end if + else + Cb = 0.0 + end if + return + end + +c Derivative for Coulomb Potential +c + function dCb(j,k) + implicit none + integer j, k + real*8 dCb, rjk + real*8 erf + include 'coms.f' + + if (iso3(j).eq.1.and.iso3(k).eq.1) then + if (rjk(j,k).lt.eps) then + dCb = 0.0 + else + dCb = Cb0*(er0*exp(-(gw*rjk(j,k)*rjk(j,k)))*sgw*rjk(j,k)- + + erf(sgw*rjk(j,k)))/rjk(j,k)/rjk(j,k) + end if + else + dCb = 0.0 + end if + return + end + +c Yukawa Potential +c + function Yuk(j,k) + implicit none + integer j, k + real*8 Yuk, rjk + real*8 erf + include 'coms.f' + + if(rjk(j,k).lt.eps) then + Yuk = Yuk0*(er0*sgw-exp(0.25/gamYuk/gamYuk/gw)/gamYuk* + * (1.0-erf(0.5/gamYuk/sgw))) + else + Yuk = Yuk0*0.5/rjk(j,k)*exp(0.25/gamYuk/gamYuk/gw)* + * (exp(-(rjk(j,k)/gamYuk))* + + (1.0-erf(0.5/gamYuk/sgw-sgw*rjk(j,k)))- + - exp(rjk(j,k)/gamYuk)* + + (1.0-erf(0.5/gamYuk/sgw+sgw*rjk(j,k)))) + end if + return + end + +c Derivative for Yukawa Potential +c + function dYuk(j,k) + implicit none + integer j, k + real*8 dYuk, rjk + real*8 erf + include 'coms.f' + + if(rjk(j,k).lt.eps) then + dYuk = 0.0 + else + dYuk = 0.5*Yuk0/rjk(j,k)*( exp(0.25/gamYuk/gamYuk/gw)*( + * (-(1.0/rjk(j,k))-1.0/gamYuk)*exp(-(rjk(j,k)/gamYuk))* + * (1.0-erf(0.5/gamYuk/sgw-sgw*rjk(j,k))) + + * (1.0/rjk(j,k)-1.0/gamYuk)*exp(rjk(j,k)/gamYuk)* + * (1.0-erf(0.5/gamYuk/sgw+sgw*rjk(j,k))) ) + + + sgw*er0*2.0*exp(-(gw*rjk(j,k)*rjk(j,k))) ) + end if + return + end + + +c Pauli Potential +c + function Pau(j,k) + implicit none + integer j, k + real*8 Pau, pjk, rjk + include 'coms.f' + + Pau = Pau0*exp(-(0.5*rjk(j,k)*rjk(j,k)/drPau))* + * exp(-(0.5*pjk(j,k)*pjk(j,k)/dpPau)) + return + end + +c Derivative (p) for Pauli Potential +c + function dPaup(j,k) + implicit none + integer j, k + real*8 dPaup, pjk, rjk + include 'coms.f' + + dPaup = -(Pau0/dpPau*pjk(j,k)* + * exp(-(0.5*rjk(j,k)*rjk(j,k)/drPau))* + * exp(-(0.5*pjk(j,k)*pjk(j,k)/dpPau))) + return + end + +c Derivative (r) for Pauli Potential +c + function dPaur(j,k) + implicit none + integer j, k + real*8 dPaur, pjk, rjk + include 'coms.f' + + dPaur = -(Pau0/drPau*rjk(j,k)* + * exp(-(0.5*rjk(j,k)*rjk(j,k)/drPau))* + * exp(-(0.5*pjk(j,k)*pjk(j,k)/dpPau))) + return + end + + function rjk(j,k) + implicit none + integer j, k + real*8 rjk + include 'coms.f' + + rjk = sqrt((rx(j)-rx(k))**2+(ry(j)-ry(k))**2+(rz(j)-rz(k))**2) + return + end + + function pjk(j,k) + implicit none + integer j, k + real*8 pjk + include 'coms.f' + + pjk = sqrt((px(j)-px(k))**2+(py(j)-py(k))**2+(pz(j)-pz(k))**2) + return + end + + function iPau(j,k) + implicit none + integer j, k + logical iPau + include 'coms.f' + + iPau = .false. + if (iso3(j).eq.iso3(k).and.ityp(j).eq.ityp(k)) iPau = .true. + return + end diff --git a/Processes/UrQMD/saveinfo.f b/Processes/UrQMD/saveinfo.f new file mode 100644 index 0000000000000000000000000000000000000000..a14a935ac213a52c04bd0295d932860201f0ba4b --- /dev/null +++ b/Processes/UrQMD/saveinfo.f @@ -0,0 +1,121 @@ +c $Id: saveinfo.f,v 1.7 2002/05/03 00:31:19 weber Exp $ +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC +C + subroutine saveinfo(ind,itag) +c +c Revision : 1.0 +c +cinput ind: particle ID +cinput itag: slot for particle to stored (>0) or extracted (<0) from +c +c This subroutine stores the information of the {\tt ind} slot in +c the particle arrays (necessary in case of pauli-blocked collisions) +c The absolute value of {\tt itag} indicates the storage slot to be used. +c For positive values of {\tt itag} the information is stored, for negative +c values it is restored. Currently two slots are available. +C +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC +c + implicit none + include 'coms.f' +c + integer ind,itag,islot,j + integer lstcollt(2),ncollt(2) + integer charget(2),spint(2),stridt(2) +c origint(2),uidt(2) + real*8 r0t(2),rxt(2),ryt(2),rzt(2), + p r0tt(2),rxtt(2),rytt(2),rztt(2), + @ p0t(2),pxt(2),pyt(2),pzt(2),fmasst(2),tdectime(2), + @ xtotfact(2),tformt(2),p0tdt(2,2),pxtdt(2,2),pytdt(2,2), + @ pztdt(2,2),fmasstdt(2,2) + integer ityptdt(2,2),iso3tdt(2,2) + save +c + if(ind.eq.0) return +c + islot=abs(itag) + +c save particle + if(itag.gt.0) then + r0t(islot)=r0(ind) + rxt(islot)=rx(ind) + ryt(islot)=ry(ind) + rzt(islot)=rz(ind) +cpot + r0tt(islot)=r0_t(ind) + rxtt(islot)=rx_t(ind) + rytt(islot)=ry_t(ind) + rztt(islot)=rz_t(ind) + + p0t(islot)=p0(ind) + pxt(islot)=px(ind) + pyt(islot)=py(ind) + pzt(islot)=pz(ind) + fmasst(islot)=fmass(ind) + itypt(islot)=ityp(ind) + iso3t(islot)=iso3(ind) + ncollt(islot)=ncoll(ind) + lstcollt(islot)=lstcoll(ind) + origint(islot)=origin(ind) + charget(islot)=charge(ind) + spint(islot)=spin(ind) + tdectime(islot)=dectime(ind) + stridt(islot)=strid(ind) + uidt(islot)=uid(ind) + xtotfact(islot)=xtotfac(ind) + tformt(islot)=tform(ind) +ctd + do 11 j=1,2 + p0tdt(j,islot)=p0td(j,ind) + pxtdt(j,islot)=pxtd(j,ind) + pytdt(j,islot)=pytd(j,ind) + pztdt(j,islot)=pztd(j,ind) + fmasstdt(j,islot)=fmasstd(j,ind) + ityptdt(j,islot)=ityptd(j,ind) + iso3tdt(j,islot)=iso3td(j,ind) + 11 continue + +c ... + elseif(itag.lt.0)then +c restore particle + r0(ind)=r0t(islot) + rx(ind)=rxt(islot) + ry(ind)=ryt(islot) + rz(ind)=rzt(islot) +cpot + r0_t(ind)=r0tt(islot) + rx_t(ind)=rxtt(islot) + ry_t(ind)=rytt(islot) + rz_t(ind)=rztt(islot) + + p0(ind)=p0t(islot) + px(ind)=pxt(islot) + py(ind)=pyt(islot) + pz(ind)=pzt(islot) + fmass(ind)=fmasst(islot) + ityp(ind)=itypt(islot) + iso3(ind)=iso3t(islot) + ncoll(ind)=ncollt(islot) + lstcoll(ind)=lstcollt(islot) + origin(ind)=origint(islot) + charge(ind)=charget(islot) + spin(ind)=spint(islot) + dectime(ind)=tdectime(islot) + strid(ind)=stridt(islot) + uid(ind)=uidt(islot) + xtotfac(ind)=xtotfact(islot) + tform(ind)=tformt(islot) +ctd + do 12 j=1,2 + p0td(j,ind)=p0tdt(j,islot) + pxtd(j,ind)=pxtdt(j,islot) + pytd(j,ind)=pytdt(j,islot) + pztd(j,ind)=pztdt(j,islot) + fmasstd(j,ind)=fmasstdt(j,islot) + ityptd(j,ind)=ityptdt(j,islot) + iso3td(j,ind)=iso3tdt(j,islot) + 12 continue + + endif + return + end diff --git a/Processes/UrQMD/scatter.f b/Processes/UrQMD/scatter.f new file mode 100644 index 0000000000000000000000000000000000000000..0611287bcbb322fa797dd28435673efd30c9a9a0 --- /dev/null +++ b/Processes/UrQMD/scatter.f @@ -0,0 +1,1437 @@ +c$Id: scatter.f,v 1.23 2002/05/03 00:31:19 weber Exp $ +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + subroutine scatter(id1,id2,ssigtot,sqrts,ccolfac) +c +c Revision : 1.0 +c +cinput id1 : index of particle 1 +cinput id2 : index of particle 2 +cinput ssigtot: total cross section +cinput sqrts : $sqrt{s}$ of collision +cinput ccolfac : scale factor for color fluctuations +c +c This subroutine performs the scattering/annihilation +c of two particles or the decay +c of one particle in the incoming channel. +c +c Structure of this routine: +c \begin{enumerate} +c \item transform to NN system for proper kinematics +c \item get collision class and number of exit-channels +c \item loop over exit-channels and get partial cross sections +c \item select exit-channel +c \item save information in case of pauli-blocking +c \item call kinematics routines +c \item call output routine for collision file +c \end{enumerate} +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + + include 'coms.f' + include 'comres.f' + include 'newpart.f' + include 'options.f' + include 'boxinc.f' + + +c local variables + real*8 sqrts,ssigtot,sigpart,sigma(0:maxpsig),sigsum,sigfac + real*8 e1,e2,lambda,colldens,ccolfac + integer ind1,ind2,ityp1,ityp2,isigline,nCh,ii + integer i,j,itot1,itot2,iso31,iso32 + integer id1,id2 +c functions and subroutines + integer collclass,isoit + +c +c make local copies of particle indices + ind1=id1 + ind2=id2 +c increment collision-counter + ctag=ctag+1 + +c save total cross section in sigma(0) + sigma(0)=ssigtot + +c initialize some arrays (definitions are listed in newpart.f) + do 13 j=1,mprt + do 12 i=1,5 + pnew(i,j)=0.0 + 12 continue + inew(j)=0 + leadfac(j)=1.d0 + sidnew(j)=0 + 13 continue + +c if ind2 is less than 0, a collision with a wall takes place + if (ind2.lt.0) then + + call file15out(ind1,ind2,sqrts,ssigtot,sigpart) + +c solid < 1 then periodic boundary conditions + if (solid.lt.1) then + if (ind2.eq.-1) then + rx(ind1)=rx(ind1)-lbox + elseif (ind2.eq.-4) then + rx(ind1)=rx(ind1)+lbox + elseif (ind2.eq.-2) then + ry(ind1)=ry(ind1)-lbox + elseif (ind2.eq.-5) then + ry(ind1)=ry(ind1)+lbox + elseif (ind2.eq.-3) then + rz(ind1)=rz(ind1)-lbox + else + rz(ind1)=rz(ind1)+lbox + endif + else +c solid walls + if (ind2.eq.-1) then + px(ind1)=-px(ind1) + elseif (ind2.eq.-4) then + px(ind1)=-px(ind1) + elseif (ind2.eq.-2) then + py(ind1)=-py(ind1) + elseif (ind2.eq.-5) then + py(ind1)=-py(ind1) + elseif (ind2.eq.-3) then + pz(ind1)=-pz(ind1) + else + pz(ind1)=-pz(ind1) + endif + Endif + + nexit=1 + inew(1)=ind1 + + call f15outch(0.d0) + + return + endif +cc + +c add fermi motion + if (CTOption(30).eq.1) then + call addfermi(ind1,peq1) + call addfermi(ind2,peq2) + endif + +c clear array of partial cross sections + do 14 i=1,maxpsig + sigma(i)=0.d0 + 14 continue + +c save particle indices into pslot for later use (Danielewicz-Pratt delays) + pslot(1)=ind1 + pslot(2)=ind2 + +c some abbreviations + ityp1=ityp(ind1) + itot1=isoit(ityp1) + iso31=iso3(ind1) + if(ind2.eq.0) then + ityp2=0 + itot2=0 + iso32=0 + else + ityp2=ityp(ind2) + itot2=isoit(ityp2) + iso32=iso3(ind2) + endif + + + + +c transform in to NN system for proper kinematics + + e1 = p0(ind1) + + if(ind2.eq.0) then +cccc DECAY cccccccccccccccccccccccc + +c increment decay counter + dectag=dectag+1 + +c prepare output to decay file + call file16entry(ind1) + + sqrts=fmass(ind1) + betax=px(ind1)/e1 + betay=py(ind1)/e1 + betaz=pz(ind1)/e1 + p0nn=p0(ind1) + pxnn=px(ind1) + pynn=py(ind1) + pznn=pz(ind1) + pnn=sqrt(pxnn*pxnn+pynn*pynn+pznn*pznn) + +c set tag for decay: + iline=20 + + else +cccc SCATTERING/ANNIHILATION cccc + e2 = p0(ind2) +c transformation betas into two particle CMS system + betax=(px(ind1)+px(ind2))/(e1+e2) + betay=(py(ind1)+py(ind2))/(e1+e2) + betaz=(pz(ind1)+pz(ind2))/(e1+e2) + +c calculate momenta in two particle CMS system + pxnn=px(ind1) + pynn=py(ind1) + pznn=pz(ind1) + p0nn=e1 +c call to Lorentz transformation + call rotbos(0d0,0d0,-betax,-betay,-betaz, + & pxnn,pynn,pznn,p0nn) + pnn=sqrt(pxnn*pxnn+pynn*pynn+pznn*pznn) + +c reduced cross section for leading hadrons of string fragmentation +c sigfac is scaling factor for cross section + sigfac=1.d0 + if(tform(ind1).le.acttime + & .and.tform(ind2).gt.acttime) then + sigfac=xtotfac(ind2) + else if(tform(ind2).le.acttime + & .and.tform(ind1).gt.acttime) then + sigfac=xtotfac(ind1) + elseif(tform(ind1).gt.acttime + & .and.tform(ind2).gt.acttime) then + sigfac=xtotfac(ind1)*xtotfac(ind2) + endif + +c modify sigfac due to color fluctuations + sigfac = sigfac*ccolfac + +c now get line-number for sigmaLN array in blockres + isigline=collclass(ityp1,iso31,ityp2,iso32) + +c number of exit-channels: + nCh=SigmaLn(1,1,isigline) + + do 10 ii=3,nCh+2 ! loop over exit-channels +c get process-id (iline) from sigmaLN array in blockres + iline=SigmaLn(ii,1,isigline) + if(iline.gt.0) then ! normal cross sections: + + call crossx(iline,sqrts,ityp1,iso31,fmass(ind1), + & ityp2,iso32,fmass(ind2),sigma(ii-2)) + + else ! detailed balance: + call crossz(iline,sqrts,ityp1,iso31,fmass(ind1), + & ityp2,iso32,fmass(ind2),sigma(ii-2)) + endif ! end of detailed balance +c ensure reduction of part. cross sections within formation time + sigma(ii-2)=sigfac*sigma(ii-2) + + + 10 continue ! end of exit channel loop + +c unitarize partial cross sections (rescale sum to match the total cross section) + call normit (sigma,isigline) + +c select partial cross section ii + call getbran(sigma,0,maxpsig,sigsum,1,nCh,ii) + + if(sigsum.lt.1d-10)then + write(6,*)'***(W) scatter: ', + , 'no entry found for fin. state -> forced elastic scat. ', + , 'particles:line=',isigline,'ecm=',sqrts + write(6,*)' collision of : ', + & ityp1,iso31,fmass(ind1), + & ityp2,iso32,fmass(ind2) + write(6,*)' sigma=',sigma,ii +c force elastic scattering + sigpart=sigma(0) + iline=13 + else + sigpart=sigma(ii) ! partial cross section + iline=SigmaLN(ii+2,1,isigline) ! <- correct! ii has been redefined + end if + endif +cccc end of scatter/decay if + + call file15out(ind1,ind2,sqrts,ssigtot,sigpart) + +c save old particle information in case of pauli blocking +c or rejection due to energy non-conservation + call saveinfo(ind1,1) + call saveinfo(ind2,2) + +c... prepare exit channel + call scatprep(ind1,ind2,sqrts,sigpart) + + lambda=1.0d0 + call prescale(lambda) + + call scatfinal(colldens) + +c output to collision file + call f15outch(colldens) + call osc99_coll + +c write output to decay file + if(ind2.eq.0) call file16write +c in case of ctoption(13).ne.0 more output is written with the next call + call f16outch + + return + end + +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + subroutine scatprep(in1,in2,sqrts,sigpart) +c +c Revision : 1.0 +c +cinput ind1 : index of ingoing particle 1 +cinput ind2 : index of ingoing particle 2 +cinput sqrts : $sqrt{s}$ of collision +cinput sigpart: partial cross section for process +c +c {\tt scatprep, prescale} and {\tt scatfinal} handle the collision/decay +c kinematics and the book-keeping of the global particle vectors. +c In {\tt scatprep} the exit channel is generated via a call to +c {\tt make22}, the information is stored in common blocks of the +c {\tt newpart.f} file. Furthermore the new particle order including +c new slots for the exit channel are generated in {\tt scatprep} +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + include 'coms.f' + include 'options.f' + include 'comres.f' + include 'newpart.f' + + integer i,ind1,ind2,k,in1,in2 + integer itmp(mprt),ipmp(mprt) + real*8 sqrts,sigpart + real*8 phi1,phi2 + real*8 pzi1,pzi2,pxi1,pxi2,pyi1,pyi2 + real*8 rstringx(2),rstringy(2),rstringz(2),tstring(2),tformold(2) + real*8 rpott(2),rpotx(2),rpoty(2),rpotz(2) + real*8 th,rdum, ctheta1 + integer bar,nb1,nb2,nm1,nm2,meslist2(mprt),strid1,strid2 + integer barlist1(mprt),barlist2(mprt),meslist1(mprt) + logical dnscall + +c functions: + + real*8 pcms + common /scatcomr/rstringx,rstringy,rstringz,tstring, + & rpott,rpotx,rpoty,rpotz, + & pzi1,pzi2,pxi1,pxi2,pyi1,pyi2, + & ctheta1,phi1,th,phi2,tformold + common /scatcomi/itmp,ipmp,ind1,ind2,nb1,nb2,strid1,strid2, + & bar,nm1,nm2 + common /scatcoml/dnscall +ctp060202 to avoid warnings with gfortran compilation + logical ctp060202 + ctp060202=.false. + if(ctp060202)write(*,*)sigpart +ctp060202 end + +c call to paulibl for baryon-density + dnscall=CTOption(39).ne.0 + + +c reset some pointer arrays + do 10 i=1,mprt + itmp(i)=0 + ipmp(i)=0 + barlist1(i)=0 + barlist2(i)=0 + meslist1(i)=0 + 10 continue + + ind1=in1 + ind2=in2 + strid1=0 + strid2=0 + +c reset xtotfacs + if(tform(ind1).le.acttime) xtotfac(ind1)=1.d0 + if(ind2.gt.0) then + if(tform(ind2).le.acttime) xtotfac(ind2)=1.d0 + endif + +c 1. determine mass, ityp's, iso3's of outgoing channel +c + if(ind2.ne.0) then ! scattering/annihilation + call make22(iline,sqrts, + & ityp(ind1),iso3(ind1),fmass(ind1),xtotfac(ind1), + & ityp(ind2),iso3(ind2),fmass(ind2),xtotfac(ind2)) + + + elseif(ind2.eq.0) then ! decay + call make22(iline,sqrts, + & ityp(ind1),iso3(ind1),fmass(ind1),xtotfac(ind1), + & 0,0,0d0,1d0) + endif + + +c set here the true nexit (number of particles in the exit channel): + nexit=nstring1+nstring2 + + +c +c 2a). annihilation/soft resonance production: store properties +c + if(nstring2.eq.0) then +c store average time and position of particles (only one part/string coming out...) + tstring(1)=(r0(ind1)+r0(ind2))/2. + rstringx(1)=(rx(ind1)+rx(ind2))/2. + rstringy(1)=(ry(ind1)+ry(ind2))/2. + rstringz(1)=(rz(ind1)+rz(ind2))/2. +c do the same for the MD trajectories + rpott(1)=(r0_t(ind1)+r0_t(ind2))/2. + rpotx(1)=(rx_t(ind1)+rx_t(ind2))/2. + rpoty(1)=(ry_t(ind1)+ry_t(ind2))/2. + rpotz(1)=(rz_t(ind1)+rz_t(ind2))/2. + + pnnout=pnn + + +c store the incoming momenta for further use before the slots get erased/replaced +c by outgoing particles + pxi1=px(ind1) + pxi2=px(ind2) + pyi1=py(ind1) + pyi2=py(ind2) + pzi1=pz(ind1) + pzi2=pz(ind2) + +c store old formation times + tformold(1)=max(tform(ind1),tform(ind2)) + tformold(2)=max(tform(ind1),tform(ind2)) +c two leading hadrons form s-channel -> the larger reduction factor +c of the incoming hadrons is maintained: + xtotfacold(1)=max(xtotfac(ind1),xtotfac(ind2)) + xtotfacold(2)=max(xtotfac(ind1),xtotfac(ind2)) + else + +c 2b) 1. scattering/decay/strings: store both locations for later use +c store time and position of both incoming particles + tstring(1)=r0(ind1) + rstringx(1)=rx(ind1) + rstringy(1)=ry(ind1) + rstringz(1)=rz(ind1) +c likewise for the MD trajectory arrays + rpott(1)=r0_t(ind1) + rpotx(1)=rx_t(ind1) + rpoty(1)=ry_t(ind1) + rpotz(1)=rz_t(ind1) + +c store old formation time and reduction factor + tformold(1)=tform(ind1) + xtotfacold(1)=xtotfac(ind1) + + if(ind2.eq.0) then !decay +c likewise for particles 2,3,4... + tstring(2)=r0(ind1) + rstringx(2)=rx(ind1) + rstringy(2)=ry(ind1) + rstringz(2)=rz(ind1) + rpott(2)=r0_t(ind1) + rpotx(2)=rx_t(ind1) + rpoty(2)=ry_t(ind1) + rpotz(2)=rz_t(ind1) + + tformold(2)=tform(ind1) + xtotfacold(2)=xtotfac(ind1) + + else + tstring(2)=r0(ind2) + rstringx(2)=rx(ind2) + rstringy(2)=ry(ind2) + rstringz(2)=rz(ind2) + + rpott(2)=r0_t(ind2) + rpotx(2)=rx_t(ind2) + rpoty(2)=ry_t(ind2) + rpotz(2)=rz_t(ind2) + + tformold(2)=tform(ind2) + xtotfacold(2)=xtotfac(ind2) + + endif +c +c 2b) 2. get relative momentum in 2 particle cms (only for ang. distrib.!) +c + if(iline.gt.0) then + pnnout=pcms(sqrts,mstring(1),mstring(2)) + endif + + endif ! nstring2.eq.0 +c +c 2b) 3. get angular distribution +c + + if (ind2.ne.0) then + call angdisnew(sqrts,fmass(ind1),fmass(ind2),iline,ctheta1,phi1) + else + call angdisnew(sqrts,fmass(ind1),0.0d0,iline,ctheta1,phi1) + end if + + +c for CTOption(2)<>0 phi1=0 and 2-part. scattering is in the scattering plane + if(ind2.ne.0.and.CTOption(2).ne.0) then + phi1=0.d0 + endif + +c get angles between two particle CMS and computational frame + call getang(pxnn,pynn,pznn,th,phi2,rdum) + +c option for pure forward streaming + if(CTOption(14).ne.0)then + ctheta1=1d0 + th=0d0 + end if +c +c 3. generate slots for new particles +c +c count baryons AND anti-baryons in old slots (NOT net-baryons!!) + bar=0 + if(abs(ityp(ind1)).le.maxbar)then + bar=bar+1 + endif +c +cccc in case of baryon-boson scattering, inew(1) contains the baryon, +cccc otherwise it does not matter +c + if(ind2.ne.0) then + if(abs(ityp(ind2)).le.maxbar) then + bar=bar+1 + endif + if(abs(ityp(ind2)).le.maxbar.and. + & abs(ityp(ind1)).ge.minmes) then + inew(1)=ind2 + inew(2)=ind1 + else + inew(1)=ind1 + inew(2)=ind2 + endif + else +cccc decay: must create a second slot + inew(1)=ind1 +c increment meson counter + nmes=nmes+1 +c set new slot number + inew(2)=nbar+nmes +c create the slot + call addpart(inew(2)) +c this is needed for delpart (to esure correct counters): + ityp(inew(2))=999 +c three or four body decays + if(nexit.gt.2) then + do 91 i=3,nexit + nmes=nmes+1 + inew(i)=nbar+nmes + call addpart(inew(i)) + ityp(inew(i))=999 + 91 continue + endif + endif + +cccc soft resonance production (second slot must be deleted) + if(nexit.eq.1) then +c the smaller index automatically belongs to a baryon if there was one + inew(1)=min0(ind1,ind2) +c get index to be deleted + inew(2)=max0(ind1,ind2) +c delete second slot + call delpart(inew(2)) + endif + +c generate sorting-order for new particles: +c 1. leading baryon of particle/string 1 +c 2. leading baryon of particle/string 2 +c 3. all other baryons of particle/string 1 +c 4. all other baryons of particle/string 2 +c 5. all mesons of particle/string 1 +c 6. all mesons of particle/string 2 +c the itypnew-indices are stored into the itmp-array +c the location-index (do the new particles "belong" to incident particle 1 or 2) +c is stored in the ipmp-array + + nb1=0 ! number of baryons in string 1 + nb2=0 ! number of baryons in string 2 + nm1=0 ! number of mesons in string 1 + nm2=0 ! number of mesons in string 2 +c now get the number of baryons and mesons and their ityps from string/particle 1 + call instring(1,nstring1,nb1,nm1,barlist1,meslist1) + if(nstring2.ne.0) +c likewise from string/particle 2 + & call instring(nstring1+1,nexit,nb2,nm2,barlist2,meslist2) + +c now really generate the above described sorting-order + if( (bar.eq.0) + & .or.(bar.eq.1.and.nb1.gt.0) + & .or.(bar.eq.2.and.nb1.gt.0.and.nb2.eq.0)) then +c loop over baryons in string/particle 1 + do 381 i=1,nb1 + itmp(i)=barlist1(i) + ipmp(i)=1 + 381 continue +c loop over baryons in string/particle 2 + do 382 i=1,nb2 + itmp(nb1+i)=barlist2(i) + ipmp(nb1+i)=2 + 382 continue + elseif((bar.eq.1.and.nb2.gt.0.and.nb1.eq.0) + & .or.(bar.eq.2.and.nb2.gt.0.and.nb1.eq.0)) then +c loop over baryons in string/particle 2 + do 391 i=1,nb2 + itmp(i)=barlist2(i) + ipmp(i)=2 + 391 continue + elseif(bar.eq.2.and.nb1.gt.0.and.nb2.gt.0) then + itmp(1)=barlist1(1) + ipmp(1)=1 + itmp(2)=barlist2(1) + ipmp(2)=2 +c loop over baryons in string/particle 1 + do 371 i=2,nb1 + itmp(1+i)=barlist1(i) + ipmp(1+i)=1 + 371 continue +c loop over baryons in string/particle 2 + do 372 i=2,nb2 + itmp(nb1+i)=barlist2(i) + ipmp(nb1+i)=2 + 372 continue + endif +c loop over mesons in string/particle 1 + do 383 i=1,nm1 + itmp(nb1+nb2+i)=meslist1(i) + ipmp(nb1+nb2+i)=1 + 383 continue +c loop over mesons in string/particle 2 + do 384 i=1,nm2 + itmp(nb1+nb2+nm1+i)=meslist2(i) + ipmp(nb1+nb2+nm1+i)=2 + 384 continue + + +c in case of annihilation without baryon production +c or if a baryon-antibaryon pair is created via a meson-meson collision, +c delete old slots +c +c note: this sequence is needed to keep all baryons at the top +c of the particle table. However, it destroys distinctive +c projectile/target areas in the particle arrays. +c + + if((bar.eq.2.and.(nb1+nb2).eq.0) + & .or. + & (bar.eq.0.and.(nb1+nb2).gt.0) + & ) then + call delpart(inew(1)) + call delpart(inew(2)) + inew(1)=0 + inew(2)=0 + +c store average time and position of particles + tstring(1)=(r0(ind1)+r0(ind2))/2. + rstringx(1)=(rx(ind1)+rx(ind2))/2. + rstringy(1)=(ry(ind1)+ry(ind2))/2. + rstringz(1)=(rz(ind1)+rz(ind2))/2. + + tstring(2)=tstring(1) + rstringx(2)=rstringx(1) + rstringy(2)=rstringy(1) + rstringz(2)=rstringz(1) + +c do likewise for MD trajectories + rpott(1)=(r0_t(ind1)+r0_t(ind2))/2. + rpotx(1)=(rx_t(ind1)+rx_t(ind2))/2. + rpoty(1)=(ry_t(ind1)+ry_t(ind2))/2. + rpotz(1)=(rz_t(ind1)+rz_t(ind2))/2. + rpott(2)=rpott(1) + rpotx(2)=rpotx(1) + rpoty(2)=rpoty(1) + rpotz(2)=rpotz(1) + +c in case of a meson-string with baryon-antibaryon creation +c the meson-slot must be deleted + elseif(bar.eq.1.and.(nb1+nb2).gt.1) then + call delpart(inew(2)) + inew(2)=0 + endif + +c now create new slots: + do 307 i=1,nexit + if(inew(i).lt.1) then +c the new particle ID is stored in itypnew + if(iabs(itypnew(itmp(i))).le.maxbar) then +c the particle is a baryon + do 385 k=1,i +c make sure that mesons in the inew array are shifted upwards + if(inew(k).gt.nbar)inew(k)=inew(k)+1 + 385 continue +c increment baryon counter + nbar=nbar+1 +c this is the new particle slot + inew(i)=nbar + elseif(iabs(itypnew(itmp(i))).ge.minmes) then +c the particle is a meson + nmes=nmes+1 + inew(i)=nbar+nmes + endif +c create the slot + call addpart(inew(i)) + endif + 307 continue + + return + end + +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine prescale(lambda) +c +c Revision : 1.0 +c +cinput lambda : scaling factor for momenta of outgoing particles +c +c {\tt scatprep, prescale} and {\tt scatfinal} handle the collision/decay +c kinematics and the book-keeping of the global particle vectors. +c In {\tt prescale} the actual kinematics for the exit-channel, including +c a call to {\tt angdis} for the angular distribution and the transformation +c from the two particle restframe to the computational frame is being +c performed. Momenta and locations of exit channel particles are written +c to the global particle vectors. \\ +c The scaling factor {\tt lambda} is needed to ensure global energy conservation +c in the case of momentum dependent interactions (MDI). In that case {\tt prescale} +c can be called several succesive times with different values of {\tt lambda} +c to minimize $E_{tot,in} - E_{tot,out}$. +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + implicit none + include 'coms.f' + include 'options.f' + include 'newpart.f' + + integer i,j,itmp(mprt),ipmp(mprt),ind1,ind2,nb1,nb2 + real*8 lambda,th,phi2,ctheta1,phi1,theta3,phi3,pabs + real*8 pzi1,pzi2,pxi1,pxi2,pyi1,pyi2 + real*8 rstringx(2),rstringy(2),rstringz(2),tstring(2) + real*8 rpott(2),rpotx(2),rpoty(2),rpotz(2) + real*8 tauf(mprt),tformold(2) + integer getspin,strid1,strid2,bar,nm1,nm2 + + common /scatcomr/rstringx,rstringy,rstringz,tstring, + & rpott,rpotx,rpoty,rpotz, + & pzi1,pzi2,pxi1,pxi2,pyi1,pyi2, + & ctheta1,phi1,th,phi2,tformold + common /scatcomi/itmp,ipmp,ind1,ind2,nb1,nb2,strid1,strid2, + & bar,nm1,nm2 + + + if(nexit.eq.1) then ! soft resonance production + +c new momenta are stored in pnew + pnew(1,1)=lambda*(pxi1+pxi2) + pnew(2,1)=lambda*(pyi1+pyi2) + pnew(3,1)=lambda*(pzi1+pzi2) +c this is the energy + pnew(4,1)=dsqrt(pnew(5,1)**2+ + & pnew(1,1)**2+pnew(2,1)**2+pnew(3,1)**2) +c formation time + tauf(1)=0.d0 + else ! scattering/decay + do 205 j=1,nexit +c compute formation time (as a eigentime) + tauf(j)=xnew(4,j)*pnew(5,j)/pnew(4,j) + +c rescale momenta of particles + call getang(pnew(1,j),pnew(2,j),pnew(3,j),theta3,phi3,pabs) + pabs=lambda*pabs + call putang(pnew(1,j),pnew(2,j),pnew(3,j),theta3,phi3,pabs) + + +c check for forward time-delay +c in case of delay the momenta are already in the comp. frame + if(.not.(CTOption(34).eq.2.and.iline.eq.20.and. + & ityptd(1,pslot(1)).ne.0)) then + +c rotate in the from z-axis to th&phi given by angdis + call rotbos(dacos(ctheta1),phi1,0d0,0d0,0d0, + & pnew(1,j),pnew(2,j),pnew(3,j),pnew(4,j)) + +c rotate from the NN to the comp. sys. and +c transform particles to computational system + +c decays should not be rotated + if (iline.eq.20) then + th = 0.d0 + phi2 = 0.d0 + end if + + call rotbos(th,phi2,betax,betay,betaz, + & pnew(1,j),pnew(2,j),pnew(3,j),pnew(4,j)) + + endif +c end of delay-if + + + 205 continue + endif + +c write coordinates for energy-check and pauli-blocking +c correct particle/string-locations from relative to absolute + + do 215 i=1,nexit +c write locations to global arrays +c the ipmp values determine wether the new particle belongs to incoming slot 1 or 2 + r0(inew(i))=tstring(ipmp(i)) + rx(inew(i))=rstringx(ipmp(i)) + ry(inew(i))=rstringy(ipmp(i)) + rz(inew(i))=rstringz(ipmp(i)) +cpot +c likewise for MD trajectories + r0_t(inew(i))=rpott(ipmp(i)) + rx_t(inew(i))=rpotx(ipmp(i)) + ry_t(inew(i))=rpoty(ipmp(i)) + rz_t(inew(i))=rpotz(ipmp(i)) + +c write momenta to global arrays + p0(inew(i))=pnew(4,itmp(i)) + px(inew(i))=pnew(1,itmp(i)) + py(inew(i))=pnew(2,itmp(i)) + pz(inew(i))=pnew(3,itmp(i)) + + +c store formation time and leading hadron + if(pnew(5,itmp(i)).gt.0d0)then + tform(inew(i))=tstring(1)+tauf(itmp(i))* + & pnew(4,itmp(i))/pnew(5,itmp(i)) + else + tform(inew(i))=tstring(ipmp(i)) + endif + +c cross section reduction factor and string ID + xtotfac(inew(i))=leadfac(itmp(i)) + strid(inew(i))=sidnew(itmp(i)) + +c additional reduction of the leading hadrons' cross section +c in case the incoming hadron x-sec was already reduced +c otherwise an elastic scattering would erase formation time... + if(xtotfacold(ipmp(i)).lt.1d0) then + xtotfac(inew(i))=xtotfacold(ipmp(i))*xtotfac(inew(i)) + endif + if(tform(inew(i)).lt.tformold(ipmp(i)) + & .and.xtotfac(inew(i)).gt.0) then + tform(inew(i))=tformold(ipmp(i)) + endif + + +c store the respective string-ids in strid1 and strid2 + if(ipmp(i).eq.1.and.strid(inew(i)).ne.0) then + strid1=strid(inew(i)) + elseif(ipmp(i).eq.2.and.strid(inew(i)).ne.0) then + strid2=strid(inew(i)) + endif + +c write mass, ID, I3 and spin to global arrays + fmass(inew(i))=pnew(5,itmp(i)) + ityp(inew(i))=itypnew(itmp(i)) + iso3(inew(i))=i3new(itmp(i)) + spin(inew(i))=getspin(itypnew(itmp(i)),-1) + + 215 continue + +c set lstcoll: +c lstcoll relates the outgoing particles of this scattering/decay interaction +c to each other - it is used to prevent them from directly interacting again +c with each other because this would be unphysical. + if(ind2.eq.0) then + lstcoll(inew(1))=ind1 + else + lstcoll(inew(1))=inew(2) + endif + if(nexit.gt.1) lstcoll(inew(2))=inew(1) + + do 216 i=1,nexit +c in case of strings assign string-id's to lstcoll of leading hadrons +c instead of collision-partner index +c on string id's can be can be distinguished from normal indices +c by an offset of NMAX+1 +c +c case 1: part.1 is excited to string + if(nstring1.gt.1.and.nstring2.eq.1) then + if(ipmp(i).eq.2) then + lstcoll(inew(i))=nmax+strid1+1 + elseif(ipmp(i).eq.1) then + if(bar.eq.2.and.nb1.gt.0.and.nb2.gt.0) then + lstcoll(inew(i))=inew(2) + else + lstcoll(inew(i))=inew(nb1+nb2+nm1+1) + endif + endif +c case 2: part.2 is excited to string + elseif(nstring1.eq.1.and.nstring2.gt.1) then + if(ipmp(i).eq.1) then + lstcoll(inew(i))=nmax+strid2+1 + elseif(ipmp(i).eq.2) then + lstcoll(inew(i))=inew(1) + endif +c case 3: two strings + elseif(nstring1.gt.1.and.nstring2.gt.1) then + if(ipmp(i).eq.1) then + lstcoll(inew(i))=nmax+strid2+1 + elseif(ipmp(i).eq.2) then + lstcoll(inew(i))=nmax+strid1+1 + endif +c case 4: one (mesonic) string + elseif(nstring1.gt.1.and.nstring2.eq.0) then + lstcoll(inew(i))=nmax+strid1+1 + endif + + 216 continue + + return + end +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine scatFinal(colldens) +c +c Revision : 1.0 +c +coutput colldens : baryon density at point of interaction +c +c {\tt scatprep, prescale} and {\tt scatfinal} handle the collision/decay +c kinematics and the book-keeping of the global particle vectors. +c In {\tt scatfinal} the interaction is checked for Pauli-blocking and all +c particle {\em quantum numbers} which so far have not been set are written +c to the global arrays. Some collision counters are incremented here, too. +c +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + include 'coms.f' + include 'comres.f' + include 'newpart.f' + include 'freezeout.f' + include 'options.f' + + integer i,ind1,ind2,itmp(mprt),ipmp(mprt),nb1,nb2,j + integer ikill1,ikill2,strid1,strid2,bar,nm1,nm2 + integer iloffset + real*8 colldens + logical dnscall,dnsdum + +c functions: + integer fchg + real*8 dectim + logical paulibl + + common /scatcomi/itmp,ipmp,ind1,ind2,nb1,nb2,strid1,strid2, + & bar,nm1,nm2 + common /scatcoml/dnscall + +c check pauli-blocking (only for nucleons and delta(1232) +c loop over all baryons in exit-channel + do 306 i=1,nb1+nb2 + if(itypnew(itmp(i)).eq.nucleon) then + dnscall=.false. + ikill1=0 + ikill2=0 +c call to Pauli-Blocker + if(paulibl(inew(i),colldens)) then +c pauli-blocked collision, restore information and return + +c first delete unnecessary slots + if(nexit.gt.2) then + do 317 j=3,nexit + call delpart(inew(j)) + 317 continue + endif + +c in case of blocked decay, delete second entry + if(ind2.eq.0) then + call delpart(inew(2)) +c only delete/create slots if something more than a mere +c swapping has happened + elseif(.not.(((inew(1).eq.ind1).or.(inew(1).eq.ind2)) + & .and.((inew(2).eq.ind1).or.(inew(2).eq.ind2)))) + & then + ikill1=max0(inew(1),inew(2)) + ikill2=min0(inew(1),inew(2)) + call delpart(ikill1) + if(ikill2.gt.0) call delpart(ikill2) + call addpart(ind1) + if(ind2.gt.0) call addpart(ind2) + endif +c restore old contents of slots ind1 and ind2 + call saveinfo(ind1,-1) + call saveinfo(ind2,-2) +c in case of blocked decay, sample new decay time + if(ind2.eq.0) then + dectime(ind1)=dectim(ind1,iline)+acttime + endif +c restore frozen fermi state if necessary + if (CTOption(30).eq.1) then + call savefermi(ind1,ind1,peq1) + call savefermi(ind2,ind2,peq2) + endif +c set lstcoll + if(ind2.ne.0) then + lstcoll(ind1)=ind2 + lstcoll(ind2)=ind1 + else + lstcoll(ind1)=ind1 + endif + +c set baryon and meson counters + if(ikill1.ne.0) then + if(abs(ityp(ind1)).lt.minmes) then + nbar=nbar+1 + else + nmes=nmes+1 + endif + endif + if(ind2.gt.0.and.ikill2.ne.0) then + if(abs(ityp(ind2)).lt.minmes) then + nbar=nbar+1 + else + nmes=nmes+1 + endif + endif + +c increment blocking counter + NBlColl=NBlColl+1 +c set number of particles in exit-channel to zero + nexit=0 + return + endif + endif + 306 continue + +c the collision was not blocked, proceed... + +c 4. rewrite arrays, clear entries etc. +c fill the rest of the slot + +c in case the Pauli-Blocker was not called, do it now in order to +c get the baryon density at the interaction point, colldens + if(dnscall) dnsdum=paulibl(inew(1),colldens) + +c write rest of the quantum numbers to global vectors + do 312 i=1,nexit +c number of collisions + ncoll(inew(i))=ncoll(inew(i))+1 +c charge + charge(inew(i))=fchg(iso3(inew(i)),ityp(inew(i))) +c time of decay + dectime(inew(i))=dectim(inew(i),iline)+tform(inew(i)) +c last process the particle was involved in + if ( (iline.ne.13).and.(iline.ne.17).and.(iline.ne.19).and. + $ (iline.ne.22).and.(iline.ne.26).and.(iline.ne.38)) then + if (ind2.gt.0) then + iloffset=0 + if ( (iline.eq.27).or.(iline.eq.28) ) then + if ( (CTOption(41).gt.1) ) then + if ( (abs(itypt(1)).gt.100).and. + $ (abs(itypt(2)).gt.100) ) then + iloffset=20 + endif + if ( (itypt(1).eq.ityp(inew(i))).and. + $ (iso3t(1).eq.iso3(inew(i))) ) then + origin(inew(i))=origint(1)+100 + uid(inew(i))=uidt(1) + elseif ( (itypt(2).eq.ityp(inew(i))).and. + $ (iso3t(2).eq.iso3(inew(i))) ) then + origin(inew(i))=origint(2)+100 + uid(inew(i))=uidt(2) + else + origin(inew(i))=iline+iloffset + $ +1000*(iabs(itypt(1))+1000*iabs(itypt(2))) + endif + else + origin(inew(i))=iline+iloffset + $ +1000*(iabs(itypt(1))+1000*iabs(itypt(2))) + endif + else + origin(inew(i))=iline + $ +1000*(iabs(itypt(1))+1000*iabs(itypt(2))) + endif + else + origin(inew(i))=iline + $ +1000*(iabs(itypt(1))) + endif +c unique ID tag + uid_cnt=uid_cnt+1 + uid(inew(i))=uid_cnt + else + origin(inew(i))=origint(i)+100 + uid(inew(i))=uidt(i) + if (ityp(inew(1)).ne.itypt(1)) then + if (nexit.ne.2) then + write(6,*) "fatal error in scatter: nexit.ne.2!" + stop + endif + origin(inew(i))=origint(3-i)+100 + uid(inew(i))=uidt(3-i) + endif + endif +c freeze-out coordinates + frr0(inew(i))=r0(inew(i)) + frrx(inew(i))=rx(inew(i)) + frry(inew(i))=ry(inew(i)) + frrz(inew(i))=rz(inew(i)) + frp0(inew(i))=p0(inew(i)) + frpx(inew(i))=px(inew(i)) + frpy(inew(i))=py(inew(i)) + frpz(inew(i))=pz(inew(i)) + +c forward time-delay + if(CTOption(34).eq.2.and.(iline.eq.36.or.iline.eq.37)) then + do 307 j=1,2 + p0td(j,inew(i))=pold(4,j) + pxtd(j,inew(i))=pold(1,j) + pytd(j,inew(i))=pold(2,j) + pztd(j,inew(i))=pold(3,j) + fmasstd(j,inew(i))=pold(5,j) + ityptd(j,inew(i))=itypold(j) + iso3td(j,inew(i))=iso3old(j) + 307 continue + else + do 308 j=1,2 + p0td(j,inew(i))=0.d0 + pxtd(j,inew(i))=0.d0 + pytd(j,inew(i))=0.d0 + pztd(j,inew(i))=0.d0 + fmasstd(j,inew(i))=0.d0 + ityptd(j,inew(i))=0 + iso3td(j,inew(i))=0 + 308 continue + endif + +c in a N particle exit channel the produced resonance +c either comes from BB->B* ? ? or a String -> B* ? ? + if(ityp(inew(i)).ge.minres.and.ityp(inew(i)).le.maxres) then + if(iline.ne.20.or.iline.ne.10) then +c B B -> ? ? + NHardRes=NHardRes+1 + elseif(iline.eq.20) then + NDecRes=NDecRes+1 + elseif(iline.eq.10) then + NSoftRes=NSoftRes+1 + endif + endif + 312 continue +c other counters for B-strings/M-strings could be added here... + if(iline.eq.13.or.iline.eq.17 + & .or.iline.eq.19.or.iline.eq.26) then + NElColl=NElColl+1 + endif + + return + end + +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + integer function collclass(ityp1,iso31,ityp2,iso32) +c +c Revision : 1.0 +c +c This function links the ingoing collision channel to the +c line number of the sigmaLN array in {\tt blockres.f} in which the +c types of cross section parametrizations to perform are defined. +c +cinput ityp1 : ityp of particle 1 +cinput iso31 : $I_3$ of particle 1 +cinput ityp2 : ityp of particle 2 +cinput iso32 : $I_3$ of particle 2 +c +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + implicit none + include 'comres.f' + include 'options.f' + integer ityp1,ityp2,iso31,iso32,i1,i2,iz1,iz2 + real*8 d1,d2 + +c copy to new variables MUST be done because of swpizm +c (otherwise scatter will crash due to swapped particle properties) + i1=iabs(ityp1) + i2=iabs(ityp2) + iz1=iso31 + iz2=iso32 + d1=0.d0 + d2=0.d0 + + if(i1.lt.i2)call swpizm(i1,iz1,d1,i2,iz2,d2) + +c baryon-antibaryon + if(i1.le.maxbar.and.i2.le.maxbar.and.ityp1*ityp2.lt.0) then + collclass=11 + if(CTOption(19).ne.0)collclass=0 + return + end if + +c nucleon nucleon + if(i1.eq.nucleon.and.i2.eq.nucleon) then + if(iz1.eq.iz2) then +c proton proton or neutron-neutron + collclass=2 + return + else +c proton neutron + collclass=1 + return + endif + elseif(i1.eq.mindel.and.i2.eq.nucleon) then +c Delta(1232) nucleon + collclass=3 + return + elseif(i1.gt.minnuc.and.i1.le.maxnuc.and. + & i2.eq.nucleon) then +c N+ nucleon + collclass=4 + return + elseif(i1.ge.mindel.and. + & i1.le.maxdel.and. + & i2.eq.nucleon) then +c D* nucleon + collclass=5 + return + elseif(i1.eq.mindel.and.i2.eq.mindel) then +c Delta(1232)-Delta(1232) + collclass=6 + return + elseif(i1.eq.mindel.and. + & i2.gt.minnuc.and. + & i2.le.maxnuc) then +c Delta(1232)-N* + collclass=7 + return + elseif(i2.eq.mindel.and. + & i1.gt.mindel.and. + & i1.le.maxdel) then +c Delta(1232)-D* + collclass=8 + return + elseif(i1.ge.minmes.and.i2.le.maxbar) then +c Boson-Baryon + collclass=9 + return + elseif(i1.ge.minmes.and.i2.ge.minmes) then +c Boson-Boson + collclass=10 + return + elseif(i1.gt.minnuc.and. + & i1.le.maxdel.and. + & i2.gt.minnuc.and. + & i2.le.maxdel) then +c D*-D* or D*-N* or N*-N* + collclass=12 + return + elseif(i1.le.maxbar.and.i2.le.maxbar) then +c all remaining BB-collisions + collclass=13 + return + else +c class not defined (sets sigtot to zero) + write(*,*)'scatter: collclass of ',i1,i2,' not yet defined!' + collclass=0 + endif + return + end + + +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine getang(x,y,z,th,ph,r) +c +c gives spherical coordinates of cartesian 3-vector $(x,y,z)$ +c +c input : 3-vector x,y,z +c output: angles {\tt th}($\vartheta$), {\tt ph}($\varphi$) and radius {\tt r} +c +C####C##1#########2#########3#########4#########5#########6#########7## + implicit none + real*8 x,y,z,th,ph,cut,r + parameter (cut=1d-9) + if(abs(x).lt.cut.and.abs(y).lt.cut) then + ph=0d0 + else + ph=datan2(y,x) + endif + r=sqrt(x*x+y*y+z*z) + th=dacos(z/max(r,cut)) + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine putang(x,y,z,th,ph,r) +c +c creates 3-vector $(x,y,z)$ out of spherical coordinates +c input: angles {\tt th}($\vartheta$), {\tt ph}($\varphi$) and radius {\tt r} +c output: 3-vector x,y,z +C####C##1#########2#########3#########4#########5#########6#########7## + implicit none + real*8 x,y,z,th,ph,r + x=r*sin(th)*cos(ph) + y=r*sin(th)*sin(ph) + z=r*cos(th) + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + SUBROUTINE rotbos(THE,PHI,BEX,BEY,BEZ,p1,p2,p3,p4) +c +c INPUT: the,phi,bex,bey,bez,p +c OUTPUT: p +c 1)rotate 4-vector p according to the and phi 2/ boost 4-vector p +C####C##1#########2#########3#########4#########5#########6#########7## + implicit none + real*8 P(4),BEX,BEY,BEZ,GA,BEP,GABEP,rot(3,3),the,phi + real*8 p1,p2,p3,p4,bb2 + integer j + + + IF(THE**2+PHI**2.GT.1E-20) THEN +C...ROTATE + ROT(1,1)=COS(THE)*COS(PHI) + ROT(1,2)=-SIN(PHI) + ROT(1,3)=SIN(THE)*COS(PHI) + ROT(2,1)=COS(THE)*SIN(PHI) + ROT(2,2)=COS(PHI) + ROT(2,3)=SIN(THE)*SIN(PHI) + ROT(3,1)=-SIN(THE) + ROT(3,2)=0. + ROT(3,3)=COS(THE) + DO 108 J=1,3 + 108 P(J)=ROT(J,1)*P1+ROT(J,2)*P2+ROT(J,3)*P3 + p(4)=p4 + else + p(1)=p1 + p(2)=p2 + p(3)=p3 + p(4)=p4 + ENDIF + + bb2=BEX**2+BEY**2+BEZ**2 + IF(bb2.GT.1E-20) THEN +C...LORENTZ BOOST (TYPICALLY FROM REST TO MOMENTUM/ENERGY=BETA) + GA=1D0/DSQRT(1D0-bb2) + BEP=BEX*P(1)+BEY*P(2)+BEZ*P(3) + GABEP=GA*(GA*BEP/(1D0+GA)+P(4)) + P(1)=P(1)+GABEP*BEX + P(2)=P(2)+GABEP*BEY + P(3)=P(3)+GABEP*BEZ + P(4)=GA*(P(4)+BEP) + ENDIF + + p1=p(1) + p2=p(2) + p3=p(3) + p4=p(4) + + RETURN + END +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine instring(low,high,nb,nm,barlist,meslist) +c +c version: 1.0 +c +c this subroutine returns arrays with the indices of the baryons/mesons +c found in the itypnew-array of {\tt newpart.f} +c +cinput low: lower search boundary +cinput high: upper search boundary +c +coutput nb : number of baryons in range +coutput nm : number of mesons in range +coutput barlist: list of indices for baryons +coutput meslist: list of indices for mesons +ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + + include 'newpart.f' + include 'comres.f' + + integer i,low,high,nb,nm,barlist(mprt),meslist(mprt) + + nb=0 + nm=0 + + do 10 i=low,high + if(abs(itypnew(i)).le.maxbar) then + nb=nb+1 + barlist(nb)=i + else + nm=nm+1 + meslist(nm)=i + endif + 10 continue + return + end + +C####C##1#########2#########3#########4#########5#########6#########7## + subroutine leadhad(n1l,n2l,nbl) +c +cinput n1l : First index of this string in the newpart-arrays +cinput n2l : Last index of this string in the newpart-arrays +cinput nbl : Baryon number of string system, nbl=3 is e+e- +c +c output : via common-block {\tt newpart.f} +c +c This subroutine determines the position of the leading hadrons +c of a string fragmentation in the newpart-arrays and assigns the +c reduction factor for the total cross sections (for all non-leading +c hadrons this factor is zero, i.e. they have no cross-section during +c their formation time) +c +C####C##1#########2#########3#########4#########5#########6#########7## + + implicit none + include 'newpart.f' + include 'comres.f' + include 'coms.f' + integer n1l,n2l,nbl,ll + +c default: no leading hadron at all + do 1 ll=n1l,n2l + leadfac(ll)=0.d0 + 1 continue + +c no leading quarks in e+e- + if(nbl.eq.3) return + +c full x-section, if there is only one particle + if(n1l.eq.n2l)then + leadfac(n1l)=1.d0 + sidnew(n1l)=0 + return + endif + +c the last hadron contains always one leading quark + if(iabs(itypnew(n2l)).le.maxbar)then + leadfac(n2l)=0.33d0 + else + leadfac(n2l)=0.5d0 + endif +c baryonic string: look for the first (=leading) baryon + if(nbl.gt.0)then + do 10 ll=n1l,n2l + if(iabs(itypnew(ll)).le.maxbar)then + leadfac(ll)=0.66d0 + goto 20 + endif + 10 continue + 20 continue + else +c mesonic string: the first hadron contains one leading quark + if(iabs(itypnew(n1l)).le.maxbar)then + leadfac(n1l)=0.33d0 + else + leadfac(n1l)=0.5d0 + endif + endif + do 33 ll=n1l,n2l + if (leadfac(ll).gt.0d0) then + sidnew(ll)=strcount + else + sidnew(ll)=0 + endif + 33 continue + strcount=strcount + 1 + + return + end diff --git a/Processes/UrQMD/siglookup.f b/Processes/UrQMD/siglookup.f new file mode 100644 index 0000000000000000000000000000000000000000..cd45e5a3f8da28d406f4415751e88b26f855e0be --- /dev/null +++ b/Processes/UrQMD/siglookup.f @@ -0,0 +1,74 @@ +c $Id: siglookup.f,v 1.4 1999/01/18 09:57:15 ernst Exp $ +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC +C + real*8 function SIGLOOKUP(iline,sqrts) +c +c Revision : 1.0 +c +cinput iline : line\# for information in {\tt sigmainf} array +cinput sqrts : $\sqrt{s}$ of collision +c +c output : returns tabulated cross section value +c +c This function returns the cross section stored in line ISIGLINE of +c the SIGMAS array at the respective value of sqrt(s) (SQRTS) +c Optional scaling according to SIGMASCAL is performed. +C +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c + implicit none + + real*8 sqrts,xpt,x1,y1in,y2in,slin,tlow,tblstp,thigh + integer isigline,index,iline +c +c later, sigtab.f should only be included into main.f and all relevant tables +c should be accessed via common blocks + include 'comres.f' +c +c line for sigmas(line,*) array + isigline=sigmainf(iline,1) +c +c log of lowest sqrt(s) entry in the table + tlow=log(sigmascal(iline,2)) + +c +c exp(tblstp) is Delta(sqrts) for table + tblstp=sigmascal(iline,3) +c +c maximum log of sqrt(s) enty in the table + thigh=itblsz*tblstp+tlow +c +c table-lookup sequence (modified IQMD/RQMD) +c first generate x-coordinate from sqrt(s) for the table + XPT=LOG(sqrts) +c check if sqrt(s) is below lower boundary + IF(XPT.LT.TLOW) THEN + siglookup=0.d0 + return + END IF +c now get index (which is the column in sigtab) + INDEX=INT((XPT-TLOW)/TBLSTP) + 1 +c check if sqrt(s) is above upper boundary + IF(INDEX.GE.ITBLSZ) THEN +c also this solution is not clean... + INDEX=ITBLSZ-1 + xpt=thigh + END IF +C FIND SLOPES AND CROSSECTIONS +c now make a straighforward interpolation +c in the sigtab array +c bracket for sqrt(s) value (between X1 and XPT) + X1=(INDEX-1)*TBLSTP + TLOW +c sigmas(isigline,INDEX) is the c.s. array, the wanted c.s. is stored +c in line isigline + Y1IN=sigmas(isigline,INDEX) + Y2IN=sigmas(isigline,INDEX+1) +c get the slope + SLIN=(Y2IN-Y1IN)/TBLSTP +c get the cross section and store it in SIGLOOKUP + SIGLOOKUP=SLIN*(XPT-X1) + Y1IN +c scale the cross section + siglookup=sigmascal(iline,1)*siglookup + return + end diff --git a/Processes/UrQMD/string.f b/Processes/UrQMD/string.f new file mode 100644 index 0000000000000000000000000000000000000000..62edad89561432977c45d5457902fd24cfd3becc --- /dev/null +++ b/Processes/UrQMD/string.f @@ -0,0 +1,2078 @@ +c $Id: string.f,v 1.18 2003/05/02 11:06:56 weber Exp $ +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine stringdec(ityp,iz2,smass,part,ident2,npart) +c +cinput smass : Stringmass +cinput ityp : Particle ID +cinput iz2 : Isospin$_3\cdot 2$ +c +coutput part : 4-momenta, 4-position, masses (array) +coutput ident2 : ityp, iz2 (array) +coutput npart : number of outgoing particles +c +c This subroutine performs string fragmentation. +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit real*8 (a-h,o-z) + implicit integer (i-n) + + PARAMETER(MXPTCL=200) + COMMON/PARTCL/ PPTCL(9,MXPTCL),nptcl,IDENT(MXPTCL),IDCAY(MXPTCL) + + include 'comstr.f' + + dimension part(9,mxptcl) + dimension ident2(2,mxptcl) + + +c we call the translation routine + call ityp2id(ityp,iz2,ifa,ifb) + + goto 1 +cspl... string fragmentation called with quark id's and energy as arguments + entry qstring(ifanew,ifbnew,smass,part,ident2,npart) + ifa=ifanew + ifb=ifbnew + 1 continue + + + smem=smass +c here we call the fragmentation routine. the produced hadrons and their +c properties are returned via the pptcl- and ident-array in the common-block + call string(ifa,ifb,smass) +c here the array pptcl has been filled with nptcl entries (1->nptcl) +c now we translate to uqmd and shift the pptcl- and ident-info to the +c corresponding part- and ident2-arrays of the newpart-common-block: + npart=nptcl + do 2 i=1,nptcl + call id2ityp(ident(i),pptcl(5,i),itypout,iz2out) + ident2(1,i)=itypout + ident2(2,i)=iz2out + smem=smem-pptcl(4,i) + do 3 j=1,9 + part(j,i)=pptcl(j,i) + 3 continue + 2 continue +c check for energy conservation: +ctp060926 if(abs(smem).gt.1.0D-5)then +ctp060926 write(*,*)'! stringdec: energy difference=',smem +ctp060926 write(*,*)'ifa,ifb,smass=',ifa,ifb,smass +ctp060926 endif + return + + end + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine strini +c +c output : via common blocks +c +c {\tt strini} calculates mixing angles for the meson-multipletts +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit real*8 (a-h,o-z) + implicit integer (i-n) + + include 'options.f' + include 'comres.f' + include 'comstr.f' + real*8 m3 + real*8 massit + integer jit +c mixing angles of meson multiplets according to flavor SU(3) quark model: +cspl-0795 these parameters assign the pure u/ubar,d/dbar,s/sbar states +c (e.g. 110,220,330) to the physical particles according to the su(3) +c quark model. The flavor mixing angles are chosen according to quadratic +c Gell-Mann-Okubo mass formula (Review of Particle Properties, +c Phys. Rev D50 (1994) 1319). For the scalar mesons this formula is not +c applicable. We assume an ideal mixing angle (tan(theta)=1/sqrt(2)). +c +c pseudoscalar: theta=-10 deg +c vector : theta= 39 deg +c pseudovector: theta= 51 deg +c tensor : theta= 28 deg +c + real*8 mixang(njspin) +c ideal mixing angles assumed for the last three multiplets + data mixang/-10d0,39d0,35.3d0,51d0,28d0,35.3d0,35.3d0,35.3d0/ +c + + pi = 4d0*datan2(1d0,1d0) + +c calculate 'singlet shift probabilities', e.g. a 11 (u-ubar) state +c can be changed to a 22 (d-dbar) or 33 (s-sbar) state with a certain +c probability. THEN they can be identified with physical hadrons! + do 3 i=1,njspin + mixang(i)=mixang(i)/36d1*2d0*3.1416d0 + PMIX1S(1,i)=(dcos(mixang(i))/sqrt(6d0) + & -dsin(mixang(i))/sqrt(3d0))**2 + PMIX1S(2,i)=PMIX1S(1,i) + PMIX1S(3,i)=(-(dcos(mixang(i))*2d0/dsqrt(6d0)) + & -dsin(mixang(i))/dsqrt(3d0))**2 + PMIX2S(1,i)=0.5d0 + PMIX2S(2,i)=0.5d0 + PMIX2S(3,i)=1d0 + +ce calculate probabilities of the meson multipletts +ce according to parm=(spin degeneracy)/(average mass) *ctp(50 ff.) + parm(i)=0d0 + m3=0d0 + do 102 j=0,3 + itp=mlt2it(4*(i-1)+j+1) + m3=m3+massit(itp) + jpc=jit(itp)/2 +102 continue + parm(i)=parm(i)+(2*jpc+1)/m3*4*CTParam(49+i) + +c the mixing-angles are the same for 'string' and 'cluster': + do 2 k=1,3 + PMIX1C(k,i)=PMIX1S(k,i) + PMIX2C(k,i)=PMIX2S(k,i) +c write(6,*)'#',pmix1c(k,i) + 2 continue + 3 continue + + return + end + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + SUBROUTINE GAUSPT(PT0,SIGQT) +c +cinput sigqt : Width of Gaussian +c +coutput pt0 : transverse momentum +c +C generate pt with Gaussian +c distribution $\propto pt \exp(-pt^2/sigqt^2)$ +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + real*8 pt0,sigqt,rnd,ranf + + RND=ranf(0) + PT0=SIGQT*SQRT(-DLOG(1.d0-RND)) + RETURN + END + + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + SUBROUTINE FLAVOR(ID,IFL1,IFL2,IFL3,JSPIN) +c +cinput ID : quarkcode +c +coutput ifl1 : single quarks id +coutput ifl2 : single quarks id +coutput ifl3 : single quarks id +coutput jspin : spin id +c +C THIS SUBROUTINE UNPACKS THE IDENT CODE ID=+/-IJKL +c +C -MESONS: +C I=0, J<=K, +/- IS SIGN FOR J, +C ID=110 FOR PI0, ID=220 FOR ETA, ETC. +c +C -BARYONS: +C I<=J<=K IN GENERAL, +C J<I<K FOR SECOND STATE ANTISYMMETRIC IN (I,J), EG. L = 2130 +c +C -DIQUARKS: +C ID=+/-IJ00, I<J FOR DIQUARK COMPOSED OF I,J. +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit real*8 (a-h,o-z) + implicit integer (i-n) + + IDABS=IABS(ID) +c extract the single (anti-)quark ids from the hadron id: + I=IDABS/1000 + J=MOD(IDABS/100,10) + K=MOD(IDABS/10,10) + JSPIN=MOD(IDABS,10) +c diquarks: + IF(ID.NE.0.AND.MOD(ID,100).EQ.0) GO TO 300 +c quarks oder so: + IF(J.EQ.0) GO TO 200 +c mesonen: + IF(I.EQ.0) GO TO 100 + +C..BARYONS: +C..ONLY X,Y BARYONS ARE QQX, QQY, Q=U,D,S. + IFL1=ISIGN(I,ID) + IFL2=ISIGN(J,ID) + IFL3=ISIGN(K,ID) + RETURN +C MESONS +100 CONTINUE + IFL1=0 + IFL2=ISIGN(J,ID) + IFL3=ISIGN(K,-ID) + RETURN +200 CONTINUE + IFL1=0 + IFL2=0 + IFL3=0 + JSPIN=0 + return +300 IFL1=ISIGN(I,ID) + IFL2=ISIGN(J,ID) + IFL3=0 + JSPIN=0 + RETURN + END + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + SUBROUTINE STRING(IFL1,IFL2,AMSTR) +c +cinput amstr : stringmass +cinput ifl1 : leading (di)quark (along +Z) +cinput ifl2 : leading (di)quark +c +c output : produced particles via common block ({\tt pptcl}) +c +C Hadron production via string fragmentation. masses acc. to Breit +c Wigner distr., incl. production of mesonic and baryonic resonances +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit real*8 (a-h,o-z) + implicit integer (i-n) + + + COMMON/COMTRY/ NTRIES + PARAMETER(MXPTCL=200) + COMMON/PARTCL/ PPTCL(9,MXPTCL),nptcl,IDENT(MXPTCL),IDCAY(MXPTCL) + + include 'comstr.f' + + DIMENSION PX1L(2),PY1L(2),PX1(2),PY1(2),PMTS(2),W(2),IFL(2) + LOGICAL DIQBR,SPINT,BACK + DIMENSION VC(3) + DIMENSION PPTL(5,MXPTCL),PPTR(5,MXPTCL), + *IDENTL(MXPTCL),IDENTR(MXPTCL) + COMMON/KAPPA/ XAP + COMMON/COLRET/ LRET + LOGICAL LRET + COMMON/CONSTI/ CONSTI + LOGICAL CONSTI + + LOGICAL leading + + include 'options.f' + + IFLL=0 + PXL=0 + PYL=0 +c..strange quark and charm quark probabilities: + prbs=ctparam(6) + prbc=ctparam(7) +cspl the diquark-suppresion parameter is reduced for small +c string masses (finite size effect) see A. Jahns diploma thesis + if(amstr.le.2.8d0)then + pbars=0.d0 + elseif (amstr.le.5d0)then + pbars=((amstr-2.8d0)/2.2d0)**3*ctparam(8) + else + pbars=ctparam(8) + endif + +c..some parameters (see input.f) + dmas=ctparam(9) + dmass=ctparam(10) + pardbs=ctparam(25) + sigqts=ctparam(42) +C +C PRBS STRANGENESS SUPPRESSION PARAMETER +C PRBC CHARM SUPPRESSION PARAMETER + PU=1./(2.+PRBS+PRBC) +C + LRET=.FALSE. +C + NREP = 0 + DIQBR=.TRUE. + NFIX=0 + BACK=.TRUE. + +c.. here starts everything (if the string break up didn't work +c.. we start again at this point) + 100 I=NFIX + ilead=0 + NPR=0 + NPL=0 + NPTCL=NFIX +c.. nrep=number of tries to break string + NREP=NREP+1 + IF(NREP.LT.NTRIES) GO TO 102 + LRET=.TRUE. +ctp060926 write(*,*)'!! STRING: no fragmentation.' + return +102 CONTINUE + IFL(1)=IFL1 + IFL(2)=IFL2 + DO 110 J=1,2 + 110 W(J)=AMSTR + DO 120 J=1,2 + PX1L(J)=0. + PY1L(J)=0. + PX1(J)=0. + 120 PY1(J)=0. +C WILL THERE BE ONLY ONE BREAK OR NOT ? + SPINT=.TRUE. + KSPIN=1 + IF(MOD(IFL(1),100).EQ.0.AND.MOD(IFL(2),100).EQ.0) GOTO 131 + IDR=IDPARS(IFL(1),IFL(2),SPINT,KSPIN) + WEND=(AMASS(IDR)+DMAS)**2 + GO TO 151 +131 IFCN=1 + IF(ranf(0).GT.0.5) IFCN=2 + IFLC1=IFCN + IF(IFL(1).LT.0) IFLC1=-IFCN + IDR1=IDPARS(IFL(1),IFLC1,SPINT,KSPIN) + IDR2=IDPARS(IFL(2),-IFLC1,SPINT,KSPIN) + WEND=(AMASS(IDR1)+AMASS(IDR2)+DMAS)**2 +151 SPINT=.FALSE. + KSPIN=0 +c.. only one break goto 225 is the end of the fragmentation + IF(W(1)*W(2).LE.WEND) GO TO 225 + +c..the main iteration loop for the fragmentation: + 130 I=I+1 + IF(I.GT.MXPTCL) GO TO 9999 +C CHOOSE SIDE OF BREAK + JSIDE=INT(1.+2.*ranf(0)) + IF(JSIDE.EQ.1) NPR=NPR+1 + IF(JSIDE.EQ.2) NPL=NPL+1 + IF(NPR.GT.MXPTCL.OR.NPL.GT.MXPTCL) GO TO 9999 +C IS IFL(JSIDE) A QUARK OR A DIQUARK ? (di-quark-->150) + IF(MOD(IFL(JSIDE),100).EQ.0) GO TO 150 +C IFL(JSIDE) IS A QUARK +C NOW WE SELECT Q,QBAR PAIR OR QQ,QQBAR PAIR + DIQBR=.FALSE. + DRND=ranf(0) +c.. do a qq-qqbar pair with certain prob. + IF(DRND.LT.PBARS) GO TO 140 +C Q,QBAR PAIR + IFLN=ISIGN(IFLAV(PU,PRBS),-IFL(JSIDE)) + GO TO 200 +C QQ,QQBAR PAIR +140 IQ1=IFLAV(PU,PRBS) + IQ2=IFLAV(PU,PRBS) + +c.. no single-strange diquarks (us,ds)! +cblubb if(max0(iq1,iq2).eq.3.and.min0(iq1,iq2).lt.3)goto 140 +c.. suppr. double strange di-quarks(ss) with certain prob. (acc. to ctp 29) + if((IQ1.eq.3.and.IQ2.eq.3) + & .and.ranf(0).gt.CTParam(29))goto 140 + + IF(IQ1.LE.IQ2) GO TO 145 + ISWAP=IQ1 + IQ1=IQ2 + IQ2=ISWAP +145 IFQQ=1000*IQ1+100*IQ2 + IFLN=ISIGN(IFQQ,IFL(JSIDE)) + GO TO 200 +c..the di-quark part: +C IFL(JSIDE) IS A DIQUARK +C CAN DIQUARK BREAK OR NOT + 150 DRND=ranf(0) + IF(DRND.LE. PARDBS) GO TO 190 +C DIQUARK BREAK (prob. in PARDBS) + CALL FLAVOR(IFL(JSIDE),IFLD1,IFLD2,IFLD3,JSPIN) + IFLL=IFLD1 + IFL(JSIDE)=IFLD2 + DRND=ranf(0) + IF(DRND.GE.PARQLS) GO TO 160 + IFLL=IFLD2 + IFL(JSIDE)=IFLD1 + 160 DIQBR=.TRUE. +C LEADING QUARK TRANSVERSE MOMENTUM + CALL GAUSPT(PTL0,SIGQTS) + PHI=2.*PI*ranf(0) + PXL=PTL0*COS(PHI) + PYL=PTL0*SIN(PHI) + PX1L(JSIDE)=PX1(JSIDE) + PY1L(JSIDE)=PY1(JSIDE) + PX1(JSIDE)=-PXL + PY1(JSIDE)=-PYL +C Q,QBAR PAIR + IFLN=ISIGN(IFLAV(PU,PRBS),-IFL(JSIDE)) + GO TO 200 +C DIQUARK DOES NOT BREAK +C Q,QBAR PAIR + 190 IFLN=ISIGN(IFLAV(PU,PRBS),IFL(JSIDE)) + DIQBR=.FALSE. +C IDENT,MASS AND TRANSVERSE MOMENTUM OF PARTICLE + 200 IDENT(I)=IDPARS(IFL(JSIDE),IFLN,SPINT,KSPIN) + PPTCL(5,I)=AMASS(IDENT(I)) + SIGQTSN=SIGQTS + IF(MOD(IFLN,100).EQ.0) SIGQTSN=sigqts*ctparam(38) + if(iabs(ifln).eq.3.or.iabs(ifl(jside)).eq.3) + & sigqtsn=sigqts*ctparam(39) + CALL GAUSPT(PT2,SIGQTSN) +c no pt for leading hadron: + leading=.false. + if((JSIDE.EQ.1.and.NPR.eq.1).and. + & (abs(IDENT(I)).eq.1120 .or.abs(IDENT(I)).eq.1220) )then +c & (abs(IDENT(I)).ge.1110))then + leading=.true. +cblu pt2=pt2/2d0 + ilead=ilead+1 + endif + if((JSIDE.EQ.2.and.NPL.eq.1).and. + & (abs(IDENT(I)).eq.1120 .or.abs(IDENT(I)).eq.1220) )then +c & (abs(IDENT(I)).ge.1110))then + leading=.true. +cblu pt2=pt2/2d0 + ilead=ilead+1 + endif +c..transverse momentum choosen for the newly produced hadron + PHI=2.*PI*ranf(0) + PX2=PT2*COS(PHI) + PY2=PT2*SIN(PHI) + PPTCL(1,I)=PX1(JSIDE)+PX2 + PPTCL(2,I)=PY1(JSIDE)+PY2 +C GENERATE Z-momentum + PMTS(3-JSIDE)=AMASS(IABS(IFL(3-JSIDE)))**2 + PTS=PPTCL(1,I)**2+PPTCL(2,I)**2 + PMTS(JSIDE)=PPTCL(5,I)**2+PTS + IF(PMTS(JSIDE)+PMTS(3-JSIDE).GE.PARRS*W(1)*W(2)) GO TO 100 + ZMIN=PMTS(JSIDE)/(W(1)*W(2)) + ZMAX=1.-PMTS(3-JSIDE)/(W(1)*W(2)) + IF(ZMIN.GE.ZMAX) GO TO 100 +C..WARNING: VERY IMPORTANT THE ORDER OF IFL AND IFLN IN ZFRAGS +c.. fraction of momentum acc. to the fragmentation fct. + Z=ZFRAGS(IFL(JSIDE),IFLN,PTS,ZMIN,ZMAX,leading) + + PPTCL(3,I)=0.5*(Z*W(JSIDE)-PMTS(JSIDE)/ + *(Z*W(JSIDE)))*(-1.)**(JSIDE+1) + PPTCL(4,I)=0.5*(Z*W(JSIDE)+PMTS(JSIDE)/(Z*W(JSIDE))) + IDCAY(I)=0 + IF(.NOT.(JSIDE.EQ.1)) GO TO 282 + IDENTR(NPR)=IDENT(I) + PPTR(1,NPR)=PPTCL(1,I) + PPTR(2,NPR)=PPTCL(2,I) + PPTR(3,NPR)=PPTCL(3,I) + PPTR(4,NPR)=PPTCL(4,I) + PPTR(5,NPR)=PPTCL(5,I) + 282 IF(.NOT.(JSIDE.EQ.2)) GO TO 283 + IDENTL(NPL)=IDENT(I) + PPTL(1,NPL)=PPTCL(1,I) + PPTL(2,NPL)=PPTCL(2,I) + PPTL(3,NPL)=PPTCL(3,I) + PPTL(4,NPL)=PPTCL(4,I) + PPTL(5,NPL)=PPTCL(5,I) + 283 IF(DIQBR) GO TO 210 + IFL(JSIDE)=-IFLN + PX1(JSIDE)=-PX2 + PY1(JSIDE)=-PY2 + GO TO 220 +C NEW DIQUARK CREATION +210 ID1=IABS(IFLL) + ID2=IABS(IFLN) + IF(ID1.LE.ID2) GO TO 215 + ISWAP=ID1 + ID1=ID2 + ID1=ISWAP +215 IFL(JSIDE)=ISIGN(1000*ID1+100*ID2,IFLL) + PX1L(JSIDE)=PX1L(JSIDE)+PXL-PX2 + PY1L(JSIDE)=PY1L(JSIDE)+PYL-PY2 + PX1(JSIDE)=PX1L(JSIDE) + PY1(JSIDE)=PY1L(JSIDE) + 220 W(1)=W(1)-PPTCL(4,I)-PPTCL(3,I) + W(2)=W(2)-PPTCL(4,I)+PPTCL(3,I) + SPINT=.TRUE. + KSPIN=2 + IF(MOD(IFL(1),100).EQ.0.AND.MOD(IFL(2),100).EQ.0) GO TO 240 + IDB=IDPARS(IFL(1),IFL(2),SPINT,KSPIN) + AMB=AMASS(IDB)+dmass + GO TO 211 +240 IFCN=1 + IF(ranf(0).GT.0.5) IFCN=2 + IFLC1=-IFCN + IF(IFL(1).GT.0) IFLC1=IFCN + IFLC2=-IFLC1 + IKH1=IDPARS(IFL(1),IFLC1,SPINT,KSPIN) + IKH2=IDPARS(IFL(2),IFLC2,SPINT,KSPIN) + AMB=AMASS(IKH1)+AMASS(IKH2)+DMASs +211 P1X=PX1(1)+PX1(2) + P1Y=PY1(1)+PY1(2) + PT12=P1X**2+P1Y**2 + W12=W(1)*W(2) + AMS2=W12-PT12 + IF(AMS2.LT.AMB**2) GO TO 100 + SPINT=.TRUE. + KSPIN=1 + IF(MOD(IFL(1),100).EQ.0.AND.MOD(IFL(2),100).EQ.0) GO TO 231 + IDR=IDPARS(IFL(1),IFL(2),SPINT,KSPIN) + WEND=(AMASS(IDR)+DMAS)**2 + GO TO 232 +231 IKHR1=IDPARS(IFL(1),IFLC1,SPINT,KSPIN) + IKHR2=IDPARS(IFL(2),IFLC2,SPINT,KSPIN) + WEND=(AMASS(IKHR1)+AMASS(IKHR2)+DMAS)**2 +232 SPINT=.FALSE. + KSPIN=0 + IF(W(1)*W(2).GE.WEND) GO TO 130 + GO TO 230 +225 P1X=PX1(1)+PX1(2) + P1Y=PY1(1)+PY1(2) + PT12=P1X**2+P1Y**2 + W12=W(1)*W(2) + AMS2=W12-PT12 +C LAST BREAK OF STRING + 230 NPTCL=I + AMC=SQRT(AMS2) + EC=(W(1)+W(2))/2.0 + VC(1)=P1X/EC + VC(2)=P1Y/EC + VC(3)=(W(1)-W(2))/(2.0*EC) + NIN1=NPTCL+1 +c.. the last break of the string will be done in clustr + CALL CLUSTR(IFL(1),IFL(2),AMC,ilead) + IF(LRET) GO TO 100 + NFIN1=NPTCL + CALL LORTR(VC,NIN1,NFIN1,BACK) + NPR=NPR+1 + NPL=NPL+1 + IF(NPR.GT.MXPTCL.OR.NPL.GT.MXPTCL) GO TO 9999 +c..the hadron from the left and the right side of the string +c..are copied to the final pptcl array + IDENTL(NPL)=IDENT(NFIN1) + PPTL(1,NPL)=PPTCL(1,NFIN1) + PPTL(2,NPL)=PPTCL(2,NFIN1) + PPTL(3,NPL)=PPTCL(3,NFIN1) + PPTL(4,NPL)=PPTCL(4,NFIN1) + PPTL(5,NPL)=PPTCL(5,NFIN1) + IDENTR(NPR)=IDENT(NIN1) + PPTR(1,NPR)=PPTCL(1,NIN1) + PPTR(2,NPR)=PPTCL(2,NIN1) + PPTR(3,NPR)=PPTCL(3,NIN1) + PPTR(4,NPR)=PPTCL(4,NIN1) + PPTR(5,NPR)=PPTCL(5,NIN1) + JJ=NFIX + DO 284 J=1,NPR + JJ=JJ+1 + IDENT(JJ)=IDENTR(J) + PPTCL(1,JJ)=PPTR(1,J) + PPTCL(2,JJ)=PPTR(2,J) + PPTCL(3,JJ)=PPTR(3,J) + PPTCL(4,JJ)=PPTR(4,J) + PPTCL(5,JJ)=PPTR(5,J) +284 CONTINUE + JJ=NFIX+NPR + DO 285 J=1,NPL + JJ=JJ+1 + K=NPL-J+1 + IDENT(JJ)=IDENTL(K) + PPTCL(1,JJ)=PPTL(1,K) + PPTCL(2,JJ)=PPTL(2,K) + PPTCL(3,JJ)=PPTL(3,K) + PPTCL(4,JJ)=PPTL(4,K) + PPTCL(5,JJ)=PPTL(5,K) +285 CONTINUE + N1=NFIX+1 + N2=NFIX+NPR+NPL-1 +c.. we choose the LUND scheme + consti=.false. + + IF(CONSTI) THEN +C------------------------------------------------------C +C----- CONSTITUENT TIME ----------------C +C------------------------------------------------------C + DO 1286 J=N1,N2 + P3S=0. + ES=0. + DO 1287 L=N1,J + P3S=P3S+PPTCL(3,L) +1287 ES=ES+PPTCL(4,L) +c.. TI is the formation time of the particle +c.. ZI is the z coordinate + TI=(AMSTR-2.*P3S)/(2.*XAP) + ZI=(AMSTR-2.*ES)/(2.*XAP) + IF(J.NE.N2) GO TO 1288 + TII=TI + ZII=ZI +1288 PPTCL(6,J)=0. + PPTCL(7,J)=0. + PPTCL(8,J)=ZI + PPTCL(9,J)=TI +1286 CONTINUE +C + PPTCL(6,N2+1)=0. + PPTCL(7,N2+1)=0. + PPTCL(8,N2+1)=ZII + PPTCL(9,N2+1)=TII +C + GO TO 1253 + ENDIF +C------------------------------------------------------C +C----- INSIDE-OUTSIDE TIME (LUND) ----------------C +C------------------------------------------------------C + DO 286 J=N1,NPTCL + P3S=0. + ES=0. + NJ=J-1 + IF(NJ.EQ.0) GO TO 289 + DO 287 L=N1,NJ + P3S=P3S+PPTCL(3,L) + 287 ES=ES+PPTCL(4,L) +c.. TI is the formation time of the particle +c.. ZI is the z coordinate + 289 TI=(AMSTR-2.*P3S+PPTCL(4,J)-PPTCL(3,J))/(2.*XAP) + ZI=(AMSTR-2.*ES-PPTCL(4,J)+PPTCL(3,J))/(2.*XAP) + PPTCL(6,J)=0. + PPTCL(7,J)=0. + PPTCL(8,J)=ZI + PPTCL(9,J)=TI + 286 CONTINUE +1253 RETURN + +c.. warning if to many hadrons are produced in string +c.. increase the particle arrays to avoid this +9999 WRITE(6,9998) I +9998 FORMAT(//10X,40H...STOP IN STRING..NPTCL TOO HIGH NPTCL=,I5) + STOP + END + + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + SUBROUTINE CLUSTR(IFL1,IFL2,AMCTR,ilead) +c +cinput amctr : stringmass, +cinput ifl1 : leading quark (or diquark) along $+Z$ axis +cinput ifl2 : 2nd leading quark (or diquark) +cinput ilead : $2-ilead=$ number of leading (di-)quarks +c +c output : produced particles via common block ({\tt pptcl}) +c +C HADRONS PRODUCTION BY MEANS CLUSTER BREAKING +C WITH QUARK AND ANTIQUARK OR QUARK AND DIQUARK OR DIQUARK AND +C ANTIDIQUARK IFL1 AND IFL2 ON ENDS. +c Only the final 2 particles are created in {\tt clustr}! +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit real*8 (a-h,o-z) + implicit integer (i-n) + + COMMON/COMTRY/ NTRIES + + PARAMETER(MXPTCL=200) + COMMON/PARTCL/ PPTCL(9,MXPTCL),nptcl,IDENT(MXPTCL),IDCAY(MXPTCL) + + include 'comstr.f' + + COMMON/COLRET/ LRET + LOGICAL LRET + DIMENSION IFL(2),U(3) + LOGICAL SPINT + real*8 valint(1) + common /values/ valint + + include 'options.f' +ctp060202 to avoid warnings with gfortran compilation + logical ctp060202 + ctp060202=.false. + if(ctp060202)write(*,*)ilead +ctp060202 end + +c.. strange and charm suppression in clustr (see string) + prbs=ctparam(6) + prbc=ctparam(7) +c..the diquark-suppresion parameter is reduced for small +c string masses (finite size effect) see A. Jahns diploma thesis + if(amctr.le.2.8d0)then + pbarc=0.d0 + elseif (amctr.le.5d0)then + pbarc=((amctr-2.8d0)/2.2d0)**3*ctparam(8) + else + pbarc=ctparam(8) + endif + + dmas=ctparam(9) + dmass=ctparam(10) + +C +C PRBS STRANGENESS SUPPRESSION PARAMETER +C PRBC CHARM SUPPRESSION PARAMETER + PU=1./(2.+PRBS+PRBC) +C + NFIX=NPTCL + NREP=0 + LRET=.FALSE. + 100 I=NFIX + IF(NREP.LT.NTRIES) GO TO 101 + LRET=.TRUE. + RETURN +101 CONTINUE + KSPIN=0 + IFL(1)=IFL1 + IFL(2)=IFL2 + SPINT=.FALSE. + I=I+2 + IF(I.GT.MXPTCL) GO TO 9999 +C CHOOSE SIDE OF BREAK + JSIDE=1 +C IF ANY IFL IS A DIQUARK + IF(MOD(IFL(1),100).EQ.0.OR.MOD(IFL(2),100).EQ.0) GO TO 150 +C IFL(1) AND IFL(2) ARE QUARKS +C SELECT Q,QBARPAIR OR QQ,QQBAR PAIR + DRND=ranf(0) + IF(DRND.LT.PBARC.and.valint(1).eq.0.d0) GO TO 140 +C Q,QBAR PAIR + IFLN=ISIGN(IFLAV(PU,PRBS),-IFL(JSIDE)) + GO TO 200 +C QQ,QQBAR PAIR +140 IQ1=IFLAV(PU,PRBS) + IQ2=IFLAV(PU,PRBS) + IF(IQ1.LE.IQ2) GO TO 145 + ISWAP=IQ1 + IQ1=IQ2 + IQ2=ISWAP +145 IFQQ=1000*IQ1+100*IQ2 + IFLN=ISIGN(IFQQ,IFL(JSIDE)) + GO TO 200 +C IFL(1) OR IFL(2) IS DIQUARK +C Q,QBAR PAIR +150 IPSIGN=IFL(JSIDE) + IF(MOD(IFL(JSIDE),100).EQ.0) GO TO 130 + IPSIGN=-IFL(JSIDE) +130 IFLN=ISIGN(IFLAV(PU,PRBS),IPSIGN) +C IDENTS AND MASSES OF PARTICLES + 200 continue +c..quark-flip included (to describe some phi data) + if(CTParam(5).gt.ranf(0).and.mod(ifln,100).ne.0.and. + & mod(ifl(jside),100).ne.0.and.mod(ifl(3-jside),100).ne.0)then +c quark-flip + IDENT(I-1)=IDPARC(IFL(JSIDE),IFL(3-JSIDE),SPINT,KSPIN) + IDENT(I)=IDPARC(-IFLN,IFLN,SPINT,KSPIN) + else + IDENT(I-1)=IDPARC(IFL(JSIDE),IFLN,SPINT,KSPIN) + IDENT(I)=IDPARC(IFL(3-JSIDE),-IFLN,SPINT,KSPIN) + end if +c..for special bbar-b annihilation reactions for conservation +c of total quantum numbers + if(valint(1).ne.0.d0)then + ifq1=int(valint(1)/10.) + ifq2=-mod(int(valint(1)),10) + if(isign(1,ifln).eq.isign(1,ifq1))then + IDENT(I-1)=IDPARC(IFL(JSIDE),ifq1,SPINT,KSPIN) + IDENT(I)=IDPARC(IFL(3-JSIDE),ifq2,SPINT,KSPIN) + else + IDENT(I-1)=IDPARC(IFL(JSIDE),ifq2,SPINT,KSPIN) + IDENT(I)=IDPARC(IFL(3-JSIDE),ifq1,SPINT,KSPIN) + endif + endif + + PPTCL(5,I-1)=AMASS(IDENT(I-1)) + PPTCL(5,I)=AMASS(IDENT(I)) +C IF TOO LOW MASS,START ALL OVER (i.e. goto 100) + DEMAS=0.15 + IF(IFLN.LT.3) DEMAS=0. +c IF(AMCTR.GT.PPTCL(5,I-1)+PPTCL(5,I)+DEMAS) GO TO 102 + IF(AMCTR.GT.PPTCL(5,I-1)+PPTCL(5,I)+DEMAS) then + if(mod(ifl1,100).eq.0.or.mod(ifl2,100).eq.0)goto 102 +c..maximum kinetic energy cutoff for meson-clustr: +c..we want a lot of energy in the particle mass in this last break + IF(AMCTR-PPTCL(5,I-1)-PPTCL(5,I).lt.ctparam(43)) GO TO 102 + endif + NREP=NREP+1 +c.. 100 starts all over + GO TO 100 + +102 CONTINUE + +c.. isotropic px py pz distribution + PA=DBLPCM(AMCTR,PPTCL(5,I-1),PPTCL(5,I)) + U(3)=1.-2.*ranf(0) + PHI=2.*PI*ranf(0) + ST=SQRT(1.-U(3)**2) + U(1)=ST*COS(PHI) + U(2)=ST*SIN(PHI) + PPTCL(1,I-1)=PA*U(1) + PPTCL(1,I)=-(PA*U(1)) + PPTCL(2,I-1)=PA*U(2) + PPTCL(2,I)=-(PA*U(2)) + PPTCL(3,I-1)=PA*U(3) + PPTCL(3,I)=-(PA*U(3)) + PA2=PA**2 + PPTCL(4,I-1)=SQRT(PA2+PPTCL(5,I-1)**2) + PPTCL(4,I)=SQRT(PA2+PPTCL(5,I)**2) + IDCAY(I-1)=0 + IDCAY(I)=0 + NPTCL=I +c..forward/backward distribution in clustr for baryons +c..(no pt in the last string break!) +c..pt for the baryon comes from parton kick in the excitation + if(abs(ident(i)).ge.1000.or.abs(ident(i-1)).ge.1000)then + PPTCL(1,I-1)=0.d0 + PPTCL(1,I)=0.d0 + PPTCL(2,I-1)=0.d0 + PPTCL(2,I)=0.d0 + PPTCL(3,I-1)=PA + PPTCL(3,I)=-PA + PA2=PA**2 + PPTCL(4,I-1)=SQRT(PA2+PPTCL(5,I-1)**2) + PPTCL(4,I)=SQRT(PA2+PPTCL(5,I)**2) + IDCAY(I-1)=0 + IDCAY(I)=0 + NPTCL=I + endif + +c..if baryon number=+-1, force the (anti-)baryon in positive +c..z-direction (just pick the right hemisphere) + if(ctoption(29).gt.0)then + if( (iabs(ident(i)/1000).ne.0.and.iabs(ident(i-1)/1000).eq.0 + & .and.pptcl(3,i).lt.0.d0).or. + & (iabs(ident(i-1)/1000).ne.0.and.iabs(ident(i)/1000).eq.0 + & .and.pptcl(3,i-1).lt.0.d0)) then + pptcl(3,i) =-pptcl(3,i) + pptcl(3,i-1)=-pptcl(3,i-1) + endif + endif + + + RETURN +c.. particle array to small warning: +9999 WRITE(6,9998) I +9998 FORMAT(//10X,40H...STOP IN CLUSTR..NPTCL TOO HIGH NPTCL=,I5) + STOP + END + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + integer FUNCTION IFLAV(PU,PRBS) +c +cinput PU : 1-{\tt PU}= up (down, resp.) probability +cinput PRBS : Strange quark suppression +c +c output : {\tt iflav}: flavor of created quark +c +c Returns quark flavor acc. to suppression prob's: +c 1=up, 2=down, 3=strange, 4=charm +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit real*8 (a-h,o-z) + implicit integer (i-n) + +C + RNDOM=ranf(0) +C + IF(RNDOM.GT.PU) GO TO 1 +c..create up quark + IFLAV=1 + RETURN + 1 IF(RNDOM.GT.2.0*PU) GO TO 2 +c..create down quark + IFLAV=2 + RETURN + 2 IF(RNDOM.GT.PU*(2.0+PRBS)) GO TO 3 +c..create strange quark + IFLAV=3 + RETURN +c..create charm quark + 3 IFLAV=4 + RETURN + END +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + real*8 FUNCTION ZFRAGS(IFL,IFLN,PT2,ZMIN,ZMAX,leading) +c +cinput IFL : ID of existing quark +cinput IFLN : ID of newly created quark +cinput PT2 : $p_t$ of newly created hadron +cinput ZMIN : lowest allowed longitudinal momentum fraction +cinput ZMAX : highest allowed longitudinal momentum fraction +cinput leading : flag for leading particle +c +coutput ZFRAGS : longitudinal momentum fraction of created hadron +c +c According to the fragmentation function(s), longitudinal momentum +c is assigned to the hadron. +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit real*8 (a-h,o-z) + implicit integer (i-n) + + LOGICAL leading + + include 'options.f' + + COMMON/INPRNT/ ITDKY,ITLIS + PARAMETER(ALFT=0.5,ARHO=0.5,APHI=0.,APSI=-2.) + PARAMETER(AN=-0.5,ALA=-0.75,ALAC=-1.75) + PARAMETER(AKSI=-1.0,AUSC=-2.0,AUCC=-2.0) + +c.. cto 21 chooses the fragmentation fct. + if ((.not.leading).or.(ifln.eq.3)) then + affm=ctparam(47) + bffm=ctparam(48) + 5108 ZFRAGS=ZMIN+ranf(0)*(ZMAX-ZMIN) + YF=((1d0-ZFRAGS)**bffm*(bffm+1)*affm+1-affm)/3d0 +ctp060926 if(yf.gt.1d0.or.yf.lt.0d0)then +ctp060926 write(6,*)'ZFRAGS: wrong norm:',yf,zmin,zmax,zfrags +ctp060926 end if + IF(ranf(0).LE.YF) RETURN + GO TO 5108 + endif + +c.. GAUSSIAN fragmentation fct. + if(CTOption(21).eq.0)then + affm=CTParam(36) + bffm=CTParam(37) +c.. suppress low momentum particles + deltaz=zmax-zmin + zmin=zmin+deltaz*0.25d0 + 108 ZFRAGS=ZMIN+ranf(0)*(ZMAX-ZMIN) +c.. gaussian distr. + yf=exp(-(((zfrags-bffm)**2)/(2.*affm**2))) +c.. field-feynmann fragmentation fct. +c YF=((1d0-ZFRAGS)**bffm*(bffm+1)*affm+1-affm)/3d0 +ctp060926 if(yf.gt.1d0.or.yf.lt.0d0)then +ctp060926 write(6,*)'ZFRAGS: wrong norm:',yf,zmin,zmax,zfrags +ctp060926 end if +c return + IF(ranf(0).LE.YF) RETURN + GO TO 108 + + else if(CTOption(21).eq.1)then +c..lund-fragmentation fct. + 1008 ZFRAGS=ZMIN+ranf(0)*(ZMAX-ZMIN) + YF=(1-zfrags)*exp(-(0.7*pt2/zfrags))/3d0 +ctp060926 if(yf.gt.1d0.or.yf.lt.0d0)then +ctp060926 write(6,*)'ZFRAGS: wrong norm:',yf,zmin,zmax,zfrags +ctp060926 end if + IF(ranf(0).LE.YF) RETURN + GO TO 1008 + + else if(CTOption(21).eq.2)then +c.. kaidalov's fragmentation fct. + ID1=IABS(IFL) + ID2=IABS(IFLN) + IF(MOD(ID2,100).EQ.0) GO TO 15 + GO TO(1,2,3,4),ID2 +C UU-TRAJECTORY + 1 ZFRAGS=ZMIN+ranf(0)*(ZMAX-ZMIN) + YF=(1.0-ZFRAGS)**(ALFT-ARHO) + IF(ranf(0).LE.YF) RETURN + GO TO 1 +C DD-TRAJECTORY + 2 ZFRAGS=ZMIN+ranf(0)*(ZMAX-ZMIN) + YF=(1.-ZFRAGS)**(ALFT-ARHO) + IF(ranf(0).LE.YF) RETURN + GO TO 2 +C SS-TRAJECTORY + 3 ZFRAGS=ZMIN+ranf(0)*(ZMAX-ZMIN) + YF=(1.-ZFRAGS)**(ALFT-APHI) + IF(ranf(0).LE.YF) RETURN + GO TO 3 +C CC-TRAJECTORY + 4 ZFRAGS=ZMIN+ranf(0)*(ZMAX-ZMIN) + YF=(1.-ZFRAGS)**(ALFT-APSI) + IF(ranf(0).LE.YF) RETURN + GO TO 4 +C +15 Continue + CALL FLAVOR(ID2,IFL2,IFL3,IFL1,ISPIN) + IF((IFL2.EQ.1.AND.IFL3.EQ.1)) GO TO 16 + IF((IFL2.EQ.1.AND.IFL3.EQ.2)) GO TO 17 + IF((IFL2.EQ.1.AND.IFL3.EQ.3)) GO TO 18 + IF((IFL2.EQ.1.AND.IFL3.EQ.4)) GO TO 19 + IF((IFL2.EQ.2.AND.IFL3.EQ.2)) GO TO 20 + IF((IFL2.EQ.2.AND.IFL3.EQ.3)) GO TO 21 + IF((IFL2.EQ.2.AND.IFL3.EQ.4)) GO TO 22 + IF((IFL2.EQ.3.AND.IFL3.EQ.3)) GO TO 23 + IF((IFL2.EQ.3.AND.IFL3.EQ.4)) GO TO 24 + IF((IFL2.EQ.4.AND.IFL3.EQ.4)) GO TO 25 +C UUUU-TRAJECTORY +16 ZFRAGS=ZMIN+ranf(0)*(ZMAX-ZMIN) + YF=(1.-ZFRAGS)**(ALFT-(2.*AN-ARHO)) + IF(ranf(0).LE.YF) RETURN + GO TO 16 +C UDUD-TRAJECTORY +17 ZFRAGS=ZMIN+ranf(0)*(ZMAX-ZMIN) + YF=(1.-ZFRAGS)**(ALFT-(2.*AN-ARHO)) + IF(ranf(0).LE.YF) RETURN + GO TO 17 +C USUS-TRAJECTORY +18 ZFRAGS=ZMIN+ranf(0)*(ZMAX-ZMIN) + YF=(1.-ZFRAGS)**(ALFT-(2.*ALA-ARHO)) + IF(ranf(0).LE.YF) RETURN + GO TO 18 +C UCUC-TRAJECTORY +19 ZFRAGS=ZMIN+ranf(0)*(ZMAX-ZMIN) + YF=(1.-ZFRAGS)**(ALFT-(2.*ALAC-ARHO)) + IF(ranf(0).LE.YF) RETURN + GO TO 19 +C DDDD-TRAJECTORY +20 ZFRAGS=ZMIN+ranf(0)*(ZMAX-ZMIN) + YF=(1.-ZFRAGS)**(ALFT-(2.*AN-ARHO)) + IF(ranf(0).LE.YF) RETURN + GO TO 16 +C DSDS-TRAJECTORY +21 ZFRAGS=ZMIN+ranf(0)*(ZMAX-ZMIN) + YF=(1.-ZFRAGS)**(ALFT-(2.*ALA-ARHO)) + IF(ranf(0).LE.YF) RETURN + GO TO 21 +C DCDC-TRAJECTORY +22 ZFRAGS=ZMIN+ranf(0)*(ZMAX-ZMIN) + YF=(1.-ZFRAGS)**(ALFT-(2.*ALAC-ARHO)) + IF(ranf(0).LE.YF) RETURN + GO TO 22 +C SSSS-TRAJECTORY +23 ZFRAGS=ZMIN+ranf(0)*(ZMAX-ZMIN) + YF=(1.-ZFRAGS)**(ALFT-(2.*AKSI-ARHO)) + IF(ranf(0).LE.YF) RETURN + GO TO 23 +C SCSC-TRAJECTORY +24 ZFRAGS=ZMIN+ranf(0)*(ZMAX-ZMIN) + YF=(1.-ZFRAGS)**(ALFT-(2.*AUSC-ARHO)) + IF(ranf(0).LE.YF) RETURN + GO TO 24 +C CCCC-BARYON +25 ZFRAGS=ZMIN+ranf(0)*(ZMAX-ZMIN) + YF=(1.-ZFRAGS)**(ALFT-(2.*AUCC-ARHO)) + IF(ranf(0).LE.YF) RETURN + GO TO 25 + else + write(6,*)'string.f: cto(21)=',ctoption(21),' not valid' + stop + end if + + END +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + SUBROUTINE LORTR(V,NIN,NFIN,BACK) +c +cinput V : boost velocity (3-vector) +cinput NIN : lower boundary in the pptcl array +cinput NFIN : upper boundary in the pptcl array +cinput back : inversion flag for transformation +c +c output : via common block ({\tt pptcl}) +c +c Performs a Lorentz-boost of a part of the pptcl array +c (from {\tt nin} to {\tt nfin}) +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit real*8 (a-h,o-z) + implicit integer (i-n) + + PARAMETER(MXPTCL=200) + COMMON/PARTCL/ PPTCL(9,MXPTCL),nptcl,IDENT(MXPTCL),IDCAY(MXPTCL) + DIMENSION V(3),VD(3) + LOGICAL BACK + L=1 + IF(BACK) L=-1 + DO 3 I=1,3 +3 VD(I)=V(I) + VVD=VD(1)*VD(1)+VD(2)*VD(2)+VD(3)*VD(3) + GAD=1.D0/DSQRT(DABS(1.D0-VVD)) + GA=GAD + DO 100 J=NIN,NFIN + VP=V(1)*PPTCL(1,J)+V(2)*PPTCL(2,J)+V(3)*PPTCL(3,J) + GAVP=GA*(GA*VP/(1.+GA)-FLOAT(L)*PPTCL(4,J)) + PPTCL(1,J)=PPTCL(1,J)+GAVP*V(1) + PPTCL(2,J)=PPTCL(2,J)+GAVP*V(2) + PPTCL(3,J)=PPTCL(3,J)+GAVP*V(3) + PMAS=PPTCL(5,J) + PPTCL(4,J)=SQRT(PPTCL(1,J)**2+PPTCL(2,J)**2+PPTCL(3,J)**2+ + +PMAS**2) +100 CONTINUE + RETURN + END +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + BLOCK DATA D2 +c +c Initial values for several common blocks +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit real*8 (a-h,o-z) + implicit integer (i-n) +C +C INPUT QUARK DISTRIBUTION PARAMETERS +C + + include 'comstr.f' + + COMMON/KAPPA/ XAP + COMMON/CONSTI/ CONSTI + LOGICAL CONSTI + DATA CONSTI/.FALSE./ +C +C +C DATA FOR COSPAR +c this parameter controls the min. energy for ending string fragmentation +c default DATA DMAS/0.35/ +c now: ctparam(9) and ctparam(10) +c DATA DMAS/1./ +c data dmass/0.25/ +C +C +C INPUT STRING TENSION (FERMI/GEV) + DATA XAP/1.0/ +C +C INPUT FRAGMENTATION PARAMETERS: +C + DATA PARQLS/0.5/,PARRS/0.9/ +C PRBS STRANGENESS SUPPRESSION PARAMETER +C PRBC CHARM SUPPRESSION PARAMETER +C PBARC AND PBARS BARYON PAIRS SUPPRESION PARAMETERS +C DATA PRBS/0.3/,PRBC/0.0005/,PBARC/0.09/,PBARS/0.09/ +c these are now ctparam(6),ctparam(7) and ctparam(8) +c DATA PRBS/0.33/,PRBC/0.0/,PBARC/0.09/,PBARS/0.09/ +C +C THESE PARAMETERS ARE IMPORTANT FOR RESONANCE PRODUCTION + DATA PJSPNC/.50/ + DATA PJSPNS/.50/ +c DATA PJSPNC/1./ +c DATA PJSPNS/1./ +C DATA PMIX1C/.25,.25,.5,.5,.5,1./,PMIX2C/.5,.5,1.,0.,0.,1./ +c DATA PMIX1S/.25,.25,.5,.5,.5,1./,PMIX2S/.5,.5,1.,0.,0.,1./ +c QUARK MIXING PARAMETERS +cspl-0795 these parameters assign the pure u/ubar,d/dbar,s/sbar states +c (e.g. 110,220,330) to the physical particles according to the su(3) +c quark model. The flavor mixing angles are chosen according to quadratic +c Gell-Mann-Okubo mass formula (Review of Particle Properties, +c Phys. Rev D50 (1994) 1319). For the scalar mesons this formula is not +c applicable. We assume an ideal mixing angle (tan(theta)=1/sqrt(2)). +c +c pseudoscalar: theta=-10 deg +c vector : theta= 39 deg +c pseudovector: theta= 51 deg +c tensor : theta= 28 deg +c +c PMIX1C/S(IF1,JSPIN) gives the quark content of the heavy isosinglet: +c e.g. the eta' (330) is 25% u/ubar 25% d/dbar and 50% s/sbar +c PMIX2C/S(IF1,JSPIN) chooses for nonstrange qqbars between the isosinglet +c the and the isotriplet +c quark content of the heavy singlett +c DATA PMIX1C/.25,.25,.5, ! eta' +c & 0.,0.,1., ! phi +c & 0.,0.,1., ! f_0 +c & .04,.04,.92, ! f_1' +c & .01,.01,.98/ ! f_2' +c DATA PMIX2C/.5 ,.5 ,1.,.5,.5,1.,.5,.5,1.,.5 ,.5 ,1. ,.5 ,.5 , 1./ +c DATA PMIX1S/.25,.25,.5,0.,0.,1.,0.,0.,1.,.04,.04,.92,.01,.01,.98/, +c & PMIX2S/.5 ,.5 ,1.,.5,.5,1.,.5,.5,1.,.5 ,.5 ,1. ,.5 ,.5 , 1./ +C +C SIGQTS IS IMPORTANT PARAMETER FOR PRODUCED HADRON TRANSVERSE MOMENTA +C +c DATA SIGQTS/0.65/ -> ctparam(42) + END +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + BLOCK DATA D4 +c +cinput () : NONE +c +coutput () : via common blocks +c +c Initial values for several common blocks +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit real*8 (a-h,o-z) + implicit integer (i-n) + + COMMON/COMTRY/ NTRIES +C +C +C DATA COMTRY + DATA NTRIES/1000/ +C + + END +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + integer FUNCTION IDPARS(IFL01,IFL02,SPINT,IR) +c +cinput IFL01 : ID of (anti-)quarks/di-quarks +cinput IFL02 : ID of (anti-)quarks/di-quarks +cinput SPINT : flag for spin assignment +cinput IR : Determines particle spin +c +c output : Quark code of the hadron +c +C CONSTRUCT MESON FROM QUARK AND ANTIQUARK WITH FLAVORS IFL01,IFL02 +C OR CONSTRUCT BARYON FROM DIQUARK AND QUARK OR ANTIDIQUARK AND +C ANTIQUARK WITH FLAVORS IFL01,IFL02. +c THE MESON MULTIPLETT IS CHOSEN ACC. TO SUPPRESSION PARAM'S: +c parm gives the probability for different meson multiplets according +c to spin degeneracy and average mass ratios +c spin-parity 0- : 1- : 0+ : 1+ : 2+ = parm(1):parm(2)...:parm(5) +c If SPINT=.t., IR will be used to assign particle spin +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit real*8 (a-h,o-z) + implicit integer (i-n) + + + LOGICAL SPINT + include 'options.f' + + include 'comstr.f' + +C + IFL1=IFL01 + IFL2=IFL02 +C CONSTRUCT MESON WITH ACCOUNT FLAVOR MIXING + IF(MOD(IFL1,100).EQ.0) GO TO 420 + IF(MOD(IFL2,100).EQ.0) GO TO 425 +c + call getbran(parm,1,njspin,psdum,1,njspin,jspin) + jspin=jspin-1 + + IF(SPINT.AND.IR.EQ.2) JSPIN=0 + IF(SPINT.AND.IR.EQ.1) JSPIN=1 + ID1=IFL1 + ID2=IFL2 + IF(ID1+ID2.NE.0) GO TO 400 +C + ID1=IABS(ID1) + IF(ID1.GE.4) GO TO 401 + RND=ranf(0) + ID1=INT(PMIX1S(ID1,JSPIN+1)+RND)+INT(PMIX2S(ID1,JSPIN+1)+RND)+1 + 401 ID2=-ID1 +C + 400 IF(IABS(ID1).LE.IABS(ID2)) GO TO 410 + ISAVE=ID1 + ID1=ID2 + ID2=ISAVE + 410 IDHAD=ISIGN(100*IABS(ID1)+10*IABS(ID2)+JSPIN,ID1) + GO TO 470 +C CONSTRUCT BARYON IDENT + 420 ID3=ISIGN(MOD(IFL1/100,10),IFL1) + ID2=IFL1/1000 + ID1=IFL2 + GO TO 430 + 425 ID3=ISIGN(MOD(IFL2/100,10),IFL2) + ID2=IFL2/1000 + ID1=IFL1 + 430 IF(IABS(ID1).LE.IABS(ID2)) GO TO 431 + ISWAP=ID1 + ID1=ID2 + ID2=ISWAP + 431 IF(IABS(ID2).LE.IABS(ID3)) GO TO 432 + ISWAP=ID2 + ID2=ID3 + ID3=ISWAP + 432 IF(IABS(ID1).LE.IABS(ID2)) GO TO 440 + ISWAP=ID1 + ID1=ID2 + ID2=ISWAP + 440 JSPIN=1 + IF(ID1.EQ.ID2.AND.ID2.EQ.ID3) GO TO 450 + JSPIN=INT(ranf(0)+PJSPNS) + IF(SPINT.AND.IR.EQ.2) JSPIN=0 + IF(SPINT.AND.IR.EQ.1) JSPIN=1 + + 450 IF(JSPIN.EQ.1.OR.ID1.EQ.ID2.OR.ID2.EQ.ID3) GO TO 460 + DRND=ranf(0) + IF(DRND.GT.PJSPNS) GO TO 460 + ISWAP=ID1 + ID1=ID2 + ID2=ISWAP + 460 IDHAD=1000*IABS(ID1)+100*IABS(ID2)+10*IABS(ID3)+JSPIN + IDHAD=ISIGN(IDHAD,IFL1) + 470 IDPARS=IDHAD + RETURN + END +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + integer FUNCTION IDPARC(IFL01,IFL02,SPINT,IR) +c +cinput IFL01 : ID of (anti-)quarks/di-quarks +cinput IFL02 : ID of (anti-)quarks/di-quarks +cinput SPINT : flag for spin assignment +cinput IR : Determines particle spin +c +c output : Quark code of the hadron +c +C CONSTRUCT MESON FROM QUARK AND ANTIQUARK WITH FLAVORS IFL01,IFL02 +C OR CONSTRUCT BARYON FROM DIQUARK AND QUARK OR ANTIDIQUARK AND +C ANTIQUARK WITH FLAVORS IFL01,IFL02. +c THE MESON MULTIPLETT IS CHOSEN ACC. TO SUPPRESSION PARAM'S: +c parm gives the probability for different meson multiplets according +c to spin degeneracy and average mass ratios +c spin-parity 0- : 1- : 0+ : 1+ : 2+ = parm(1):parm(2)...:parm(5) +c If SPINT=.t., IR will be used to assign particle spin +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit real*8 (a-h,o-z) + implicit integer (i-n) + + LOGICAL SPINT + include 'options.f' + + include 'comstr.f' + +C + IFL1=IFL01 + IFL2=IFL02 +C CONSTRUCT MESON WITH ACCOUNT FLAVOR MIXING + IF(MOD(IFL1,100).EQ.0) GO TO 420 + IF(MOD(IFL2,100).EQ.0) GO TO 425 + +c.. choose multiplett by its probability + call getbran(parm,1,njspin,dummy,1,njspin,jspin) + jspin=jspin-1 + + IF(SPINT.AND.IR.EQ.2) JSPIN=0 + IF(SPINT.AND.IR.EQ.1) JSPIN=1 + ID1=IFL1 + ID2=IFL2 + IF(ID1+ID2.NE.0) GO TO 400 +C + ID1=IABS(ID1) + IF(ID1.GE.4) GO TO 401 +c.. singlet mixing acc. to mixing angles + RND=ranf(0) + ID1=INT(PMIX1C(ID1,JSPIN+1)+RND)+INT(PMIX2C(ID1,JSPIN+1)+RND)+1 + 401 ID2=-ID1 +C + 400 IF(IABS(ID1).LE.IABS(ID2)) GO TO 410 + ISAVE=ID1 + ID1=ID2 + ID2=ISAVE + 410 IDHAD=ISIGN(100*IABS(ID1)+10*IABS(ID2)+JSPIN,ID1) + GO TO 470 +C CONSTRUCT BARYON IDENT + 420 ID3=ISIGN(MOD(IFL1/100,10),IFL1) + ID2=IFL1/1000 + ID1=IFL2 + GO TO 430 + 425 ID3=ISIGN(MOD(IFL2/100,10),IFL2) + ID2=IFL2/1000 + ID1=IFL1 + 430 IF(IABS(ID1).LE.IABS(ID2)) GO TO 431 + ISWAP=ID1 + ID1=ID2 + ID2=ISWAP + 431 IF(IABS(ID2).LE.IABS(ID3)) GO TO 432 + ISWAP=ID2 + ID2=ID3 + ID3=ISWAP + 432 IF(IABS(ID1).LE.IABS(ID2)) GO TO 440 + ISWAP=ID1 + ID1=ID2 + ID2=ISWAP + 440 JSPIN=1 + IF(ID1.EQ.ID2.AND.ID2.EQ.ID3) GO TO 450 + JSPIN=INT(ranf(0)+PJSPNC) + IF(SPINT.AND.IR.EQ.2) JSPIN=0 + IF(SPINT.AND.IR.EQ.1) JSPIN=1 + 450 IF(JSPIN.EQ.1.OR.ID1.EQ.ID2.OR.ID2.EQ.ID3) GO TO 460 + DRND=ranf(0) + IF(DRND.GT.PJSPNC) GO TO 460 + ISWAP=ID1 + ID1=ID2 + ID2=ISWAP + 460 IDHAD=1000*IABS(ID1)+100*IABS(ID2)+10*IABS(ID3)+JSPIN + IDHAD=ISIGN(IDHAD,IFL1) + 470 IDPARC=IDHAD + RETURN + END +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + real*8 FUNCTION AMASS(ID) +c +c +cinput ID : Quark code +c +c +C THIS FUNCTION RETURNS THE MASS OF THE PARTICLE WITH +C IDENT CODE ID. (QUARK-BASED IDENT CODE) +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit real*8 (a-h,o-z) + implicit integer (i-n) + include 'comres.f' + include 'comstr.f' + + real*8 mmin,mmax,m0,mminit, massit, widit + integer isoit + dimension amq(4) + include 'options.f' + +c.. quark masses (u,d,s,c) + DATA AMq/.15,.15,.45,1.6/ + +c fraction of baryonresonances + bresfrac=ctparam(11) + + CALL FLAVOR(ID,IFL1,IFL2,IFL3,JSPIN) + idabs=iabs(id) + +c get quark masses + if (idabs.le.4) then + amass=amq(idabs) + return + endif +c get diquark masses + IF(ID.NE.0.AND.MOD(ID,100).EQ.0) then + AMASS=AMq(IABS(IFL1))+AMq(IABS(IFL2)) + return + endif + +c get hadron masses + +c get baryon masses +c (anti-)nucleon ? + if ((idabs.eq.1120).or.(idabs.eq.1220)) then + if (ranf(0).lt.bresfrac)then +c.. N* + amass=getmass(mresmax,1) + return + else +c.. N + amass=0.938 + return + endif + endif +c (anti-)delta ? + if ((idabs.eq.1111).or.(idabs.eq.1121) + & .or.(idabs.eq.1221).or.(idabs.eq.2221)) then + if (ranf(0).lt.bresfrac)then +c.. D* + amass=getmass(mresmax,2) + return + else +c.. Delta(1232) + m0=massit(mindel) + w0=widit(mindel) +c get meson mass accord. to breit wigner distr. + mmin=mminit(mindel) + mmax=m0+3d0*w0 +cdh call getmas(m0,w0,mindel,isoit(mindel),mmin,mmax,-1,amass) + call getmas(m0,w0,mindel,isoit(mindel),mmin,mmax,-1.d0,amass) + return + endif + endif +c (other baryons) + if(idabs-1000.ge.0) then + call id2ityp(id,0.d0,itypin,iz2) +c..check range and avoid double counting for explicitely treated resonances + if ((abs(itypin).ge.minlam.and.abs(itypin).le.maxcas).and. + & (idabs.ne.1231.and.idabs.ne.1131.and.idabs.ne.2231.and. + & idabs.ne.1331.and.idabs.ne.2331).and. + & (ctoption(31).eq.1)) then +c.. generate also non-groundstate ityps for strange baryons + call probitypres(itypin,ityp) + else + ityp=itypin + endif + amass=massit(iabs(ityp)) + return + endif + +c mesons + if(idabs.le.330+njspin-1) then + call id2ityp(id,0.d0,ityp,iz2) + m0=massit(iabs(ityp)) + w0=widit(iabs(ityp)) +c get meson mass accord. to breit wigner distr. + mmin=max(mminit(iabs(ityp)),m0-3d0*w0) + mmax=m0+3d0*w0 +cdh call getmas(m0,w0,ityp,iz2,mmin,mmax,-1,amass) + call getmas(m0,w0,ityp,iz2,mmin,mmax,-1.d0,amass) + return + endif + write(6,*)'! amass: no mass for part.id:',id + return + END + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + real*8 FUNCTION DBLPCM(A,B,C) +c +cinput A : Mass of particle A +cinput B : Mass of particle B +cinput C : Mass of particle C +c +c +c In the rest frame of a particle of mass A, decaying into particles +c of masses B and C, {\tt dblpcm} returns the momenta of the outgoing +c particles. +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit real*8 (a-h,o-z) + implicit integer (i-n) + + DA=A + DB=B + DC=C + DVAL=(DA**2-DB**2-DC**2)**2-(2.D0*DB*DC)**2 + DBLPCM=0. + IF(DVAL.GT.0.D0)DBLPCM=DSQRT(DVAL)/(2.D0*DA) + return + END + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine ityp2id(ityp,iz2,ifa,ifb) +c +cinput ityp : UrQMD particle ID +cinput iz2 : UrQMD $2\cdot I_3$ +c +coutput ifa : quarkcode (diquark) +coutput ifb : quarkcode (quark) +c +c returns quark id from uqmd-ityp and isospin z-component (times 2) +c +c quark ids are: 1 up, 2 down, 3 strange, 4 charm +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + include 'comres.f' + integer itypabs,ityp,iz2,ifa,ifb,sf + integer t3,if(3) + itypabs=iabs(ityp) + t3=iz2*isign(1,ityp) + +c nucleons ? + if (itypabs.lt.minmes) then + sf=strres(itypabs) +c uuu + if(t3.eq.3) then + if(1)=1 + if(2)=1 + if(3)=1 + call mquarks(if,ifa,ifb) + ifa=ifa*isign(1,ityp) + ifb=ifb*isign(1,ityp) + return + endif +c uus + if(t3.eq.2) then + if(1)=1 + if(2)=1 + if(3)=3 + call mquarks(if,ifa,ifb) + ifa=ifa*isign(1,ityp) + ifb=ifb*isign(1,ityp) + return + endif +c uud + if((t3.eq.1).and.(sf.eq.0)) then + if(1)=1 + if(2)=1 + if(3)=2 + call mquarks(if,ifa,ifb) + ifa=ifa*isign(1,ityp) + ifb=ifb*isign(1,ityp) + return + endif +c uss + if((t3.eq.1).and.(sf.eq.2)) then + if(1)=1 + if(2)=3 + if(3)=3 + call mquarks(if,ifa,ifb) + ifa=ifa*isign(1,ityp) + ifb=ifb*isign(1,ityp) + return + endif +c uds + if((t3.eq.0).and.(sf.eq.1)) then + if(1)=1 + if(2)=2 + if(3)=3 + call mquarks(if,ifa,ifb) + ifa=ifa*isign(1,ityp) + ifb=ifb*isign(1,ityp) + return + endif +c sss + if((t3.eq.0).and.(sf.eq.3)) then + if(1)=3 + if(2)=3 + if(3)=3 + call mquarks(if,ifa,ifb) + ifa=ifa*isign(1,ityp) + ifb=ifb*isign(1,ityp) + return + endif +c udd + if((t3.eq.-1).and.(sf.eq.0)) then + if(1)=1 + if(2)=2 + if(3)=2 + call mquarks(if,ifa,ifb) + ifa=ifa*isign(1,ityp) + ifb=ifb*isign(1,ityp) + return + endif +c dss + if((t3.eq.-1).and.(sf.eq.2)) then + if(1)=2 + if(2)=3 + if(3)=3 + call mquarks(if,ifa,ifb) + ifa=ifa*isign(1,ityp) + ifb=ifb*isign(1,ityp) + return + endif +c dds + if (t3.eq.-2) then + if(1)=2 + if(2)=2 + if(3)=3 + call mquarks(if,ifa,ifb) + ifa=ifa*isign(1,ityp) + ifb=ifb*isign(1,ityp) + return + endif +c ddd + if (t3.eq.-3) then + if(1)=2 + if(2)=2 + if(3)=2 + call mquarks(if,ifa,ifb) + ifa=ifa*isign(1,ityp) + ifb=ifb*isign(1,ityp) + return + endif + + endif +c-- -- -- -- -- -- -- -- -- -- -- -- -- -- -- -- -- -- -- -- -- -- -- -- -- +c bosons + if (itypabs.ge.minmes) then + sf=strmes(itypabs) +c d ubar + if(t3.eq.-2) then + ifa=2 + ifb=-1 + return + endif +c d sbar + if((t3.eq.-1).and.(sf*isign(1,ityp).eq.-1)) then + ifa=2 + ifb=-3 + return + endif +c s ubar + if((t3.eq.-1).and.(sf*isign(1,ityp).eq.+1)) then + ifa=3 + ifb=-2 + return + endif +c q qbar + if(t3.eq.0) then +c u ubar +c all neutral triplet states: + if ((itypabs.eq.minmes+1) .or. !pi0 + & (itypabs.eq.minmes+4) .or. + & (itypabs.eq.minmes+11) .or. + & (itypabs.eq.minmes+14) .or. + & (itypabs.eq.minmes+18) .or. + & (itypabs.eq.minmes+22) .or. + & (itypabs.eq.minmes+26) .or. + & (itypabs.eq.minmes+30) .or. +c the gamma gets also a quark content + & (itypabs.eq.minmes)) then + ifa=1 + ifb=-1 + return + endif +c d dbar +c light singlet states (generally less strange quark content) + if ((itypabs.eq.minmes+2) .or. !eta + & (itypabs.eq.minmes+3) .or. + & (itypabs.eq.minmes+5) .or. + & (itypabs.eq.minmes+15) .or. + & (itypabs.eq.minmes+19) .or. + & (itypabs.eq.minmes+23) .or. + & (itypabs.eq.minmes+27) .or. + & (itypabs.eq.minmes+31)) then + ifa=2 + ifb=-2 + return + endif +c s sbar + if ((itypabs.eq.minmes+7) .or. !eta' (958) + & (itypabs.eq.minmes+9) .or. !phi (1020) + & (itypabs.eq.minmes+12) .or. !f_0 (980) + & (itypabs.eq.minmes+16) .or. !f_1 (1510) + & (itypabs.eq.minmes+20) .or. !f_2'(1525) + & (itypabs.eq.minmes+24) .or. !f_2'(1525) + & (itypabs.eq.minmes+28) .or. !f_2'(1525) + & (itypabs.eq.minmes+32))then + ifa=3 + ifb=-3 + return + endif + endif +c u sbar + if((t3.eq.1).and.(sf*isign(1,ityp).eq.-1)) then + ifa=1 + ifb=-3 + return + endif +c s dbar + if((t3.eq.1).and.(sf*isign(1,ityp).eq.+1)) then + ifa=3 + ifb=-1 + return + endif +c u dbar + if(t3.eq.2) then + ifa=1 + ifb=-2 + return + endif + endif + +c in any other case we will do a mesonic string +c.. and a warning ! +ctp060926 write(*,*)'! ityp2id: ityp',ityp,',iz2',iz2, +ctp060926 & ' can not be converted into id. Please check.' + ifa=1 + ifb=-1 + RETURN + end +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine mquarks(if,ifa,ifb) +c +cinput if : single quarks (array) +c +coutput ifa : diquark +coutput ifb : quark +c +c this routine adds randomly the single quarks of the +c baryon to become a diquark and a quark. +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + + include 'options.f' + + real*8 ranf + integer if(0:2),ifa,ifb,ir + + integer i,prod,inons + + + ir=int(3.*ranf(0)) + + ifa=1000*if(ir)+100*if(mod(ir+1,3)) + ifb=if(mod(ir+2,3)) +c.. check if heavy quark clusters are switched off (cto 37=0) + if (CTOption(37).eq.0) return + +c.. not switched off -> clusters strange quarks to +c.. diquark molecule, i.e. keep ss-diquark together +c. are there 2 strange quarks + prod=if(0)*if(1)*if(2) + if (prod.eq.9.or.prod.eq.18.or.prod.eq.27) then +c. find the non-strange quark inons + inons=0 + do i=0,2 + if(if(i).lt.3) inons=i + enddo + ifb=if(inons) + ifa=1000*if(mod(inons+1,3))+100*if(mod(inons+2,3)) + endif + return + end + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine id2ityp(id,mass,it,iz) +c +cinput id : quarkcode +cinput mass : mass of resonance +c +coutput: it : UrQMD particle ID +coutput: iz : $2\cdot I_3$ of particle +c +c returns UrQMD ID ({\tt it}) and isospin z-component (times 2) ({\tt IZ}) +c from quark id +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + include 'comres.f' + include 'options.f' + integer IT,IZ,id,idabs,i,j,k,jspin,idloc,whichres + real*8 mass,pardelt,mminit,dm,dmold,massit + integer iit,irun + +c.. extract quark id's and spin + IDABS=IABS(ID) + I=IDABS/1000 + J=MOD(IDABS/100,10) + K=MOD(IDABS/10,10) + JSPIN=MOD(IDABS,10) + +c single diquarks are not popular in urqmd: + IF(ID.NE.0.AND.MOD(ID,100).EQ.0) GO TO 222 +c single quarks are not popular in urqmd: + IF(J.EQ.0) GO TO 222 + +c mesons: + if(I.EQ.0) then +c calculate isospin from quark content: + IZ=0 + if(j.lt.3) IZ=3-2*j + if(k.lt.3) IZ=IZ+(2*k-3) + IZ=isign(1,id)*IZ + + idloc=idabs-jspin + if((idloc.eq.110).or.(idloc.eq.120))then +c..triplett (e.g. pion) + IT= mlt2it(jspin*4+1) ! minmes+1 + return + else if(idloc.eq.220)then +c..1st singlett (e.g. eta) + IT= mlt2it(jspin*4+3) !minmes+2 + return + else if(idloc.eq.130.or.idloc.eq.230)then +c..strange doublett (e.g. (anti-)kaon) + IT=isign(mlt2it(jspin*4+2),id) + return + else if(idloc.eq.330)then +c..2nd singlett (e.g. eta') + IT=mlt2it(jspin*4+4) !minmes+7 + return + else + goto 222 + endif + + else +c.. baryons: + +c calculate isospin from quark content: + IZ=0 + if(i.lt.3) IZ=3-2*i + if(j.lt.3) IZ=IZ+3-2*j + if(k.lt.3) IZ=IZ+3-2*k + IZ=isign(1,id)*IZ +c spin 1/2 baryons (all nucleon-resonances are treated here!) + if(jspin.eq.0)then +c (anti-)nucleons and resonances + if(idabs.eq.1120.or.idabs.eq.1220)then +c mass below parnuc -> nucleon (ground state), mass above parnuc ->N* + if(mass.lt.mminit(minnuc+1))then + IT=isign(minnuc,id) + return + else + IT=isign(whichres(dble(mass),1),id) + return + endif + else if(idabs.eq.2130)then +c lambda + iit=minlam + if (mass.gt.1d0)then + dmold=1d30 + do irun = minlam,maxlam + dm=abs(massit(irun)-mass) + if (dm.le.dmold)then + dmold=dm + iit=irun + end if + end do + end if + IT=isign(iit,id) + return + else if(idabs.eq.1230.or.idabs.eq.1130.or.idabs.eq.2230)then +c sigma + iit=minsig + if (mass.gt.1d0)then + dmold=1d30 + do irun = minsig,maxsig + dm=abs(massit(irun)-mass) + if (dm.le.dmold)then + dmold=dm + iit=irun + end if + end do + end if + IT=isign(iit,id) + return + else if(idabs.eq.1330.or.idabs.eq.2330)then +c cascade + iit=mincas + if (mass.gt.1d0)then + dmold=1d30 + do irun = mincas,maxcas + dm=abs(massit(irun)-mass) + if (dm.le.dmold)then + dmold=dm + iit=irun + end if + end do + endif + IT=isign(iit,id) + return + else + goto 222 + endif +c spin 3/2 baryons (all delta-resonances are treated here!) + else if(jspin.eq.1)then + if(idabs.eq.1111.or.idabs.eq.1121.or. + & idabs.eq.1221.or.idabs.eq.2221)then +c if mass below pardelt -> Delta1232, otherwise: Delta-resonance + pardelt=1.45 + if(mass.lt.pardelt)then +c delta 1232 + IT=isign(whichres(dble(mass),0),id) + return + else +c delta resonance + IT=isign(whichres(dble(mass),2),id) + return + endif + else if(idabs.eq.1231.or.idabs.eq.1131.or.idabs.eq.2231)then +c sigma* + IT=isign(minsig+1,id) + return + else if(idabs.eq.1331.or.idabs.eq.2331)then +c cascade* + IT=isign(mincas+1,id) + return + else if(idabs.eq.3331)then +c omega + IT=isign(minome,id) + return + else + goto 222 + endif +c higher spin baryons include here: + + else + goto 222 + endif + endif + + 222 continue +ctp060926 write(6,*)'! ID=',id,' can not be converted into ityp' +ctp060926 write(6,*)'I=',i,'J=',j,'K=',k,'spin=',jspin + RETURN + END + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine probitypres(itypin,itypout) +c +cinput itypin : ityp of groundstate +c +coutput: itypout : ityp of groundstate plus resonances +c +c returns a new ityp which also includes resonce ityps, this is +c necessary to include hyperon resonces as long as no proper getmass +c for hyperons existst. +c the probabilities are chooses according to a exp(delta m/b) distribution. +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + include 'comres.f' + + integer itypin,itypout,ss,i,itypinn + real*8 prob(1:200),probres,norm,deltam,massit + + ss=itypin/abs(itypin) + itypinn=abs(itypin) + +c.. the lambda + if (itypinn.ge.minlam.and.itypinn.le.maxlam)then +c get probabilities and norm + norm=0d0 + do i=minlam+1,maxlam + deltam=abs(massit(i)-massit(minlam)) + prob(i)=probres(deltam,massit(minlam),i) + norm=norm+prob(i) + end do + do i=minlam+1,maxlam + prob(i)=prob(i)/norm + end do + call findityp(prob,itypout,minlam+1,maxlam) + itypout=itypout*ss + return + end if + +c.. the sigma + if (itypinn.ge.minsig.and.itypinn.le.maxsig)then +c get probabilities and norm + norm=0d0 + do i=minsig+1,maxsig + deltam=abs(massit(i)-massit(minsig)) + prob(i)=probres(deltam,massit(minsig),i) +c... do not generate masses for minsig+1 they are treated ecplicitely + if (i.eq.minsig+1) prob(i)=0d0 + norm=norm+prob(i) + end do + do i=minsig+1,maxsig + prob(i)=prob(i)/norm + end do + call findityp(prob,itypout,minsig+1,maxsig) + itypout=itypout*ss + return + end if + +c.. the cascades + if (itypinn.ge.mincas.and.itypinn.le.maxcas)then +c get probabilities and norm + norm=0d0 + do i=mincas+1,maxcas + deltam=abs(massit(i)-massit(mincas)) + prob(i)=probres(deltam,massit(mincas),i) +c... do not generate masses for mincas+1 they are treated ecplicitely + if (i.eq.mincas+1) prob(i)=0d0 + norm=norm+prob(i) + end do + do i=mincas+1,maxcas + prob(i)=prob(i)/norm + end do + call findityp(prob,itypout,mincas+1,maxcas) + itypout=itypout*ss + return + end if + write(*,*)'itypin, itypout',itypin,itypout + stop 'Error in probitypres!' + end + + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + real*8 function probres(dm,minmass,it) +c +cinput dm : mass difference to groundstate +cinput minmass : mass of groundstate +cinput it : ityp +c +coutput: probres: unnormalized probability for this state +c +c returns probabilty for a higher mass state according to +c exponential distribution with degeneracy +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + real*8 dm,minmass,j,g,T + integer it, getspin + +c.. assume temperature T=170 MeV (from statistical model, e.g. becattini,heinz) + T=0.170d0 + +c.. get spin*2 + j=1d0*getspin(it,1) + + if (j.lt.0) then +c.. take spin into account via J= m^2 and deg. g=2j+1 (regge theory) + j=2d0*(minmass+dm)**2 + end if + + g=(j+1d0) + + probres=g*exp(-(dm/T)) + return + end +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine findityp (p,it,mini,maxi) +c +cinput p : array with normalized probabilities +cinput mini : lowest index +cinput maxi : largest index +c +coutput: it: ityp according to probability +c +c returns a new ityp according to probabilties defined in p +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + real*8 p(1:200),y,ranf + integer it,mini,maxi,ix + + it=mini + ix=0 + y=0d0 + + 1 continue + ix=int(mini+int((maxi-mini+1)*ranf(0))) + y=ranf(0) + if (y.lt.p(ix)) then + it=ix + return + end if + goto 1 + end + +C--------------------------------------------------------------------------- +C THE END diff --git a/Processes/UrQMD/tabinit.f b/Processes/UrQMD/tabinit.f new file mode 100644 index 0000000000000000000000000000000000000000..5032e1c8ba87a88d7dbe4c7e49ebd03c768c3a96 --- /dev/null +++ b/Processes/UrQMD/tabinit.f @@ -0,0 +1,527 @@ +c $Id: tabinit.f,v 1.14 2003/05/02 13:14:46 weber Exp $ +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine loadwtab (io) +c +c Revision : 1.0 +c +coutput : information in common-block comwid.f +c +c load the tabulated branching ratios from disk +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + + include 'comres.f' + include 'comwid.f' + + integer ios, nsp, io, ver!, i +c character*35 pwdcmd + character*10 deftab + character*8 defexe + logical b + +c set the defaultname of the file, containing the table + parameter (deftab='tables.dat', defexe='uqmd.exe') + + b=io.eq.1 + +c get the name of the table from the environment variable + call getenv('URQMD13_TAB',tabname) +c if it is empty, use the default name + if (tabname(1:4).eq.' ') then + tabname=deftab + endif + + if(b)write (6,*) 'Looking for the tabulated decay width...' + & ,tabname +c open the table + open (unit=75,iostat=ios,file=tabname,form='unformatted', + . status='old') +c if it fails ... + if (ios.ne.0) then +c close the file handle +c close (unit=75, status='delete') + if(b)write (6,*) 'No file:',tabname,'in this directory' +c get the full path of the executable, ... +c call getenv('_',pwdcmd) +c write (6,*) 'pwd:',pwdcmd + write (6,*) 'tabname:',tabname +c extract the path +c i=max(index(pwdcmd,defexe),2) +c write (tabname,*) pwdcmd (1:i-1),deftab +c tabname=tabname(2:) + if(b)write (6,*) 'Looking for ',tabname,'...' +c and look for a table in the directory of the executable + open (unit=75,iostat=ios,file=tabname, + . form='unformatted',status='old') + endif +c if the last 'open' command succeeds read the file + if (ios.eq.0) then + if(b)write (6,*) 'O.K.' + if(b)write (6,*) 'reading...' +c read all tables + read (unit=75, iostat=ios) ver, nsp, tabx, fbtaby, pbtaby, + . fmtaby, pmtaby, bwbarnorm, bwmesnorm, + . tabxnd, frrtaby +c caution! the file is unformatted, therefor it is system dependent! + if(b)write (6,*) 'version=',ver +c if no errors occur ... + if (ios.eq.0) then + if(b)write (6,*) 'O.K.' + wtabflg=3 +c check, if the version number is correct + if (ver.eq.tabver) then + if(b)write (6,*) 'tabver=',ver,' O.K.' + else + write (6,*) 'wrong table!' + write (6,*) 'tabver should be',tabver,',instead of',ver + wtabflg=0 + endif +c check, if the table has the correct 'widnsp' + if (nsp.eq.widnsp) then + if(b)write (6,*) 'widnsp=',nsp,' O.K.' + else + write (6,*) 'wrong table!' + write (6,*) 'widnsp should be',widnsp,', instead of',nsp + wtabflg=0 + endif +c if table is O.K. close file + if (wtabflg.eq.3) then + close (unit=75, status='keep') +c otherwise ... + else +c delete the present table + close (unit=75, status='delete') + tabname=deftab +c and calculate a new one + call mkwtab + endif +c in case of read errors ... + else +c delete the present table + close (unit=75, status='delete') + write (6,*) 'Error while reading ',tabname + tabname=deftab +c and calculate a new one + call mkwtab + endif +c in any other case ... + else +ctp tabname=deftab +c calculate an new table + call mkwtab + endif + + return + end + + + + + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine savewtab +c +c Revision : 1.0 +c +c save the tabulated branching ratios to disk +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + + include 'comres.f' + include 'comwid.f' + + integer ios + + write (6,*) 'Writing new table...' + +c try to generate a new file + open (unit=75,iostat=ios,file=tabname,form='unformatted', + . status='new') +c if it succedds ... + if (ios.eq.0) then +c write the tables into the file + write (unit=75, iostat=ios) tabver, widnsp, tabx, fbtaby, + . pbtaby, fmtaby, pmtaby, bwbarnorm, bwmesnorm, + . tabxnd, frrtaby + if (ios.eq.0) write (6,*) 'O.K.' +c otherwise complain + else + write (6,*) 'Error: ',tabname,'exists!' + endif +c close the file + close (unit=75, status='keep') + + return + end + + + + + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine mkwtab +c +c Revision : 1.0 +c +coutput : information in common-block comwid.f +c +c tabulate the mass dependent branching ratios +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + + include 'comres.f' + include 'comwid.f' + + real*8 fwidth,m,first,last,delta,abl0,abln,mir,mminit,fbrancx + real*8 massit,bran,smass,bwnorm,fppfit + integer i,bchan,itp,isoit,cmin,cmax,i1,i2,i3,i4,ii1 + + write (6,*) 'Generating table...' +c this indicates, that all tables are still empty + wtabflg=0 + +c high precision splines from mintab to maxtab1 +c lower precicision between maxtab1 and maxtab2 + +c now fill the x-values +c start with 'mintab' + first=mintab +c 66 % of all fixpoints between mintab and maxtab1 +c calculate the steps + delta=(maxtab1-mintab)/((widnsp-1d0)*2d0/3d0) + if (delta.le.0d0) then + write(*,*)'(E) Please allow maxtab1>mintab in comwid' + stop + endif +c store the values into 'tabx' + do 10 i=1,int(widnsp*2./3.) + m=first+(i-1)*delta + tabx(i)=m + 10 continue +c 33 % of all fixpoints with larger delta between maxtab1 and maxtab2 + delta=(maxtab2-maxtab1)/((widnsp-1d0)*1d0/3d0) + if (delta.le.0d0) then + write(*,*)'(E) Please allow maxtab2>maxtab1 in comwid' + stop + endif +c store the values into 'tabx' + do 11 i=int(widnsp*2./3.)+1,widnsp + m=maxtab1+(i-1-int(widnsp*2./3.))*delta + tabx(i)=m + 11 continue + +c now fill the y-values of the full branching ratios + +c these are the first derivatives at the first an the last point +c of the interpolating function. a value greater than 1E30 signals the +c 'spline' routine to set the boundary condition for a natural spline +c with zero second derivative + abl0=2D30 + abln=2D30 + +c loop over all baryons + do 20 itp=minbar,maxbar +c loop over all x-values + do 21 i=1,widnsp +c store the values ... + fbtaby (i,itp,1)=fwidth(itp,isoit(itp),tabx(i)) + 21 continue +c calculate the second derivate and store it in 'fbtaby(,,2)' + call spline (tabx(1),fbtaby(1,itp,1),widnsp,abl0,abln, + . fbtaby(1,itp,2)) + 20 continue + write (6,*) '(1/7) ready.' + +c loop over all mesons + do 30 itp=minmes,maxmes +c loop over all x-values + do 31 i=1,widnsp +c store the values ... + fmtaby (i,itp,1)=fwidth(itp,isoit(itp),tabx(i)) + 31 continue +c calculate the second derivate and store it in 'fmtaby(,,2)' + call spline (tabx(1),fmtaby(1,itp,1),widnsp,abl0,abln, + . fmtaby(1,itp,2)) + 30 continue + write (6,*) '(2/7) ready.' + +c the flag indicates, that now all full widths are tabulated + wtabflg=1 + +c now fill the y-values of the partial branching ratios + +c loop over all baryons + do 40 itp=minbar,maxbar +c get the mass of this particle + mir=massit(itp) +c get the range of possible decay channels + call brange (itp, cmin, cmax) +c check, if there are any decay channels + if (cmax.gt.0) then +c loop over all decay channels + do 41 bchan=cmin,cmax +c now get the outgoing particles 'i1' and 'i2' for the channel 'j' +c 'bran' is the mass independent branching ratio (tabulated in blockres) +c 'bflag' indicates, if 'i1', 'i2' or both are broad + call b3type (itp,bchan,bran,i1,i2,i3,i4) +c check, if decay is allowed + + smass=mminit(i2) + if(i3.ne.0) smass=smass+mminit(i3) + if(i4.ne.0) smass=smass+mminit(i4) + + if (bran.gt.1d-9.and.mir.gt.mminit(i1)+smass) then +c loop over all x-values + do 42 i=1,widnsp +c store the values + +cdh +* write(*,*)'mkwtab: i,itp,bchan=',i,itp,bchan +* write(*,*)'mkwtab: isoit,tabx,bran,i1,i2,i3,i4=', +* & isoit(itp),tabx(i),bran,i1,i2,i3,i4 +cdh + + pbtaby(i,1,itp,bchan)= + . fbrancx (bchan,itp,isoit(itp),tabx(i), + . bran,i1,i2,i3,i4) + 42 continue +c calculate the second derivate and store it in 'pbtaby(,2,,)' + call spline (tabx(1),pbtaby(1,1,itp,bchan),widnsp, + . abl0,abln,pbtaby(1,2,itp,bchan)) + end if + 41 continue + end if + 40 continue + write (6,*) '(3/7) ready.' + +c loop over all mesons + do 50 itp=minmes,maxmes +c get the mass of this particle + mir=massit(itp) +c get the range of possible decay channels + call brange (itp, cmin, cmax) +c check, if there are any decay channels + if (cmax.gt.0) then + do 51 bchan=cmin,cmax +c now get the outgoing particles 'i1' and 'i2' for the channel 'j' +c 'bran' is the mass independent branching ratio (tabulated in blockres) +c 'bflag' indicates, if 'i1', 'i2' or both are broad + call b3type(itp,bchan,bran,i1,i2,i3,i4) +c!!! + smass=mminit(i2) + if(i3.ne.0) smass=smass+mminit(i3) + if(i4.ne.0) smass=smass+mminit(i4) + + if (bran.gt.1d-9.and.mir.gt.mminit(i1)+smass) then +c loop over all x-values + do 52 i=1,widnsp + pmtaby(i,1,itp,bchan)= + . fbrancx (bchan,itp,isoit(itp),tabx(i), + . bran,i1,i2,i3,i4) + 52 continue +c calculate the second derivate and store it in 'pmtaby(,2,,)' + call spline (tabx(1),pmtaby(1,1,itp,bchan),widnsp, + . abl0,abln,pmtaby(1,2,itp,bchan)) + end if + 51 continue + end if + 50 continue + + write (6,*) '(4/7) ready.' + + +c calculate the norm integral of the Breit-Wigner functions +c with mass dependent widths + +c..baryons + do 60 i=minbar,maxbar + bwbarnorm(i)=bwnorm(i) +60 continue + write (6,*) '(5/7) ready.' + +c.. mesons + do 61 i=minmes,maxmes + bwmesnorm(i)=bwnorm(i) +61 continue + write (6,*) '(6/7) ready.' + +c now all branching ratios and BW-integrals are tabulated + wtabflg=2 + +ce tabulate fppfit +c fill the x-values +c range of tabulated cross sections + first=2d0*massit(nucleon)+massit(pimeson) + last=maxtab1 +c calculate the steps +c the energies are weighted quadratically + delta=(last-first)/((widnsp-1)*2./3.)**2 +c store the values into 'tabx' +c 66 % of all fixpoints between mintab and maxtab1 + do 69 i=1,int(widnsp*2./3.) + m=first+(i-1)**2*delta + tabxnd(i)=m + 69 continue +c 33 % of all fixpoints with larger, constant delta between maxtab1 and maxtab2 + delta=(maxtab2-last)/((widnsp-1)*1./3.) + do 70 i=int(widnsp*2./3.)+1,widnsp + m=maxtab1+(i-1-int(widnsp*2./3.))*delta + tabxnd(i)=m + 70 continue + + +c.. all pp-exit channels +c loop over first out-particle N & D + do 81 ii1=1,2 + if(ii1.eq.1)i1=minnuc + if(ii1.eq.2)i1=mindel +c loop over second out-particle N(1440)..maxdel + do 82 i2=minnuc+1,maxdel +c loop over all x-values + do 83 i=1,widnsp +c store the values ... + frrtaby(i,1,ii1,i2)=fppfit(99,tabxnd(i),i1,i2) +83 continue +c calculate the second derivate and store it in 'frrtaby(,,2)' + call spline (tabxnd(1),frrtaby(1,1,ii1,i2),widnsp,abl0,abln, + . frrtaby(1,2,ii1,i2)) +82 continue +81 continue + + + write (6,*) '(7/7) ready.' + +c pp cross sections are now tabulated + wtabflg=3 + +c save the table on disk + call savewtab + + return + end + + + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + real*8 function splint (xa,ya,y2a,n,x) +c +c Unit : general infrastructure +c Author : (C) Copr. 1986-92 Numerical Recipes Software +c Date : 03/07/96 +c Revision : 1.1 +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + + include 'comres.f' + include 'comwid.f' + + integer n + integer k,khi,klo + real*8 x,y,xa(n),y2a(n),ya(n) + real*8 a,b,h + + save khi,klo + data klo/1/ + data khi/2/ + + if(khi.le.n.and.x.ge.xa(klo).and.x.lt.xa(khi))then + elseif(khi+1.le.n.and.x.ge.xa(klo+1).and.x.lt.xa(khi+1))then + klo=klo+1 + khi=khi+1 + else + + klo=1 + khi=n +1 if (khi-klo.gt.1) then + k=(khi+klo)/2d0 + if(xa(k).gt.x)then + khi=k + else + klo=k + endif + goto 1 + endif + endif + + h=xa(khi)-xa(klo) + if (h.eq.0.) pause 'bad xa input in splint' + a=(xa(khi)-x)/h + b=(x-xa(klo))/h + y=a*ya(klo)+b*ya(khi)+((a*a*a-a)*y2a(klo)+ + . (b*b*b-b)*y2a(khi))*(h*h)/6d0 + splint=y + + return + end + + + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + real*8 function splintth (xa,ya,y2a,n,x,th) +c +c Unit : general infrastructure +c Author : (C) Copr. 1986-92 Numerical Recipes Software +c modified my H. Weber +c Date : 03/07/96 +c Revision : 1.1 +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc +c +c split routine with nice threshold behaviour for cross sections +c + + implicit none + + include 'comres.f' + include 'comwid.f' + + integer n + integer k,khi,klo + real*8 x,y,xa(n),y2a(n),ya(n) + real*8 a,b,h,th + + save khi,klo + data klo/1/ + data khi/2/ + + if(khi.le.n.and.x.ge.xa(klo).and.x.lt.xa(khi))then + elseif(khi+1.le.n.and.x.ge.xa(klo+1).and.x.lt.xa(khi+1))then + klo=klo+1 + khi=khi+1 + else + + klo=1 + khi=n +1 if (khi-klo.gt.1) then + k=(khi+klo)/2d0 + if(xa(k).gt.x)then + khi=k + else + klo=k + endif + goto 1 + endif + endif + h=xa(khi)-xa(klo) + if (h.eq.0.) pause 'bad xa input in splint' + if (xa(khi).lt.(th+2*h)) then +c linear approximation close to threshold (within 2h) + splintth=ya(khi)*(x-th)/(xa(khi)-th) + else + a=(xa(khi)-x)/h + b=(x-xa(klo))/h + y=a*ya(klo)+b*ya(khi)+((a*a*a-a)*y2a(klo)+ + . (b*b*b-b)*y2a(khi))*(h*h)/6d0 + splintth=y + endif + + return + end diff --git a/Processes/UrQMD/testUrQMD.cc b/Processes/UrQMD/testUrQMD.cc new file mode 100644 index 0000000000000000000000000000000000000000..3e347a827eaf5564836d5f82cabb55dbce471ffe --- /dev/null +++ b/Processes/UrQMD/testUrQMD.cc @@ -0,0 +1,208 @@ +/* + * (c) Copyright 2019 CORSIKA Project, corsika-project@lists.kit.edu + * + * See file AUTHORS for a list of contributors. + * + * This software is distributed under the terms of the GNU General Public + * Licence version 3 (GPL Version 3). See file LICENSE for a full version of + * the license. + */ + +#include <corsika/process/urqmd/UrQMD.h> +#include <corsika/random/RNGManager.h> + +#include <corsika/geometry/Point.h> +#include <corsika/geometry/RootCoordinateSystem.h> +#include <corsika/geometry/Vector.h> + +#include <corsika/units/PhysicalConstants.h> +#include <corsika/units/PhysicalUnits.h> + +#include <corsika/utl/CorsikaFenv.h> + +#include <corsika/particles/ParticleProperties.h> +#include <corsika/setup/SetupStack.h> +#include <corsika/setup/SetupTrajectory.h> + +#include <corsika/environment/Environment.h> +#include <corsika/environment/HomogeneousMedium.h> +#include <corsika/environment/NuclearComposition.h> + +#include <tuple> +#include <utility> + +#define CATCH_CONFIG_MAIN // This tells Catch to provide a main() - only do this in one + // cpp file +#include <catch2/catch.hpp> + +using namespace corsika; +using namespace corsika::process::UrQMD; +using namespace corsika::units::si; + +template <typename TStackView> +auto sumCharge(TStackView const& view) { + int totalCharge = 0; + + for (auto const& p : view) { totalCharge += particles::GetChargeNumber(p.GetPID()); } + + return totalCharge; +} + +template <typename TStackView> +auto sumMomentum(TStackView const& view, geometry::CoordinateSystem const& vCS) { + geometry::Vector<hepenergy_d> sum{vCS, 0_eV, 0_eV, 0_eV}; + + for (auto const& p : view) { sum += p.GetMomentum(); } + + return sum; +} + +auto setupEnvironment(particles::Code vTargetCode) { + // setup environment, geometry + auto env = std::make_unique<environment::Environment<environment::IMediumModel>>(); + auto& universe = *(env->GetUniverse()); + const geometry::CoordinateSystem& cs = env->GetCoordinateSystem(); + + auto theMedium = + environment::Environment<environment::IMediumModel>::CreateNode<geometry::Sphere>( + geometry::Point{cs, 0_m, 0_m, 0_m}, + 1_km * std::numeric_limits<double>::infinity()); + + using MyHomogeneousModel = environment::HomogeneousMedium<environment::IMediumModel>; + theMedium->SetModelProperties<MyHomogeneousModel>( + 1_kg / (1_m * 1_m * 1_m), + environment::NuclearComposition(std::vector<particles::Code>{vTargetCode}, + std::vector<float>{1.})); + + auto const* nodePtr = theMedium.get(); + universe.AddChild(std::move(theMedium)); + + return std::make_tuple(std::move(env), &cs, nodePtr); +} + +template <typename TNodeType> +auto setupStack(int vA, int vZ, HEPEnergyType vMomentum, TNodeType* vNodePtr, + geometry::CoordinateSystem const& cs) { + auto stack = std::make_unique<setup::Stack>(); + auto constexpr mN = corsika::units::constants::nucleonMass; + + geometry::Point const origin(cs, {0_m, 0_m, 0_m}); + corsika::stack::MomentumVector const pLab(cs, {vMomentum, 0_GeV, 0_GeV}); + + HEPEnergyType const E0 = + sqrt(units::si::detail::static_pow<2>(mN * vA) + pLab.squaredNorm()); + auto particle = + stack->AddParticle(std::tuple<particles::Code, units::si::HEPEnergyType, + corsika::stack::MomentumVector, geometry::Point, + units::si::TimeType, unsigned short, unsigned short>{ + particles::Code::Nucleus, E0, pLab, origin, 0_ns, vA, vZ}); + + particle.SetNode(vNodePtr); + return std::make_tuple( + std::move(stack), + std::make_unique<decltype(corsika::stack::SecondaryView(particle))>(particle)); +} + +template <typename TNodeType> +auto setupStack(particles::Code vProjectileType, HEPEnergyType vMomentum, + TNodeType* vNodePtr, geometry::CoordinateSystem const& cs) { + auto stack = std::make_unique<setup::Stack>(); + + geometry::Point const origin(cs, {0_m, 0_m, 0_m}); + corsika::stack::MomentumVector const pLab(cs, {vMomentum, 0_GeV, 0_GeV}); + + HEPEnergyType const E0 = + sqrt(units::si::detail::static_pow<2>(particles::GetMass(vProjectileType)) + + pLab.squaredNorm()); + auto particle = stack->AddParticle( + std::tuple<particles::Code, units::si::HEPEnergyType, + corsika::stack::MomentumVector, geometry::Point, units::si::TimeType>{ + vProjectileType, E0, pLab, origin, 0_ns}); + + particle.SetNode(vNodePtr); + return std::make_tuple( + std::move(stack), + std::make_unique<decltype(corsika::stack::SecondaryView(particle))>(particle)); +} + +TEST_CASE("UrQMD") { + SECTION("conversion") { + REQUIRE_THROWS(process::UrQMD::ConvertFromUrQMD(106, 0)); + REQUIRE(process::UrQMD::ConvertFromUrQMD(101, 0) == particles::Code::Pi0); + REQUIRE(process::UrQMD::ConvertToUrQMD(particles::Code::PiPlus) == + std::make_pair<int, int>(101, 2)); + } + + feenableexcept(FE_INVALID); + corsika::random::RNGManager::GetInstance().RegisterRandomStream("UrQMD"); + UrQMD urqmd; + + SECTION("cross sections") { + auto [env, csPtr, nodePtr] = setupEnvironment(particles::Code::Unknown); + auto const& cs = *csPtr; + + particles::Code validProjectileCodes[] = { + particles::Code::PiPlus, particles::Code::PiMinus, particles::Code::Proton, + particles::Code::Neutron, particles::Code::KPlus, particles::Code::KMinus, + particles::Code::K0, particles::Code::K0Bar}; + + for (auto code : validProjectileCodes) { + auto [stack, view] = setupStack(code, 100_GeV, nodePtr, cs); + REQUIRE(stack->GetSize() == 1); + + // simple check whether the cross-section is non-vanishing + REQUIRE(urqmd.GetCrossSection(view->GetProjectile(), particles::Code::Proton) / + 1_mb > + 0); + REQUIRE(urqmd.GetCrossSection(view->GetProjectile(), particles::Code::Nitrogen) / + 1_mb > + 0); + REQUIRE(urqmd.GetCrossSection(view->GetProjectile(), particles::Code::Oxygen) / + 1_mb > + 0); + REQUIRE(urqmd.GetCrossSection(view->GetProjectile(), particles::Code::Argon) / + 1_mb > + 0); + } + } + + SECTION("nucleon projectile") { + auto [env, csPtr, nodePtr] = setupEnvironment(particles::Code::Oxygen); + unsigned short constexpr A = 14, Z = 7; + auto [stackPtr, secViewPtr] = setupStack(A, Z, 400_GeV, nodePtr, *csPtr); + + // must be assigned to variable, cannot be used as rvalue?! + auto projectile = secViewPtr->GetProjectile(); + auto const projectileMomentum = projectile.GetMomentum(); + [[maybe_unused]] process::EProcessReturn const ret = urqmd.DoInteraction(projectile); + + REQUIRE(sumCharge(*secViewPtr) == + Z + particles::GetChargeNumber(particles::Code::Oxygen)); + + auto const secMomSum = + sumMomentum(*secViewPtr, projectileMomentum.GetCoordinateSystem()); + REQUIRE((secMomSum - projectileMomentum).norm() / projectileMomentum.norm() == + Approx(0).margin(1e-2)); + } + + SECTION("\"special\" projectile") { + auto [env, csPtr, nodePtr] = setupEnvironment(particles::Code::Oxygen); + auto [stackPtr, secViewPtr] = + setupStack(particles::Code::PiPlus, 400_GeV, nodePtr, *csPtr); + + // must be assigned to variable, cannot be used as rvalue?! + auto projectile = secViewPtr->GetProjectile(); + auto const projectileMomentum = projectile.GetMomentum(); + + [[maybe_unused]] process::EProcessReturn const ret = urqmd.DoInteraction(projectile); + + REQUIRE(sumCharge(*secViewPtr) == + particles::GetChargeNumber(particles::Code::PiPlus) + + particles::GetChargeNumber(particles::Code::Oxygen)); + + auto const secMomSum = + sumMomentum(*secViewPtr, projectileMomentum.GetCoordinateSystem()); + REQUIRE((secMomSum - projectileMomentum).norm() / projectileMomentum.norm() == + Approx(0).margin(1e-2)); + } +} diff --git a/Processes/UrQMD/urqmd.f b/Processes/UrQMD/urqmd.f new file mode 100644 index 0000000000000000000000000000000000000000..9319dae63135f3fbe34fa422cd0ec0fc88f8a04c --- /dev/null +++ b/Processes/UrQMD/urqmd.f @@ -0,0 +1,357 @@ +c $Id: urqmd.f,v 1.22 2001/04/06 22:38:54 weber Exp $ +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC +cdh program UrQMD + subroutine UrQMD(iflbmax) +c +c Authors : The UrQMD collaboration +c S.A. Bass, M. Belkacem, M. Bleicher, M. Brandstetter, +c L. Bravina, C. Ernst, L. Gerland, M. Hofmann, +c S. Hofmann, J. Konopka, G. Mao, L. Neise, S. Soff, +c C. Spieles, H. Weber, L.A. Winckelmann, H. Stoecker +c and W. Greiner +c +c Revision: 1.2 +c +cc contact address: +cc +cc urqmd@th.physik.uni-frankfurt.de +cc +c +c This is the main module of {\tt urqmd}. It servers as a connection between +c the initialization, the propagation (including the real part of the +c optical potential) and the collision term (imaginary part of the optical +c potential). +c +c iflbmax: flag for retrying interaction after non-interaction +c 0 = do retry until interaction happens +c 1 = do not ( propagate particle, retry then) +c +C modifications for use in connection with CORSIKA by D. Heck +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + implicit none + include 'coms.f' + include 'comres.f' + include 'options.f' + include 'colltab.f' + include 'inputs.f' + include 'newpart.f' + include 'boxinc.f' +c + integer i,j,k,steps,ii,ocharge,ncharge, mc, mp, noc, it1,it2 + real*8 sqrts,otime,xdummy,st + logical isstable + integer stidx,iflbmax + real*8 Ekinbar, Ekinmes, ESky2, ESky3, EYuk, ECb, EPau + common /energies/ Ekinbar, Ekinmes, ESky2, ESky3, EYuk, ECb, EPau + integer cti1sav,cti2sav + common/cncc/ncc + integer*8 ncc + +c +c numerical/technical initialisation +c +cdh call uinit(0) +cdh call osc_header +cdh call osc99_header +c +c Main program +c + noc=0 + + 1 mc=0 + mp=0 +c +c loop over all events +c +cdh do 10 event=1,nevents + +c start event here +c + +c time is the system time at the BEGINNING of every timestep + time = 0.0 + +c initialize random number generator +c call auto-seed generator only for first event and if no seed was fixed +cdh if(.not.firstseed.and.(.not.fixedseed)) then +cdh ranseed=-(1*abs(ranseed)) +cdh call sseed(ranseed) +cdh else +cdh firstseed=.false. +cdh endif +cdh +cdh write(6,*)'event# ',event,ranseed + +c +c initialisation of physics quantities +c + call init + +c old time if an old fort.14 is used + if(CTOption(40).eq.1)time=acttime + +c output preparation + +c write headers to file + call output(13) + call output(14) + call output(15) +cdh call output(16) +cdh if(event.eq.1)call output(17) +cdh call osc99_event(-1) + + +c for CTOption(4)=1 : output of initialization configuration + if(CTOption(4).eq.1)call file14out(0) + +c participant/spectator model: +cdh if(CTOption(28).ne.0) call rmspec(0.5d0*bimp,-(0.5d0*bimp)) + +c compute time of output + otime = outsteps*dtimestep + +c reset time step counter + steps = 0 + +c loop over all timesteps + + do 20 steps=1,nsteps +c store coordinates in arrays with *_t +c this is needed for MD type propagation + if (eos.ne.0) then + do 23 j=1,npart + r0_t(j) = r0(j) + rx_t(j) = rx(j) + ry_t(j) = ry(j) + rz_t(j) = rz(j) + 23 continue + end if + +c we are at the beginning of the timestep, set current time (acttime) + acttime = time + +c option for MD without collision term + if(CTOption(16).ne.0) goto 103 + +c Load collision table with next collisions in current timestep + call colload +c check for collisions in time-step, nct = # of collisions in table + if (nct.gt.0) then + +c entry-point for collision loop in case of full colload after every coll. + 101 continue + k = 0 +c normal entry-point for collision loop + 100 continue +c get next collision + call getnext(k) + +c exit collision loop if no collisions are left + if (k.eq.0) goto 102 + +c propagate all particles to next collision time +c store actual time in acttime, propagation time st=cttime(k)-acttime + st=cttime(k)-acttime + call cascstep(acttime,st) +c new actual time (for upcoming collision) + acttime = cttime(k) + +c perform collision + + if(cti2(k).gt.0.)then + if(abs(sqrts(cti1(k),cti2(k))-ctsqrts(k)).gt.1d-3)then + write(6,*)' ***(E) wrong collision update (col) ***' + write(6,*)cti1(k),cti2(k), + & ctsqrts(k),sqrts(cti1(k),cti2(k)) + endif + else if(cti2(k).eq.0.and. + & abs(fmass(cti1(k))-ctsqrts(k)).gt.1d-3) then + write(6,*)' *** main(W) wrong collision update (decay)' + write(6,*)ctag,cti1(k),ityp(cti1(k)),dectime(cti1(k)), + & fmass(cti1(k)),ctsqrts(k) + endif + + ocharge=charge(cti1(k)) + if(cti2(k).gt.0) ocharge=ocharge+charge(cti2(k)) + +c store quantities in local variables for charge conservation check + it1= ityp(cti1(k)) + if(cti2(k).gt.0)it2= ityp(cti2(k)) + +c increment "dirty" collision counter + if(cti2(k).gt.0)then !scatter !scatter + mc=mc+1 + endif +c perform scattering/decay + ncc = ncc+1 + cti1sav = cti1(k) ! hjd + cti2sav = cti2(k) ! hjd + call scatter(cti1(k),cti2(k),ctsigtot(k),ctsqrts(k), + & ctcolfluc(k)) + +c +c update collision table +c +c normal update mode + if(CTOption(17).eq.0) then + if(nexit.eq.0) then +c new collision partners for pauli-blocked states (nexit=0) +c hjd1 and cdh + if (cti1(k).ne.cti1sav.or.cti2(k).ne.cti2sav) then + goto 1 +c cti1(k) = cti1sav !!! hjd1 +c cti2(k) = cti2sav !!! hjd1 + endif +c hjd1 and cdh + call collupd(cti1(k),1) + if(cti2(k).gt.0) call collupd(cti2(k),1) + else + ncharge=0 +c new collision partners for scattered/produced particles (nexit><0) + do 30 i=1,nexit +c ncharge is used for charge conservation check + ncharge=ncharge+charge(inew(i)) + call collupd(inew(i),1) + 30 continue + +c charge conservation check + if(ocharge.ne.ncharge) then + write(6,*)'ch-conservation error coll/dec ',ctag + write(6,*)' it1:',it1,' it2:',it2 + write(6,*)' ch:',ocharge,ncharge + write(6,*)'cti1(k),cti2(k),ctsigtot(k),ctsqrts(k)' + write(6,*)cti1(k),cti2(k),ctsigtot(k),ctsqrts(k) + endif + endif + +c update collisions for partners of annihilated particles + do 55 ii=1,nsav + call collupd(ctsav(ii),1) + 55 continue + nsav=0 + + else ! (CTOption(17).ne.0) +c full collision load + call colload + endif + + if (CTOption(17).eq.0) goto 100 + goto 101 + +c this is the point to jump to after all collisions in the timestep +c have been taken care of + 102 continue + + endif ! (nct.gt.0) + +c After all collisions in the timestep are done, propagate to end of +c the timestep. + +c point to jump to in case of MD without collision term + 103 continue + +c increment timestep + time = time+dtimestep + +c After all collisions in the timestep are done, propagate to end of +c the timestep. + call cascstep(acttime,time-acttime) + +c in case of potential interaction, do MD propagation step + if (eos.ne.0) then + +c set initial conditions for MD propagation-step + do 24 j=1,npart + r0(j) = r0_t(j) + rx(j) = rx_t(j) + ry(j) = ry_t(j) + rz(j) = rz_t(j) + 24 continue + +c now molecular dynamics trajectories + call proprk(time,dtimestep) + + end if ! (eos.ne.0) + +c perform output if desired +cdh if(mod(steps,outsteps).eq.0.and.steps.lt.nsteps)then +cdh if(CTOption(28).eq.2)call spectrans(otime) +cdh call file14out(steps) +cdh endif ! output handling + + 20 continue ! time step loop + +c + acttime=time +c optional decay of all unstable particles before final output +c DANGER: pauli-blocked decays are not performed !!! + if(CTOption(18).eq.0) then +c no do-loop is used because npart changes in loop-structure + i=0 + nct=0 + actcol=0 +c disable Pauli-Blocker for final decays + CTOption(10)=1 +c decay loop structure starts here + 40 continue + i=i+1 + +c is particle unstable + if(dectime(i).lt.1.d30) then + 41 continue + isstable = .false. + do 44 stidx=1,nstable + if (ityp(i).eq.stabvec(stidx)) then +cdh write (6,*) 'no decay of particle ',ityp(i) + isstable = .true. + endif + 44 enddo + if (.not.isstable) then +c perform decay + call scatter(i,0,0.d0,fmass(i),xdummy) +c backtracing if decay-product is unstable itself + if(dectime(i).lt.1.d30) goto 41 + endif + endif +c check next particle + if(i.lt.npart) goto 40 + endif ! final decay +c final output + +cdh if(CTOption(28).eq.2)call spectrans(otime) + + call file13out(nsteps) + call file14out(nsteps) +cdh call file16out +cdh call osc_event +cdh call osc99_event(1) +cdh call osc99_eoe + +c print *,"noc",noc,bdist,ctag,bimp + mp=mp+npart + if(iflbmax.eq.0.and.ctag.eq.0)then +cdh write(*,*)'(W) No collision in event ',event + noc=noc+1 + if(noc.ge.1000 .and. mod(noc,1000) .eq. 0)then + print *,'no collision problem in UrQMD' +c~ stop + endif + if (noc.ge.50000) then + call exit(2) ! think of a better way to hand over the error + ! to C++ + endif + goto 1 + endif + + write(*,*) 'iterations =', noc + +c end of event loop +cdh 10 continue + +cdh write(6,*)'no. of collisions = ',mc/dble(nevents), ' (per event)' +cdh write(6,*)'final particles = ',mp/dble(nevents), ' (per event)' +cdh write(6,*)'empty events : ', noc, ' = ', +cdh + noc*1d2/dble(nevents), '%' + return + end diff --git a/Processes/UrQMD/urqmdInterface.F b/Processes/UrQMD/urqmdInterface.F new file mode 100644 index 0000000000000000000000000000000000000000..4fe9c044e447f577559444be28e0798ab3cd678e --- /dev/null +++ b/Processes/UrQMD/urqmdInterface.F @@ -0,0 +1,434 @@ +c 18.11.2011 Link routines between UrQMD 1.3 and CONEX. +c author T. Pierog based on CORSIKA and EPOS link to UrQMD + +c adapted by M. Reininghaus for linking UrQMD to CORSIKA 8 (Apr 2019) + +#ifdef __STD__ +#define __GHEISHA__ +#define __QGSJET__ +#define __ANALYSIS__ +#endif + + +c----------------------------------------------------------------------- + subroutine IniUrQMD +c----------------------------------------------------------------------- +c Primary initialization for UrQMD 1.31 +c----------------------------------------------------------------------- + implicit none +c CONEX includes +c~ #include "conex.h" +c~ #include "conex.incnex" +#ifndef __CXCORSIKA__ +c~ character*500 furqdat +c~ integer ifurqdat, nfurqdat +c~ common/urqfname/ furqdat, ifurqdat, nfurqdat + + include 'boxinc.f' + include 'inputs.f' + include 'options.f' + +c commons from coms.f + integer Ap, At, Zp, Zt, npart, nbar, nmes, ctag + integer nsteps,ranseed,event,eos,dectag,uid_cnt + integer NHardRes,NSoftRes,NDecRes,NElColl,NBlColl + common /sys/ npart, nbar, nmes, ctag,nsteps,uid_cnt, + + ranseed,event,Ap,At,Zp,Zt,eos,dectag, + + NHardRes,NSoftRes,NDecRes,NElColl,NBlColl + +c local + INTEGER i,io,ia,ie,id + CHARACTER CTPStrg(numctp)*60, CTOStrng(numcto)*60 + integer mxie,mxid,mxia + parameter (mxie=41,mxid=10,mxia=3) + character adum + double precision sig_u1,ekdummy + integer iamaxu,idmaxu,iemaxu +c~ common /cxs_u1/ sig_u1(mxie,mxid,mxia),iamaxu,idmaxu,iemaxu +c~ double precision xs(3),bim(3) +c~ c M.R.: bim added to cxs_u2 +c~ common /cxs_u2/ xs,bim + integer iudebug +c~ data bim/6.d0,6.d0,7.d0/ + integer init + data init/0/ + SAVE + + if(init.ge.1)return + init=init+1 +#ifdef __CXDEBUG__ + call utisx1('iniurqmd ',4) + write(*,'(a)')'initialize URQMD ...' +#endif + +C----------------------------------------------------------------------- + +c~ IF ( isx.ge.2 ) THEN +c~ IUDEBUG = isx-1 +c~ ELSE +c~ IUDEBUG = 0 +c~ ENDIF + + WRITE (*,*) + $ '############################################################' + WRITE (*,*) + $ '## ##' + WRITE (*,*) + $ '## UrQMD 1.3.1 University of Frankfurt ##' + WRITE (*,*) + $ '## urqmd@th.physik.uni-frankfurt.de ##' + WRITE (*,*) + $ '## ##' + WRITE (*,*) + $ '############################################################' + WRITE (*,*) + $ '## ##' + WRITE (*,*) + $ '## please cite when using this model: ##' + WRITE (*,*) + $ '## S.A.Bass et al. Prog.Part.Nucl.Phys. 41 (1998) 225 ##' + WRITE (*,*) + $ '## M.Bleicher et al. J.Phys. G25 (1999) 1859 ##' + WRITE (*,*) + $ '## ##' + WRITE (*,*) + $ '############################################################' + +C SET THE 'LARGE' CROSS-SECTIONS FOR ALL 3 TARGET ELEMENTS +c~ DO I = 1, 3 +c~ XS(I) = 10.D0 * PI * BIM(I)**2 +c~ ENDDO + +C SET NMAX TO DEFAULT VALUE + call set0 + call params + +C THIS IS THE SUBSTITUE FOR THE URQMD INPUT ROUTINE +C INITIALIZE COUNTERS + boxflag = 0 + mbflag = 0 + edens = 0.d0 + para = 0 + solid = 0 + mbox = 0 + io = 0 + +C THE FOLLOWING FLAGS CHECK, WHETHER ALL NECESSARY INPUT IS GIVEN +C PROJECTILE + prspflg = 0 +C TARGET + trspflg = 0 +C + srtflag = 0 + firstev = 0 +C EXCITATION FUNCTION + nsrt = 1 + npb = 1 + efuncflag = 0 +C DEFAULT NUMBER OF EVENTS + nevents = 1 +C DEFAULT NUMBER OF TIMESTEPS + nsteps = 1000 + +C SKIP CONDITIONS ON UNIT 13, 14, 15, 16 & 18 +C SUPPRESS ALL OUTPUT + bf13 = .true. + bf14 = .true. + bf15 = .true. + bf16 = .true. + bf18 = .true. + bf19 = .true. + bf20 = .true. +C SET DEBUG OUTPUT DEPENDING ON CHOSEN DEBUG LEVEL +C SET THE OUTPUT OF UNITS 13, 14, 15 TO THE DEBUG OUTPUT UNIT +c~ IF ( IUDEBUG .EQ. 1 ) THEN +c~ bf13 = .true. +c~ bf14 = .false. +c~ call uounit(14,IFCK) +c~ bf15 = .true. +c~ ELSEIF ( IUDEBUG .EQ. 2 ) THEN +c~ bf13 = .false. +c~ call uounit(13,IFCK) +c~ bf14 = .true. +c~ bf15 = .true. +c~ ELSEIF ( IUDEBUG .GT. 2 ) THEN +c~ bf13 = .true. +c~ bf14 = .true. +c~ bf15 = .false. +c~ call uounit(15,IFCK) +c~ ENDIF + do i = 1, numcto + CTOdc(i) = ' ' + enddo + do i = 1, numctp + CTPdc(i) = ' ' + enddo + do i = 1, maxstables + stabvec(i) = 0 + enddo + nstable = 0 + +C DEFAULT SETTINGS FOR CTParam AND CTOption +C DEFAULT SETTINGS FOR CTParam + CTParam(1)=1.d0 + CTPStrg(1)='scaling factor for decay-width' + CTParam(2)=0.52d0 + CTPStrg(2)='used for minimal stringmass & el/inel cut in makestr' + CTParam(3)=2.d0 + CTPStrg(3)='velocity exponent for modified AQM' + CTParam(4)=0.3d0 + CTPStrg(4)='transverse pion mass, used in make22 & strexct' + CTParam(5)=0.d0 + CTPStrg(5)='probabil. for quark rearrangement in cluster' + CTParam(6)=0.37d0 + CTPstrg(6)='strangeness probability' + CTParam(7)=0.d0 + CTPStrg(7)='charm probability (not yet implemented in UQMD)' + CTParam(8)=0.093d0 + CTPStrg(8)='probability to create a diquark' + CTParam(9)=0.35d0 + CTPStrg(9)='kinetic energy cut off for last string break' + CTParam(10)=0.25d0 + CTPStrg(10)='min. kinetic energy for hadron in string' + CTParam(11)=0.d0 + CTPStrg(11)='fraction of non groundstate resonances' + CTParam(12)=.5d0 + CTPStrg(12)='probability for rho 770 in String' + CTParam(13)=.27d0 + CTPStrg(13)='probability for rho 1450 (rest->rho1700)' + CTParam(14)=.49d0 + CTPStrg(14)='probability for omega 782' + CTParam(15)=.27d0 + CTPStrg(15)='probability for omega 1420(rest->om1600)' + CTParam(16)=1.0d0 + CTPStrg(16)='mass cut betw. rho770 and rho 1450' + CTParam(17)=1.6d0 + CTPSTRG(17)='mass cut betw. rho1450 and rho1700' + CTParam(18)=.85d0 + CTPStrg(18)='mass cut betw. om 782 and om1420' + CTParam(19)=1.55d0 + CTPStrg(19)='mass cut betw. om1420 and om1600' + CTParam(20)=0.0d0 + CTPStrg(20)=' distance for second projectile' + CTParam(21)=0.0d0 + CTPStrg(21)=' deformation parameter' + + CTParam(25)=.9d0 + CTPStrg(25)=' probability for diquark not to break' + CTParam(26)=50.d0 + CTPStrg(26)=' maximum trials to get string masses' + CTParam(27)=1.d0 + CTPStrg(27)=' scaling factor for xmin in string excitation' + CTParam(28)=1.d0 + CTPStrg(28)=' scaling factor for transverse fermi motion' + CTParam(29)=0.4d0 + CTPStrg(29)=' single strange di-quark suppression factor ' + CTParam(30)=1.5d0 + CTPStrg(30)=' radius offset for initialization ' + CTParam(31)=1.6d0 + CTPStrg(31)=' sigma of gaussian for tranverse momentum tranfer ' + CTParam(32)=0.d0 + CTPStrg(32)=' alpha-1 for valence quark distribution ' + CTParam(33)=2.5d0 + CTPStrg(33)=' betav for valence quark distribution (DPM)' + CTParam(34)=0.1d0 + CTPStrg(34)=' minimal x multiplied with ecm ' + CTParam(35)=3.0d0 + CTPStrg(35)=' offset for cut for the FSM ' + CTParam(36)=0.275d0 + CTPStrg(36)=' fragmentation function parameter a ' + CTParam(37)=0.42d0 + CTPStrg(37)=' fragmentation function parameter b ' + CTParam(38)=1.08d0 + CTPStrg(38)=' diquark pt scaling factor ' + CTParam(39)=0.8d0 + CTPStrg(39)=' strange quark pt scaling factor ' + CTParam(40)=0.5d0 + CTPStrg(40)=' betas-1 for valence quark distribution (LEM)' + CTParam(41)=0.d0 + CTPStrg(41)=' distance of initialization' + CTParam(42)=0.55d0 + CTPStrg(42)=' width of gaussian -> pt in string-fragmentation ' + CTParam(43)=5.d0 + CTPStrg(43)=' maximum kinetic energy in mesonic clustr ' + CTParam(44)=0.8d0 + CTPStrg(44)=' prob. of double vs. single excitation for AQM inel.' + CTParam(45)=0.5d0 + CTPStrg(45)=' offset for minimal mass generation of strings' + CTParam(46)=800000.d0 + CTPStrg(46)=' maximal number of rejections for initialization' + CTParam(47)=1.0d0 + CTPStrg(47)=' field feynman fragmentation funct. param. a' + CTParam(48)=2.0d0 + CTPStrg(48)=' field feynman fragmentation funct. param. b' + + CTParam(50)=1.d0 + CTPStrg(50)=' enhancement factor for 0- mesons' + CTParam(51)=1.d0 + CTPStrg(51)=' enhancement factor for 1- mesons' + CTParam(52)=1.d0 + CTPStrg(52)=' enhancement factor for 0+ mesons' + CTParam(53)=1.d0 + CTPStrg(53)=' enhancement factor for 1+ mesons' + CTParam(54)=1.d0 + CTPStrg(54)=' enhancement factor for 2+ mesons' + CTParam(55)=1.d0 + CTPStrg(55)=' enhancement factor for 1+-mesons' + CTParam(56)=1.d0 + CTPStrg(56)=' enhancement factor for 1-*mesons' + CTParam(57)=1.d0 + CTPStrg(57)=' enhancement factor for 1-*mesons' + CTParam(58)=1.d0 + CTPStrg(58)=' scaling factor for DP time-delay' + +C DEFAULT SETTINGS FOR CTOption + CTOption(1)=1 ! hjd1 + CTOStrng(1)=' resonance widths are mass dependent ' + CTOption(2)=0 + CTOStrng(2)=' conservation of scattering plane' + CTOption(3)=0 + CTOStrng(3)=' use modified detailed balance' + CTOption(4)=0 + CTOStrng(4)=' no initial conf. output ' + CTOption(5)=0 + CTOStrng(5)=' fixed random impact parameter' + CTOption(6)=0 + CTOStrng(6)=' no first collisions inside proj/target' + CTOption(7)=0 + CTOStrng(7)=' elastic cross-section enabled (<>0:total=inelast)' + CTOption(8)=0 + CTOStrng(8)=' extrapolate branching ratios ' + CTOption(9)=0 + CTOStrng(9)=' use tabulated pp cross-sections ' + CTOption(10)=0 + CTOStrng(10)=' enable Pauli Blocker' + CTOption(11)=0 + CTOStrng(11)=' mass reduction for cascade initialization' + CTOption(12)=0 + CTOStrng(12)=' string condition =0 (.ne.0 no strings)' + CTOption(13)=0 + CTOStrng(13)=' enhanced file16 output ' + CTOption(14)=0 + CTOStrng(14)=' cos(the) is distributet between -1..1 ' + CTOption(15)=0 + CTOStrng(15)=' allow mm&mb-scattering' + CTOption(16)=0 + CTOStrng(16)=' propagate without collisions' + CTOption(17)=0 + CTOStrng(17)=' colload after every timestep ' + CTOption(18)=0 + CTOStrng(18)=' final decay of unstable particles' + CTOption(19)=0 + CTOStrng(19)=' allow bbar annihilaion' + CTOption(20)=0 + CTOStrng(20)=' dont generate e+e- instead of bbar' + CTOption(21)=0 + CTOStrng(21)=' use field feynman frgm. function' + CTOption(22)=1 + CTOStrng(22)=' use lund excitation function' + CTOption(23)=0 + CTOStrng(23)=' lorentz contraction of projectile & targed' + CTOption(24)=2 ! 1 is default 2 means fast method + CTOStrng(24)=' Wood-Saxon initialization' + CTOption(25)=0 + CTOStrng(25)=' phase space corrections for resonance mass' + CTOption(26)=0 + CTOStrng(26)=' use z -> 1-z for diquark-pairs' + CTOption(27)=1 ! hjd1 + CTOStrng(27)=' reference frame (1=target, 2=projectile, else=cms)' + CTOption(28)=1 ! M.R. 2019-04-15 + CTOStrng(28)=' propagate spectators also ' + CTOption(29)=2 + CTOStrng(29)=' no transverse momentum in clustr ' + CTOption(30)=1 + CTOStrng(30)=' frozen fermi motion ' + CTOption(31)=0 + CTOStrng(31)=' reduced mass spectrum in string' + CTOption(32)=0 + CTOStrng(32)=' masses are distributed acc. to m-dep. widths' + CTOption(33)=0 + CTOStrng(33)=' use tables & m-dep. for pmean in fprwdt & fwidth' + CTOption(34)=1 + CTOStrng(34)=' lifetme according to m-dep. width' + CTOption(35)=1 + CTOStrng(35)=' generate high precision tables' + CTOption(36)=0 + CTOStrng(36)=' normalize Breit-Wigners with m.dep. widths ' + CTOption(37)=0 + CTOStrng(37)=' heavy quarks form di-quark clusters' + CTOption(38)=0 + CTOStrng(38)=' scale p-pbar to b-bbar with equal p_lab ' + CTOption(39)=0 + CTOStrng(39)=' dont call pauliblocker' + CTOption(40)=0 + CTOStrng(40)=' read old fort.14 file ' + CTOption(41)=0 + CTOStrng(41)=' generate extended output for cto40' + CTOption(42)=0 + CTOStrng(42)=' hadrons now have color fluctuations' + CTOption(43)=0 + CTOStrng(43)=' dont generate dimuon intead of dielectron output' + CTOption(44)=0 + CTOStrng(44)=' not used at the moment' + CTOption(45)=0 + CTOStrng(45)=' not used at the moment' + +C INITIALIZE ARRAYS FOR SPECIAL PRO/TAR COMBINATIONS + do i = 1, 2 + spityp(i) = 0 + spiso3(i) = 0 + enddo + +C INITIALIZE ARRAYS FOR SPECIAL PARTICLES + EoS = 0 + +C READ CROSS-SECTION FILES +Cdh CALL URQREC() + +C INITIALIZES SOME ARRAYS + call strini ! initialize mixing angles for meson-multipletts + call loginit + + IF ( CTOption(33) .EQ. 0 .OR. CTOption(9) .EQ. 0 ) THEN + call loadwtab(io) +c~ IF ( IUDEBUG .GT. 0 ) WRITE(IFCK,*) 'URQINI: AFTER LOADWTAB' + ENDIF + +C READ URQMD TOTAL CROSS SECTION TABLE +c +c ie=1..41 E=10.0**(float(ie)/10-1.0-0.05) (bin-middle) +c id=1..9 p,ap,n,an,pi+,pi-,K+,K-,KS +c ia=1..3 N,O,Ar +c +c~ if(ifurqdat.eq.1)then +c~ OPEN(UNIT=76,FILE=furqdat(1:nfurqdat),STATUS='OLD') +c~ else +c~ OPEN(UNIT=76,FILE='UrQMD-1.3.1-xs.dat',STATUS='OLD') +c~ endif +c~ read(76,*) adum,iamaxu,idmaxu,iemaxu +c~ do ia=1,iamaxu +c~ do id=1,idmaxu +c~ do ie=1,iemaxu +c~ read(76,*) ekdummy,sig_u1(ie,id,ia) +c~ enddo +c~ read(76,*) +c~ read(76,*) +c~ enddo +c~ enddo +c~ close(76) + +C IN CASE OF CASCADE MODE, THE POTENTIALS NEED NOT BE CALCULATED + +C CALCULATE NORMALIZATION OF RESONANCES DISTRIBUTION... + call norm_init +#endif + + +c~ xsegymin=0.25d0 + +#ifdef __CXDEBUG__ + call utisx2 +#endif + + end + diff --git a/Processes/UrQMD/whichres.f b/Processes/UrQMD/whichres.f new file mode 100644 index 0000000000000000000000000000000000000000..bd2e66561b83d894b8b7af609522a7a076e95990 --- /dev/null +++ b/Processes/UrQMD/whichres.f @@ -0,0 +1,261 @@ +c $Id: whichres.f,v 1.6 1999/01/18 09:57:18 ernst Exp $ +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + integer function whichres(m,class) +c +c Revision : 1.0 +cinput m : Mass of the resonance +cinput class : class of resonance: see subr. getrange +coutput whichres : itype of the resonance +c +c DETERMINES ID OF A RESONANCE WITH MASS M ACCORDING TO THE GLOBAL +c TYPE OF THE RESONANCE. THE TYPE OF THE RESONANCE IS SELECTED +c RANDOMLY BETWEEN ALL TYPES PERMITTED. +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + real*8 m + integer class,i,im,ip + + call getrange(class,im,ip) + + call whichi(i,im,ip,m) + + whichres=i + + return + end + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine whichi(i,im,ip,m) +c +c Revision : 1.0 +cinput m : Mass of the resonance +cinput im,ip : lower and upper limit of itypes +coutput i : itype of the resonance +c +c DETERMINES ID OF A RESONANCE WITH MASS M ACCORDING TO +c the range defined by {\tt im} and {\tt ip}. +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + include 'comres.f' + real*8 m,fmax,f(-itmax:itmax),fbrwig,bwnorm + integer i,im,ip,jit,isoit + include 'options.f' + + + do 101 i=im,ip +c f(i) = breitwig(m,i) + f(i) = fbrwig(i,isoit(i),m,1)/bwnorm(i)*dble(jit(i)+1) + + 101 continue + + call getbran(f,-itmax,itmax,fmax,im,ip,i) + + return + end + + + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine getrange(class,i1,i2) +c +c Revision : 1.0 +c +cinput class : class of resonance: +c 0 = Delta(1232) +c 1 = N* +c 2 = Delta* (EXcludind D(1232)) +c 3 = all nonstrange resonances allowed +c 4 = nucleon +c 11 = N and N* +c 12 = Delta(1232) and Delta* +c 13 = Lambda, Lambda* +c 14 = Sigma, Sigma* +c 15 = Cascade, Cascade* +c 16 = Omega(s) +c +coutput i1,i2 : range of resonance IDs (from,to) +c +C INTERFACE BETWEEN class AND paticle ID +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + integer class,i1,i2 + include 'comres.f' + + if (class.eq.0) then +c inspect only Delta(1232) + i1 = mindel + i2 = mindel + else if (class.eq.1) then +c all N*-Resonances + i1 = minnuc+1 + i2 = maxnuc + else if (class.eq.2) then +c all Delta-Resonances (EXcluding D(1232)) + i1 = mindel+1 + i2 = maxdel + else if (class.eq.3) then +c all non strange Resonances + i1 = minres + i2 = maxres + else if (class.eq.4) then + i1 = nucleon + i2 = nucleon + else if (class.eq.11) then + i1 = minnuc + i2 = maxnuc + else if (class.eq.12) then + i1 = mindel + i2 = maxdel + else if (class.eq.13) then + i1 = minlam + i2 = maxlam + else if (class.eq.14) then + i1 = minsig + i2 = maxsig + else if (class.eq.15) then + i1 = mincas + i2 = maxcas + else if (class.eq.16) then + i1 = minome + i2 = maxome + else +c something went wrong + write(6,*) 'getrange: class=',class,' not valid...' + stop + endif + + end + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + subroutine getinw(i,m,class,mmax) +c +c Revision : 1.0 +c +cinput i : Resonance ID +cinput mmax : upper limit for mass to create +coutput i : Resonance ID of particle in same class +coutput m : Mass of particle in same class +coutput class : Class of resonance i (see {\tt getrange}) +c +c Does in a way the inverse of subr. getrange: look in which class +c resonance i is and determine mass m and itype i of same class with +c maximal mass of mmax. +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + include 'comres.f' + integer i,j,im,ip,isav,class,ii,iim,iip + real*8 m,mmax + + real*8 massit,getmass + integer whichres,isign + + isav=i + do 108 j=0,2 + call getrange(j,im,ip) + if(i.ge.im.and.i.le.ip)then + m=getmass(mmax,j) + i=whichres(m,j) + class=j + return + end if + 108 continue +c if failed keep old value of i and standard value for m +claw next line is for debug purpose + write(6,*)'getinw: itype not in resonance range:itype=',isav + i=isav + m=massit(i) + return + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + entry getirg(ii,iim,iip) +c +cinput ii : particle ID +coutput iim,iip : minimal and maximal itype of particle's class +c +c Determine which range (acc. to {\tt getrange}) particle +c {\tt ii} belongs to. +c +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + + do 1008 j=11,16 + call getrange(j,iim,iip) + if(iabs(ii).ge.iim.and.iabs(ii).le.iip)then + iim=min(isign(iim,ii),isign(iip,ii)) + iip=max(isign(iim,ii),isign(iip,ii)) + return + endif + 1008 continue +c only one particle (ii) within range + iim=ii + iip=ii + return + + end + +cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc + real*8 function massdist(m,class) +c +c Revision : 1.0 +c +cinput m : mass to look at +cinput class : resonance class (see {\tt getrange} +coutput massdist : value of mass distribution at mass m +c +C MASS DISTRIBUTION AT MASS M FOR GIVEN class OF RESONANCES. +C DISTRIBUTION IS CALCULATED BY SUPERPOSING BREIT-WIGNER- +C DISTRIBUTIONS FOR ALL RESONANCES OF A KIND. +c +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + implicit none + real*8 m + integer class,i1,i2,i,isoit,jit + include 'comres.f' + real*8 fbrwig,bwnorm + include 'options.f' + + call getrange(class,i1,i2) +c Delta(1232) is included via i1=i2=mindel + massdist = 0.0 + do 101 i=i1,i2 +c massdist=massdist+breitwig(m,i) + massdist=massdist+fbrwig(i,isoit(i),m,1) + & /bwnorm(i)*dble(jit(i)+1) + 101 continue + return + end + +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + real*8 function pcms(ecm,m1,m2) +c calculates the CM-momentum in a 2-body decay/coll. depending on ecm + implicit none + real*8 ecm,m1,m2,s + +ctp131205 lt -> le +c if (ecm.lt.m1+m2) then + if (ecm.le.m1+m2) then + pcms = 0.0 + return + endif + + s = ecm*ecm + pcms = sqrt( (s-(m1+m2)**2)*(s-(m1-m2)**2)/(4.0*s)) + return + end +CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC + real*8 function bcms(ecm,m1,m2) +c calculates the CM-velocity in a 2-body decay/coll. depending on ecm + + implicit none + real*8 ecm,m1,m2,s + + if (ecm.le.m1+m2) then + bcms = 0.0 + return + endif + + s = ecm*ecm + bcms = sqrt( (1d0-(m1+m2)**2/s) * (1d0-(m1-m2)**2/s) ) + return + end diff --git a/ThirdParty/phys/units/quantity.hpp b/ThirdParty/phys/units/quantity.hpp index 06fbb4b2c760dfc8641d58392aa30062ff7c4e84..970773d598ec4e076467fb990c9fdb610b9c936f 100644 --- a/ThirdParty/phys/units/quantity.hpp +++ b/ThirdParty/phys/units/quantity.hpp @@ -473,6 +473,16 @@ namespace phys { friend constexpr bool operator>=(quantity<D, X> const& x, quantity<D, Y> const& y); }; + // helper to check whether some type is a quantity + template <typename TNonQuantityType> + struct is_quantity : std::false_type {}; + + template <typename Dims, typename T> + struct is_quantity<quantity<Dims, T>> : std::true_type {}; + + template <typename T> + constexpr bool is_quantity_v = is_quantity<T>::value; + // Give names to the seven fundamental dimensions of physical reality. typedef dimensions<1, 0, 0, 0, 0, 0, 0, 0> length_d;